Merge pull request #6 from GPUCode/citra_merged

Update fmt to 9.1.0

.github/workflows/ci.yml

@@ -0,0 +1,90 @@
+name: dynarmic-ci
+
+on:
+  push:
+    branches: [ "*" ]
+    tags: [ "*" ]
+  pull_request:
+    branches: [ "*" ]
+
+jobs:
+  linux-x86_64-gcc:
+    runs-on: ubuntu-latest
+    strategy:
+      matrix:
+        gcc-ver: [7, 8]
+    env: 
+      GCC_VERSION: ${{ matrix.gcc-ver }}
+    steps:
+      - uses: actions/checkout@v2
+        with:
+          submodules: recursive
+      - name: Deps
+        run: ./.travis/build-x86_64-linux/deps.sh
+      - name: Build
+        run: ./.travis/build-x86_64-linux/build.sh
+  linux-aarch64-gcc-8:
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v2
+        with:
+          submodules: recursive
+      - name: Deps apt-get
+        run: |
+          sudo apt-get update
+          sudo apt-get install \
+            gcc-8-aarch64-linux-gnu \
+            g++-8-aarch64-linux-gnu \
+            ninja-build \
+            qemu-user
+      - name: Deps
+        run: ./.travis/build-aarch64-linux/deps.sh
+      - name: Build
+        run: ./.travis/build-aarch64-linux/build.sh
+  linux:
+    runs-on: ubuntu-latest
+    strategy:
+      matrix:
+        image: ["sse3-only-on-x86_64-linux", "test-with-unicorn-on-x86_64-linux"]
+    steps:
+      - uses: actions/checkout@v2
+        with:
+          submodules: recursive
+      - name: Deps apt-get
+        run: |
+          sudo apt-get install \
+            gcc-7 \
+            g++-7 \
+            llvm-dev \
+            ninja-build
+      - name: Deps
+        run: ./.travis/${{ matrix.image }}/deps.sh
+      - name: Build
+        run: ./.travis/${{ matrix.image }}/build.sh
+  macos:
+    runs-on: macos-latest
+    strategy:
+      matrix:
+        arch: ["x86_64", "aarch64"]
+    steps:
+      - uses: actions/checkout@v2
+        with:
+          submodules: recursive
+      - name: Deps
+        run: ./.travis/build-${{ matrix.arch }}-macos/deps.sh
+      - name: Build
+        run: ./.travis/build-${{ matrix.arch }}-macos/build.sh
+  windows:
+    runs-on: windows-latest
+    steps:
+      - uses: actions/checkout@v2
+        with:
+          submodules: recursive
+      - name: Deps
+        run: ./.travis/build-x86_64-windows/deps.sh
+        shell: bash
+      - name: Set up MSVC
+        uses: ilammy/msvc-dev-cmd@v1
+      - name: Build
+        run: ./.travis/build-x86_64-windows/build.sh
+        shell: bash

.gitignore

@@ -1,6 +1,6 @@
 # Built files
 build/
-build-*/
 docs/Doxygen/
+.vs/
 # Generated files
 src/backend/x64/mig/

.travis.yml

@@ -30,6 +30,20 @@ matrix:
             - ninja-build
       install: ./.travis/build-x86_64-linux/deps.sh
       script: ./.travis/build-x86_64-linux/build.sh
+    - env: NAME="Linux aarch64 Build"
+      os: linux
+      dist: bionic
+      addons:
+        apt:
+          sources:
+            - ubuntu-toolchain-r-test
+          packages:
+          - gcc-8-aarch64-linux-gnu
+          - g++-8-aarch64-linux-gnu
+          - ninja-build
+          - qemu-user
+      install: ./.travis/build-aarch64-linux/deps.sh
+      script: ./.travis/build-aarch64-linux/build.sh
     - env: NAME="macOS Build"
       os: osx
       sudo: false

.travis/build-aarch64-linux/build.sh

@@ -0,0 +1,13 @@
+#!/bin/sh
+
+set -e
+set -x
+
+export CC=aarch64-linux-gnu-gcc-8
+export CXX=aarch64-linux-gnu-g++-8
+
+mkdir build && cd build
+cmake .. -DBoost_INCLUDE_DIRS=${PWD}/../externals/ext-boost -DCMAKE_BUILD_TYPE=Release -G Ninja
+ninja
+
+qemu-aarch64 -L /usr/aarch64-linux-gnu ./tests/dynarmic_tests -d yes

.travis/build-aarch64-linux/deps.sh

@@ -0,0 +1,9 @@
+#!/bin/sh
+
+set -e
+set -x
+
+# TODO: This isn't ideal.
+cd externals
+git clone https://github.com/MerryMage/ext-boost
+cd ..

.travis/build-aarch64-macos/build.sh

@@ -0,0 +1,11 @@
+#!/bin/sh
+
+set -e
+set -x
+set -o pipefail
+
+export MACOSX_DEPLOYMENT_TARGET=11.0
+
+mkdir build && cd build
+cmake .. -GXcode -DBoost_INCLUDE_DIRS=${PWD}/../externals/ext-boost -DDYNARMIC_TESTS=0 -DCMAKE_OSX_ARCHITECTURES=arm64
+xcodebuild -configuration Release

.travis/build-aarch64-macos/deps.sh

@@ -0,0 +1,9 @@
+#!/bin/sh
+
+set -e
+set -x
+
+# TODO: This isn't ideal.
+cd externals
+git clone https://github.com/MerryMage/ext-boost
+cd ..

.travis/build-x86_64-linux/deps.sh

@@ -3,6 +3,12 @@
 set -e
 set -x
 
+sudo apt-get update
+sudo apt-get install \
+	gcc-${GCC_VERSION} \
+	g++-${GCC_VERSION} \
+	ninja-build
+
 # TODO: This isn't ideal.
 cd externals
 git clone https://github.com/MerryMage/ext-boost

.travis/build-x86_64-windows/build.sh

@@ -0,0 +1,10 @@
+#!/bin/sh
+
+set -e
+set -x
+
+mkdir build && cd build
+cmake .. -DBoost_INCLUDE_DIRS=${PWD}/../externals/ext-boost -DCMAKE_BUILD_TYPE=Release -G Ninja
+ninja
+
+./tests/dynarmic_tests --durations yes

.travis/build-x86_64-windows/deps.sh

@@ -0,0 +1,9 @@
+#!/bin/sh
+
+set -e
+set -x
+
+# TODO: This isn't ideal.
+cd externals
+git clone https://github.com/MerryMage/ext-boost
+cd ..

CMakeLists.txt

@@ -8,9 +8,36 @@ if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
   set(MASTER_PROJECT ON)
 endif()
 
+# Add the module directory to the list of paths
+list(APPEND CMAKE_MODULE_PATH "${PROJECT_SOURCE_DIR}/CMakeModules")
+
+if (CMAKE_CXX_COMPILER_ID STREQUAL "Clang" AND CMAKE_CXX_COMPILER_VERSION VERSION_GREATER 12)
+    string(APPEND CMAKE_CXX_FLAGS " -fbracket-depth=1024")
+endif()
+
+# Arch detection
+include(DetectArchitecture)
+if (MSVC)
+    detect_architecture("_M_AMD64" x86_64)
+    detect_architecture("_M_ARM64" Aarch64)
+else()
+    detect_architecture("__x86_64__" x86_64)
+    detect_architecture("__aarch64__" Aarch64)
+endif()
+if (NOT DEFINED DYNARMIC_ARCHITECTURE)
+    message(FATAL_ERROR "Unsupported architecture encountered. Ending CMake generation.")
+endif()
+message(STATUS "Target architecture: ${DYNARMIC_ARCHITECTURE}")
+
+set(REQUIRES_NO_EXECUTE_SUPPORT OFF)
+#Apple Silicon chips require W^X
+if(APPLE AND ARCHITECTURE_Aarch64)
+    set(REQUIRES_NO_EXECUTE_SUPPORT ON)
+endif()
+
 # Dynarmic project options
 option(DYNARMIC_ENABLE_CPU_FEATURE_DETECTION "Turning this off causes dynarmic to assume the host CPU doesn't support anything later than SSE3" ON)
-option(DYNARMIC_ENABLE_NO_EXECUTE_SUPPORT "Enables support for systems that require W^X" OFF)
+option(DYNARMIC_ENABLE_NO_EXECUTE_SUPPORT "Enables support for systems that require W^X" ${REQUIRES_NO_EXECUTE_SUPPORT})
 option(DYNARMIC_FATAL_ERRORS "Errors are fatal" OFF)
 option(DYNARMIC_TESTS "Build tests" ${MASTER_PROJECT})
 option(DYNARMIC_TESTS_USE_UNICORN "Enable fuzzing tests against unicorn" OFF)
@@ -38,9 +65,6 @@ if ("${CMAKE_SOURCE_DIR}" STREQUAL "${CMAKE_BINARY_DIR}")
     message(SEND_ERROR "In-source builds are not allowed.")
 endif()
 
-# Add the module directory to the list of paths
-list(APPEND CMAKE_MODULE_PATH "${PROJECT_SOURCE_DIR}/CMakeModules")
-
 # Compiler flags
 if (MSVC)
     set(DYNARMIC_CXX_FLAGS
@@ -99,20 +123,6 @@ else()
     endif()
 endif()
 
-# Arch detection
-include(DetectArchitecture)
-if (MSVC)
-    detect_architecture("_M_AMD64" x86_64)
-    detect_architecture("_M_ARM64" Aarch64)
-else()
-    detect_architecture("__x86_64__" x86_64)
-    detect_architecture("__aarch64__" Aarch64)
-endif()
-if (NOT DEFINED ARCHITECTURE)
-    message(FATAL_ERROR "Unsupported architecture encountered. Ending CMake generation.")
-endif()
-message(STATUS "Target architecture: ${ARCHITECTURE}")
-
 # Include Boost
 if (NOT TARGET boost)
     if (NOT Boost_INCLUDE_DIRS)

CMakeModules/DetectArchitecture.cmake

@@ -1,6 +1,6 @@
 include(CheckSymbolExists)
 function(detect_architecture symbol arch)
-    if (NOT DEFINED ARCHITECTURE)
+    if (NOT DEFINED DYNARMIC_ARCHITECTURE)
         set(CMAKE_REQUIRED_QUIET 1)
         check_symbol_exists("${symbol}" "" ARCHITECTURE_${arch})
         unset(CMAKE_REQUIRED_QUIET)
@@ -8,7 +8,7 @@ function(detect_architecture symbol arch)
         # The output variable needs to be unique across invocations otherwise
         # CMake's crazy scope rules will keep it defined
         if (ARCHITECTURE_${arch})
-            set(ARCHITECTURE "${arch}" PARENT_SCOPE)
+            set(DYNARMIC_ARCHITECTURE "${arch}" PARENT_SCOPE)
             set(ARCHITECTURE_${arch} 1 PARENT_SCOPE)
             add_definitions(-DARCHITECTURE_${arch}=1)
         endif()

externals/fmt/.github/pull_request_template.md

@@ -1,6 +0,0 @@
-<!-- Please read the contribution guidelines before submitting a pull request. -->
-<!-- By submitting this pull request, you agree that your contributions are licensed under the {fmt} license,
-     and agree to future changes to the licensing. -->
-<!-- If you're a first-time contributor, please acknowledge it by leaving the statement below. -->
-
-I agree that my contributions are licensed under the {fmt} license, and agree to future changes to the licensing.

externals/fmt/.gitignore

@@ -1,35 +0,0 @@
-.vscode/
-.vs/
-
-*.iml
-.idea/
-.externalNativeBuild/
-.gradle/
-gradle/
-gradlew*
-local.properties
-build/
-
-bin/
-/_CPack_Packages
-/CMakeScripts
-/doc/doxyxml
-/doc/html
-virtualenv
-/Testing
-/install_manifest.txt
-*~
-*.a
-*.so*
-*.xcodeproj
-*.zip
-cmake_install.cmake
-CPack*.cmake
-fmt-*.cmake
-CTestTestfile.cmake
-CMakeCache.txt
-CMakeFiles
-FMT.build
-Makefile
-run-msbuild.bat
-fmt.pc

externals/fmt/.travis.yml

@@ -1,101 +0,0 @@
-language: cpp
-dist: trusty
-sudo: false
-
-os: linux
-
-git:
-  depth: 1
-
-env:
-  global:
-    - secure: |-
-        a1eovNn4uol9won7ghr67eD3/59oeESN+G9bWE+ecI1V6yRseG9whniGhIpC/YfMW/Qz5I
-        5sxSmFjaw9bxCISNwUIrL1O5x2AmRYTnFcXk4dFsUvlZg+WeF/aKyBYCNRM8C2ndbBmtAO
-        o1F2EwFbiso0EmtzhAPs19ujiVxkLn4=
-
-matrix:
-  include:
-      # Documentation
-    - env: BUILD=Doc
-      sudo: required
-      # g++ 6 on Linux with C++14
-    - env: COMPILER=g++-6 BUILD=Debug STANDARD=14
-      compiler: gcc
-      addons:
-        apt:
-          update: true
-          sources:
-            - ubuntu-toolchain-r-test
-          packages:
-            - g++-6
-    - env: COMPILER=g++-6 BUILD=Release STANDARD=14
-      compiler: gcc
-      addons:
-        apt:
-          update: true
-          sources:
-            - ubuntu-toolchain-r-test
-          packages:
-            - g++-6
-     # g++ 8 on Linux with C++17
-    - env: COMPILER=g++-8 BUILD=Debug STANDARD=17
-      compiler: gcc
-      addons:
-        apt:
-          update: true
-          sources:
-            - ubuntu-toolchain-r-test
-          packages:
-            - g++-8
-    - env: COMPILER=g++-8 BUILD=Release STANDARD=17
-      compiler: gcc
-      addons:
-        apt:
-          update: true
-          sources:
-            - ubuntu-toolchain-r-test
-          packages:
-            - g++-8
-
-      # Apple clang on OS X with C++14
-    - env: BUILD=Debug STANDARD=14
-      compiler: clang
-      os: osx
-    - env: BUILD=Release STANDARD=14
-      compiler: clang
-      os: osx
-      # clang 6.0 on Linux with C++14 (builds the fuzzers as well)
-    - env: COMPILER=clang++-6.0 BUILD=Debug STANDARD=14 ENABLE_FUZZING=1
-      compiler: clang
-      addons:
-        apt:
-          update: true
-          packages:
-            - clang-6.0
-          sources:
-            - ubuntu-toolchain-r-test
-            - llvm-toolchain-trusty
-            - llvm-toolchain-trusty-6.0
-      # clang 4.0 on Linux with C++14
-    - env: COMPILER=clang++-4.0 BUILD=Debug STANDARD=11
-      compiler: clang
-      addons:
-        apt:
-          update: true
-          packages:
-            - clang-4.0
-          sources:
-            - ubuntu-toolchain-r-test
-            - llvm-toolchain-trusty
-            - llvm-toolchain-trusty-4.0
-      # g++ 4.8 on Linux with C++11
-    - env: COMPILER=g++-4.8 BUILD=Debug STANDARD=11
-      compiler: gcc
-
-before_script:
-  - if [[ "${TRAVIS_OS_NAME}" == "linux" ]]; then export CXX=${COMPILER}; fi
-  - if [[ "${BUILD}" != "Doc" ]]; then ${CXX} --version; fi
-
-script:
-  - support/travis-build.py

externals/fmt/CMakeLists.txt

@@ -1,61 +1,106 @@
-cmake_minimum_required(VERSION 3.1.0)
+cmake_minimum_required(VERSION 3.1...3.18)
 
-# Use newer policies if available, up to most recent tested version of CMake.
-if(${CMAKE_VERSION} VERSION_LESS 3.11)
+# Fallback for using newer policies on CMake <3.12.
+if(${CMAKE_VERSION} VERSION_LESS 3.12)
   cmake_policy(VERSION ${CMAKE_MAJOR_VERSION}.${CMAKE_MINOR_VERSION})
-else()
-  cmake_policy(VERSION 3.11)
 endif()
 
 # Determine if fmt is built as a subproject (using add_subdirectory)
 # or if it is the master project.
-set(MASTER_PROJECT OFF)
-if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
-  set(MASTER_PROJECT ON)
-  message(STATUS "CMake version: ${CMAKE_VERSION}")
+if (NOT DEFINED FMT_MASTER_PROJECT)
+  set(FMT_MASTER_PROJECT OFF)
+  if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
+    set(FMT_MASTER_PROJECT ON)
+    message(STATUS "CMake version: ${CMAKE_VERSION}")
+  endif ()
 endif ()
 
 # Joins arguments and places the results in ${result_var}.
 function(join result_var)
-  set(result )
+  set(result "")
   foreach (arg ${ARGN})
     set(result "${result}${arg}")
   endforeach ()
   set(${result_var} "${result}" PARENT_SCOPE)
 endfunction()
 
+function(enable_module target)
+  if (MSVC)
+    set(BMI ${CMAKE_CURRENT_BINARY_DIR}/${target}.ifc)
+    target_compile_options(${target}
+      PRIVATE /interface /ifcOutput ${BMI}
+      INTERFACE /reference fmt=${BMI})
+  endif ()
+  set_target_properties(${target} PROPERTIES ADDITIONAL_CLEAN_FILES ${BMI})
+  set_source_files_properties(${BMI} PROPERTIES GENERATED ON)
+endfunction()
+
+include(CMakeParseArguments)
+
 # Sets a cache variable with a docstring joined from multiple arguments:
 #   set(<variable> <value>... CACHE <type> <docstring>...)
 # This allows splitting a long docstring for readability.
 function(set_verbose)
-  cmake_parse_arguments(SET_VERBOSE "" "" "CACHE" ${ARGN})
-  list(GET SET_VERBOSE_CACHE 0 type)
-  list(REMOVE_AT SET_VERBOSE_CACHE 0)
-  join(doc ${SET_VERBOSE_CACHE})
-  set(${SET_VERBOSE_UNPARSED_ARGUMENTS} CACHE ${type} ${doc})
+  # cmake_parse_arguments is broken in CMake 3.4 (cannot parse CACHE) so use
+  # list instead.
+  list(GET ARGN 0 var)
+  list(REMOVE_AT ARGN 0)
+  list(GET ARGN 0 val)
+  list(REMOVE_AT ARGN 0)
+  list(REMOVE_AT ARGN 0)
+  list(GET ARGN 0 type)
+  list(REMOVE_AT ARGN 0)
+  join(doc ${ARGN})
+  set(${var} ${val} CACHE ${type} ${doc})
 endfunction()
 
 # Set the default CMAKE_BUILD_TYPE to Release.
 # This should be done before the project command since the latter can set
 # CMAKE_BUILD_TYPE itself (it does so for nmake).
-if (MASTER_PROJECT AND NOT CMAKE_BUILD_TYPE)
+if (FMT_MASTER_PROJECT AND NOT CMAKE_BUILD_TYPE)
   set_verbose(CMAKE_BUILD_TYPE Release CACHE STRING
               "Choose the type of build, options are: None(CMAKE_CXX_FLAGS or "
               "CMAKE_C_FLAGS used) Debug Release RelWithDebInfo MinSizeRel.")
 endif ()
 
+project(FMT CXX)
+include(GNUInstallDirs)
+set_verbose(FMT_INC_DIR ${CMAKE_INSTALL_INCLUDEDIR} CACHE STRING
+            "Installation directory for include files, a relative path that "
+            "will be joined with ${CMAKE_INSTALL_PREFIX} or an absolute path.")
+
 option(FMT_PEDANTIC "Enable extra warnings and expensive tests." OFF)
 option(FMT_WERROR "Halt the compilation with an error on compiler warnings."
        OFF)
 
 # Options that control generation of various targets.
-option(FMT_DOC "Generate the doc target." ${MASTER_PROJECT})
-option(FMT_INSTALL "Generate the install target." ${MASTER_PROJECT})
-option(FMT_TEST "Generate the test target." ${MASTER_PROJECT})
+option(FMT_DOC "Generate the doc target." ${FMT_MASTER_PROJECT})
+option(FMT_INSTALL "Generate the install target." ${FMT_MASTER_PROJECT})
+option(FMT_TEST "Generate the test target." ${FMT_MASTER_PROJECT})
 option(FMT_FUZZ "Generate the fuzz target." OFF)
 option(FMT_CUDA_TEST "Generate the cuda-test target." OFF)
+option(FMT_OS "Include core requiring OS (Windows/Posix) " ON)
+option(FMT_MODULE "Build a module instead of a traditional library." OFF)
+option(FMT_SYSTEM_HEADERS "Expose headers with marking them as system." OFF)
 
-project(FMT CXX)
+set(FMT_CAN_MODULE OFF)
+if (CMAKE_CXX_STANDARD GREATER 17 AND
+    # msvc 16.10-pre4
+    MSVC AND CMAKE_CXX_COMPILER_VERSION VERSION_GREATER 19.29.30035)
+  set(FMT_CAN_MODULE OFF)
+endif ()
+if (NOT FMT_CAN_MODULE)
+  set(FMT_MODULE OFF)
+  message(STATUS "Module support is disabled.")
+endif ()
+if (FMT_TEST AND FMT_MODULE)
+  # The tests require {fmt} to be compiled as traditional library
+  message(STATUS "Testing is incompatible with build mode 'module'.")
+endif ()
+set(FMT_SYSTEM_HEADERS_ATTRIBUTE "")
+if (FMT_SYSTEM_HEADERS)
+  set(FMT_SYSTEM_HEADERS_ATTRIBUTE SYSTEM)
+endif ()
 
 # Get version from core.h
 file(READ include/fmt/core.h core_h)
@@ -80,7 +125,7 @@ set(CMAKE_MODULE_PATH ${CMAKE_MODULE_PATH}
   "${CMAKE_CURRENT_SOURCE_DIR}/support/cmake")
 
 include(cxx14)
-include(CheckCXXCompilerFlag)
+include(JoinPaths)
 
 list(FIND CMAKE_CXX_COMPILE_FEATURES "cxx_variadic_templates" index)
 if (${index} GREATER -1)
@@ -90,24 +135,36 @@ if (${index} GREATER -1)
 endif ()
 message(STATUS "Required features: ${FMT_REQUIRED_FEATURES}")
 
+if (FMT_MASTER_PROJECT AND NOT DEFINED CMAKE_CXX_VISIBILITY_PRESET)
+  set_verbose(CMAKE_CXX_VISIBILITY_PRESET hidden CACHE STRING
+              "Preset for the export of private symbols")
+  set_property(CACHE CMAKE_CXX_VISIBILITY_PRESET PROPERTY STRINGS
+               hidden default)
+endif ()
+
+if (FMT_MASTER_PROJECT AND NOT DEFINED CMAKE_VISIBILITY_INLINES_HIDDEN)
+  set_verbose(CMAKE_VISIBILITY_INLINES_HIDDEN ON CACHE BOOL
+              "Whether to add a compile flag to hide symbols of inline functions")
+endif ()
+
 if (CMAKE_CXX_COMPILER_ID MATCHES "GNU")
   set(PEDANTIC_COMPILE_FLAGS -pedantic-errors -Wall -Wextra -pedantic
       -Wold-style-cast -Wundef
       -Wredundant-decls -Wwrite-strings -Wpointer-arith
       -Wcast-qual -Wformat=2 -Wmissing-include-dirs
-      -Wcast-align -Wnon-virtual-dtor
+      -Wcast-align
       -Wctor-dtor-privacy -Wdisabled-optimization
       -Winvalid-pch -Woverloaded-virtual
-      -Wconversion -Wswitch-enum
-      -Wno-ctor-dtor-privacy -Wno-format-nonliteral -Wno-shadow)
+      -Wconversion -Wundef
+      -Wno-ctor-dtor-privacy -Wno-format-nonliteral)
   if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 4.6)
-      set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wnoexcept
+      set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS}
          -Wno-dangling-else -Wno-unused-local-typedefs)
   endif ()
   if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 5.0)
       set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wdouble-promotion
           -Wtrampolines -Wzero-as-null-pointer-constant -Wuseless-cast
-          -Wvector-operation-performance -Wsized-deallocation)
+          -Wvector-operation-performance -Wsized-deallocation -Wshadow)
   endif ()
   if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 6.0)
       set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wshift-overflow=2
@@ -117,8 +174,9 @@ if (CMAKE_CXX_COMPILER_ID MATCHES "GNU")
 endif ()
 
 if (CMAKE_CXX_COMPILER_ID MATCHES "Clang")
-  set(PEDANTIC_COMPILE_FLAGS -Wall -Wextra -pedantic -Wconversion
-      -Wno-sign-conversion -Wdeprecated -Wweak-vtables)
+  set(PEDANTIC_COMPILE_FLAGS -Wall -Wextra -pedantic -Wconversion -Wundef
+      -Wdeprecated -Wweak-vtables -Wshadow
+      -Wno-gnu-zero-variadic-macro-arguments)
   check_cxx_compiler_flag(-Wzero-as-null-pointer-constant HAS_NULLPTR_WARNING)
   if (HAS_NULLPTR_WARNING)
     set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS}
@@ -132,7 +190,7 @@ if (MSVC)
   set(WERROR_FLAG /WX)
 endif ()
 
-if (MASTER_PROJECT AND CMAKE_GENERATOR MATCHES "Visual Studio")
+if (FMT_MASTER_PROJECT AND CMAKE_GENERATOR MATCHES "Visual Studio")
   # If Microsoft SDK is installed create script run-msbuild.bat that
   # calls SetEnv.cmd to set up build environment and runs msbuild.
   # It is useful when building Visual Studio projects with the SDK
@@ -150,18 +208,6 @@ if (MASTER_PROJECT AND CMAKE_GENERATOR MATCHES "Visual Studio")
     ${CMAKE_MAKE_PROGRAM} -p:FrameworkPathOverride=\"${netfxpath}\" %*")
 endif ()
 
-set(strtod_l_headers stdlib.h)
-if (APPLE)
-  set(strtod_l_headers ${strtod_l_headers} xlocale.h)
-endif ()
-
-include(CheckSymbolExists)
-if (WIN32)
-  check_symbol_exists(_strtod_l "${strtod_l_headers}" HAVE_STRTOD_L)
-else ()
-  check_symbol_exists(strtod_l "${strtod_l_headers}" HAVE_STRTOD_L)
-endif ()
-
 function(add_headers VAR)
   set(headers ${${VAR}})
   foreach (header ${ARGN})
@@ -171,34 +217,41 @@ function(add_headers VAR)
 endfunction()
 
 # Define the fmt library, its includes and the needed defines.
-add_headers(FMT_HEADERS chrono.h color.h compile.h core.h format.h format-inl.h
-                        locale.h os.h ostream.h posix.h printf.h ranges.h)
-set(FMT_SOURCES src/format.cc src/os.cc)
+add_headers(FMT_HEADERS args.h chrono.h color.h compile.h core.h format.h
+                        format-inl.h os.h ostream.h printf.h ranges.h std.h
+                        xchar.h)
+if (FMT_MODULE)
+  set(FMT_SOURCES src/fmt.cc)
+elseif (FMT_OS)
+  set(FMT_SOURCES src/format.cc src/os.cc)
+else()
+  set(FMT_SOURCES src/format.cc)
+endif ()
 
 add_library(fmt ${FMT_SOURCES} ${FMT_HEADERS} README.rst ChangeLog.rst)
 add_library(fmt::fmt ALIAS fmt)
 
-if (HAVE_STRTOD_L)
-  target_compile_definitions(fmt PUBLIC FMT_LOCALE)
-endif ()
-
 if (FMT_WERROR)
   target_compile_options(fmt PRIVATE ${WERROR_FLAG})
 endif ()
 if (FMT_PEDANTIC)
   target_compile_options(fmt PRIVATE ${PEDANTIC_COMPILE_FLAGS})
 endif ()
+if (FMT_MODULE)
+  enable_module(fmt)
+endif ()
 
 target_compile_features(fmt INTERFACE ${FMT_REQUIRED_FEATURES})
 
-target_include_directories(fmt PUBLIC
+target_include_directories(fmt ${FMT_SYSTEM_HEADERS_ATTRIBUTE} PUBLIC
   $<BUILD_INTERFACE:${PROJECT_SOURCE_DIR}/include>
-  $<INSTALL_INTERFACE:include>)
+  $<INSTALL_INTERFACE:${FMT_INC_DIR}>)
 
 set(FMT_DEBUG_POSTFIX d CACHE STRING "Debug library postfix.")
 
 set_target_properties(fmt PROPERTIES
   VERSION ${FMT_VERSION} SOVERSION ${CPACK_PACKAGE_VERSION_MAJOR}
+  PUBLIC_HEADER "${FMT_HEADERS}"
   DEBUG_POSTFIX "${FMT_DEBUG_POSTFIX}")
 
 # Set FMT_LIB_NAME for pkg-config fmt.pc. We cannot use the OUTPUT_NAME target
@@ -209,11 +262,6 @@ if (CMAKE_BUILD_TYPE STREQUAL "Debug")
 endif ()
 
 if (BUILD_SHARED_LIBS)
-  if (UNIX AND NOT APPLE AND NOT ${CMAKE_SYSTEM_NAME} MATCHES "SunOS")
-    # Fix rpmlint warning:
-    # unused-direct-shlib-dependency /usr/lib/libformat.so.1.1.0 /lib/libm.so.6.
-    target_link_libraries(fmt -Wl,--as-needed)
-  endif ()
   target_compile_definitions(fmt PRIVATE FMT_EXPORT INTERFACE FMT_SHARED)
 endif ()
 if (FMT_SAFE_DURATION_CAST)
@@ -226,44 +274,40 @@ add_library(fmt::fmt-header-only ALIAS fmt-header-only)
 target_compile_definitions(fmt-header-only INTERFACE FMT_HEADER_ONLY=1)
 target_compile_features(fmt-header-only INTERFACE ${FMT_REQUIRED_FEATURES})
 
-target_include_directories(fmt-header-only INTERFACE
+target_include_directories(fmt-header-only ${FMT_SYSTEM_HEADERS_ATTRIBUTE} INTERFACE
   $<BUILD_INTERFACE:${PROJECT_SOURCE_DIR}/include>
-  $<INSTALL_INTERFACE:include>)
+  $<INSTALL_INTERFACE:${FMT_INC_DIR}>)
 
 # Install targets.
 if (FMT_INSTALL)
-  include(GNUInstallDirs)
   include(CMakePackageConfigHelpers)
   set_verbose(FMT_CMAKE_DIR ${CMAKE_INSTALL_LIBDIR}/cmake/fmt CACHE STRING
-              "Installation directory for cmake files, relative to "
-              "${CMAKE_INSTALL_PREFIX}.")
+              "Installation directory for cmake files, a relative path that "
+              "will be joined with ${CMAKE_INSTALL_PREFIX} or an absolute "
+              "path.")
   set(version_config ${PROJECT_BINARY_DIR}/fmt-config-version.cmake)
   set(project_config ${PROJECT_BINARY_DIR}/fmt-config.cmake)
   set(pkgconfig ${PROJECT_BINARY_DIR}/fmt.pc)
   set(targets_export_name fmt-targets)
 
-  set (INSTALL_TARGETS fmt)
-  if (TARGET fmt-header-only)
-    set(INSTALL_TARGETS ${INSTALL_TARGETS} fmt-header-only)
-  endif ()
-
   set_verbose(FMT_LIB_DIR ${CMAKE_INSTALL_LIBDIR} CACHE STRING
-              "Installation directory for libraries, relative to "
-              "${CMAKE_INSTALL_PREFIX}.")
-
-  set_verbose(FMT_INC_DIR ${CMAKE_INSTALL_INCLUDEDIR}/fmt CACHE STRING
-              "Installation directory for include files, relative to "
-              "${CMAKE_INSTALL_PREFIX}.")
+              "Installation directory for libraries, a relative path that "
+              "will be joined to ${CMAKE_INSTALL_PREFIX} or an absolute path.")
 
   set_verbose(FMT_PKGCONFIG_DIR ${CMAKE_INSTALL_LIBDIR}/pkgconfig CACHE PATH
-              "Installation directory for pkgconfig (.pc) files, relative to "
-              "${CMAKE_INSTALL_PREFIX}.")
+              "Installation directory for pkgconfig (.pc) files, a relative "
+              "path that will be joined with ${CMAKE_INSTALL_PREFIX} or an "
+              "absolute path.")
 
   # Generate the version, config and target files into the build directory.
   write_basic_package_version_file(
     ${version_config}
     VERSION ${FMT_VERSION}
     COMPATIBILITY AnyNewerVersion)
+
+  join_paths(libdir_for_pc_file "\${exec_prefix}" "${FMT_LIB_DIR}")
+  join_paths(includedir_for_pc_file "\${prefix}" "${FMT_INC_DIR}")
+
   configure_file(
     "${PROJECT_SOURCE_DIR}/support/cmake/fmt.pc.in"
     "${pkgconfig}"
@@ -272,6 +316,17 @@ if (FMT_INSTALL)
     ${PROJECT_SOURCE_DIR}/support/cmake/fmt-config.cmake.in
     ${project_config}
     INSTALL_DESTINATION ${FMT_CMAKE_DIR})
+
+  set(INSTALL_TARGETS fmt fmt-header-only)
+
+  # Install the library and headers.
+  install(TARGETS ${INSTALL_TARGETS} EXPORT ${targets_export_name}
+          LIBRARY DESTINATION ${FMT_LIB_DIR}
+          ARCHIVE DESTINATION ${FMT_LIB_DIR}
+          PUBLIC_HEADER DESTINATION "${FMT_INC_DIR}/fmt"
+          FRAMEWORK DESTINATION "."
+          RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR})
+
   # Use a namespace because CMake provides better diagnostics for namespaced
   # imported targets.
   export(TARGETS ${INSTALL_TARGETS} NAMESPACE fmt::
@@ -284,15 +339,8 @@ if (FMT_INSTALL)
   install(EXPORT ${targets_export_name} DESTINATION ${FMT_CMAKE_DIR}
           NAMESPACE fmt::)
 
-  # Install the library and headers.
-  install(TARGETS ${INSTALL_TARGETS} EXPORT ${targets_export_name}
-          LIBRARY DESTINATION ${FMT_LIB_DIR}
-          ARCHIVE DESTINATION ${FMT_LIB_DIR}
-          RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR})
-
   install(FILES $<TARGET_PDB_FILE:${INSTALL_TARGETS}>
           DESTINATION ${FMT_LIB_DIR} OPTIONAL)
-  install(FILES ${FMT_HEADERS} DESTINATION ${FMT_INC_DIR})
   install(FILES "${pkgconfig}" DESTINATION "${FMT_PKGCONFIG_DIR}")
 endif ()
 
@@ -308,10 +356,17 @@ endif ()
 # Control fuzzing independent of the unit tests.
 if (FMT_FUZZ)
   add_subdirectory(test/fuzzing)
+
+  # The FMT_FUZZ macro is used to prevent resource exhaustion in fuzzing
+  # mode and make fuzzing practically possible. It is similar to
+  # FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION but uses a different name to
+  # avoid interfering with fuzzing of projects that use {fmt}.
+  # See also https://llvm.org/docs/LibFuzzer.html#fuzzer-friendly-build-mode.
+  target_compile_definitions(fmt PUBLIC FMT_FUZZ)
 endif ()
 
 set(gitignore ${PROJECT_SOURCE_DIR}/.gitignore)
-if (MASTER_PROJECT AND EXISTS ${gitignore})
+if (FMT_MASTER_PROJECT AND EXISTS ${gitignore})
   # Get the list of ignored files from .gitignore.
   file (STRINGS ${gitignore} lines)
   list(REMOVE_ITEM lines /doc/html)

externals/fmt/CONTRIBUTING.md

@@ -14,4 +14,7 @@ exceptions:
 * snake_case should be used instead of UpperCamelCase for function and type
   names
 
+All documentation must adhere to the [Google Developer Documentation Style
+Guide](https://developers.google.com/style).
+
 Thanks for contributing!

externals/fmt/README.rst

@@ -1,159 +1,186 @@
-{fmt}
-=====
+.. image:: https://user-images.githubusercontent.com/
+           576385/156254208-f5b743a9-88cf-439d-b0c0-923d53e8d551.png
+   :width: 25%
+   :alt: {fmt}
 
-.. image:: https://travis-ci.org/fmtlib/fmt.png?branch=master
-   :target: https://travis-ci.org/fmtlib/fmt
+.. image:: https://github.com/fmtlib/fmt/workflows/linux/badge.svg
+   :target: https://github.com/fmtlib/fmt/actions?query=workflow%3Alinux
 
-.. image:: https://ci.appveyor.com/api/projects/status/ehjkiefde6gucy1v
-   :target: https://ci.appveyor.com/project/vitaut/fmt
+.. image:: https://github.com/fmtlib/fmt/workflows/macos/badge.svg
+   :target: https://github.com/fmtlib/fmt/actions?query=workflow%3Amacos
 
-.. image:: https://oss-fuzz-build-logs.storage.googleapis.com/badges/libfmt.svg
-   :alt: fmt is continuously fuzzed att oss-fuzz
-   :target: https://bugs.chromium.org/p/oss-fuzz/issues/list?colspec=ID%20Type%20Component%20Status%20Proj%20Reported%20Owner%20Summary&q=proj%3Dlibfmt&can=1
+.. image:: https://github.com/fmtlib/fmt/workflows/windows/badge.svg
+   :target: https://github.com/fmtlib/fmt/actions?query=workflow%3Awindows
+
+.. image:: https://oss-fuzz-build-logs.storage.googleapis.com/badges/fmt.svg
+   :alt: fmt is continuously fuzzed at oss-fuzz
+   :target: https://bugs.chromium.org/p/oss-fuzz/issues/list?\
+            colspec=ID%20Type%20Component%20Status%20Proj%20Reported%20Owner%20\
+            Summary&q=proj%3Dfmt&can=1
 
 .. image:: https://img.shields.io/badge/stackoverflow-fmt-blue.svg
    :alt: Ask questions at StackOverflow with the tag fmt
    :target: https://stackoverflow.com/questions/tagged/fmt
 
-**{fmt}** is an open-source formatting library for C++.
-It can be used as a safe and fast alternative to (s)printf and iostreams.
+**{fmt}** is an open-source formatting library providing a fast and safe
+alternative to C stdio and C++ iostreams.
 
-`Documentation <https://fmt.dev/latest/>`__
+If you like this project, please consider donating to one of the funds that
+help victims of the war in Ukraine: https://www.stopputin.net/.
 
-Q&A: ask questions on `StackOverflow with the tag fmt <https://stackoverflow.com/questions/tagged/fmt>`_.
+`Documentation <https://fmt.dev>`__
+
+`Cheat Sheets <https://hackingcpp.com/cpp/libs/fmt.html>`__
+
+Q&A: ask questions on `StackOverflow with the tag fmt
+<https://stackoverflow.com/questions/tagged/fmt>`_.
+
+Try {fmt} in `Compiler Explorer <https://godbolt.org/z/Eq5763>`_.
 
 Features
 --------
 
-* Replacement-based `format API <https://fmt.dev/dev/api.html>`_ with
-  positional arguments for localization.
-* `Format string syntax <https://fmt.dev/dev/syntax.html>`_ similar to the one
-  of `str.format <https://docs.python.org/3/library/stdtypes.html#str.format>`_
-  in Python.
+* Simple `format API <https://fmt.dev/latest/api.html>`_ with positional arguments
+  for localization
+* Implementation of `C++20 std::format
+  <https://en.cppreference.com/w/cpp/utility/format>`__
+* `Format string syntax <https://fmt.dev/latest/syntax.html>`_ similar to Python's
+  `format <https://docs.python.org/3/library/stdtypes.html#str.format>`_
+* Fast IEEE 754 floating-point formatter with correct rounding, shortness and
+  round-trip guarantees
 * Safe `printf implementation
-  <https://fmt.dev/latest/api.html#printf-formatting>`_ including
-  the POSIX extension for positional arguments.
-* Implementation of `C++20 std::format <https://en.cppreference.com/w/cpp/utility/format>`__.
-* Support for user-defined types.
+  <https://fmt.dev/latest/api.html#printf-formatting>`_ including the POSIX
+  extension for positional arguments
+* Extensibility: `support for user-defined types
+  <https://fmt.dev/latest/api.html#formatting-user-defined-types>`_
 * High performance: faster than common standard library implementations of
-  `printf <https://en.cppreference.com/w/cpp/io/c/fprintf>`_ and
-  iostreams. See `Speed tests`_ and `Fast integer to string conversion in C++
-  <http://zverovich.net/2013/09/07/integer-to-string-conversion-in-cplusplus.html>`_.
-* Small code size both in terms of source code (the minimum configuration
-  consists of just three header files, ``core.h``, ``format.h`` and
-  ``format-inl.h``) and compiled code. See `Compile time and code bloat`_.
-* Reliability: the library has an extensive set of `unit tests
-  <https://github.com/fmtlib/fmt/tree/master/test>`_ and is continuously fuzzed.
+  ``(s)printf``, iostreams, ``to_string`` and ``to_chars``, see `Speed tests`_
+  and `Converting a hundred million integers to strings per second
+  <http://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html>`_
+* Small code size both in terms of source code with the minimum configuration
+  consisting of just three files, ``core.h``, ``format.h`` and ``format-inl.h``,
+  and compiled code; see `Compile time and code bloat`_
+* Reliability: the library has an extensive set of `tests
+  <https://github.com/fmtlib/fmt/tree/master/test>`_ and is `continuously fuzzed
+  <https://bugs.chromium.org/p/oss-fuzz/issues/list?colspec=ID%20Type%20
+  Component%20Status%20Proj%20Reported%20Owner%20Summary&q=proj%3Dfmt&can=1>`_
 * Safety: the library is fully type safe, errors in format strings can be
   reported at compile time, automatic memory management prevents buffer overflow
-  errors.
+  errors
 * Ease of use: small self-contained code base, no external dependencies,
   permissive MIT `license
   <https://github.com/fmtlib/fmt/blob/master/LICENSE.rst>`_
 * `Portability <https://fmt.dev/latest/index.html#portability>`_ with
-  consistent output across platforms and support for older compilers.
-* Clean warning-free codebase even on high warning levels
-  (``-Wall -Wextra -pedantic``).
-* Support for wide strings.
-* Optional header-only configuration enabled with the ``FMT_HEADER_ONLY`` macro.
+  consistent output across platforms and support for older compilers
+* Clean warning-free codebase even on high warning levels such as
+  ``-Wall -Wextra -pedantic``
+* Locale-independence by default
+* Optional header-only configuration enabled with the ``FMT_HEADER_ONLY`` macro
 
-See the `documentation <https://fmt.dev/latest/>`_ for more details.
+See the `documentation <https://fmt.dev>`_ for more details.
 
 Examples
 --------
 
-Print ``Hello, world!`` to ``stdout``:
+**Print to stdout** (`run <https://godbolt.org/z/Tevcjh>`_)
 
 .. code:: c++
 
-    fmt::print("Hello, {}!", "world");  // Python-like format string syntax
-    fmt::printf("Hello, %s!", "world"); // printf format string syntax
+    #include <fmt/core.h>
+    
+    int main() {
+      fmt::print("Hello, world!\n");
+    }
 
-Format a string and use positional arguments:
+**Format a string** (`run <https://godbolt.org/z/oK8h33>`_)
+
+.. code:: c++
+
+    std::string s = fmt::format("The answer is {}.", 42);
+    // s == "The answer is 42."
+
+**Format a string using positional arguments** (`run <https://godbolt.org/z/Yn7Txe>`_)
 
 .. code:: c++
 
     std::string s = fmt::format("I'd rather be {1} than {0}.", "right", "happy");
     // s == "I'd rather be happy than right."
 
-Check a format string at compile time:
+**Print chrono durations** (`run <https://godbolt.org/z/K8s4Mc>`_)
 
 .. code:: c++
 
-    // test.cc
-    #include <fmt/format.h>
-    std::string s = format(FMT_STRING("{2}"), 42);
+    #include <fmt/chrono.h>
 
-.. code::
-
-    $ c++ -Iinclude -std=c++14 test.cc
-    ...
-    test.cc:4:17: note: in instantiation of function template specialization 'fmt::v5::format<S, int>' requested here
-    std::string s = format(FMT_STRING("{2}"), 42);
-                    ^
-    include/fmt/core.h:778:19: note: non-constexpr function 'on_error' cannot be used in a constant expression
-        ErrorHandler::on_error(message);
-                      ^
-    include/fmt/format.h:2226:16: note: in call to '&checker.context_->on_error(&"argument index out of range"[0])'
-          context_.on_error("argument index out of range");
-                   ^
-
-Use {fmt} as a safe portable replacement for ``itoa``
-(`godbolt <https://godbolt.org/g/NXmpU4>`_):
-
-.. code:: c++
-
-    fmt::memory_buffer buf;
-    format_to(buf, "{}", 42);    // replaces itoa(42, buffer, 10)
-    format_to(buf, "{:x}", 42);  // replaces itoa(42, buffer, 16)
-    // access the string with to_string(buf) or buf.data()
-
-Format objects of user-defined types via a simple `extension API
-<https://fmt.dev/latest/api.html#formatting-user-defined-types>`_:
-
-.. code:: c++
-
-    #include "fmt/format.h"
-
-    struct date {
-      int year, month, day;
-    };
-
-    template <>
-    struct fmt::formatter<date> {
-      constexpr auto parse(format_parse_context& ctx) { return ctx.begin(); }
-
-      template <typename FormatContext>
-      auto format(const date& d, FormatContext& ctx) {
-        return format_to(ctx.out(), "{}-{}-{}", d.year, d.month, d.day);
-      }
-    };
-
-    std::string s = fmt::format("The date is {}", date{2012, 12, 9});
-    // s == "The date is 2012-12-9"
-
-Create your own functions similar to `format
-<https://fmt.dev/latest/api.html#format>`_ and
-`print <https://fmt.dev/latest/api.html#print>`_
-which take arbitrary arguments (`godbolt <https://godbolt.org/g/MHjHVf>`_):
-
-.. code:: c++
-
-    // Prints formatted error message.
-    void vreport_error(const char* format, fmt::format_args args) {
-      fmt::print("Error: ");
-      fmt::vprint(format, args);
-    }
-    template <typename... Args>
-    void report_error(const char* format, const Args & ... args) {
-      vreport_error(format, fmt::make_format_args(args...));
+    int main() {
+      using namespace std::literals::chrono_literals;
+      fmt::print("Default format: {} {}\n", 42s, 100ms);
+      fmt::print("strftime-like format: {:%H:%M:%S}\n", 3h + 15min + 30s);
     }
 
-    report_error("file not found: {}", path);
+Output::
 
-Note that ``vreport_error`` is not parameterized on argument types which can
-improve compile times and reduce code size compared to a fully parameterized
-version.
+    Default format: 42s 100ms
+    strftime-like format: 03:15:30
+
+**Print a container** (`run <https://godbolt.org/z/MxM1YqjE7>`_)
+
+.. code:: c++
+
+    #include <vector>
+    #include <fmt/ranges.h>
+
+    int main() {
+      std::vector<int> v = {1, 2, 3};
+      fmt::print("{}\n", v);
+    }
+
+Output::
+
+    [1, 2, 3]
+
+**Check a format string at compile time**
+
+.. code:: c++
+
+    std::string s = fmt::format("{:d}", "I am not a number");
+
+This gives a compile-time error in C++20 because ``d`` is an invalid format
+specifier for a string.
+
+**Write a file from a single thread**
+
+.. code:: c++
+
+    #include <fmt/os.h>
+
+    int main() {
+      auto out = fmt::output_file("guide.txt");
+      out.print("Don't {}", "Panic");
+    }
+
+This can be `5 to 9 times faster than fprintf
+<http://www.zverovich.net/2020/08/04/optimal-file-buffer-size.html>`_.
+
+**Print with colors and text styles**
+
+.. code:: c++
+
+    #include <fmt/color.h>
+
+    int main() {
+      fmt::print(fg(fmt::color::crimson) | fmt::emphasis::bold,
+                 "Hello, {}!\n", "world");
+      fmt::print(fg(fmt::color::floral_white) | bg(fmt::color::slate_gray) |
+                 fmt::emphasis::underline, "Hello, {}!\n", "мир");
+      fmt::print(fg(fmt::color::steel_blue) | fmt::emphasis::italic,
+                 "Hello, {}!\n", "世界");
+    }
+
+Output on a modern terminal:
+
+.. image:: https://user-images.githubusercontent.com/
+           576385/88485597-d312f600-cf2b-11ea-9cbe-61f535a86e28.png
 
 Benchmarks
 ----------
@@ -174,18 +201,20 @@ Folly Format      folly::format   2.23
 {fmt} is the fastest of the benchmarked methods, ~35% faster than ``printf``.
 
 The above results were generated by building ``tinyformat_test.cpp`` on macOS
-10.14.6 with ``clang++ -O3 -DSPEED_TEST -DHAVE_FORMAT``, and taking the best of
-three runs. In the test, the format string ``"%0.10f:%04d:%+g:%s:%p:%c:%%\n"``
+10.14.6 with ``clang++ -O3 -DNDEBUG -DSPEED_TEST -DHAVE_FORMAT``, and taking the
+best of three runs. In the test, the format string ``"%0.10f:%04d:%+g:%s:%p:%c:%%\n"``
 or equivalent is filled 2,000,000 times with output sent to ``/dev/null``; for
 further details refer to the `source
-<https://github.com/fmtlib/format-benchmark/blob/master/tinyformat_test.cpp>`_.
+<https://github.com/fmtlib/format-benchmark/blob/master/src/tinyformat-test.cc>`_.
 
-{fmt} is 10x faster than ``std::ostringstream`` and ``sprintf`` on floating-point
-formatting (`dtoa-benchmark <https://github.com/fmtlib/dtoa-benchmark>`_)
-and as fast as `double-conversion <https://github.com/google/double-conversion>`_:
+{fmt} is up to 20-30x faster than ``std::ostringstream`` and ``sprintf`` on
+floating-point formatting (`dtoa-benchmark <https://github.com/fmtlib/dtoa-benchmark>`_)
+and faster than `double-conversion <https://github.com/google/double-conversion>`_ and
+`ryu <https://github.com/ulfjack/ryu>`_:
 
-.. image:: https://user-images.githubusercontent.com/576385/69767160-cdaca400-112f-11ea-9fc5-347c9f83caad.png
-   :target: https://fmt.dev/unknown_mac64_clang10.0.html
+.. image:: https://user-images.githubusercontent.com/576385/
+           95684665-11719600-0ba8-11eb-8e5b-972ff4e49428.png
+   :target: https://fmt.dev/unknown_mac64_clang12.0.html
 
 Compile time and code bloat
 ~~~~~~~~~~~~~~~~~~~~~~~~~~~
@@ -260,40 +289,46 @@ Then you can run the speed test::
 or the bloat test::
 
     $ make bloat-test
+    
+Migrating code
+--------------
+
+`clang-tidy-fmt <https://github.com/mikecrowe/clang-tidy-fmt>`_ provides clang
+tidy checks for converting occurrences of ``printf`` and ``fprintf`` to
+``fmt::print``.
 
 Projects using this library
 ---------------------------
 
-* `0 A.D. <https://play0ad.com/>`_: A free, open-source, cross-platform real-time
-  strategy game
+* `0 A.D. <https://play0ad.com/>`_: a free, open-source, cross-platform
+  real-time strategy game
+
+* `2GIS <https://2gis.ru/>`_: free business listings with a city map
 
 * `AMPL/MP <https://github.com/ampl/mp>`_:
-  An open-source library for mathematical programming
-  
-* `AvioBook <https://www.aviobook.aero/en>`_: A comprehensive aircraft
+  an open-source library for mathematical programming
+
+* `Aseprite <https://github.com/aseprite/aseprite>`_:
+  animated sprite editor & pixel art tool 
+
+* `AvioBook <https://www.aviobook.aero/en>`_: a comprehensive aircraft
   operations suite
   
-* `Celestia <https://celestia.space/>`_: Real-time 3D visualization of space
+* `Blizzard Battle.net <https://battle.net/>`_: an online gaming platform
+  
+* `Celestia <https://celestia.space/>`_: real-time 3D visualization of space
 
-* `Ceph <https://ceph.com/>`_: A scalable distributed storage system
+* `Ceph <https://ceph.com/>`_: a scalable distributed storage system
 
-* `ccache <https://ccache.dev/>`_: A compiler cache
+* `ccache <https://ccache.dev/>`_: a compiler cache
 
-* `CUAUV <http://cuauv.org/>`_: Cornell University's autonomous underwater
+* `ClickHouse <https://github.com/ClickHouse/ClickHouse>`_: analytical database
+  management system
+
+* `CUAUV <https://cuauv.org/>`_: Cornell University's autonomous underwater
   vehicle
 
-* `HarpyWar/pvpgn <https://github.com/pvpgn/pvpgn-server>`_:
-  Player vs Player Gaming Network with tweaks
-
-* `KBEngine <https://kbengine.org/>`_: An open-source MMOG server engine
-
-* `Keypirinha <https://keypirinha.com/>`_: A semantic launcher for Windows
-
-* `Kodi <https://kodi.tv/>`_ (formerly xbmc): Home theater software
-
-* `Lifeline <https://github.com/peter-clark/lifeline>`_: A 2D game
-
-* `Drake <https://drake.mit.edu/>`_: A planning, control, and analysis toolbox
+* `Drake <https://drake.mit.edu/>`_: a planning, control, and analysis toolbox
   for nonlinear dynamical systems (MIT)
 
 * `Envoy <https://lyft.github.io/envoy/>`_: C++ L7 proxy and communication bus
@@ -301,49 +336,86 @@ Projects using this library
 
 * `FiveM <https://fivem.net/>`_: a modification framework for GTA V
 
-* `MongoDB <https://mongodb.com/>`_: Distributed document database
+* `fmtlog <https://github.com/MengRao/fmtlog>`_: a performant fmtlib-style
+  logging library with latency in nanoseconds
 
-* `MongoDB Smasher <https://github.com/duckie/mongo_smasher>`_: A small tool to
+* `Folly <https://github.com/facebook/folly>`_: Facebook open-source library
+
+* `GemRB <https://gemrb.org/>`_: a portable open-source implementation of
+  Bioware’s Infinity Engine
+
+* `Grand Mountain Adventure
+  <https://store.steampowered.com/app/1247360/Grand_Mountain_Adventure/>`_:
+  a beautiful open-world ski & snowboarding game
+
+* `HarpyWar/pvpgn <https://github.com/pvpgn/pvpgn-server>`_:
+  Player vs Player Gaming Network with tweaks
+
+* `KBEngine <https://github.com/kbengine/kbengine>`_: an open-source MMOG server
+  engine
+
+* `Keypirinha <https://keypirinha.com/>`_: a semantic launcher for Windows
+
+* `Kodi <https://kodi.tv/>`_ (formerly xbmc): home theater software
+
+* `Knuth <https://kth.cash/>`_: high-performance Bitcoin full-node
+
+* `Microsoft Verona <https://github.com/microsoft/verona>`_:
+  research programming language for concurrent ownership
+
+* `MongoDB <https://mongodb.com/>`_: distributed document database
+
+* `MongoDB Smasher <https://github.com/duckie/mongo_smasher>`_: a small tool to
   generate randomized datasets
 
-* `OpenSpace <https://openspaceproject.com/>`_: An open-source astrovisualization
-  framework
+* `OpenSpace <https://openspaceproject.com/>`_: an open-source
+  astrovisualization framework
 
 * `PenUltima Online (POL) <https://www.polserver.com/>`_:
-  An MMO server, compatible with most Ultima Online clients
+  an MMO server, compatible with most Ultima Online clients
 
-* `quasardb <https://www.quasardb.net/>`_: A distributed, high-performance,
+* `PyTorch <https://github.com/pytorch/pytorch>`_: an open-source machine
+  learning library
+
+* `quasardb <https://www.quasardb.net/>`_: a distributed, high-performance,
   associative database
+  
+* `Quill <https://github.com/odygrd/quill>`_: asynchronous low-latency logging library
 
-* `readpe <https://bitbucket.org/sys_dev/readpe>`_: Read Portable Executable
+* `QKW <https://github.com/ravijanjam/qkw>`_: generalizing aliasing to simplify
+  navigation, and executing complex multi-line terminal command sequences
 
-* `redis-cerberus <https://github.com/HunanTV/redis-cerberus>`_: A Redis cluster
+* `redis-cerberus <https://github.com/HunanTV/redis-cerberus>`_: a Redis cluster
   proxy
 
-* `rpclib <http://rpclib.net/>`_: A modern C++ msgpack-RPC server and client
+* `redpanda <https://vectorized.io/redpanda>`_: a 10x faster Kafka® replacement
+  for mission critical systems written in C++
+
+* `rpclib <http://rpclib.net/>`_: a modern C++ msgpack-RPC server and client
   library
 
-* `Saddy <https://github.com/mamontov-cpp/saddy-graphics-engine-2d>`_:
-  Small crossplatform 2D graphic engine
+* `Salesforce Analytics Cloud
+  <https://www.salesforce.com/analytics-cloud/overview/>`_:
+  business intelligence software
 
-* `Salesforce Analytics Cloud <https://www.salesforce.com/analytics-cloud/overview/>`_:
-  Business intelligence software
-
-* `Scylla <https://www.scylladb.com/>`_: A Cassandra-compatible NoSQL data store
+* `Scylla <https://www.scylladb.com/>`_: a Cassandra-compatible NoSQL data store
   that can handle 1 million transactions per second on a single server
 
-* `Seastar <http://www.seastar-project.org/>`_: An advanced, open-source C++
+* `Seastar <http://www.seastar-project.org/>`_: an advanced, open-source C++
   framework for high-performance server applications on modern hardware
 
-* `spdlog <https://github.com/gabime/spdlog>`_: Super fast C++ logging library
+* `spdlog <https://github.com/gabime/spdlog>`_: super fast C++ logging library
 
-* `Stellar <https://www.stellar.org/>`_: Financial platform
+* `Stellar <https://www.stellar.org/>`_: financial platform
 
-* `Touch Surgery <https://www.touchsurgery.com/>`_: Surgery simulator
+* `Touch Surgery <https://www.touchsurgery.com/>`_: surgery simulator
 
-* `TrinityCore <https://github.com/TrinityCore/TrinityCore>`_: Open-source
+* `TrinityCore <https://github.com/TrinityCore/TrinityCore>`_: open-source
   MMORPG framework
 
+* `Windows Terminal <https://github.com/microsoft/terminal>`_: the new Windows
+  terminal
+
 `More... <https://github.com/search?q=fmtlib&type=Code>`_
 
 If you are aware of other projects using this library, please let me know
@@ -400,15 +472,15 @@ Boost Format
 
 This is a very powerful library which supports both ``printf``-like format
 strings and positional arguments. Its main drawback is performance. According to
-various benchmarks it is much slower than other methods considered here. Boost
+various benchmarks, it is much slower than other methods considered here. Boost
 Format also has excessive build times and severe code bloat issues (see
 `Benchmarks`_).
 
 FastFormat
 ~~~~~~~~~~
 
-This is an interesting library which is fast, safe and has positional
-arguments. However it has significant limitations, citing its author:
+This is an interesting library which is fast, safe and has positional arguments.
+However, it has significant limitations, citing its author:
 
     Three features that have no hope of being accommodated within the
     current design are:
@@ -417,8 +489,8 @@ arguments. However it has significant limitations, citing its author:
     * Octal/hexadecimal encoding
     * Runtime width/alignment specification
 
-It is also quite big and has a heavy dependency, STLSoft, which might be
-too restrictive for using it in some projects.
+It is also quite big and has a heavy dependency, STLSoft, which might be too
+restrictive for using it in some projects.
 
 Boost Spirit.Karma
 ~~~~~~~~~~~~~~~~~~
@@ -426,32 +498,9 @@ Boost Spirit.Karma
 This is not really a formatting library but I decided to include it here for
 completeness. As iostreams, it suffers from the problem of mixing verbatim text
 with arguments. The library is pretty fast, but slower on integer formatting
-than ``fmt::format_int`` on Karma's own benchmark,
-see `Fast integer to string conversion in C++
-<http://zverovich.net/2013/09/07/integer-to-string-conversion-in-cplusplus.html>`_.
-
-FAQ
----
-
-Q: how can I capture formatting arguments and format them later?
-
-A: use ``std::tuple``:
-
-.. code:: c++
-
-   template <typename... Args>
-   auto capture(const Args&... args) {
-     return std::make_tuple(args...);
-   }
-
-   auto print_message = [](const auto&... args) {
-     fmt::print(args...);
-   };
-
-   // Capture and store arguments:
-   auto args = capture("{} {}", 42, "foo");
-   // Do formatting:
-   std::apply(print_message, args);
+than ``fmt::format_to`` with format string compilation on Karma's own benchmark,
+see `Converting a hundred million integers to strings per second
+<http://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html>`_.
 
 License
 -------
@@ -459,18 +508,19 @@ License
 {fmt} is distributed under the MIT `license
 <https://github.com/fmtlib/fmt/blob/master/LICENSE.rst>`_.
 
-The `Format String Syntax
-<https://fmt.dev/latest/syntax.html>`_
-section in the documentation is based on the one from Python `string module
-documentation <https://docs.python.org/3/library/string.html#module-string>`_
-adapted for the current library. For this reason the documentation is
-distributed under the Python Software Foundation license available in
-`doc/python-license.txt
-<https://raw.github.com/fmtlib/fmt/master/doc/python-license.txt>`_.
-It only applies if you distribute the documentation of fmt.
+Documentation License
+---------------------
 
-Acknowledgments
----------------
+The `Format String Syntax <https://fmt.dev/latest/syntax.html>`_
+section in the documentation is based on the one from Python `string module
+documentation <https://docs.python.org/3/library/string.html#module-string>`_.
+For this reason the documentation is distributed under the Python Software
+Foundation license available in `doc/python-license.txt
+<https://raw.github.com/fmtlib/fmt/master/doc/python-license.txt>`_.
+It only applies if you distribute the documentation of {fmt}.
+
+Maintainers
+-----------
 
 The {fmt} library is maintained by Victor Zverovich (`vitaut
 <https://github.com/vitaut>`_) and Jonathan Müller (`foonathan
@@ -479,23 +529,3 @@ See `Contributors <https://github.com/fmtlib/fmt/graphs/contributors>`_ and
 `Releases <https://github.com/fmtlib/fmt/releases>`_ for some of the names.
 Let us know if your contribution is not listed or mentioned incorrectly and
 we'll make it right.
-
-The benchmark section of this readme file and the performance tests are taken
-from the excellent `tinyformat <https://github.com/c42f/tinyformat>`_ library
-written by Chris Foster.  Boost Format library is acknowledged transitively
-since it had some influence on tinyformat.
-Some ideas used in the implementation are borrowed from `Loki
-<http://loki-lib.sourceforge.net/>`_ SafeFormat and `Diagnostic API
-<https://clang.llvm.org/doxygen/classclang_1_1Diagnostic.html>`_ in
-`Clang <https://clang.llvm.org/>`_.
-Format string syntax and the documentation are based on Python's `str.format
-<https://docs.python.org/3/library/stdtypes.html#str.format>`_.
-Thanks `Doug Turnbull <https://github.com/softwaredoug>`_ for his valuable
-comments and contribution to the design of the type-safe API and
-`Gregory Czajkowski <https://github.com/gcflymoto>`_ for implementing binary
-formatting. Thanks `Ruslan Baratov <https://github.com/ruslo>`_ for comprehensive
-`comparison of integer formatting algorithms <https://github.com/ruslo/int-dec-format-tests>`_
-and useful comments regarding performance, `Boris Kaul <https://github.com/localvoid>`_ for
-`C++ counting digits benchmark <https://github.com/localvoid/cxx-benchmark-count-digits>`_.
-Thanks to `CarterLi <https://github.com/CarterLi>`_ for contributing various
-improvements to the code.

externals/fmt/doc/CMakeLists.txt

@@ -1,12 +1,26 @@
-find_program(DOXYGEN doxygen)
+find_program(DOXYGEN doxygen
+  PATHS "$ENV{ProgramFiles}/doxygen/bin"
+        "$ENV{ProgramFiles\(x86\)}/doxygen/bin")
 if (NOT DOXYGEN)
   message(STATUS "Target 'doc' disabled (requires doxygen)")
   return ()
 endif ()
 
+# Find the Python interpreter and set the PYTHON_EXECUTABLE variable.
+if (CMAKE_VERSION VERSION_LESS 3.12)
+  # This logic is deprecated in CMake after 3.12.
+  find_package(PythonInterp QUIET REQUIRED)
+else ()
+  find_package(Python QUIET REQUIRED)
+  set(PYTHON_EXECUTABLE ${Python_EXECUTABLE})
+endif ()
+
 add_custom_target(doc
-  COMMAND ${CMAKE_CURRENT_SOURCE_DIR}/build.py ${FMT_VERSION}
+  COMMAND ${PYTHON_EXECUTABLE} ${CMAKE_CURRENT_SOURCE_DIR}/build.py
+                               ${FMT_VERSION}
   SOURCES api.rst syntax.rst usage.rst build.py conf.py _templates/layout.html)
 
+include(GNUInstallDirs)
 install(DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/html/
-        DESTINATION share/doc/fmt OPTIONAL)
+        DESTINATION ${CMAKE_INSTALL_DATAROOTDIR}/doc/fmt OPTIONAL
+        PATTERN ".doctrees" EXCLUDE)

externals/fmt/doc/_static/breathe.css

@@ -1,28 +0,0 @@
-
-/* -- breathe specific styles ----------------------------------------------- */
-
-/* So enum value descriptions are displayed inline to the item */
-.breatheenumvalues li tt + p {
-  display: inline;
-}
-
-/* So parameter descriptions are displayed inline to the item */
-.breatheparameterlist li tt + p {
-  display: inline;
-}
-
-.container .breathe-sectiondef {
-  width: inherit;
-}
-
-.github-btn {
-  border: 0;
-  overflow: hidden;
-}
-
-.jumbotron {
-  background-size: 100% 4px;
-  background-repeat: repeat-y;
-  color: white;
-  text-align: center;
-}

externals/fmt/doc/_templates/layout.html

@@ -6,14 +6,13 @@
 <meta name="author" content="Victor Zverovich">
 <link rel="stylesheet" href="_static/fmt.css">
 {# Google Analytics #}
+<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
 <script>
-  (function(i,s,o,g,r,a,m){i['GoogleAnalyticsObject']=r;i[r]=i[r]||function(){
-    (i[r].q=i[r].q||[]).push(arguments)},i[r].l=1*new Date();
-    a=s.createElement(o),m=s.getElementsByTagName(o)[0];a.async=1;
-    a.src=g;m.parentNode.insertBefore(a,m)
-  })(window,document,'script','//www.google-analytics.com/analytics.js','ga');
-  ga('create', 'UA-20116650-4', 'fmtlib.net');
-  ga('send', 'pageview');
+  window.dataLayer = window.dataLayer || [];
+  function gtag(){dataLayer.push(arguments);}
+  gtag('js', new Date());
+
+  gtag('config', 'UA-20116650-4');
 </script>
 {% endblock %}
 

externals/fmt/doc/api.rst

@@ -6,15 +6,19 @@ API Reference
 
 The {fmt} library API consists of the following parts:
 
-* :ref:`fmt/core.h <core-api>`: the core API providing argument handling
-  facilities and a lightweight subset of formatting functions
-* :ref:`fmt/format.h <format-api>`: the full format API providing compile-time
-  format string checks, output iterator and user-defined type support
-* :ref:`fmt/ranges.h <ranges-api>`: additional formatting support for ranges
-  and tuples
+* :ref:`fmt/core.h <core-api>`: the core API providing main formatting functions
+  for ``char``/UTF-8 with C++20 compile-time checks and minimal dependencies
+* :ref:`fmt/format.h <format-api>`: the full format API providing additional
+  formatting functions and locale support
+* :ref:`fmt/ranges.h <ranges-api>`: formatting of ranges and tuples
 * :ref:`fmt/chrono.h <chrono-api>`: date and time formatting
+* :ref:`fmt/std.h <std-api>`: formatters for standard library types
+* :ref:`fmt/compile.h <compile-api>`: format string compilation
+* :ref:`fmt/color.h <color-api>`: terminal color and text style
+* :ref:`fmt/os.h <os-api>`: system APIs
 * :ref:`fmt/ostream.h <ostream-api>`: ``std::ostream`` support
 * :ref:`fmt/printf.h <printf-api>`: ``printf`` formatting
+* :ref:`fmt/xchar.h <xchar-api>`: optional ``wchar_t`` support 
 
 All functions and types provided by the library reside in namespace ``fmt`` and
 macros have prefix ``FMT_``.
@@ -24,34 +28,65 @@ macros have prefix ``FMT_``.
 Core API
 ========
 
-``fmt/core.h`` defines the core API which provides argument handling facilities
-and a lightweight subset of formatting functions. In the header-only mode
-include ``fmt/format.h`` instead of ``fmt/core.h``.
+``fmt/core.h`` defines the core API which provides main formatting functions
+for ``char``/UTF-8 with C++20 compile-time checks. It has minimal include
+dependencies for better compile times. This header is only beneficial when
+using {fmt} as a library and not in the header-only mode.
 
 The following functions use :ref:`format string syntax <syntax>`
 similar to that of Python's `str.format
-<http://docs.python.org/3/library/stdtypes.html#str.format>`_.
-They take *format_str* and *args* as arguments.
+<https://docs.python.org/3/library/stdtypes.html#str.format>`_.
+They take *fmt* and *args* as arguments.
 
-*format_str* is a format string that contains literal text and replacement
-fields surrounded by braces ``{}``. The fields are replaced with formatted
-arguments in the resulting string. A function taking *format_str* doesn't
-participate in an overload resolution if the latter is not a string.
+*fmt* is a format string that contains literal text and replacement fields
+surrounded by braces ``{}``. The fields are replaced with formatted arguments
+in the resulting string. `~fmt::format_string` is a format string which can be
+implicitly constructed from a string literal or a ``constexpr`` string and is
+checked at compile time in C++20. To pass a runtime format string wrap it in
+`fmt::runtime`.
 
 *args* is an argument list representing objects to be formatted.
 
 .. _format:
 
-.. doxygenfunction:: format(const S&, Args&&...)
-.. doxygenfunction:: vformat(const S&, basic_format_args<buffer_context<Char>>)
+.. doxygenfunction:: format(format_string<T...> fmt, T&&... args) -> std::string
+.. doxygenfunction:: vformat(string_view fmt, format_args args) -> std::string
+
+.. doxygenfunction:: format_to(OutputIt out, format_string<T...> fmt, T&&... args) -> OutputIt
+.. doxygenfunction:: format_to_n(OutputIt out, size_t n, format_string<T...> fmt, T&&... args) -> format_to_n_result<OutputIt>
+.. doxygenfunction:: formatted_size(format_string<T...> fmt, T&&... args) -> size_t
+
+.. doxygenstruct:: fmt::format_to_n_result
+   :members:
 
 .. _print:
 
-.. doxygenfunction:: print(const S&, Args&&...)
-.. doxygenfunction:: vprint(string_view, format_args)
+.. doxygenfunction:: fmt::print(format_string<T...> fmt, T&&... args)
+.. doxygenfunction:: fmt::vprint(string_view fmt, format_args args)
 
-.. doxygenfunction:: print(std::FILE *, const S&, Args&&...)
-.. doxygenfunction:: vprint(std::FILE *, string_view, format_args)
+.. doxygenfunction:: print(std::FILE *f, format_string<T...> fmt, T&&... args)
+.. doxygenfunction:: vprint(std::FILE *f, string_view fmt, format_args args)
+
+Compile-Time Format String Checks
+---------------------------------
+
+Compile-time checks are enabled by default on compilers that support C++20
+``consteval``. On older compilers you can use the ``FMT_STRING`` macro defined
+in ``fmt/format.h`` instead. It requires C++14 and is a no-op in C++11.
+
+.. doxygendefine:: FMT_STRING
+
+To force the use of legacy compile-time checks, define the preprocessor variable
+``FMT_ENFORCE_COMPILE_STRING``. When set, functions accepting ``FMT_STRING``
+will fail to compile with regular strings. Runtime-checked formatting is still
+possible using ``fmt::vformat``, ``fmt::vprint``, etc.
+
+.. doxygenclass:: fmt::basic_format_string
+   :members:
+
+.. doxygentypedef:: fmt::format_string
+
+.. doxygenfunction:: fmt::runtime(string_view) -> basic_runtime<char>
 
 Named Arguments
 ---------------
@@ -63,19 +98,56 @@ Named arguments are not supported in compile-time checks at the moment.
 Argument Lists
 --------------
 
+You can create your own formatting function with compile-time checks and small
+binary footprint, for example (https://godbolt.org/z/oba4Mc):
+
+.. code:: c++
+
+    #include <fmt/format.h>
+
+    void vlog(const char* file, int line, fmt::string_view format,
+              fmt::format_args args) {
+      fmt::print("{}: {}: ", file, line);
+      fmt::vprint(format, args);
+    }
+
+    template <typename S, typename... Args>
+    void log(const char* file, int line, const S& format, Args&&... args) {
+      vlog(file, line, format, fmt::make_format_args(args...));
+    }
+
+    #define MY_LOG(format, ...) \
+      log(__FILE__, __LINE__, FMT_STRING(format), __VA_ARGS__)
+
+    MY_LOG("invalid squishiness: {}", 42);
+
+Note that ``vlog`` is not parameterized on argument types which improves compile
+times and reduces binary code size compared to a fully parameterized version.
+
 .. doxygenfunction:: fmt::make_format_args(const Args&...)
 
 .. doxygenclass:: fmt::format_arg_store
    :members:
 
+.. doxygenclass:: fmt::dynamic_format_arg_store
+   :members:
+
 .. doxygenclass:: fmt::basic_format_args
    :members:
 
-.. doxygenstruct:: fmt::format_args
+.. doxygentypedef:: fmt::format_args
 
 .. doxygenclass:: fmt::basic_format_arg
    :members:
 
+.. doxygenclass:: fmt::basic_format_parse_context
+   :members:
+
+.. doxygenclass:: fmt::basic_format_context
+   :members:
+
+.. doxygentypedef:: fmt::format_context
+
 Compatibility
 -------------
 
@@ -83,12 +155,11 @@ Compatibility
    :members:
 
 .. doxygentypedef:: fmt::string_view
-.. doxygentypedef:: fmt::wstring_view
 
 Locale
 ------
 
-All formatting is locale-independent by default. Use the ``'n'`` format
+All formatting is locale-independent by default. Use the ``'L'`` format
 specifier to insert the appropriate number separator characters from the
 locale::
 
@@ -96,42 +167,42 @@ locale::
   #include <locale>
 
   std::locale::global(std::locale("en_US.UTF-8"));
-  auto s = fmt::format("{:n}", 1000000);  // s == "1,000,000"
+  auto s = fmt::format("{:L}", 1000000);  // s == "1,000,000"
 
 .. _format-api:
 
 Format API
 ==========
 
-``fmt/format.h`` defines the full format API providing compile-time format
-string checks, output iterator and user-defined type support.
+``fmt/format.h`` defines the full format API providing additional formatting
+functions and locale support.
 
-Compile-time Format String Checks
----------------------------------
+.. _udt:
 
-Compile-time checks are supported for built-in and string types as well as
-user-defined types with ``constexpr`` ``parse`` functions in their ``formatter``
-specializations.
-
-.. doxygendefine:: FMT_STRING
-
-Formatting User-defined Types
+Formatting User-Defined Types
 -----------------------------
 
+The {fmt} library provides formatters for many standard C++ types.
+See :ref:`fmt/ranges.h <ranges-api>` for ranges and tuples including standard
+containers such as ``std::vector``, :ref:`fmt/chrono.h <chrono-api>` for date
+and time formatting and :ref:`fmt/std.h <std-api>` for path and variant 
+formatting.
+
 To make a user-defined type formattable, specialize the ``formatter<T>`` struct
 template and implement ``parse`` and ``format`` methods::
 
   #include <fmt/format.h>
 
-  struct point { double x, y; };
+  struct point {
+    double x, y;
+  };
 
-  template <>
-  struct fmt::formatter<point> {
+  template <> struct fmt::formatter<point> {
     // Presentation format: 'f' - fixed, 'e' - exponential.
     char presentation = 'f';
 
     // Parses format specifications of the form ['f' | 'e'].
-    constexpr auto parse(format_parse_context& ctx) {
+    constexpr auto parse(format_parse_context& ctx) -> decltype(ctx.begin()) {
       // [ctx.begin(), ctx.end()) is a character range that contains a part of
       // the format string starting from the format specifications to be parsed,
       // e.g. in
@@ -142,14 +213,17 @@ template and implement ``parse`` and ``format`` methods::
       // parse specifiers until '}' or the end of the range. In this example
       // the formatter should parse the 'f' specifier and return an iterator
       // pointing to '}'.
+      
+      // Please also note that this character range may be empty, in case of
+      // the "{}" format string, so therefore you should check ctx.begin()
+      // for equality with ctx.end().
 
       // Parse the presentation format and store it in the formatter:
       auto it = ctx.begin(), end = ctx.end();
       if (it != end && (*it == 'f' || *it == 'e')) presentation = *it++;
 
       // Check if reached the end of the range:
-      if (it != end && *it != '}')
-        throw format_error("invalid format");
+      if (it != end && *it != '}') throw format_error("invalid format");
 
       // Return an iterator past the end of the parsed range:
       return it;
@@ -158,12 +232,11 @@ template and implement ``parse`` and ``format`` methods::
     // Formats the point p using the parsed format specification (presentation)
     // stored in this formatter.
     template <typename FormatContext>
-    auto format(const point& p, FormatContext& ctx) {
+    auto format(const point& p, FormatContext& ctx) const -> decltype(ctx.out()) {
       // ctx.out() is an output iterator to write to.
-      return format_to(
-          ctx.out(),
-          presentation == 'f' ? "({:.1f}, {:.1f})" : "({:.1e}, {:.1e})",
-          p.x, p.y);
+      return presentation == 'f'
+                ? fmt::format_to(ctx.out(), "({:.1f}, {:.1f})", p.x, p.y)
+                : fmt::format_to(ctx.out(), "({:.1e}, {:.1e})", p.x, p.y);
     }
   };
 
@@ -178,11 +251,10 @@ example::
 
   enum class color {red, green, blue};
 
-  template <>
-  struct fmt::formatter<color>: formatter<string_view> {
+  template <> struct fmt::formatter<color>: formatter<string_view> {
     // parse is inherited from formatter<string_view>.
     template <typename FormatContext>
-    auto format(color c, FormatContext& ctx) {
+    auto format(color c, FormatContext& ctx) const {
       string_view name = "unknown";
       switch (c) {
       case color::red:   name = "red"; break;
@@ -193,6 +265,15 @@ example::
     }
   };
 
+Since ``parse`` is inherited from ``formatter<string_view>`` it will recognize
+all string format specifications, for example
+
+.. code-block:: c++
+
+   fmt::format("{:>10}", color::blue)
+
+will return ``"      blue"``.
+
 You can also write a formatter for a hierarchy of classes::
 
   #include <type_traits>
@@ -211,7 +292,7 @@ You can also write a formatter for a hierarchy of classes::
   struct fmt::formatter<T, std::enable_if_t<std::is_base_of<A, T>::value, char>> :
       fmt::formatter<std::string> {
     template <typename FormatCtx>
-    auto format(const A& a, FormatCtx& ctx) {
+    auto format(const A& a, FormatCtx& ctx) const {
       return fmt::formatter<std::string>::format(a.name(), ctx);
     }
   };
@@ -222,44 +303,56 @@ You can also write a formatter for a hierarchy of classes::
     fmt::print("{}", a); // prints "B"
   }
 
-.. doxygenclass:: fmt::basic_format_parse_context
-   :members:
+If a type provides both a ``formatter`` specialization and an implicit
+conversion to a formattable type, the specialization takes precedence over the
+conversion.
 
-Output Iterator Support
------------------------
+For enums {fmt} also provides the ``format_as`` extension API. To format an enum
+via this API define ``format_as`` that takes this enum and converts it to the
+underlying type. ``format_as`` should be defined in the same namespace as the
+enum.
 
-.. doxygenfunction:: fmt::format_to(OutputIt, const S&, Args&&...)
-.. doxygenfunction:: fmt::format_to_n(OutputIt, std::size_t, string_view, Args&&...)
-.. doxygenstruct:: fmt::format_to_n_result
-   :members:
+Example (https://godbolt.org/z/r7vvGE1v7)::
 
-Literal-based API
+  #include <fmt/format.h>
+
+  namespace kevin_namespacy {
+  enum class film {
+    house_of_cards, american_beauty, se7en = 7
+  };
+  auto format_as(film f) { return fmt::underlying(f); }
+  }
+
+  int main() {
+    fmt::print("{}\n", kevin_namespacy::film::se7en); // prints "7"
+  }
+
+Literal-Based API
 -----------------
 
 The following user-defined literals are defined in ``fmt/format.h``.
 
-.. doxygenfunction:: operator""_format(const char *, std::size_t)
-
-.. doxygenfunction:: operator""_a(const char *, std::size_t)
+.. doxygenfunction:: operator""_a()
 
 Utilities
 ---------
 
-.. doxygenstruct:: fmt::is_char
+.. doxygenfunction:: fmt::ptr(T p) -> const void*
+.. doxygenfunction:: fmt::ptr(const std::unique_ptr<T> &p) -> const void*
+.. doxygenfunction:: fmt::ptr(const std::shared_ptr<T> &p) -> const void*
 
-.. doxygentypedef:: fmt::char_t
+.. doxygenfunction:: fmt::underlying(Enum e) -> typename std::underlying_type<Enum>::type
 
-.. doxygenfunction:: fmt::formatted_size(string_view, const Args&...)
+.. doxygenfunction:: fmt::to_string(const T &value) -> std::string
 
-.. doxygenfunction:: fmt::to_string(const T&)
+.. doxygenfunction:: fmt::join(Range &&range, string_view sep) -> join_view<detail::iterator_t<Range>, detail::sentinel_t<Range>>
 
-.. doxygenfunction:: fmt::to_wstring(const T&)
+.. doxygenfunction:: fmt::join(It begin, Sentinel end, string_view sep) -> join_view<It, Sentinel>
 
-.. doxygenfunction:: fmt::to_string_view(const Char *)
+.. doxygenfunction:: fmt::group_digits(T value) -> group_digits_view<T>
 
-.. doxygenfunction:: fmt::join(const Range&, string_view)
-
-.. doxygenfunction:: fmt::join(It, It, string_view)
+.. doxygenclass:: fmt::detail::buffer
+   :members:
 
 .. doxygenclass:: fmt::basic_memory_buffer
    :protected-members:
@@ -268,20 +361,14 @@ Utilities
 System Errors
 -------------
 
-fmt does not use ``errno`` to communicate errors to the user, but it may call
-system functions which set ``errno``. Users should not make any assumptions about
-the value of ``errno`` being preserved by library functions.
+{fmt} does not use ``errno`` to communicate errors to the user, but it may call
+system functions which set ``errno``. Users should not make any assumptions
+about the value of ``errno`` being preserved by library functions.
 
-.. doxygenclass:: fmt::system_error
-   :members:
+.. doxygenfunction:: fmt::system_error
 
 .. doxygenfunction:: fmt::format_system_error
 
-.. doxygenclass:: fmt::windows_error
-   :members:
-
-.. _formatstrings:
-
 Custom Allocators
 -----------------
 
@@ -300,8 +387,8 @@ allocator::
 
     custom_string vformat(custom_allocator alloc, fmt::string_view format_str,
                           fmt::format_args args) {
-      custom_memory_buffer buf(alloc);
-      fmt::vformat_to(buf, format_str, args);
+      auto buf = custom_memory_buffer(alloc);
+      fmt::vformat_to(std::back_inserter(buf), format_str, args);
       return custom_string(buf.data(), buf.size(), alloc);
     }
 
@@ -312,59 +399,15 @@ allocator::
       return vformat(alloc, format_str, fmt::make_format_args(args...));
     }
 
-The allocator will be used for the output container only. If you are using named
-arguments, the container that stores pointers to them will be allocated using
-the default allocator. Also floating-point formatting falls back on ``sprintf``
-which may do allocations.
-
-Custom Formatting of Built-in Types
------------------------------------
-
-It is possible to change the way arguments are formatted by providing a
-custom argument formatter class::
-
-  using arg_formatter = fmt::arg_formatter<fmt::buffer_range<char>>;
-
-  // A custom argument formatter that formats negative integers as unsigned
-  // with the ``x`` format specifier.
-  class custom_arg_formatter : public arg_formatter {
-   public:
-    custom_arg_formatter(fmt::format_context& ctx,
-                         fmt::format_parse_context* parse_ctx = nullptr,
-                         fmt::format_specs* spec = nullptr)
-      : arg_formatter(ctx, parse_ctx, spec) {}
-
-    using arg_formatter::operator();
-
-    auto operator()(int value) {
-      if (specs() && specs()->type == 'x')
-        return (*this)(static_cast<unsigned>(value)); // convert to unsigned and format
-      return arg_formatter::operator()(value);
-    }
-  };
-
-  std::string custom_vformat(fmt::string_view format_str, fmt::format_args args) {
-    fmt::memory_buffer buffer;
-    // Pass custom argument formatter as a template arg to vformat_to.
-    fmt::vformat_to<custom_arg_formatter>(buffer, format_str, args);
-    return fmt::to_string(buffer);
-  }
-
-  template <typename ...Args>
-  inline std::string custom_format(
-      fmt::string_view format_str, const Args&... args) {
-    return custom_vformat(format_str, fmt::make_format_args(args...));
-  }
-
-  std::string s = custom_format("{:x}", -42); // s == "ffffffd6"
-
-.. doxygenclass:: fmt::arg_formatter
-   :members:
+The allocator will be used for the output container only. Formatting functions
+normally don't do any allocations for built-in and string types except for
+non-default floating-point formatting that occasionally falls back on
+``sprintf``.
 
 .. _ranges-api:
 
-Ranges and Tuple Formatting
-===========================
+Range and Tuple Formatting
+==========================
 
 The library also supports convenient formatting of ranges and tuples::
 
@@ -391,18 +434,110 @@ Using ``fmt::join``, you can separate tuple elements with a custom separator::
 Date and Time Formatting
 ========================
 
-The library supports `strftime
-<http://en.cppreference.com/w/cpp/chrono/c/strftime>`_-like date and time
-formatting::
+``fmt/chrono.h`` provides formatters for
+
+* `std::chrono::duration <https://en.cppreference.com/w/cpp/chrono/duration>`_
+* `std::chrono::time_point
+  <https://en.cppreference.com/w/cpp/chrono/time_point>`_
+* `std::tm <https://en.cppreference.com/w/cpp/chrono/c/tm>`_
+
+The format syntax is described in :ref:`chrono-specs`.
+
+**Example**::
 
   #include <fmt/chrono.h>
 
-  std::time_t t = std::time(nullptr);
-  // Prints "The date is 2016-04-29." (with the current date)
-  fmt::print("The date is {:%Y-%m-%d}.", *std::localtime(&t));
+  int main() {
+    std::time_t t = std::time(nullptr);
 
-The format string syntax is described in the documentation of
-`strftime <http://en.cppreference.com/w/cpp/chrono/c/strftime>`_.
+    // Prints "The date is 2020-11-07." (with the current date):
+    fmt::print("The date is {:%Y-%m-%d}.", fmt::localtime(t));
+
+    using namespace std::literals::chrono_literals;
+
+    // Prints "Default format: 42s 100ms":
+    fmt::print("Default format: {} {}\n", 42s, 100ms);
+
+    // Prints "strftime-like format: 03:15:30":
+    fmt::print("strftime-like format: {:%H:%M:%S}\n", 3h + 15min + 30s);
+  }
+
+.. doxygenfunction:: localtime(std::time_t time)
+
+.. doxygenfunction:: gmtime(std::time_t time)
+
+.. _std-api:
+
+Standard Library Types Formatting
+=================================
+
+``fmt/std.h`` provides formatters for:
+
+* `std::filesystem::path <https://en.cppreference.com/w/cpp/filesystem/path>`_
+* `std::thread::id <https://en.cppreference.com/w/cpp/thread/thread/id>`_
+* `std::monostate <https://en.cppreference.com/w/cpp/utility/variant/monostate>`_
+* `std::variant <https://en.cppreference.com/w/cpp/utility/variant/variant>`_
+
+Formatting Variants
+-------------------
+
+A ``std::variant`` is only formattable if every variant alternative is formattable, and requires the
+``__cpp_lib_variant`` `library feature <https://en.cppreference.com/w/cpp/feature_test>`_.
+  
+**Example**::
+
+  #include <fmt/std.h>
+
+  std::variant<char, float> v0{'x'};
+  // Prints "variant('x')"
+  fmt::print("{}", v0);
+
+  std::variant<std::monostate, char> v1;
+  // Prints "variant(monostate)"
+
+.. _compile-api:
+
+Format String Compilation
+=========================
+
+``fmt/compile.h`` provides format string compilation enabled via the
+``FMT_COMPILE`` macro or the ``_cf`` user-defined literal. Format strings
+marked with ``FMT_COMPILE`` or ``_cf`` are parsed, checked and converted into
+efficient formatting code at compile-time. This supports arguments of built-in
+and string types as well as user-defined types with ``constexpr`` ``parse``
+functions in their ``formatter`` specializations. Format string compilation can
+generate more binary code compared to the default API and is only recommended in
+places where formatting is a performance bottleneck.
+
+.. doxygendefine:: FMT_COMPILE
+
+.. doxygenfunction:: operator""_cf()
+
+.. _color-api:
+
+Terminal Color and Text Style
+=============================
+
+``fmt/color.h`` provides support for terminal color and text style output.
+
+.. doxygenfunction:: print(const text_style &ts, const S &format_str, const Args&... args)
+
+.. doxygenfunction:: fg(detail::color_type)
+
+.. doxygenfunction:: bg(detail::color_type)
+
+.. doxygenfunction:: styled(const T& value, text_style ts)
+
+.. _os-api:
+
+System APIs
+===========
+
+.. doxygenclass:: fmt::ostream
+   :members:
+
+.. doxygenfunction:: fmt::windows_error
+   :members:
 
 .. _ostream-api:
 
@@ -410,24 +545,28 @@ The format string syntax is described in the documentation of
 ========================
 
 ``fmt/ostream.h`` provides ``std::ostream`` support including formatting of
-user-defined types that have overloaded ``operator<<``::
+user-defined types that have an overloaded insertion operator (``operator<<``).
+In order to make a type formattable via ``std::ostream`` you should provide a
+``formatter`` specialization inherited from ``ostream_formatter``::
 
   #include <fmt/ostream.h>
 
-  class date {
-    int year_, month_, day_;
-  public:
-    date(int year, int month, int day): year_(year), month_(month), day_(day) {}
+  struct date {
+    int year, month, day;
 
     friend std::ostream& operator<<(std::ostream& os, const date& d) {
-      return os << d.year_ << '-' << d.month_ << '-' << d.day_;
+      return os << d.year << '-' << d.month << '-' << d.day;
     }
   };
 
-  std::string s = fmt::format("The date is {}", date(2012, 12, 9));
+  template <> struct fmt::formatter<date> : ostream_formatter {};
+
+  std::string s = fmt::format("The date is {}", date{2012, 12, 9});
   // s == "The date is 2012-12-9"
 
-.. doxygenfunction:: print(std::basic_ostream<Char>&, const S&, Args&&...)
+.. doxygenfunction:: streamed(const T &)
+
+.. doxygenfunction:: print(std::ostream &os, format_string<T...> fmt, T&&... args)
 
 .. _printf-api:
 
@@ -436,15 +575,42 @@ user-defined types that have overloaded ``operator<<``::
 
 The header ``fmt/printf.h`` provides ``printf``-like formatting functionality.
 The following functions use `printf format string syntax
-<http://pubs.opengroup.org/onlinepubs/009695399/functions/fprintf.html>`_ with
+<https://pubs.opengroup.org/onlinepubs/009695399/functions/fprintf.html>`_ with
 the POSIX extension for positional arguments. Unlike their standard
 counterparts, the ``fmt`` functions are type-safe and throw an exception if an
 argument type doesn't match its format specification.
 
-.. doxygenfunction:: printf(const S&, const Args&...)
+.. doxygenfunction:: printf(const S &format_str, const T&... args)
 
-.. doxygenfunction:: fprintf(std::FILE *, const S&, const Args&...)
+.. doxygenfunction:: fprintf(std::FILE *f, const S &fmt, const T&... args) -> int
 
-.. doxygenfunction:: fprintf(std::basic_ostream<Char>&, const S&, const Args&...)
+.. doxygenfunction:: sprintf(const S&, const T&...)
 
-.. doxygenfunction:: sprintf(const S&, const Args&...)
+.. _xchar-api:
+
+``wchar_t`` Support
+===================
+
+The optional header ``fmt/xchar.h`` provides support for ``wchar_t`` and exotic
+character types.
+
+.. doxygenstruct:: fmt::is_char
+
+.. doxygentypedef:: fmt::wstring_view
+
+.. doxygentypedef:: fmt::wformat_context
+
+.. doxygenfunction:: fmt::to_wstring(const T &value)
+
+Compatibility with C++20 ``std::format``
+========================================
+
+{fmt} implements nearly all of the `C++20 formatting library
+<https://en.cppreference.com/w/cpp/utility/format>`_ with the following
+differences:
+
+* Names are defined in the ``fmt`` namespace instead of ``std`` to avoid
+  collisions with standard library implementations.
+* Width calculation doesn't use grapheme clusterization. The latter has been
+  implemented in a separate branch but hasn't been integrated yet.
+* Most C++20 chrono types are not supported yet.

externals/fmt/doc/basic-bootstrap/layout.html

@@ -90,12 +90,14 @@
         VERSION:     '{{ release|e }}',
         COLLAPSE_INDEX: false,
         FILE_SUFFIX: '{{ '' if no_search_suffix else file_suffix }}',
+        LINK_SUFFIX: '{{ link_suffix }}',
+        SOURCELINK_SUFFIX: '{{ sourcelink_suffix }}',
         HAS_SOURCE:  {{ has_source|lower }},
         SOURCELINK_SUFFIX:  '{{ sourcelink_suffix }}'
       };
     </script>
     {%- for scriptfile in script_files %}
-    <script type="text/javascript" src="{{ pathto(scriptfile, 1) }}"></script>
+    {{ js_tag(scriptfile) }}
     {%- endfor %}
 {%- endmacro %}
 

externals/fmt/doc/build.py

@@ -1,63 +1,38 @@
-#!/usr/bin/env python
+#!/usr/bin/env python3
 # Build the documentation.
 
-from __future__ import print_function
-import errno, os, shutil, sys, tempfile
-from subprocess import check_call, check_output, CalledProcessError, Popen, PIPE
-from distutils.version import LooseVersion
+import errno, os, re, sys
+from subprocess import check_call, CalledProcessError, Popen, PIPE, STDOUT
 
-versions = ['1.0.0', '1.1.0', '2.0.0', '3.0.2', '4.0.0', '4.1.0', '5.0.0', '5.1.0', '5.2.0', '5.2.1', '5.3.0', '6.0.0', '6.1.0', '6.1.1', '6.1.2', '6.2.0']
+versions = ['1.0.0', '1.1.0', '2.0.0', '3.0.2', '4.0.0', '4.1.0', '5.0.0', '5.1.0', '5.2.0', '5.2.1', '5.3.0', '6.0.0', '6.1.0', '6.1.1', '6.1.2', '6.2.0', '6.2.1', '7.0.0', '7.0.1', '7.0.2', '7.0.3', '7.1.0', '7.1.1', '7.1.2', '7.1.3', '8.0.0', '8.0.1', '8.1.0', '8.1.1', '9.0.0', '9.1.0']
 
-def pip_install(package, commit=None, **kwargs):
-  "Install package using pip."
-  min_version = kwargs.get('min_version')
-  if min_version:
-    from pkg_resources import get_distribution, DistributionNotFound
-    try:
-      installed_version = get_distribution(os.path.basename(package)).version
-      if LooseVersion(installed_version) >= min_version:
-        print('{} {} already installed'.format(package, min_version))
-        return
-    except DistributionNotFound:
-      pass
-  if commit:
-    package = 'git+https://github.com/{0}.git@{1}'.format(package, commit)
-  print('Installing {0}'.format(package))
-  check_call(['pip', 'install', package])
+class Pip:
+  def __init__(self, venv_dir):
+    self.path = os.path.join(venv_dir, 'bin', 'pip')
 
-def create_build_env(dirname='virtualenv'):
+  def install(self, package, commit=None):
+    "Install package using pip."
+    if commit:
+      package = 'git+https://github.com/{0}.git@{1}'.format(package, commit)
+    print('Installing {0}'.format(package))
+    check_call([self.path, 'install', package])
+
+def create_build_env(venv_dir='virtualenv'):
   # Create virtualenv.
-  if not os.path.exists(dirname):
-    check_call(['virtualenv', dirname])
-  import sysconfig
-  scripts_dir = os.path.basename(sysconfig.get_path('scripts'))
-  activate_this_file = os.path.join(dirname, scripts_dir, 'activate_this.py')
-  with open(activate_this_file) as f:
-    exec(f.read(), dict(__file__=activate_this_file))
-  # Import get_distribution after activating virtualenv to get info about
-  # the correct packages.
-  from pkg_resources import get_distribution, DistributionNotFound
-  # Upgrade pip because installation of sphinx with pip 1.1 available on Travis
-  # is broken (see #207) and it doesn't support the show command.
-  pip_version = get_distribution('pip').version
-  if LooseVersion(pip_version) < LooseVersion('1.5.4'):
-    print("Updating pip")
-    check_call(['pip', 'install', '--upgrade', 'pip'])
-  # Upgrade distribute because installation of sphinx with distribute 0.6.24
-  # available on Travis is broken (see #207).
-  try:
-    distribute_version = get_distribution('distribute').version
-    if LooseVersion(distribute_version) <= LooseVersion('0.6.24'):
-      print("Updating distribute")
-      check_call(['pip', 'install', '--upgrade', 'distribute'])
-  except DistributionNotFound:
-    pass
-  # Install Sphinx and Breathe.
-  pip_install('sphinx-doc/sphinx', '12b83372ac9316e8cbe86e7fed889296a4cc29ee',
-              min_version='1.4.1.dev20160531')
-  pip_install('michaeljones/breathe',
-              '129222318f7c8f865d2631e7da7b033567e7f56a',
-              min_version='4.2.0')
+  if not os.path.exists(venv_dir):
+    check_call(['python3', '-m', 'venv', venv_dir])
+  # Install Sphinx and Breathe. Require the exact version of Sphinx which is
+  # compatible with Breathe.
+  pip = Pip(venv_dir)
+  pip.install('wheel')
+  pip.install('six')
+  # See: https://github.com/sphinx-doc/sphinx/issues/9777
+  pip.install('docutils==0.17.1')
+  # Jinja2 >= 3.1 incompatible with sphinx 3.3.0
+  # See: https://github.com/sphinx-doc/sphinx/issues/10291
+  pip.install('Jinja2<3.1')
+  pip.install('sphinx-doc/sphinx', 'v3.3.0')
+  pip.install('michaeljones/breathe', 'v4.25.0')
 
 def build_docs(version='dev', **kwargs):
   doc_dir = kwargs.get('doc_dir', os.path.dirname(os.path.realpath(__file__)))
@@ -66,16 +41,17 @@ def build_docs(version='dev', **kwargs):
       'include_dir', os.path.join(os.path.dirname(doc_dir), 'include', 'fmt'))
   # Build docs.
   cmd = ['doxygen', '-']
-  p = Popen(cmd, stdin=PIPE)
+  p = Popen(cmd, stdin=PIPE, stdout=PIPE, stderr=STDOUT)
   doxyxml_dir = os.path.join(work_dir, 'doxyxml')
-  p.communicate(input=r'''
+  out, _ = p.communicate(input=r'''
       PROJECT_NAME      = fmt
       GENERATE_LATEX    = NO
       GENERATE_MAN      = NO
       GENERATE_RTF      = NO
       CASE_SENSE_NAMES  = NO
-      INPUT             = {0}/core.h {0}/format.h {0}/os.h {0}/ostream.h \
-                          {0}/printf.h {0}/time.h
+      INPUT             = {0}/chrono.h {0}/color.h {0}/core.h {0}/compile.h \
+                          {0}/format.h {0}/os.h {0}/ostream.h {0}/printf.h \
+                          {0}/xchar.h
       QUIET             = YES
       JAVADOC_AUTOBRIEF = YES
       AUTOLINK_SUPPORT  = NO
@@ -86,28 +62,50 @@ def build_docs(version='dev', **kwargs):
       ALIASES          += "endrst=\endverbatim"
       MACRO_EXPANSION   = YES
       PREDEFINED        = _WIN32=1 \
+                          __linux__=1 \
+                          FMT_ENABLE_IF(...)= \
                           FMT_USE_VARIADIC_TEMPLATES=1 \
                           FMT_USE_RVALUE_REFERENCES=1 \
                           FMT_USE_USER_DEFINED_LITERALS=1 \
                           FMT_USE_ALIAS_TEMPLATES=1 \
+                          FMT_USE_NONTYPE_TEMPLATE_ARGS=1 \
                           FMT_API= \
                           "FMT_BEGIN_NAMESPACE=namespace fmt {{" \
                           "FMT_END_NAMESPACE=}}" \
                           "FMT_STRING_ALIAS=1" \
-                          "FMT_ENABLE_IF(B)="
-      EXCLUDE_SYMBOLS   = fmt::internal::* StringValue write_str
+                          "FMT_VARIADIC(...)=" \
+                          "FMT_VARIADIC_W(...)=" \
+                          "FMT_DOC=1"
+      EXCLUDE_SYMBOLS   = fmt::formatter fmt::printf_formatter fmt::arg_join \
+                          fmt::basic_format_arg::handle
     '''.format(include_dir, doxyxml_dir).encode('UTF-8'))
+  out = out.decode('utf-8')
+  internal_symbols = [
+    'fmt::detail::.*',
+    'basic_data<>',
+    'fmt::type_identity',
+    'fmt::dynamic_formatter'
+  ]
+  noisy_warnings = [
+    'warning: (Compound|Member .* of class) (' + '|'.join(internal_symbols) + \
+      ') is not documented.',
+    'warning: Internal inconsistency: .* does not belong to any container!'
+  ]
+  for w in noisy_warnings:
+      out = re.sub('.*' + w + '\n', '', out)
+  print(out)
   if p.returncode != 0:
     raise CalledProcessError(p.returncode, cmd)
+
   html_dir = os.path.join(work_dir, 'html')
   main_versions = reversed(versions[-3:])
-  check_call(['sphinx-build',
+  check_call([os.path.join(work_dir, 'virtualenv', 'bin', 'sphinx-build'),
               '-Dbreathe_projects.format=' + os.path.abspath(doxyxml_dir),
               '-Dversion=' + version, '-Drelease=' + version,
               '-Aversion=' + version, '-Aversions=' + ','.join(main_versions),
               '-b', 'html', doc_dir, html_dir])
   try:
-    check_call(['lessc', '--clean-css',
+    check_call(['lessc', '--verbose', '--clean-css',
                 '--include-path=' + os.path.join(doc_dir, 'bootstrap'),
                 os.path.join(doc_dir, 'fmt.less'),
                 os.path.join(html_dir, '_static', 'fmt.css')])

externals/fmt/doc/fmt.less

@@ -56,6 +56,11 @@ div.sphinxsidebar {
   padding: 0;
 }
 
+// Override center alignment in tables.
+td {
+  text-align: left;
+}
+
 p.rubric {
   margin-top: 10px;
 }

externals/fmt/doc/html/_sources/api.rst.txt

@@ -0,0 +1,616 @@
+.. _string-formatting-api:
+
+*************
+API Reference
+*************
+
+The {fmt} library API consists of the following parts:
+
+* :ref:`fmt/core.h <core-api>`: the core API providing main formatting functions
+  for ``char``/UTF-8 with C++20 compile-time checks and minimal dependencies
+* :ref:`fmt/format.h <format-api>`: the full format API providing additional
+  formatting functions and locale support
+* :ref:`fmt/ranges.h <ranges-api>`: formatting of ranges and tuples
+* :ref:`fmt/chrono.h <chrono-api>`: date and time formatting
+* :ref:`fmt/std.h <std-api>`: formatters for standard library types
+* :ref:`fmt/compile.h <compile-api>`: format string compilation
+* :ref:`fmt/color.h <color-api>`: terminal color and text style
+* :ref:`fmt/os.h <os-api>`: system APIs
+* :ref:`fmt/ostream.h <ostream-api>`: ``std::ostream`` support
+* :ref:`fmt/printf.h <printf-api>`: ``printf`` formatting
+* :ref:`fmt/xchar.h <xchar-api>`: optional ``wchar_t`` support 
+
+All functions and types provided by the library reside in namespace ``fmt`` and
+macros have prefix ``FMT_``.
+
+.. _core-api:
+
+Core API
+========
+
+``fmt/core.h`` defines the core API which provides main formatting functions
+for ``char``/UTF-8 with C++20 compile-time checks. It has minimal include
+dependencies for better compile times. This header is only beneficial when
+using {fmt} as a library and not in the header-only mode.
+
+The following functions use :ref:`format string syntax <syntax>`
+similar to that of Python's `str.format
+<https://docs.python.org/3/library/stdtypes.html#str.format>`_.
+They take *fmt* and *args* as arguments.
+
+*fmt* is a format string that contains literal text and replacement fields
+surrounded by braces ``{}``. The fields are replaced with formatted arguments
+in the resulting string. `~fmt::format_string` is a format string which can be
+implicitly constructed from a string literal or a ``constexpr`` string and is
+checked at compile time in C++20. To pass a runtime format string wrap it in
+`fmt::runtime`.
+
+*args* is an argument list representing objects to be formatted.
+
+.. _format:
+
+.. doxygenfunction:: format(format_string<T...> fmt, T&&... args) -> std::string
+.. doxygenfunction:: vformat(string_view fmt, format_args args) -> std::string
+
+.. doxygenfunction:: format_to(OutputIt out, format_string<T...> fmt, T&&... args) -> OutputIt
+.. doxygenfunction:: format_to_n(OutputIt out, size_t n, format_string<T...> fmt, T&&... args) -> format_to_n_result<OutputIt>
+.. doxygenfunction:: formatted_size(format_string<T...> fmt, T&&... args) -> size_t
+
+.. doxygenstruct:: fmt::format_to_n_result
+   :members:
+
+.. _print:
+
+.. doxygenfunction:: fmt::print(format_string<T...> fmt, T&&... args)
+.. doxygenfunction:: fmt::vprint(string_view fmt, format_args args)
+
+.. doxygenfunction:: print(std::FILE *f, format_string<T...> fmt, T&&... args)
+.. doxygenfunction:: vprint(std::FILE *f, string_view fmt, format_args args)
+
+Compile-Time Format String Checks
+---------------------------------
+
+Compile-time checks are enabled by default on compilers that support C++20
+``consteval``. On older compilers you can use the ``FMT_STRING`` macro defined
+in ``fmt/format.h`` instead. It requires C++14 and is a no-op in C++11.
+
+.. doxygendefine:: FMT_STRING
+
+To force the use of legacy compile-time checks, define the preprocessor variable
+``FMT_ENFORCE_COMPILE_STRING``. When set, functions accepting ``FMT_STRING``
+will fail to compile with regular strings. Runtime-checked formatting is still
+possible using ``fmt::vformat``, ``fmt::vprint``, etc.
+
+.. doxygenclass:: fmt::basic_format_string
+   :members:
+
+.. doxygentypedef:: fmt::format_string
+
+.. doxygenfunction:: fmt::runtime(string_view) -> basic_runtime<char>
+
+Named Arguments
+---------------
+
+.. doxygenfunction:: fmt::arg(const S&, const T&)
+
+Named arguments are not supported in compile-time checks at the moment.
+
+Argument Lists
+--------------
+
+You can create your own formatting function with compile-time checks and small
+binary footprint, for example (https://godbolt.org/z/oba4Mc):
+
+.. code:: c++
+
+    #include <fmt/format.h>
+
+    void vlog(const char* file, int line, fmt::string_view format,
+              fmt::format_args args) {
+      fmt::print("{}: {}: ", file, line);
+      fmt::vprint(format, args);
+    }
+
+    template <typename S, typename... Args>
+    void log(const char* file, int line, const S& format, Args&&... args) {
+      vlog(file, line, format, fmt::make_format_args(args...));
+    }
+
+    #define MY_LOG(format, ...) \
+      log(__FILE__, __LINE__, FMT_STRING(format), __VA_ARGS__)
+
+    MY_LOG("invalid squishiness: {}", 42);
+
+Note that ``vlog`` is not parameterized on argument types which improves compile
+times and reduces binary code size compared to a fully parameterized version.
+
+.. doxygenfunction:: fmt::make_format_args(const Args&...)
+
+.. doxygenclass:: fmt::format_arg_store
+   :members:
+
+.. doxygenclass:: fmt::dynamic_format_arg_store
+   :members:
+
+.. doxygenclass:: fmt::basic_format_args
+   :members:
+
+.. doxygentypedef:: fmt::format_args
+
+.. doxygenclass:: fmt::basic_format_arg
+   :members:
+
+.. doxygenclass:: fmt::basic_format_parse_context
+   :members:
+
+.. doxygenclass:: fmt::basic_format_context
+   :members:
+
+.. doxygentypedef:: fmt::format_context
+
+Compatibility
+-------------
+
+.. doxygenclass:: fmt::basic_string_view
+   :members:
+
+.. doxygentypedef:: fmt::string_view
+
+Locale
+------
+
+All formatting is locale-independent by default. Use the ``'L'`` format
+specifier to insert the appropriate number separator characters from the
+locale::
+
+  #include <fmt/core.h>
+  #include <locale>
+
+  std::locale::global(std::locale("en_US.UTF-8"));
+  auto s = fmt::format("{:L}", 1000000);  // s == "1,000,000"
+
+.. _format-api:
+
+Format API
+==========
+
+``fmt/format.h`` defines the full format API providing additional formatting
+functions and locale support.
+
+.. _udt:
+
+Formatting User-Defined Types
+-----------------------------
+
+The {fmt} library provides formatters for many standard C++ types.
+See :ref:`fmt/ranges.h <ranges-api>` for ranges and tuples including standard
+containers such as ``std::vector``, :ref:`fmt/chrono.h <chrono-api>` for date
+and time formatting and :ref:`fmt/std.h <std-api>` for path and variant 
+formatting.
+
+To make a user-defined type formattable, specialize the ``formatter<T>`` struct
+template and implement ``parse`` and ``format`` methods::
+
+  #include <fmt/format.h>
+
+  struct point {
+    double x, y;
+  };
+
+  template <> struct fmt::formatter<point> {
+    // Presentation format: 'f' - fixed, 'e' - exponential.
+    char presentation = 'f';
+
+    // Parses format specifications of the form ['f' | 'e'].
+    constexpr auto parse(format_parse_context& ctx) -> decltype(ctx.begin()) {
+      // [ctx.begin(), ctx.end()) is a character range that contains a part of
+      // the format string starting from the format specifications to be parsed,
+      // e.g. in
+      //
+      //   fmt::format("{:f} - point of interest", point{1, 2});
+      //
+      // the range will contain "f} - point of interest". The formatter should
+      // parse specifiers until '}' or the end of the range. In this example
+      // the formatter should parse the 'f' specifier and return an iterator
+      // pointing to '}'.
+      
+      // Please also note that this character range may be empty, in case of
+      // the "{}" format string, so therefore you should check ctx.begin()
+      // for equality with ctx.end().
+
+      // Parse the presentation format and store it in the formatter:
+      auto it = ctx.begin(), end = ctx.end();
+      if (it != end && (*it == 'f' || *it == 'e')) presentation = *it++;
+
+      // Check if reached the end of the range:
+      if (it != end && *it != '}') throw format_error("invalid format");
+
+      // Return an iterator past the end of the parsed range:
+      return it;
+    }
+
+    // Formats the point p using the parsed format specification (presentation)
+    // stored in this formatter.
+    template <typename FormatContext>
+    auto format(const point& p, FormatContext& ctx) const -> decltype(ctx.out()) {
+      // ctx.out() is an output iterator to write to.
+      return presentation == 'f'
+                ? fmt::format_to(ctx.out(), "({:.1f}, {:.1f})", p.x, p.y)
+                : fmt::format_to(ctx.out(), "({:.1e}, {:.1e})", p.x, p.y);
+    }
+  };
+
+Then you can pass objects of type ``point`` to any formatting function::
+
+  point p = {1, 2};
+  std::string s = fmt::format("{:f}", p);
+  // s == "(1.0, 2.0)"
+
+You can also reuse existing formatters via inheritance or composition, for
+example::
+
+  enum class color {red, green, blue};
+
+  template <> struct fmt::formatter<color>: formatter<string_view> {
+    // parse is inherited from formatter<string_view>.
+    template <typename FormatContext>
+    auto format(color c, FormatContext& ctx) const {
+      string_view name = "unknown";
+      switch (c) {
+      case color::red:   name = "red"; break;
+      case color::green: name = "green"; break;
+      case color::blue:  name = "blue"; break;
+      }
+      return formatter<string_view>::format(name, ctx);
+    }
+  };
+
+Since ``parse`` is inherited from ``formatter<string_view>`` it will recognize
+all string format specifications, for example
+
+.. code-block:: c++
+
+   fmt::format("{:>10}", color::blue)
+
+will return ``"      blue"``.
+
+You can also write a formatter for a hierarchy of classes::
+
+  #include <type_traits>
+  #include <fmt/format.h>
+
+  struct A {
+    virtual ~A() {}
+    virtual std::string name() const { return "A"; }
+  };
+
+  struct B : A {
+    virtual std::string name() const { return "B"; }
+  };
+
+  template <typename T>
+  struct fmt::formatter<T, std::enable_if_t<std::is_base_of<A, T>::value, char>> :
+      fmt::formatter<std::string> {
+    template <typename FormatCtx>
+    auto format(const A& a, FormatCtx& ctx) const {
+      return fmt::formatter<std::string>::format(a.name(), ctx);
+    }
+  };
+
+  int main() {
+    B b;
+    A& a = b;
+    fmt::print("{}", a); // prints "B"
+  }
+
+If a type provides both a ``formatter`` specialization and an implicit
+conversion to a formattable type, the specialization takes precedence over the
+conversion.
+
+For enums {fmt} also provides the ``format_as`` extension API. To format an enum
+via this API define ``format_as`` that takes this enum and converts it to the
+underlying type. ``format_as`` should be defined in the same namespace as the
+enum.
+
+Example (https://godbolt.org/z/r7vvGE1v7)::
+
+  #include <fmt/format.h>
+
+  namespace kevin_namespacy {
+  enum class film {
+    house_of_cards, american_beauty, se7en = 7
+  };
+  auto format_as(film f) { return fmt::underlying(f); }
+  }
+
+  int main() {
+    fmt::print("{}\n", kevin_namespacy::film::se7en); // prints "7"
+  }
+
+Literal-Based API
+-----------------
+
+The following user-defined literals are defined in ``fmt/format.h``.
+
+.. doxygenfunction:: operator""_a()
+
+Utilities
+---------
+
+.. doxygenfunction:: fmt::ptr(T p) -> const void*
+.. doxygenfunction:: fmt::ptr(const std::unique_ptr<T> &p) -> const void*
+.. doxygenfunction:: fmt::ptr(const std::shared_ptr<T> &p) -> const void*
+
+.. doxygenfunction:: fmt::underlying(Enum e) -> typename std::underlying_type<Enum>::type
+
+.. doxygenfunction:: fmt::to_string(const T &value) -> std::string
+
+.. doxygenfunction:: fmt::join(Range &&range, string_view sep) -> join_view<detail::iterator_t<Range>, detail::sentinel_t<Range>>
+
+.. doxygenfunction:: fmt::join(It begin, Sentinel end, string_view sep) -> join_view<It, Sentinel>
+
+.. doxygenfunction:: fmt::group_digits(T value) -> group_digits_view<T>
+
+.. doxygenclass:: fmt::detail::buffer
+   :members:
+
+.. doxygenclass:: fmt::basic_memory_buffer
+   :protected-members:
+   :members:
+
+System Errors
+-------------
+
+{fmt} does not use ``errno`` to communicate errors to the user, but it may call
+system functions which set ``errno``. Users should not make any assumptions
+about the value of ``errno`` being preserved by library functions.
+
+.. doxygenfunction:: fmt::system_error
+
+.. doxygenfunction:: fmt::format_system_error
+
+Custom Allocators
+-----------------
+
+The {fmt} library supports custom dynamic memory allocators.
+A custom allocator class can be specified as a template argument to
+:class:`fmt::basic_memory_buffer`::
+
+    using custom_memory_buffer = 
+      fmt::basic_memory_buffer<char, fmt::inline_buffer_size, custom_allocator>;
+
+It is also possible to write a formatting function that uses a custom
+allocator::
+
+    using custom_string =
+      std::basic_string<char, std::char_traits<char>, custom_allocator>;
+
+    custom_string vformat(custom_allocator alloc, fmt::string_view format_str,
+                          fmt::format_args args) {
+      auto buf = custom_memory_buffer(alloc);
+      fmt::vformat_to(std::back_inserter(buf), format_str, args);
+      return custom_string(buf.data(), buf.size(), alloc);
+    }
+
+    template <typename ...Args>
+    inline custom_string format(custom_allocator alloc,
+                                fmt::string_view format_str,
+                                const Args& ... args) {
+      return vformat(alloc, format_str, fmt::make_format_args(args...));
+    }
+
+The allocator will be used for the output container only. Formatting functions
+normally don't do any allocations for built-in and string types except for
+non-default floating-point formatting that occasionally falls back on
+``sprintf``.
+
+.. _ranges-api:
+
+Range and Tuple Formatting
+==========================
+
+The library also supports convenient formatting of ranges and tuples::
+
+  #include <fmt/ranges.h>
+
+  std::tuple<char, int, float> t{'a', 1, 2.0f};
+  // Prints "('a', 1, 2.0)"
+  fmt::print("{}", t);
+
+
+NOTE: currently, the overload of ``fmt::join`` for iterables exists in the main
+``format.h`` header, but expect this to change in the future.
+
+Using ``fmt::join``, you can separate tuple elements with a custom separator::
+
+  #include <fmt/ranges.h>
+
+  std::tuple<int, char> t = {1, 'a'};
+  // Prints "1, a"
+  fmt::print("{}", fmt::join(t, ", "));
+
+.. _chrono-api:
+
+Date and Time Formatting
+========================
+
+``fmt/chrono.h`` provides formatters for
+
+* `std::chrono::duration <https://en.cppreference.com/w/cpp/chrono/duration>`_
+* `std::chrono::time_point
+  <https://en.cppreference.com/w/cpp/chrono/time_point>`_
+* `std::tm <https://en.cppreference.com/w/cpp/chrono/c/tm>`_
+
+The format syntax is described in :ref:`chrono-specs`.
+
+**Example**::
+
+  #include <fmt/chrono.h>
+
+  int main() {
+    std::time_t t = std::time(nullptr);
+
+    // Prints "The date is 2020-11-07." (with the current date):
+    fmt::print("The date is {:%Y-%m-%d}.", fmt::localtime(t));
+
+    using namespace std::literals::chrono_literals;
+
+    // Prints "Default format: 42s 100ms":
+    fmt::print("Default format: {} {}\n", 42s, 100ms);
+
+    // Prints "strftime-like format: 03:15:30":
+    fmt::print("strftime-like format: {:%H:%M:%S}\n", 3h + 15min + 30s);
+  }
+
+.. doxygenfunction:: localtime(std::time_t time)
+
+.. doxygenfunction:: gmtime(std::time_t time)
+
+.. _std-api:
+
+Standard Library Types Formatting
+=================================
+
+``fmt/std.h`` provides formatters for:
+
+* `std::filesystem::path <https://en.cppreference.com/w/cpp/filesystem/path>`_
+* `std::thread::id <https://en.cppreference.com/w/cpp/thread/thread/id>`_
+* `std::monostate <https://en.cppreference.com/w/cpp/utility/variant/monostate>`_
+* `std::variant <https://en.cppreference.com/w/cpp/utility/variant/variant>`_
+
+Formatting Variants
+-------------------
+
+A ``std::variant`` is only formattable if every variant alternative is formattable, and requires the
+``__cpp_lib_variant`` `library feature <https://en.cppreference.com/w/cpp/feature_test>`_.
+  
+**Example**::
+
+  #include <fmt/std.h>
+
+  std::variant<char, float> v0{'x'};
+  // Prints "variant('x')"
+  fmt::print("{}", v0);
+
+  std::variant<std::monostate, char> v1;
+  // Prints "variant(monostate)"
+
+.. _compile-api:
+
+Format String Compilation
+=========================
+
+``fmt/compile.h`` provides format string compilation enabled via the
+``FMT_COMPILE`` macro or the ``_cf`` user-defined literal. Format strings
+marked with ``FMT_COMPILE`` or ``_cf`` are parsed, checked and converted into
+efficient formatting code at compile-time. This supports arguments of built-in
+and string types as well as user-defined types with ``constexpr`` ``parse``
+functions in their ``formatter`` specializations. Format string compilation can
+generate more binary code compared to the default API and is only recommended in
+places where formatting is a performance bottleneck.
+
+.. doxygendefine:: FMT_COMPILE
+
+.. doxygenfunction:: operator""_cf()
+
+.. _color-api:
+
+Terminal Color and Text Style
+=============================
+
+``fmt/color.h`` provides support for terminal color and text style output.
+
+.. doxygenfunction:: print(const text_style &ts, const S &format_str, const Args&... args)
+
+.. doxygenfunction:: fg(detail::color_type)
+
+.. doxygenfunction:: bg(detail::color_type)
+
+.. doxygenfunction:: styled(const T& value, text_style ts)
+
+.. _os-api:
+
+System APIs
+===========
+
+.. doxygenclass:: fmt::ostream
+   :members:
+
+.. doxygenfunction:: fmt::windows_error
+   :members:
+
+.. _ostream-api:
+
+``std::ostream`` Support
+========================
+
+``fmt/ostream.h`` provides ``std::ostream`` support including formatting of
+user-defined types that have an overloaded insertion operator (``operator<<``).
+In order to make a type formattable via ``std::ostream`` you should provide a
+``formatter`` specialization inherited from ``ostream_formatter``::
+
+  #include <fmt/ostream.h>
+
+  struct date {
+    int year, month, day;
+
+    friend std::ostream& operator<<(std::ostream& os, const date& d) {
+      return os << d.year << '-' << d.month << '-' << d.day;
+    }
+  };
+
+  template <> struct fmt::formatter<date> : ostream_formatter {};
+
+  std::string s = fmt::format("The date is {}", date{2012, 12, 9});
+  // s == "The date is 2012-12-9"
+
+.. doxygenfunction:: streamed(const T &)
+
+.. doxygenfunction:: print(std::ostream &os, format_string<T...> fmt, T&&... args)
+
+.. _printf-api:
+
+``printf`` Formatting
+=====================
+
+The header ``fmt/printf.h`` provides ``printf``-like formatting functionality.
+The following functions use `printf format string syntax
+<https://pubs.opengroup.org/onlinepubs/009695399/functions/fprintf.html>`_ with
+the POSIX extension for positional arguments. Unlike their standard
+counterparts, the ``fmt`` functions are type-safe and throw an exception if an
+argument type doesn't match its format specification.
+
+.. doxygenfunction:: printf(const S &format_str, const T&... args)
+
+.. doxygenfunction:: fprintf(std::FILE *f, const S &fmt, const T&... args) -> int
+
+.. doxygenfunction:: sprintf(const S&, const T&...)
+
+.. _xchar-api:
+
+``wchar_t`` Support
+===================
+
+The optional header ``fmt/xchar.h`` provides support for ``wchar_t`` and exotic
+character types.
+
+.. doxygenstruct:: fmt::is_char
+
+.. doxygentypedef:: fmt::wstring_view
+
+.. doxygentypedef:: fmt::wformat_context
+
+.. doxygenfunction:: fmt::to_wstring(const T &value)
+
+Compatibility with C++20 ``std::format``
+========================================
+
+{fmt} implements nearly all of the `C++20 formatting library
+<https://en.cppreference.com/w/cpp/utility/format>`_ with the following
+differences:
+
+* Names are defined in the ``fmt`` namespace instead of ``std`` to avoid
+  collisions with standard library implementations.
+* Width calculation doesn't use grapheme clusterization. The latter has been
+  implemented in a separate branch but hasn't been integrated yet.
+* Most C++20 chrono types are not supported yet.

externals/fmt/doc/html/_sources/contents.rst.txt

@@ -0,0 +1,10 @@
+########
+Contents
+########
+
+.. toctree::
+   :maxdepth: 2
+
+   usage
+   api
+   syntax

externals/fmt/doc/html/_sources/index.rst.txt

@@ -0,0 +1,198 @@
+Overview
+========
+
+**{fmt}** is an open-source formatting library providing a fast and safe
+alternative to C stdio and C++ iostreams.
+
+.. raw:: html
+
+   <div class="panel panel-default">
+     <div class="panel-heading">What users say:</div>
+     <div class="panel-body">
+       Thanks for creating this library. It’s been a hole in C++ for
+       a long time. I’ve used both <code>boost::format</code> and
+       <code>loki::SPrintf</code>, and neither felt like the right answer.
+       This does.
+     </div>
+   </div>
+
+.. _format-api-intro:
+
+Format API
+----------
+
+The format API is similar in spirit to the C ``printf`` family of function but
+is safer, simpler and several times `faster
+<https://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html>`_
+than common standard library implementations.
+The `format string syntax <syntax.html>`_ is similar to the one used by
+`str.format <https://docs.python.org/3/library/stdtypes.html#str.format>`_ in
+Python:
+
+.. code:: c++
+
+  std::string s = fmt::format("The answer is {}.", 42);
+  
+The ``fmt::format`` function returns a string "The answer is 42.". You can use
+``fmt::memory_buffer`` to avoid constructing ``std::string``:
+
+.. code:: c++
+
+  auto out = fmt::memory_buffer();
+  fmt::format_to(std::back_inserter(out),
+            "For a moment, {} happened.", "nothing");
+  auto data = out.data(); // pointer to the formatted data
+  auto size = out.size(); // size of the formatted data
+
+The ``fmt::print`` function performs formatting and writes the result to a stream:
+
+.. code:: c++
+
+  fmt::print(stderr, "System error code = {}\n", errno);
+
+If you omit the file argument the function will print to ``stdout``:
+
+.. code:: c++
+
+  fmt::print("Don't {}\n", "panic");
+
+The format API also supports positional arguments useful for localization:
+
+.. code:: c++
+
+  fmt::print("I'd rather be {1} than {0}.", "right", "happy");
+
+You can pass named arguments with ``fmt::arg``:
+
+.. code:: c++
+
+  fmt::print("Hello, {name}! The answer is {number}. Goodbye, {name}.",
+             fmt::arg("name", "World"), fmt::arg("number", 42));
+
+If your compiler supports C++11 user-defined literals, the suffix ``_a`` offers 
+an alternative, slightly terser syntax for named arguments:
+
+.. code:: c++
+
+  using namespace fmt::literals;
+  fmt::print("Hello, {name}! The answer is {number}. Goodbye, {name}.",
+             "name"_a="World", "number"_a=42);
+
+.. _safety:
+
+Safety
+------
+
+The library is fully type safe, automatic memory management prevents buffer
+overflow, errors in format strings are reported using exceptions or at compile
+time. For example, the code
+
+.. code:: c++
+
+  fmt::format("The answer is {:d}", "forty-two");
+
+throws the ``format_error`` exception because the argument ``"forty-two"`` is a
+string while the format code ``d`` only applies to integers.
+
+The code
+
+.. code:: c++
+
+  format(FMT_STRING("The answer is {:d}"), "forty-two");
+
+reports a compile-time error on compilers that support relaxed ``constexpr``.
+See `here <api.html#compile-time-format-string-checks>`_ for details.
+
+The following code
+
+.. code:: c++
+
+  fmt::format("Cyrillic letter {}", L'\x42e');
+  
+produces a compile-time error because wide character ``L'\x42e'`` cannot be
+formatted into a narrow string. For comparison, writing a wide character to
+``std::ostream`` results in its numeric value being written to the stream
+(i.e. 1070 instead of letter 'ю' which is represented by ``L'\x42e'`` if we
+use Unicode) which is rarely desirable.
+
+Compact Binary Code
+-------------------
+
+The library produces compact per-call compiled code. For example
+(`godbolt <https://godbolt.org/g/TZU4KF>`_),
+
+.. code:: c++
+
+   #include <fmt/core.h>
+
+   int main() {
+     fmt::print("The answer is {}.", 42);
+   }
+
+compiles to just
+
+.. code:: asm
+
+   main: # @main
+     sub rsp, 24
+     mov qword ptr [rsp], 42
+     mov rcx, rsp
+     mov edi, offset .L.str
+     mov esi, 17
+     mov edx, 1
+     call fmt::v7::vprint(fmt::v7::basic_string_view<char>, fmt::v7::format_args)
+     xor eax, eax
+     add rsp, 24
+     ret
+   .L.str:
+     .asciz "The answer is {}."
+
+.. _portability:
+
+Portability
+-----------
+
+The library is highly portable and relies only on a small set of C++11 features:
+
+* variadic templates
+* type traits
+* rvalue references
+* decltype
+* trailing return types
+* deleted functions
+* alias templates
+
+These are available in GCC 4.8, Clang 3.4, MSVC 19.0 (2015) and more recent
+compiler version. For older compilers use {fmt} `version 4.x
+<https://github.com/fmtlib/fmt/releases/tag/4.1.0>`_ which is maintained and
+only requires C++98.
+
+The output of all formatting functions is consistent across platforms.
+For example,
+
+.. code::
+
+  fmt::print("{}", std::numeric_limits<double>::infinity());
+
+always prints ``inf`` while the output of ``printf`` is platform-dependent.
+
+.. _ease-of-use:
+
+Ease of Use
+-----------
+
+{fmt} has a small self-contained code base with the core library consisting of
+just three header files and no external dependencies.
+A permissive MIT `license <https://github.com/fmtlib/fmt#license>`_ allows
+using the library both in open-source and commercial projects.
+
+`Learn more... <contents.html>`_
+
+.. raw:: html
+
+  <a class="btn btn-success" href="https://github.com/fmtlib/fmt">GitHub Repository</a>
+
+  <div class="section footer">
+    <iframe src="https://ghbtns.com/github-btn.html?user=fmtlib&amp;repo=fmt&amp;type=watch&amp;count=true"
+            class="github-btn" width="100" height="20"></iframe>
+  </div>

externals/fmt/doc/html/_sources/syntax.rst.txt

@@ -0,0 +1,514 @@
+.. _syntax:
+
+********************
+Format String Syntax
+********************
+
+Formatting functions such as :ref:`fmt::format() <format>` and
+:ref:`fmt::print() <print>` use the same format string syntax described in this
+section.
+
+Format strings contain "replacement fields" surrounded by curly braces ``{}``.
+Anything that is not contained in braces is considered literal text, which is
+copied unchanged to the output.  If you need to include a brace character in the
+literal text, it can be escaped by doubling: ``{{`` and ``}}``.
+
+The grammar for a replacement field is as follows:
+
+.. productionlist:: sf
+   replacement_field: "{" [`arg_id`] [":" (`format_spec` | `chrono_format_spec`)] "}"
+   arg_id: `integer` | `identifier`
+   integer: `digit`+
+   digit: "0"..."9"
+   identifier: `id_start` `id_continue`*
+   id_start: "a"..."z" | "A"..."Z" | "_"
+   id_continue: `id_start` | `digit`
+
+In less formal terms, the replacement field can start with an *arg_id*
+that specifies the argument whose value is to be formatted and inserted into
+the output instead of the replacement field.
+The *arg_id* is optionally followed by a *format_spec*, which is preceded by a
+colon ``':'``.  These specify a non-default format for the replacement value.
+
+See also the :ref:`formatspec` section.
+
+If the numerical arg_ids in a format string are 0, 1, 2, ... in sequence,
+they can all be omitted (not just some) and the numbers 0, 1, 2, ... will be
+automatically inserted in that order.
+
+Named arguments can be referred to by their names or indices.
+
+Some simple format string examples::
+
+   "First, thou shalt count to {0}" // References the first argument
+   "Bring me a {}"                  // Implicitly references the first argument
+   "From {} to {}"                  // Same as "From {0} to {1}"
+
+The *format_spec* field contains a specification of how the value should be
+presented, including such details as field width, alignment, padding, decimal
+precision and so on.  Each value type can define its own "formatting
+mini-language" or interpretation of the *format_spec*.
+
+Most built-in types support a common formatting mini-language, which is
+described in the next section.
+
+A *format_spec* field can also include nested replacement fields in certain
+positions within it. These nested replacement fields can contain only an
+argument id; format specifications are not allowed. This allows the formatting
+of a value to be dynamically specified.
+
+See the :ref:`formatexamples` section for some examples.
+
+.. _formatspec:
+
+Format Specification Mini-Language
+==================================
+
+"Format specifications" are used within replacement fields contained within a
+format string to define how individual values are presented (see
+:ref:`syntax`).  Each formattable type may define how the format
+specification is to be interpreted.
+
+Most built-in types implement the following options for format specifications,
+although some of the formatting options are only supported by the numeric types.
+
+The general form of a *standard format specifier* is:
+
+.. productionlist:: sf
+   format_spec: [[`fill`]`align`][`sign`]["#"]["0"][`width`]["." `precision`]["L"][`type`]
+   fill: <a character other than '{' or '}'>
+   align: "<" | ">" | "^"
+   sign: "+" | "-" | " "
+   width: `integer` | "{" [`arg_id`] "}"
+   precision: `integer` | "{" [`arg_id`] "}"
+   type: "a" | "A" | "b" | "B" | "c" | "d" | "e" | "E" | "f" | "F" | "g" | "G" |
+       : "o" | "p" | "s" | "x" | "X"
+
+The *fill* character can be any Unicode code point other than ``'{'`` or
+``'}'``. The presence of a fill character is signaled by the character following
+it, which must be one of the alignment options. If the second character of
+*format_spec* is not a valid alignment option, then it is assumed that both the
+fill character and the alignment option are absent.
+
+The meaning of the various alignment options is as follows:
+
++---------+----------------------------------------------------------+
+| Option  | Meaning                                                  |
++=========+==========================================================+
+| ``'<'`` | Forces the field to be left-aligned within the available |
+|         | space (this is the default for most objects).            |
++---------+----------------------------------------------------------+
+| ``'>'`` | Forces the field to be right-aligned within the          |
+|         | available space (this is the default for numbers).       |
++---------+----------------------------------------------------------+
+| ``'^'`` | Forces the field to be centered within the available     |
+|         | space.                                                   |
++---------+----------------------------------------------------------+
+
+Note that unless a minimum field width is defined, the field width will always
+be the same size as the data to fill it, so that the alignment option has no
+meaning in this case.
+
+The *sign* option is only valid for number types, and can be one of the
+following:
+
++---------+------------------------------------------------------------+
+| Option  | Meaning                                                    |
++=========+============================================================+
+| ``'+'`` | indicates that a sign should be used for both              |
+|         | nonnegative as well as negative numbers.                   |
++---------+------------------------------------------------------------+
+| ``'-'`` | indicates that a sign should be used only for negative     |
+|         | numbers (this is the default behavior).                    |
++---------+------------------------------------------------------------+
+| space   | indicates that a leading space should be used on           |
+|         | nonnegative numbers, and a minus sign on negative numbers. |
++---------+------------------------------------------------------------+
+
+The ``'#'`` option causes the "alternate form" to be used for the
+conversion.  The alternate form is defined differently for different
+types.  This option is only valid for integer and floating-point types.
+For integers, when binary, octal, or hexadecimal output is used, this
+option adds the prefix respective ``"0b"`` (``"0B"``), ``"0"``, or
+``"0x"`` (``"0X"``) to the output value.  Whether the prefix is
+lower-case or upper-case is determined by the case of the type
+specifier, for example, the prefix ``"0x"`` is used for the type ``'x'``
+and ``"0X"`` is used for ``'X'``.  For floating-point numbers the
+alternate form causes the result of the conversion to always contain a
+decimal-point character, even if no digits follow it. Normally, a
+decimal-point character appears in the result of these conversions
+only if a digit follows it. In addition, for ``'g'`` and ``'G'``
+conversions, trailing zeros are not removed from the result.
+
+.. ifconfig:: False
+
+   The ``','`` option signals the use of a comma for a thousands separator.
+   For a locale aware separator, use the ``'L'`` integer presentation type
+   instead.
+
+*width* is a decimal integer defining the minimum field width.  If not
+specified, then the field width will be determined by the content.
+
+Preceding the *width* field by a zero (``'0'``) character enables sign-aware
+zero-padding for numeric types. It forces the padding to be placed after the
+sign or base (if any) but before the digits. This is used for printing fields in
+the form '+000000120'. This option is only valid for numeric types and it has no
+effect on formatting of infinity and NaN.
+
+The *precision* is a decimal number indicating how many digits should be
+displayed after the decimal point for a floating-point value formatted with
+``'f'`` and ``'F'``, or before and after the decimal point for a floating-point
+value formatted with ``'g'`` or ``'G'``.  For non-number types the field
+indicates the maximum field size - in other words, how many characters will be
+used from the field content. The *precision* is not allowed for integer,
+character, Boolean, and pointer values. Note that a C string must be
+null-terminated even if precision is specified.
+
+The ``'L'`` option uses the current locale setting to insert the appropriate
+number separator characters. This option is only valid for numeric types.
+
+Finally, the *type* determines how the data should be presented.
+
+The available string presentation types are:
+
++---------+----------------------------------------------------------+
+| Type    | Meaning                                                  |
++=========+==========================================================+
+| ``'s'`` | String format. This is the default type for strings and  |
+|         | may be omitted.                                          |
++---------+----------------------------------------------------------+
+| none    | The same as ``'s'``.                                     |
++---------+----------------------------------------------------------+
+
+The available character presentation types are:
+
++---------+----------------------------------------------------------+
+| Type    | Meaning                                                  |
++=========+==========================================================+
+| ``'c'`` | Character format. This is the default type for           |
+|         | characters and may be omitted.                           |
++---------+----------------------------------------------------------+
+| none    | The same as ``'c'``.                                     |
++---------+----------------------------------------------------------+
+
+The available integer presentation types are:
+
++---------+----------------------------------------------------------+
+| Type    | Meaning                                                  |
++=========+==========================================================+
+| ``'b'`` | Binary format. Outputs the number in base 2. Using the   |
+|         | ``'#'`` option with this type adds the prefix ``"0b"``   |
+|         | to the output value.                                     |
++---------+----------------------------------------------------------+
+| ``'B'`` | Binary format. Outputs the number in base 2. Using the   |
+|         | ``'#'`` option with this type adds the prefix ``"0B"``   |
+|         | to the output value.                                     |
++---------+----------------------------------------------------------+
+| ``'c'`` | Character format. Outputs the number as a character.     |
++---------+----------------------------------------------------------+
+| ``'d'`` | Decimal integer. Outputs the number in base 10.          |
++---------+----------------------------------------------------------+
+| ``'o'`` | Octal format. Outputs the number in base 8.              |
++---------+----------------------------------------------------------+
+| ``'x'`` | Hex format. Outputs the number in base 16, using         |
+|         | lower-case letters for the digits above 9. Using the     |
+|         | ``'#'`` option with this type adds the prefix ``"0x"``   |
+|         | to the output value.                                     |
++---------+----------------------------------------------------------+
+| ``'X'`` | Hex format. Outputs the number in base 16, using         |
+|         | upper-case letters for the digits above 9. Using the     |
+|         | ``'#'`` option with this type adds the prefix ``"0X"``   |
+|         | to the output value.                                     |
++---------+----------------------------------------------------------+
+| none    | The same as ``'d'``.                                     |
++---------+----------------------------------------------------------+
+
+Integer presentation types can also be used with character and Boolean values.
+Boolean values are formatted using textual representation, either ``true`` or
+``false``, if the presentation type is not specified.
+
+The available presentation types for floating-point values are:
+
++---------+----------------------------------------------------------+
+| Type    | Meaning                                                  |
++=========+==========================================================+
+| ``'a'`` | Hexadecimal floating point format. Prints the number in  |
+|         | base 16 with prefix ``"0x"`` and lower-case letters for  |
+|         | digits above 9. Uses ``'p'`` to indicate the exponent.   |
++---------+----------------------------------------------------------+
+| ``'A'`` | Same as ``'a'`` except it uses upper-case letters for    |
+|         | the prefix, digits above 9 and to indicate the exponent. |
++---------+----------------------------------------------------------+
+| ``'e'`` | Exponent notation. Prints the number in scientific       |
+|         | notation using the letter 'e' to indicate the exponent.  |
++---------+----------------------------------------------------------+
+| ``'E'`` | Exponent notation. Same as ``'e'`` except it uses an     |
+|         | upper-case ``'E'`` as the separator character.           |
++---------+----------------------------------------------------------+
+| ``'f'`` | Fixed point. Displays the number as a fixed-point        |
+|         | number.                                                  |
++---------+----------------------------------------------------------+
+| ``'F'`` | Fixed point. Same as ``'f'``, but converts ``nan`` to    |
+|         | ``NAN`` and ``inf`` to ``INF``.                          |
++---------+----------------------------------------------------------+
+| ``'g'`` | General format.  For a given precision ``p >= 1``,       |
+|         | this rounds the number to ``p`` significant digits and   |
+|         | then formats the result in either fixed-point format     |
+|         | or in scientific notation, depending on its magnitude.   |
+|         |                                                          |
+|         | A precision of ``0`` is treated as equivalent to a       |
+|         | precision of ``1``.                                      |
++---------+----------------------------------------------------------+
+| ``'G'`` | General format. Same as ``'g'`` except switches to       |
+|         | ``'E'`` if the number gets too large. The                |
+|         | representations of infinity and NaN are uppercased, too. |
++---------+----------------------------------------------------------+
+| none    | Similar to ``'g'``, except that the default precision is |
+|         | as high as needed to represent the particular value.     |
++---------+----------------------------------------------------------+
+
+.. ifconfig:: False
+
+   +---------+----------------------------------------------------------+
+   |         | The precise rules are as follows: suppose that the       |
+   |         | result formatted with presentation type ``'e'`` and      |
+   |         | precision ``p-1`` would have exponent ``exp``.  Then     |
+   |         | if ``-4 <= exp < p``, the number is formatted            |
+   |         | with presentation type ``'f'`` and precision             |
+   |         | ``p-1-exp``.  Otherwise, the number is formatted         |
+   |         | with presentation type ``'e'`` and precision ``p-1``.    |
+   |         | In both cases insignificant trailing zeros are removed   |
+   |         | from the significand, and the decimal point is also      |
+   |         | removed if there are no remaining digits following it.   |
+   |         |                                                          |
+   |         | Positive and negative infinity, positive and negative    |
+   |         | zero, and nans, are formatted as ``inf``, ``-inf``,      |
+   |         | ``0``, ``-0`` and ``nan`` respectively, regardless of    |
+   |         | the precision.                                           |
+   |         |                                                          |
+   +---------+----------------------------------------------------------+
+
+The available presentation types for pointers are:
+
++---------+----------------------------------------------------------+
+| Type    | Meaning                                                  |
++=========+==========================================================+
+| ``'p'`` | Pointer format. This is the default type for             |
+|         | pointers and may be omitted.                             |
++---------+----------------------------------------------------------+
+| none    | The same as ``'p'``.                                     |
++---------+----------------------------------------------------------+
+
+.. _chrono-specs:
+
+Chrono Format Specifications
+============================
+
+Format specifications for chrono types and ``std::tm`` have the following
+syntax:
+
+.. productionlist:: sf
+   chrono_format_spec: [[`fill`]`align`][`width`]["." `precision`][`chrono_specs`]
+   chrono_specs: [`chrono_specs`] `conversion_spec` | `chrono_specs` `literal_char`
+   conversion_spec: "%" [`modifier`] `chrono_type`
+   literal_char: <a character other than '{', '}' or '%'>
+   modifier: "E" | "O"
+   chrono_type: "a" | "A" | "b" | "B" | "c" | "C" | "d" | "D" | "e" | "F" |
+              : "g" | "G" | "h" | "H" | "I" | "j" | "m" | "M" | "n" | "p" |
+              : "q" | "Q" | "r" | "R" | "S" | "t" | "T" | "u" | "U" | "V" |
+              : "w" | "W" | "x" | "X" | "y" | "Y" | "z" | "Z" | "%"
+
+Literal chars are copied unchanged to the output. Precision is valid only for
+``std::chrono::duration`` types with a floating-point representation type.
+
+The available presentation types (*chrono_type*) for chrono durations and time
+points are:
+
++---------+--------------------------------------------------------------------+
+| Type    | Meaning                                                            |
++=========+====================================================================+
+| ``'H'`` | The hour (24-hour clock) as a decimal number. If the result is a   |
+|         | single digit, it is prefixed with 0. The modified command ``%OH``  |
+|         | produces the locale's alternative representation.                  |
++---------+--------------------------------------------------------------------+
+| ``'M'`` | The minute as a decimal number. If the result is a single digit,   |
+|         | it is prefixed with 0. The modified command ``%OM`` produces the   |
+|         | locale's alternative representation.                               |
++---------+--------------------------------------------------------------------+
+| ``'S'`` | Seconds as a decimal number. If the number of seconds is less than |
+|         | 10, the result is prefixed with 0. If the precision of the input   |
+|         | cannot be exactly represented with seconds, then the format is a   |
+|         | decimal floating-point number with a fixed format and a precision  |
+|         | matching that of the precision of the input (or to a microseconds  |
+|         | precision if the conversion to floating-point decimal seconds      |
+|         | cannot be made within 18 fractional digits). The character for the |
+|         | decimal point is localized according to the locale. The modified   |
+|         | command ``%OS`` produces the locale's alternative representation.  |
++---------+--------------------------------------------------------------------+
+
+Specifiers that have a calendaric component such as ``'d'`` (the day of month)
+are valid only for ``std::tm`` and not durations or time points.
+
+.. range-specs:
+
+Range Format Specifications
+===========================
+
+Format specifications for range types have the following syntax:
+
+.. productionlist:: sf
+   range_format_spec: [":" [`underlying_spec`]]
+
+The `underlying_spec` is parsed based on the formatter of the range's
+reference type.
+
+By default, a range of characters or strings is printed escaped and quoted. But
+if any `underlying_spec` is provided (even if it is empty), then the characters
+or strings are printed according to the provided specification.
+
+Examples::
+
+  fmt::format("{}", std::vector{10, 20, 30});
+  // Result: [10, 20, 30]
+  fmt::format("{::#x}", std::vector{10, 20, 30});
+  // Result: [0xa, 0x14, 0x13]
+  fmt::format("{}", vector{'h', 'e', 'l', 'l', 'o'});
+  // Result: ['h', 'e', 'l', 'l', 'o']
+  fmt::format("{::}", vector{'h', 'e', 'l', 'l', 'o'});
+  // Result: [h, e, l, l, o]
+  fmt::format("{::d}", vector{'h', 'e', 'l', 'l', 'o'});
+  // Result: [104, 101, 108, 108, 111]
+
+.. _formatexamples:
+
+Format Examples
+===============
+
+This section contains examples of the format syntax and comparison with
+the printf formatting.
+
+In most of the cases the syntax is similar to the printf formatting, with the
+addition of the ``{}`` and with ``:`` used instead of ``%``.
+For example, ``"%03.2f"`` can be translated to ``"{:03.2f}"``.
+
+The new format syntax also supports new and different options, shown in the
+following examples.
+
+Accessing arguments by position::
+
+   fmt::format("{0}, {1}, {2}", 'a', 'b', 'c');
+   // Result: "a, b, c"
+   fmt::format("{}, {}, {}", 'a', 'b', 'c');
+   // Result: "a, b, c"
+   fmt::format("{2}, {1}, {0}", 'a', 'b', 'c');
+   // Result: "c, b, a"
+   fmt::format("{0}{1}{0}", "abra", "cad");  // arguments' indices can be repeated
+   // Result: "abracadabra"
+
+Aligning the text and specifying a width::
+
+   fmt::format("{:<30}", "left aligned");
+   // Result: "left aligned                  "
+   fmt::format("{:>30}", "right aligned");
+   // Result: "                 right aligned"
+   fmt::format("{:^30}", "centered");
+   // Result: "           centered           "
+   fmt::format("{:*^30}", "centered");  // use '*' as a fill char
+   // Result: "***********centered***********"
+
+Dynamic width::
+
+   fmt::format("{:<{}}", "left aligned", 30);
+   // Result: "left aligned                  "
+
+Dynamic precision::
+
+   fmt::format("{:.{}f}", 3.14, 1);
+   // Result: "3.1"
+
+Replacing ``%+f``, ``%-f``, and ``% f`` and specifying a sign::
+
+   fmt::format("{:+f}; {:+f}", 3.14, -3.14);  // show it always
+   // Result: "+3.140000; -3.140000"
+   fmt::format("{: f}; {: f}", 3.14, -3.14);  // show a space for positive numbers
+   // Result: " 3.140000; -3.140000"
+   fmt::format("{:-f}; {:-f}", 3.14, -3.14);  // show only the minus -- same as '{:f}; {:f}'
+   // Result: "3.140000; -3.140000"
+
+Replacing ``%x`` and ``%o`` and converting the value to different bases::
+
+   fmt::format("int: {0:d};  hex: {0:x};  oct: {0:o}; bin: {0:b}", 42);
+   // Result: "int: 42;  hex: 2a;  oct: 52; bin: 101010"
+   // with 0x or 0 or 0b as prefix:
+   fmt::format("int: {0:d};  hex: {0:#x};  oct: {0:#o};  bin: {0:#b}", 42);
+   // Result: "int: 42;  hex: 0x2a;  oct: 052;  bin: 0b101010"
+
+Padded hex byte with prefix and always prints both hex characters::
+
+   fmt::format("{:#04x}", 0);
+   // Result: "0x00"
+
+Box drawing using Unicode fill::
+
+   fmt::print(
+     "┌{0:─^{2}}┐\n"
+     "│{1: ^{2}}│\n"
+     "└{0:─^{2}}┘\n", "", "Hello, world!", 20);
+
+prints::
+
+   ┌────────────────────┐
+   │   Hello, world!    │
+   └────────────────────┘
+
+Using type-specific formatting::
+
+   #include <fmt/chrono.h>
+
+   auto t = tm();
+   t.tm_year = 2010 - 1900;
+   t.tm_mon = 7;
+   t.tm_mday = 4;
+   t.tm_hour = 12;
+   t.tm_min = 15;
+   t.tm_sec = 58;
+   fmt::print("{:%Y-%m-%d %H:%M:%S}", t);
+   // Prints: 2010-08-04 12:15:58
+
+Using the comma as a thousands separator::
+
+   #include <fmt/format.h>
+
+   auto s = fmt::format(std::locale("en_US.UTF-8"), "{:L}", 1234567890);
+   // s == "1,234,567,890"
+
+.. ifconfig:: False
+
+   Nesting arguments and more complex examples::
+
+      >>> for align, text in zip('<^>', ['left', 'center', 'right']):
+      ...     '{0:{fill}{align}16}") << text, fill=align, align=align)
+      ...
+      'left<<<<<<<<<<<<'
+      '^^^^^center^^^^^'
+      '>>>>>>>>>>>right'
+      >>>
+      >>> octets = [192, 168, 0, 1]
+      Format("{:02X}{:02X}{:02X}{:02X}") << *octets)
+      'C0A80001'
+      >>> int(_, 16)
+      3232235521
+      >>>
+      >>> width = 5
+      >>> for num in range(5,12):
+      ...     for base in 'dXob':
+      ...         print('{0:{width}{base}}") << num, base=base, width=width), end=' ')
+      ...     print()
+      ...
+          5     5     5   101
+          6     6     6   110
+          7     7     7   111
+          8     8    10  1000
+          9     9    11  1001
+         10     A    12  1010
+         11     B    13  1011

externals/fmt/doc/html/_sources/usage.rst.txt

@@ -0,0 +1,212 @@
+*****
+Usage
+*****
+
+To use the {fmt} library, add :file:`fmt/core.h`, :file:`fmt/format.h`,
+:file:`fmt/format-inl.h`, :file:`src/format.cc` and optionally other headers
+from a `release archive <https://github.com/fmtlib/fmt/releases/latest>`_ or
+the `Git repository <https://github.com/fmtlib/fmt>`_ to your project.
+Alternatively, you can :ref:`build the library with CMake <building>`.
+
+.. _building:
+
+Building the Library
+====================
+
+The included `CMake build script`__ can be used to build the fmt
+library on a wide range of platforms. CMake is freely available for
+download from https://www.cmake.org/download/.
+
+__ https://github.com/fmtlib/fmt/blob/master/CMakeLists.txt
+
+CMake works by generating native makefiles or project files that can
+be used in the compiler environment of your choice. The typical
+workflow starts with::
+
+  mkdir build          # Create a directory to hold the build output.
+  cd build
+  cmake ..  # Generate native build scripts.
+
+where :file:`{<path/to/fmt>}` is a path to the ``fmt`` repository.
+
+If you are on a \*nix system, you should now see a Makefile in the
+current directory. Now you can build the library by running :command:`make`.
+
+Once the library has been built you can invoke :command:`make test` to run
+the tests.
+
+You can control generation of the make ``test`` target with the ``FMT_TEST``
+CMake option. This can be useful if you include fmt as a subdirectory in
+your project but don't want to add fmt's tests to your ``test`` target.
+
+If you use Windows and have Visual Studio installed, a :file:`FMT.sln`
+file and several :file:`.vcproj` files will be created. You can then build them
+using Visual Studio or msbuild.
+
+On Mac OS X with Xcode installed, an :file:`.xcodeproj` file will be generated.
+
+To build a `shared library`__ set the ``BUILD_SHARED_LIBS`` CMake variable to
+``TRUE``::
+
+  cmake -DBUILD_SHARED_LIBS=TRUE ...
+
+__ https://en.wikipedia.org/wiki/Library_%28computing%29#Shared_libraries
+
+
+To build a `static library` with position independent code (required if the main
+consumer of the fmt library is a shared library i.e. a Python extension) set the
+``CMAKE_POSITION_INDEPENDENT_CODE`` CMake variable to ``TRUE``::
+
+  cmake -DCMAKE_POSITION_INDEPENDENT_CODE=TRUE ...
+
+
+Installing the Library
+======================
+
+After building the library you can install it on a Unix-like system by running
+:command:`sudo make install`.
+
+Usage with CMake
+================
+
+You can add the ``fmt`` library directory into your project and include it in
+your ``CMakeLists.txt`` file::
+
+   add_subdirectory(fmt)
+
+or
+
+::
+
+   add_subdirectory(fmt EXCLUDE_FROM_ALL)
+
+to exclude it from ``make``, ``make all``, or ``cmake --build .``.
+
+You can detect and use an installed version of {fmt} as follows::
+
+   find_package(fmt)
+   target_link_libraries(<your-target> fmt::fmt)
+
+Setting up your target to use a header-only version of ``fmt`` is equally easy::
+
+   target_link_libraries(<your-target> PRIVATE fmt::fmt-header-only)
+
+Usage with build2
+=================
+
+You can use `build2 <https://build2.org>`_, a dependency manager and a
+build-system combined, to use ``fmt``.
+
+Currently this package is available in these package repositories:
+
+- **https://cppget.org/fmt/** for released and published versions.
+- `The git repository with the sources of the build2 package of fmt <https://github.com/build2-packaging/fmt.git>`_
+  for unreleased or custom revisions of ``fmt``.
+
+**Usage:**
+
+- ``build2`` package name: ``fmt``
+- Library target name : ``lib{fmt}``
+
+For example, to make your ``build2`` project depend on ``fmt``:
+
+- Add one of the repositories to your configurations, or in your
+  ``repositories.manifest``, if not already there::
+
+    :
+    role: prerequisite
+    location: https://pkg.cppget.org/1/stable
+
+- Add this package as a dependency to your ``./manifest`` file
+  (example for ``v7.0.x``)::
+
+    depends: fmt ~7.0.0
+
+- Import the target and use it as a prerequisite to your own target
+  using `fmt` in the appropriate ``buildfile``::
+
+    import fmt = fmt%lib{fmt}
+    lib{mylib} : cxx{**} ... $fmt
+
+Then build your project as usual with `b` or `bdep update`.
+
+For ``build2`` newcomers or to get more details and use cases, you can read the
+``build2``
+`toolchain introduction <https://build2.org/build2-toolchain/doc/build2-toolchain-intro.xhtml>`_.
+
+Building the Documentation
+==========================
+
+To build the documentation you need the following software installed on your
+system:
+
+* `Python <https://www.python.org/>`_ with pip and virtualenv
+* `Doxygen <http://www.stack.nl/~dimitri/doxygen/>`_
+* `Less <http://lesscss.org/>`_ with ``less-plugin-clean-css``.
+  Ubuntu doesn't package the ``clean-css`` plugin so you should use ``npm``
+  instead of ``apt`` to install both ``less`` and the plugin::
+
+    sudo npm install -g less less-plugin-clean-css.
+
+First generate makefiles or project files using CMake as described in
+the previous section. Then compile the ``doc`` target/project, for example::
+
+  make doc
+
+This will generate the HTML documentation in ``doc/html``.
+
+Conda
+=====
+
+fmt can be installed on Linux, macOS and Windows with
+`Conda <https://docs.conda.io/en/latest/>`__, using its
+`conda-forge <https://conda-forge.org>`__
+`package <https://github.com/conda-forge/fmt-feedstock>`__, as follows::
+
+  conda install -c conda-forge fmt
+
+Vcpkg
+=====
+
+You can download and install fmt using the `vcpkg
+<https://github.com/Microsoft/vcpkg>`__ dependency manager::
+
+  git clone https://github.com/Microsoft/vcpkg.git
+  cd vcpkg
+  ./bootstrap-vcpkg.sh
+  ./vcpkg integrate install
+  ./vcpkg install fmt
+
+The fmt port in vcpkg is kept up to date by Microsoft team members and community
+contributors. If the version is out of date, please `create an issue or pull
+request <https://github.com/Microsoft/vcpkg>`__ on the vcpkg repository.
+
+LHelper
+=======
+
+You can download and install fmt using
+`lhelper <https://github.com/franko/lhelper>`__ dependency manager::
+
+  lhelper activate <some-environment>
+  lhelper install fmt
+
+All the recipes for lhelper are kept in the
+`lhelper's recipe <https://github.com/franko/lhelper-recipes>`__ repository.
+
+Android NDK
+===========
+
+fmt provides `Android.mk file`__ that can be used to build the library
+with `Android NDK <https://developer.android.com/tools/sdk/ndk/index.html>`_.
+For an example of using fmt with Android NDK, see the
+`android-ndk-example <https://github.com/fmtlib/android-ndk-example>`_
+repository.
+
+__ https://github.com/fmtlib/fmt/blob/master/support/Android.mk
+
+Homebrew
+========
+
+fmt can be installed on OS X using `Homebrew <https://brew.sh/>`_::
+
+  brew install fmt

externals/fmt/doc/html/_static/basic.css

@@ -0,0 +1,856 @@
+/*
+ * basic.css
+ * ~~~~~~~~~
+ *
+ * Sphinx stylesheet -- basic theme.
+ *
+ * :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS.
+ * :license: BSD, see LICENSE for details.
+ *
+ */
+
+/* -- main layout ----------------------------------------------------------- */
+
+div.clearer {
+    clear: both;
+}
+
+div.section::after {
+    display: block;
+    content: '';
+    clear: left;
+}
+
+/* -- relbar ---------------------------------------------------------------- */
+
+div.related {
+    width: 100%;
+    font-size: 90%;
+}
+
+div.related h3 {
+    display: none;
+}
+
+div.related ul {
+    margin: 0;
+    padding: 0 0 0 10px;
+    list-style: none;
+}
+
+div.related li {
+    display: inline;
+}
+
+div.related li.right {
+    float: right;
+    margin-right: 5px;
+}
+
+/* -- sidebar --------------------------------------------------------------- */
+
+div.sphinxsidebarwrapper {
+    padding: 10px 5px 0 10px;
+}
+
+div.sphinxsidebar {
+    float: left;
+    width: 230px;
+    margin-left: -100%;
+    font-size: 90%;
+    word-wrap: break-word;
+    overflow-wrap : break-word;
+}
+
+div.sphinxsidebar ul {
+    list-style: none;
+}
+
+div.sphinxsidebar ul ul,
+div.sphinxsidebar ul.want-points {
+    margin-left: 20px;
+    list-style: square;
+}
+
+div.sphinxsidebar ul ul {
+    margin-top: 0;
+    margin-bottom: 0;
+}
+
+div.sphinxsidebar form {
+    margin-top: 10px;
+}
+
+div.sphinxsidebar input {
+    border: 1px solid #98dbcc;
+    font-family: sans-serif;
+    font-size: 1em;
+}
+
+div.sphinxsidebar #searchbox form.search {
+    overflow: hidden;
+}
+
+div.sphinxsidebar #searchbox input[type="text"] {
+    float: left;
+    width: 80%;
+    padding: 0.25em;
+    box-sizing: border-box;
+}
+
+div.sphinxsidebar #searchbox input[type="submit"] {
+    float: left;
+    width: 20%;
+    border-left: none;
+    padding: 0.25em;
+    box-sizing: border-box;
+}
+
+
+img {
+    border: 0;
+    max-width: 100%;
+}
+
+/* -- search page ----------------------------------------------------------- */
+
+ul.search {
+    margin: 10px 0 0 20px;
+    padding: 0;
+}
+
+ul.search li {
+    padding: 5px 0 5px 20px;
+    background-image: url(file.png);
+    background-repeat: no-repeat;
+    background-position: 0 7px;
+}
+
+ul.search li a {
+    font-weight: bold;
+}
+
+ul.search li div.context {
+    color: #888;
+    margin: 2px 0 0 30px;
+    text-align: left;
+}
+
+ul.keywordmatches li.goodmatch a {
+    font-weight: bold;
+}
+
+/* -- index page ------------------------------------------------------------ */
+
+table.contentstable {
+    width: 90%;
+    margin-left: auto;
+    margin-right: auto;
+}
+
+table.contentstable p.biglink {
+    line-height: 150%;
+}
+
+a.biglink {
+    font-size: 1.3em;
+}
+
+span.linkdescr {
+    font-style: italic;
+    padding-top: 5px;
+    font-size: 90%;
+}
+
+/* -- general index --------------------------------------------------------- */
+
+table.indextable {
+    width: 100%;
+}
+
+table.indextable td {
+    text-align: left;
+    vertical-align: top;
+}
+
+table.indextable ul {
+    margin-top: 0;
+    margin-bottom: 0;
+    list-style-type: none;
+}
+
+table.indextable > tbody > tr > td > ul {
+    padding-left: 0em;
+}
+
+table.indextable tr.pcap {
+    height: 10px;
+}
+
+table.indextable tr.cap {
+    margin-top: 10px;
+    background-color: #f2f2f2;
+}
+
+img.toggler {
+    margin-right: 3px;
+    margin-top: 3px;
+    cursor: pointer;
+}
+
+div.modindex-jumpbox {
+    border-top: 1px solid #ddd;
+    border-bottom: 1px solid #ddd;
+    margin: 1em 0 1em 0;
+    padding: 0.4em;
+}
+
+div.genindex-jumpbox {
+    border-top: 1px solid #ddd;
+    border-bottom: 1px solid #ddd;
+    margin: 1em 0 1em 0;
+    padding: 0.4em;
+}
+
+/* -- domain module index --------------------------------------------------- */
+
+table.modindextable td {
+    padding: 2px;
+    border-collapse: collapse;
+}
+
+/* -- general body styles --------------------------------------------------- */
+
+div.body {
+    min-width: 450px;
+    max-width: 800px;
+}
+
+div.body p, div.body dd, div.body li, div.body blockquote {
+    -moz-hyphens: auto;
+    -ms-hyphens: auto;
+    -webkit-hyphens: auto;
+    hyphens: auto;
+}
+
+a.headerlink {
+    visibility: hidden;
+}
+
+a.brackets:before,
+span.brackets > a:before{
+    content: "[";
+}
+
+a.brackets:after,
+span.brackets > a:after {
+    content: "]";
+}
+
+h1:hover > a.headerlink,
+h2:hover > a.headerlink,
+h3:hover > a.headerlink,
+h4:hover > a.headerlink,
+h5:hover > a.headerlink,
+h6:hover > a.headerlink,
+dt:hover > a.headerlink,
+caption:hover > a.headerlink,
+p.caption:hover > a.headerlink,
+div.code-block-caption:hover > a.headerlink {
+    visibility: visible;
+}
+
+div.body p.caption {
+    text-align: inherit;
+}
+
+div.body td {
+    text-align: left;
+}
+
+.first {
+    margin-top: 0 !important;
+}
+
+p.rubric {
+    margin-top: 30px;
+    font-weight: bold;
+}
+
+img.align-left, .figure.align-left, object.align-left {
+    clear: left;
+    float: left;
+    margin-right: 1em;
+}
+
+img.align-right, .figure.align-right, object.align-right {
+    clear: right;
+    float: right;
+    margin-left: 1em;
+}
+
+img.align-center, .figure.align-center, object.align-center {
+  display: block;
+  margin-left: auto;
+  margin-right: auto;
+}
+
+img.align-default, .figure.align-default {
+  display: block;
+  margin-left: auto;
+  margin-right: auto;
+}
+
+.align-left {
+    text-align: left;
+}
+
+.align-center {
+    text-align: center;
+}
+
+.align-default {
+    text-align: center;
+}
+
+.align-right {
+    text-align: right;
+}
+
+/* -- sidebars -------------------------------------------------------------- */
+
+div.sidebar {
+    margin: 0 0 0.5em 1em;
+    border: 1px solid #ddb;
+    padding: 7px;
+    background-color: #ffe;
+    width: 40%;
+    float: right;
+    clear: right;
+    overflow-x: auto;
+}
+
+p.sidebar-title {
+    font-weight: bold;
+}
+
+div.admonition, div.topic, blockquote {
+    clear: left;
+}
+
+/* -- topics ---------------------------------------------------------------- */
+
+div.topic {
+    border: 1px solid #ccc;
+    padding: 7px;
+    margin: 10px 0 10px 0;
+}
+
+p.topic-title {
+    font-size: 1.1em;
+    font-weight: bold;
+    margin-top: 10px;
+}
+
+/* -- admonitions ----------------------------------------------------------- */
+
+div.admonition {
+    margin-top: 10px;
+    margin-bottom: 10px;
+    padding: 7px;
+}
+
+div.admonition dt {
+    font-weight: bold;
+}
+
+p.admonition-title {
+    margin: 0px 10px 5px 0px;
+    font-weight: bold;
+}
+
+div.body p.centered {
+    text-align: center;
+    margin-top: 25px;
+}
+
+/* -- content of sidebars/topics/admonitions -------------------------------- */
+
+div.sidebar > :last-child,
+div.topic > :last-child,
+div.admonition > :last-child {
+    margin-bottom: 0;
+}
+
+div.sidebar::after,
+div.topic::after,
+div.admonition::after,
+blockquote::after {
+    display: block;
+    content: '';
+    clear: both;
+}
+
+/* -- tables ---------------------------------------------------------------- */
+
+table.docutils {
+    margin-top: 10px;
+    margin-bottom: 10px;
+    border: 0;
+    border-collapse: collapse;
+}
+
+table.align-center {
+    margin-left: auto;
+    margin-right: auto;
+}
+
+table.align-default {
+    margin-left: auto;
+    margin-right: auto;
+}
+
+table caption span.caption-number {
+    font-style: italic;
+}
+
+table caption span.caption-text {
+}
+
+table.docutils td, table.docutils th {
+    padding: 1px 8px 1px 5px;
+    border-top: 0;
+    border-left: 0;
+    border-right: 0;
+    border-bottom: 1px solid #aaa;
+}
+
+table.footnote td, table.footnote th {
+    border: 0 !important;
+}
+
+th {
+    text-align: left;
+    padding-right: 5px;
+}
+
+table.citation {
+    border-left: solid 1px gray;
+    margin-left: 1px;
+}
+
+table.citation td {
+    border-bottom: none;
+}
+
+th > :first-child,
+td > :first-child {
+    margin-top: 0px;
+}
+
+th > :last-child,
+td > :last-child {
+    margin-bottom: 0px;
+}
+
+/* -- figures --------------------------------------------------------------- */
+
+div.figure {
+    margin: 0.5em;
+    padding: 0.5em;
+}
+
+div.figure p.caption {
+    padding: 0.3em;
+}
+
+div.figure p.caption span.caption-number {
+    font-style: italic;
+}
+
+div.figure p.caption span.caption-text {
+}
+
+/* -- field list styles ----------------------------------------------------- */
+
+table.field-list td, table.field-list th {
+    border: 0 !important;
+}
+
+.field-list ul {
+    margin: 0;
+    padding-left: 1em;
+}
+
+.field-list p {
+    margin: 0;
+}
+
+.field-name {
+    -moz-hyphens: manual;
+    -ms-hyphens: manual;
+    -webkit-hyphens: manual;
+    hyphens: manual;
+}
+
+/* -- hlist styles ---------------------------------------------------------- */
+
+table.hlist {
+    margin: 1em 0;
+}
+
+table.hlist td {
+    vertical-align: top;
+}
+
+
+/* -- other body styles ----------------------------------------------------- */
+
+ol.arabic {
+    list-style: decimal;
+}
+
+ol.loweralpha {
+    list-style: lower-alpha;
+}
+
+ol.upperalpha {
+    list-style: upper-alpha;
+}
+
+ol.lowerroman {
+    list-style: lower-roman;
+}
+
+ol.upperroman {
+    list-style: upper-roman;
+}
+
+:not(li) > ol > li:first-child > :first-child,
+:not(li) > ul > li:first-child > :first-child {
+    margin-top: 0px;
+}
+
+:not(li) > ol > li:last-child > :last-child,
+:not(li) > ul > li:last-child > :last-child {
+    margin-bottom: 0px;
+}
+
+ol.simple ol p,
+ol.simple ul p,
+ul.simple ol p,
+ul.simple ul p {
+    margin-top: 0;
+}
+
+ol.simple > li:not(:first-child) > p,
+ul.simple > li:not(:first-child) > p {
+    margin-top: 0;
+}
+
+ol.simple p,
+ul.simple p {
+    margin-bottom: 0;
+}
+
+dl.footnote > dt,
+dl.citation > dt {
+    float: left;
+    margin-right: 0.5em;
+}
+
+dl.footnote > dd,
+dl.citation > dd {
+    margin-bottom: 0em;
+}
+
+dl.footnote > dd:after,
+dl.citation > dd:after {
+    content: "";
+    clear: both;
+}
+
+dl.field-list {
+    display: grid;
+    grid-template-columns: fit-content(30%) auto;
+}
+
+dl.field-list > dt {
+    font-weight: bold;
+    word-break: break-word;
+    padding-left: 0.5em;
+    padding-right: 5px;
+}
+
+dl.field-list > dt:after {
+    content: ":";
+}
+
+dl.field-list > dd {
+    padding-left: 0.5em;
+    margin-top: 0em;
+    margin-left: 0em;
+    margin-bottom: 0em;
+}
+
+dl {
+    margin-bottom: 15px;
+}
+
+dd > :first-child {
+    margin-top: 0px;
+}
+
+dd ul, dd table {
+    margin-bottom: 10px;
+}
+
+dd {
+    margin-top: 3px;
+    margin-bottom: 10px;
+    margin-left: 30px;
+}
+
+dl > dd:last-child,
+dl > dd:last-child > :last-child {
+    margin-bottom: 0;
+}
+
+dt:target, span.highlighted {
+    background-color: #fbe54e;
+}
+
+rect.highlighted {
+    fill: #fbe54e;
+}
+
+dl.glossary dt {
+    font-weight: bold;
+    font-size: 1.1em;
+}
+
+.optional {
+    font-size: 1.3em;
+}
+
+.sig-paren {
+    font-size: larger;
+}
+
+.versionmodified {
+    font-style: italic;
+}
+
+.system-message {
+    background-color: #fda;
+    padding: 5px;
+    border: 3px solid red;
+}
+
+.footnote:target  {
+    background-color: #ffa;
+}
+
+.line-block {
+    display: block;
+    margin-top: 1em;
+    margin-bottom: 1em;
+}
+
+.line-block .line-block {
+    margin-top: 0;
+    margin-bottom: 0;
+    margin-left: 1.5em;
+}
+
+.guilabel, .menuselection {
+    font-family: sans-serif;
+}
+
+.accelerator {
+    text-decoration: underline;
+}
+
+.classifier {
+    font-style: oblique;
+}
+
+.classifier:before {
+    font-style: normal;
+    margin: 0.5em;
+    content: ":";
+}
+
+abbr, acronym {
+    border-bottom: dotted 1px;
+    cursor: help;
+}
+
+/* -- code displays --------------------------------------------------------- */
+
+pre {
+    overflow: auto;
+    overflow-y: hidden;  /* fixes display issues on Chrome browsers */
+}
+
+pre, div[class*="highlight-"] {
+    clear: both;
+}
+
+span.pre {
+    -moz-hyphens: none;
+    -ms-hyphens: none;
+    -webkit-hyphens: none;
+    hyphens: none;
+}
+
+div[class*="highlight-"] {
+    margin: 1em 0;
+}
+
+td.linenos pre {
+    border: 0;
+    background-color: transparent;
+    color: #aaa;
+}
+
+table.highlighttable {
+    display: block;
+}
+
+table.highlighttable tbody {
+    display: block;
+}
+
+table.highlighttable tr {
+    display: flex;
+}
+
+table.highlighttable td {
+    margin: 0;
+    padding: 0;
+}
+
+table.highlighttable td.linenos {
+    padding-right: 0.5em;
+}
+
+table.highlighttable td.code {
+    flex: 1;
+    overflow: hidden;
+}
+
+.highlight .hll {
+    display: block;
+}
+
+div.highlight pre,
+table.highlighttable pre {
+    margin: 0;
+}
+
+div.code-block-caption + div {
+    margin-top: 0;
+}
+
+div.code-block-caption {
+    margin-top: 1em;
+    padding: 2px 5px;
+    font-size: small;
+}
+
+div.code-block-caption code {
+    background-color: transparent;
+}
+
+table.highlighttable td.linenos,
+span.linenos,
+div.doctest > div.highlight span.gp {  /* gp: Generic.Prompt */
+    user-select: none;
+}
+
+div.code-block-caption span.caption-number {
+    padding: 0.1em 0.3em;
+    font-style: italic;
+}
+
+div.code-block-caption span.caption-text {
+}
+
+div.literal-block-wrapper {
+    margin: 1em 0;
+}
+
+code.descname {
+    background-color: transparent;
+    font-weight: bold;
+    font-size: 1.2em;
+}
+
+code.descclassname {
+    background-color: transparent;
+}
+
+code.xref, a code {
+    background-color: transparent;
+    font-weight: bold;
+}
+
+h1 code, h2 code, h3 code, h4 code, h5 code, h6 code {
+    background-color: transparent;
+}
+
+.viewcode-link {
+    float: right;
+}
+
+.viewcode-back {
+    float: right;
+    font-family: sans-serif;
+}
+
+div.viewcode-block:target {
+    margin: -1px -10px;
+    padding: 0 10px;
+}
+
+/* -- math display ---------------------------------------------------------- */
+
+img.math {
+    vertical-align: middle;
+}
+
+div.body div.math p {
+    text-align: center;
+}
+
+span.eqno {
+    float: right;
+}
+
+span.eqno a.headerlink {
+    position: absolute;
+    z-index: 1;
+}
+
+div.math:hover a.headerlink {
+    visibility: visible;
+}
+
+/* -- printout stylesheet --------------------------------------------------- */
+
+@media print {
+    div.document,
+    div.documentwrapper,
+    div.bodywrapper {
+        margin: 0 !important;
+        width: 100%;
+    }
+
+    div.sphinxsidebar,
+    div.related,
+    div.footer,
+    #top-link {
+        display: none;
+    }
+}

externals/fmt/doc/html/_static/doctools.js

@@ -0,0 +1,316 @@
+/*
+ * doctools.js
+ * ~~~~~~~~~~~
+ *
+ * Sphinx JavaScript utilities for all documentation.
+ *
+ * :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS.
+ * :license: BSD, see LICENSE for details.
+ *
+ */
+
+/**
+ * select a different prefix for underscore
+ */
+$u = _.noConflict();
+
+/**
+ * make the code below compatible with browsers without
+ * an installed firebug like debugger
+if (!window.console || !console.firebug) {
+  var names = ["log", "debug", "info", "warn", "error", "assert", "dir",
+    "dirxml", "group", "groupEnd", "time", "timeEnd", "count", "trace",
+    "profile", "profileEnd"];
+  window.console = {};
+  for (var i = 0; i < names.length; ++i)
+    window.console[names[i]] = function() {};
+}
+ */
+
+/**
+ * small helper function to urldecode strings
+ */
+jQuery.urldecode = function(x) {
+  return decodeURIComponent(x).replace(/\+/g, ' ');
+};
+
+/**
+ * small helper function to urlencode strings
+ */
+jQuery.urlencode = encodeURIComponent;
+
+/**
+ * This function returns the parsed url parameters of the
+ * current request. Multiple values per key are supported,
+ * it will always return arrays of strings for the value parts.
+ */
+jQuery.getQueryParameters = function(s) {
+  if (typeof s === 'undefined')
+    s = document.location.search;
+  var parts = s.substr(s.indexOf('?') + 1).split('&');
+  var result = {};
+  for (var i = 0; i < parts.length; i++) {
+    var tmp = parts[i].split('=', 2);
+    var key = jQuery.urldecode(tmp[0]);
+    var value = jQuery.urldecode(tmp[1]);
+    if (key in result)
+      result[key].push(value);
+    else
+      result[key] = [value];
+  }
+  return result;
+};
+
+/**
+ * highlight a given string on a jquery object by wrapping it in
+ * span elements with the given class name.
+ */
+jQuery.fn.highlightText = function(text, className) {
+  function highlight(node, addItems) {
+    if (node.nodeType === 3) {
+      var val = node.nodeValue;
+      var pos = val.toLowerCase().indexOf(text);
+      if (pos >= 0 &&
+          !jQuery(node.parentNode).hasClass(className) &&
+          !jQuery(node.parentNode).hasClass("nohighlight")) {
+        var span;
+        var isInSVG = jQuery(node).closest("body, svg, foreignObject").is("svg");
+        if (isInSVG) {
+          span = document.createElementNS("http://www.w3.org/2000/svg", "tspan");
+        } else {
+          span = document.createElement("span");
+          span.className = className;
+        }
+        span.appendChild(document.createTextNode(val.substr(pos, text.length)));
+        node.parentNode.insertBefore(span, node.parentNode.insertBefore(
+          document.createTextNode(val.substr(pos + text.length)),
+          node.nextSibling));
+        node.nodeValue = val.substr(0, pos);
+        if (isInSVG) {
+          var rect = document.createElementNS("http://www.w3.org/2000/svg", "rect");
+          var bbox = node.parentElement.getBBox();
+          rect.x.baseVal.value = bbox.x;
+          rect.y.baseVal.value = bbox.y;
+          rect.width.baseVal.value = bbox.width;
+          rect.height.baseVal.value = bbox.height;
+          rect.setAttribute('class', className);
+          addItems.push({
+              "parent": node.parentNode,
+              "target": rect});
+        }
+      }
+    }
+    else if (!jQuery(node).is("button, select, textarea")) {
+      jQuery.each(node.childNodes, function() {
+        highlight(this, addItems);
+      });
+    }
+  }
+  var addItems = [];
+  var result = this.each(function() {
+    highlight(this, addItems);
+  });
+  for (var i = 0; i < addItems.length; ++i) {
+    jQuery(addItems[i].parent).before(addItems[i].target);
+  }
+  return result;
+};
+
+/*
+ * backward compatibility for jQuery.browser
+ * This will be supported until firefox bug is fixed.
+ */
+if (!jQuery.browser) {
+  jQuery.uaMatch = function(ua) {
+    ua = ua.toLowerCase();
+
+    var match = /(chrome)[ \/]([\w.]+)/.exec(ua) ||
+      /(webkit)[ \/]([\w.]+)/.exec(ua) ||
+      /(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) ||
+      /(msie) ([\w.]+)/.exec(ua) ||
+      ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) ||
+      [];
+
+    return {
+      browser: match[ 1 ] || "",
+      version: match[ 2 ] || "0"
+    };
+  };
+  jQuery.browser = {};
+  jQuery.browser[jQuery.uaMatch(navigator.userAgent).browser] = true;
+}
+
+/**
+ * Small JavaScript module for the documentation.
+ */
+var Documentation = {
+
+  init : function() {
+    this.fixFirefoxAnchorBug();
+    this.highlightSearchWords();
+    this.initIndexTable();
+    if (DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) {
+      this.initOnKeyListeners();
+    }
+  },
+
+  /**
+   * i18n support
+   */
+  TRANSLATIONS : {},
+  PLURAL_EXPR : function(n) { return n === 1 ? 0 : 1; },
+  LOCALE : 'unknown',
+
+  // gettext and ngettext don't access this so that the functions
+  // can safely bound to a different name (_ = Documentation.gettext)
+  gettext : function(string) {
+    var translated = Documentation.TRANSLATIONS[string];
+    if (typeof translated === 'undefined')
+      return string;
+    return (typeof translated === 'string') ? translated : translated[0];
+  },
+
+  ngettext : function(singular, plural, n) {
+    var translated = Documentation.TRANSLATIONS[singular];
+    if (typeof translated === 'undefined')
+      return (n == 1) ? singular : plural;
+    return translated[Documentation.PLURALEXPR(n)];
+  },
+
+  addTranslations : function(catalog) {
+    for (var key in catalog.messages)
+      this.TRANSLATIONS[key] = catalog.messages[key];
+    this.PLURAL_EXPR = new Function('n', 'return +(' + catalog.plural_expr + ')');
+    this.LOCALE = catalog.locale;
+  },
+
+  /**
+   * add context elements like header anchor links
+   */
+  addContextElements : function() {
+    $('div[id] > :header:first').each(function() {
+      $('<a class="headerlink">\u00B6</a>').
+      attr('href', '#' + this.id).
+      attr('title', _('Permalink to this headline')).
+      appendTo(this);
+    });
+    $('dt[id]').each(function() {
+      $('<a class="headerlink">\u00B6</a>').
+      attr('href', '#' + this.id).
+      attr('title', _('Permalink to this definition')).
+      appendTo(this);
+    });
+  },
+
+  /**
+   * workaround a firefox stupidity
+   * see: https://bugzilla.mozilla.org/show_bug.cgi?id=645075
+   */
+  fixFirefoxAnchorBug : function() {
+    if (document.location.hash && $.browser.mozilla)
+      window.setTimeout(function() {
+        document.location.href += '';
+      }, 10);
+  },
+
+  /**
+   * highlight the search words provided in the url in the text
+   */
+  highlightSearchWords : function() {
+    var params = $.getQueryParameters();
+    var terms = (params.highlight) ? params.highlight[0].split(/\s+/) : [];
+    if (terms.length) {
+      var body = $('div.body');
+      if (!body.length) {
+        body = $('body');
+      }
+      window.setTimeout(function() {
+        $.each(terms, function() {
+          body.highlightText(this.toLowerCase(), 'highlighted');
+        });
+      }, 10);
+      $('<p class="highlight-link"><a href="javascript:Documentation.' +
+        'hideSearchWords()">' + _('Hide Search Matches') + '</a></p>')
+          .appendTo($('#searchbox'));
+    }
+  },
+
+  /**
+   * init the domain index toggle buttons
+   */
+  initIndexTable : function() {
+    var togglers = $('img.toggler').click(function() {
+      var src = $(this).attr('src');
+      var idnum = $(this).attr('id').substr(7);
+      $('tr.cg-' + idnum).toggle();
+      if (src.substr(-9) === 'minus.png')
+        $(this).attr('src', src.substr(0, src.length-9) + 'plus.png');
+      else
+        $(this).attr('src', src.substr(0, src.length-8) + 'minus.png');
+    }).css('display', '');
+    if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) {
+        togglers.click();
+    }
+  },
+
+  /**
+   * helper function to hide the search marks again
+   */
+  hideSearchWords : function() {
+    $('#searchbox .highlight-link').fadeOut(300);
+    $('span.highlighted').removeClass('highlighted');
+  },
+
+  /**
+   * make the url absolute
+   */
+  makeURL : function(relativeURL) {
+    return DOCUMENTATION_OPTIONS.URL_ROOT + '/' + relativeURL;
+  },
+
+  /**
+   * get the current relative url
+   */
+  getCurrentURL : function() {
+    var path = document.location.pathname;
+    var parts = path.split(/\//);
+    $.each(DOCUMENTATION_OPTIONS.URL_ROOT.split(/\//), function() {
+      if (this === '..')
+        parts.pop();
+    });
+    var url = parts.join('/');
+    return path.substring(url.lastIndexOf('/') + 1, path.length - 1);
+  },
+
+  initOnKeyListeners: function() {
+    $(document).keydown(function(event) {
+      var activeElementType = document.activeElement.tagName;
+      // don't navigate when in search box, textarea, dropdown or button
+      if (activeElementType !== 'TEXTAREA' && activeElementType !== 'INPUT' && activeElementType !== 'SELECT'
+          && activeElementType !== 'BUTTON' && !event.altKey && !event.ctrlKey && !event.metaKey
+          && !event.shiftKey) {
+        switch (event.keyCode) {
+          case 37: // left
+            var prevHref = $('link[rel="prev"]').prop('href');
+            if (prevHref) {
+              window.location.href = prevHref;
+              return false;
+            }
+          case 39: // right
+            var nextHref = $('link[rel="next"]').prop('href');
+            if (nextHref) {
+              window.location.href = nextHref;
+              return false;
+            }
+        }
+      }
+    });
+  }
+};
+
+// quick alias for translations
+_ = Documentation.gettext;
+
+$(document).ready(function() {
+  Documentation.init();
+});

externals/fmt/doc/html/_static/documentation_options.js

@@ -0,0 +1,12 @@
+var DOCUMENTATION_OPTIONS = {
+    URL_ROOT: document.getElementById("documentation_options").getAttribute('data-url_root'),
+    VERSION: '9.1.0',
+    LANGUAGE: 'None',
+    COLLAPSE_INDEX: false,
+    BUILDER: 'html',
+    FILE_SUFFIX: '.html',
+    LINK_SUFFIX: '.html',
+    HAS_SOURCE: true,
+    SOURCELINK_SUFFIX: '.txt',
+    NAVIGATION_WITH_KEYS: false
+};

externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.svg

@@ -0,0 +1,229 @@
+<?xml version="1.0" standalone="no"?>
+<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
+<svg xmlns="http://www.w3.org/2000/svg">
+<metadata></metadata>
+<defs>
+<font id="glyphicons_halflingsregular" horiz-adv-x="1200" >
+<font-face units-per-em="1200" ascent="960" descent="-240" />
+<missing-glyph horiz-adv-x="500" />
+<glyph />
+<glyph />
+<glyph unicode="&#xd;" />
+<glyph unicode=" " />
+<glyph unicode="*" d="M100 500v200h259l-183 183l141 141l183 -183v259h200v-259l183 183l141 -141l-183 -183h259v-200h-259l183 -183l-141 -141l-183 183v-259h-200v259l-183 -183l-141 141l183 183h-259z" />
+<glyph unicode="+" d="M0 400v300h400v400h300v-400h400v-300h-400v-400h-300v400h-400z" />
+<glyph unicode="&#xa0;" />
+<glyph unicode="&#x2000;" horiz-adv-x="652" />
+<glyph unicode="&#x2001;" horiz-adv-x="1304" />
+<glyph unicode="&#x2002;" horiz-adv-x="652" />
+<glyph unicode="&#x2003;" horiz-adv-x="1304" />
+<glyph unicode="&#x2004;" horiz-adv-x="434" />
+<glyph unicode="&#x2005;" horiz-adv-x="326" />
+<glyph unicode="&#x2006;" horiz-adv-x="217" />
+<glyph unicode="&#x2007;" horiz-adv-x="217" />
+<glyph unicode="&#x2008;" horiz-adv-x="163" />
+<glyph unicode="&#x2009;" horiz-adv-x="260" />
+<glyph unicode="&#x200a;" horiz-adv-x="72" />
+<glyph unicode="&#x202f;" horiz-adv-x="260" />
+<glyph unicode="&#x205f;" horiz-adv-x="326" />
+<glyph unicode="&#x20ac;" d="M100 500l100 100h113q0 47 5 100h-218l100 100h135q37 167 112 257q117 141 297 141q242 0 354 -189q60 -103 66 -209h-181q0 55 -25.5 99t-63.5 68t-75 36.5t-67 12.5q-24 0 -52.5 -10t-62.5 -32t-65.5 -67t-50.5 -107h379l-100 -100h-300q-6 -46 -6 -100h406l-100 -100 h-300q9 -74 33 -132t52.5 -91t62 -54.5t59 -29t46.5 -7.5q29 0 66 13t75 37t63.5 67.5t25.5 96.5h174q-31 -172 -128 -278q-107 -117 -274 -117q-205 0 -324 158q-36 46 -69 131.5t-45 205.5h-217z" />
+<glyph unicode="&#x2212;" d="M200 400h900v300h-900v-300z" />
+<glyph unicode="&#x25fc;" horiz-adv-x="500" d="M0 0z" />
+<glyph unicode="&#x2601;" d="M-14 494q0 -80 56.5 -137t135.5 -57h750q120 0 205 86.5t85 207.5t-85 207t-205 86q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5z" />
+<glyph unicode="&#x2709;" d="M0 100l400 400l200 -200l200 200l400 -400h-1200zM0 300v600l300 -300zM0 1100l600 -603l600 603h-1200zM900 600l300 300v-600z" />
+<glyph unicode="&#x270f;" d="M-13 -13l333 112l-223 223zM187 403l214 -214l614 614l-214 214zM887 1103l214 -214l99 92q13 13 13 32.5t-13 33.5l-153 153q-15 13 -33 13t-33 -13z" />
+<glyph unicode="&#xe001;" d="M0 1200h1200l-500 -550v-550h300v-100h-800v100h300v550z" />
+<glyph unicode="&#xe002;" d="M14 84q18 -55 86 -75.5t147 5.5q65 21 109 69t44 90v606l600 155v-521q-64 16 -138 -7q-79 -26 -122.5 -83t-25.5 -111q18 -55 86 -75.5t147 4.5q70 23 111.5 63.5t41.5 95.5v881q0 10 -7 15.5t-17 2.5l-752 -193q-10 -3 -17 -12.5t-7 -19.5v-689q-64 17 -138 -7 q-79 -25 -122.5 -82t-25.5 -112z" />
+<glyph unicode="&#xe003;" d="M23 693q0 200 142 342t342 142t342 -142t142 -342q0 -142 -78 -261l300 -300q7 -8 7 -18t-7 -18l-109 -109q-8 -7 -18 -7t-18 7l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 693q0 -136 97 -233t234 -97t233.5 96.5t96.5 233.5t-96.5 233.5t-233.5 96.5 t-234 -97t-97 -233z" />
+<glyph unicode="&#xe005;" d="M100 784q0 64 28 123t73 100.5t104.5 64t119 20.5t120 -38.5t104.5 -104.5q48 69 109.5 105t121.5 38t118.5 -20.5t102.5 -64t71 -100.5t27 -123q0 -57 -33.5 -117.5t-94 -124.5t-126.5 -127.5t-150 -152.5t-146 -174q-62 85 -145.5 174t-149.5 152.5t-126.5 127.5 t-94 124.5t-33.5 117.5z" />
+<glyph unicode="&#xe006;" d="M-72 800h479l146 400h2l146 -400h472l-382 -278l145 -449l-384 275l-382 -275l146 447zM168 71l2 1z" />
+<glyph unicode="&#xe007;" d="M-72 800h479l146 400h2l146 -400h472l-382 -278l145 -449l-384 275l-382 -275l146 447zM168 71l2 1zM237 700l196 -142l-73 -226l192 140l195 -141l-74 229l193 140h-235l-77 211l-78 -211h-239z" />
+<glyph unicode="&#xe008;" d="M0 0v143l400 257v100q-37 0 -68.5 74.5t-31.5 125.5v200q0 124 88 212t212 88t212 -88t88 -212v-200q0 -51 -31.5 -125.5t-68.5 -74.5v-100l400 -257v-143h-1200z" />
+<glyph unicode="&#xe009;" d="M0 0v1100h1200v-1100h-1200zM100 100h100v100h-100v-100zM100 300h100v100h-100v-100zM100 500h100v100h-100v-100zM100 700h100v100h-100v-100zM100 900h100v100h-100v-100zM300 100h600v400h-600v-400zM300 600h600v400h-600v-400zM1000 100h100v100h-100v-100z M1000 300h100v100h-100v-100zM1000 500h100v100h-100v-100zM1000 700h100v100h-100v-100zM1000 900h100v100h-100v-100z" />
+<glyph unicode="&#xe010;" d="M0 50v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5zM0 650v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5zM600 50v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5zM600 650v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400 q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5z" />
+<glyph unicode="&#xe011;" d="M0 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM0 450v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200 q-21 0 -35.5 14.5t-14.5 35.5zM0 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5 t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 450v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5 v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 450v200q0 21 14.5 35.5t35.5 14.5h200 q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5z" />
+<glyph unicode="&#xe012;" d="M0 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM0 450q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v200q0 21 -14.5 35.5t-35.5 14.5h-200q-21 0 -35.5 -14.5 t-14.5 -35.5v-200zM0 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 50v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5 t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5zM400 450v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5zM400 850v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5 v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5z" />
+<glyph unicode="&#xe013;" d="M29 454l419 -420l818 820l-212 212l-607 -607l-206 207z" />
+<glyph unicode="&#xe014;" d="M106 318l282 282l-282 282l212 212l282 -282l282 282l212 -212l-282 -282l282 -282l-212 -212l-282 282l-282 -282z" />
+<glyph unicode="&#xe015;" d="M23 693q0 200 142 342t342 142t342 -142t142 -342q0 -142 -78 -261l300 -300q7 -8 7 -18t-7 -18l-109 -109q-8 -7 -18 -7t-18 7l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 693q0 -136 97 -233t234 -97t233.5 96.5t96.5 233.5t-96.5 233.5t-233.5 96.5 t-234 -97t-97 -233zM300 600v200h100v100h200v-100h100v-200h-100v-100h-200v100h-100z" />
+<glyph unicode="&#xe016;" d="M23 694q0 200 142 342t342 142t342 -142t142 -342q0 -141 -78 -262l300 -299q7 -7 7 -18t-7 -18l-109 -109q-8 -8 -18 -8t-18 8l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 694q0 -136 97 -233t234 -97t233.5 97t96.5 233t-96.5 233t-233.5 97t-234 -97 t-97 -233zM300 601h400v200h-400v-200z" />
+<glyph unicode="&#xe017;" d="M23 600q0 183 105 331t272 210v-166q-103 -55 -165 -155t-62 -220q0 -177 125 -302t302 -125t302 125t125 302q0 120 -62 220t-165 155v166q167 -62 272 -210t105 -331q0 -118 -45.5 -224.5t-123 -184t-184 -123t-224.5 -45.5t-224.5 45.5t-184 123t-123 184t-45.5 224.5 zM500 750q0 -21 14.5 -35.5t35.5 -14.5h100q21 0 35.5 14.5t14.5 35.5v400q0 21 -14.5 35.5t-35.5 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-400z" />
+<glyph unicode="&#xe018;" d="M100 1h200v300h-200v-300zM400 1v500h200v-500h-200zM700 1v800h200v-800h-200zM1000 1v1200h200v-1200h-200z" />
+<glyph unicode="&#xe019;" d="M26 601q0 -33 6 -74l151 -38l2 -6q14 -49 38 -93l3 -5l-80 -134q45 -59 105 -105l133 81l5 -3q45 -26 94 -39l5 -2l38 -151q40 -5 74 -5q27 0 74 5l38 151l6 2q46 13 93 39l5 3l134 -81q56 44 104 105l-80 134l3 5q24 44 39 93l1 6l152 38q5 40 5 74q0 28 -5 73l-152 38 l-1 6q-16 51 -39 93l-3 5l80 134q-44 58 -104 105l-134 -81l-5 3q-45 25 -93 39l-6 1l-38 152q-40 5 -74 5q-27 0 -74 -5l-38 -152l-5 -1q-50 -14 -94 -39l-5 -3l-133 81q-59 -47 -105 -105l80 -134l-3 -5q-25 -47 -38 -93l-2 -6l-151 -38q-6 -48 -6 -73zM385 601 q0 88 63 151t152 63t152 -63t63 -151q0 -89 -63 -152t-152 -63t-152 63t-63 152z" />
+<glyph unicode="&#xe020;" d="M100 1025v50q0 10 7.5 17.5t17.5 7.5h275v100q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5v-100h275q10 0 17.5 -7.5t7.5 -17.5v-50q0 -11 -7 -18t-18 -7h-1050q-11 0 -18 7t-7 18zM200 100v800h900v-800q0 -41 -29.5 -71t-70.5 -30h-700q-41 0 -70.5 30 t-29.5 71zM300 100h100v700h-100v-700zM500 100h100v700h-100v-700zM500 1100h300v100h-300v-100zM700 100h100v700h-100v-700zM900 100h100v700h-100v-700z" />
+<glyph unicode="&#xe021;" d="M1 601l656 644l644 -644h-200v-600h-300v400h-300v-400h-300v600h-200z" />
+<glyph unicode="&#xe022;" d="M100 25v1150q0 11 7 18t18 7h475v-500h400v-675q0 -11 -7 -18t-18 -7h-850q-11 0 -18 7t-7 18zM700 800v300l300 -300h-300z" />
+<glyph unicode="&#xe023;" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM500 500v400h100 v-300h200v-100h-300z" />
+<glyph unicode="&#xe024;" d="M-100 0l431 1200h209l-21 -300h162l-20 300h208l431 -1200h-538l-41 400h-242l-40 -400h-539zM488 500h224l-27 300h-170z" />
+<glyph unicode="&#xe025;" d="M0 0v400h490l-290 300h200v500h300v-500h200l-290 -300h490v-400h-1100zM813 200h175v100h-175v-100z" />
+<glyph unicode="&#xe026;" d="M1 600q0 122 47.5 233t127.5 191t191 127.5t233 47.5t233 -47.5t191 -127.5t127.5 -191t47.5 -233t-47.5 -233t-127.5 -191t-191 -127.5t-233 -47.5t-233 47.5t-191 127.5t-127.5 191t-47.5 233zM188 600q0 -170 121 -291t291 -121t291 121t121 291t-121 291t-291 121 t-291 -121t-121 -291zM350 600h150v300h200v-300h150l-250 -300z" />
+<glyph unicode="&#xe027;" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM350 600l250 300 l250 -300h-150v-300h-200v300h-150z" />
+<glyph unicode="&#xe028;" d="M0 25v475l200 700h800l199 -700l1 -475q0 -11 -7 -18t-18 -7h-1150q-11 0 -18 7t-7 18zM200 500h200l50 -200h300l50 200h200l-97 500h-606z" />
+<glyph unicode="&#xe029;" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -172 121.5 -293t292.5 -121t292.5 121t121.5 293q0 171 -121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM500 397v401 l297 -200z" />
+<glyph unicode="&#xe030;" d="M23 600q0 -118 45.5 -224.5t123 -184t184 -123t224.5 -45.5t224.5 45.5t184 123t123 184t45.5 224.5h-150q0 -177 -125 -302t-302 -125t-302 125t-125 302t125 302t302 125q136 0 246 -81l-146 -146h400v400l-145 -145q-157 122 -355 122q-118 0 -224.5 -45.5t-184 -123 t-123 -184t-45.5 -224.5z" />
+<glyph unicode="&#xe031;" d="M23 600q0 118 45.5 224.5t123 184t184 123t224.5 45.5q198 0 355 -122l145 145v-400h-400l147 147q-112 80 -247 80q-177 0 -302 -125t-125 -302h-150zM100 0v400h400l-147 -147q112 -80 247 -80q177 0 302 125t125 302h150q0 -118 -45.5 -224.5t-123 -184t-184 -123 t-224.5 -45.5q-198 0 -355 122z" />
+<glyph unicode="&#xe032;" d="M100 0h1100v1200h-1100v-1200zM200 100v900h900v-900h-900zM300 200v100h100v-100h-100zM300 400v100h100v-100h-100zM300 600v100h100v-100h-100zM300 800v100h100v-100h-100zM500 200h500v100h-500v-100zM500 400v100h500v-100h-500zM500 600v100h500v-100h-500z M500 800v100h500v-100h-500z" />
+<glyph unicode="&#xe033;" d="M0 100v600q0 41 29.5 70.5t70.5 29.5h100v200q0 82 59 141t141 59h300q82 0 141 -59t59 -141v-200h100q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-900q-41 0 -70.5 29.5t-29.5 70.5zM400 800h300v150q0 21 -14.5 35.5t-35.5 14.5h-200 q-21 0 -35.5 -14.5t-14.5 -35.5v-150z" />
+<glyph unicode="&#xe034;" d="M100 0v1100h100v-1100h-100zM300 400q60 60 127.5 84t127.5 17.5t122 -23t119 -30t110 -11t103 42t91 120.5v500q-40 -81 -101.5 -115.5t-127.5 -29.5t-138 25t-139.5 40t-125.5 25t-103 -29.5t-65 -115.5v-500z" />
+<glyph unicode="&#xe035;" d="M0 275q0 -11 7 -18t18 -7h50q11 0 18 7t7 18v300q0 127 70.5 231.5t184.5 161.5t245 57t245 -57t184.5 -161.5t70.5 -231.5v-300q0 -11 7 -18t18 -7h50q11 0 18 7t7 18v300q0 116 -49.5 227t-131 192.5t-192.5 131t-227 49.5t-227 -49.5t-192.5 -131t-131 -192.5 t-49.5 -227v-300zM200 20v460q0 8 6 14t14 6h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14zM800 20v460q0 8 6 14t14 6h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14z" />
+<glyph unicode="&#xe036;" d="M0 400h300l300 -200v800l-300 -200h-300v-400zM688 459l141 141l-141 141l71 71l141 -141l141 141l71 -71l-141 -141l141 -141l-71 -71l-141 141l-141 -141z" />
+<glyph unicode="&#xe037;" d="M0 400h300l300 -200v800l-300 -200h-300v-400zM700 857l69 53q111 -135 111 -310q0 -169 -106 -302l-67 54q86 110 86 248q0 146 -93 257z" />
+<glyph unicode="&#xe038;" d="M0 401v400h300l300 200v-800l-300 200h-300zM702 858l69 53q111 -135 111 -310q0 -170 -106 -303l-67 55q86 110 86 248q0 145 -93 257zM889 951l7 -8q123 -151 123 -344q0 -189 -119 -339l-7 -8l81 -66l6 8q142 178 142 405q0 230 -144 408l-6 8z" />
+<glyph unicode="&#xe039;" d="M0 0h500v500h-200v100h-100v-100h-200v-500zM0 600h100v100h400v100h100v100h-100v300h-500v-600zM100 100v300h300v-300h-300zM100 800v300h300v-300h-300zM200 200v100h100v-100h-100zM200 900h100v100h-100v-100zM500 500v100h300v-300h200v-100h-100v-100h-200v100 h-100v100h100v200h-200zM600 0v100h100v-100h-100zM600 1000h100v-300h200v-300h300v200h-200v100h200v500h-600v-200zM800 800v300h300v-300h-300zM900 0v100h300v-100h-300zM900 900v100h100v-100h-100zM1100 200v100h100v-100h-100z" />
+<glyph unicode="&#xe040;" d="M0 200h100v1000h-100v-1000zM100 0v100h300v-100h-300zM200 200v1000h100v-1000h-100zM500 0v91h100v-91h-100zM500 200v1000h200v-1000h-200zM700 0v91h100v-91h-100zM800 200v1000h100v-1000h-100zM900 0v91h200v-91h-200zM1000 200v1000h200v-1000h-200z" />
+<glyph unicode="&#xe041;" d="M0 700l1 475q0 10 7.5 17.5t17.5 7.5h474l700 -700l-500 -500zM148 953q0 -42 29 -71q30 -30 71.5 -30t71.5 30q29 29 29 71t-29 71q-30 30 -71.5 30t-71.5 -30q-29 -29 -29 -71z" />
+<glyph unicode="&#xe042;" d="M1 700l1 475q0 11 7 18t18 7h474l700 -700l-500 -500zM148 953q0 -42 30 -71q29 -30 71 -30t71 30q30 29 30 71t-30 71q-29 30 -71 30t-71 -30q-30 -29 -30 -71zM701 1200h100l700 -700l-500 -500l-50 50l450 450z" />
+<glyph unicode="&#xe043;" d="M100 0v1025l175 175h925v-1000l-100 -100v1000h-750l-100 -100h750v-1000h-900z" />
+<glyph unicode="&#xe044;" d="M200 0l450 444l450 -443v1150q0 20 -14.5 35t-35.5 15h-800q-21 0 -35.5 -15t-14.5 -35v-1151z" />
+<glyph unicode="&#xe045;" d="M0 100v700h200l100 -200h600l100 200h200v-700h-200v200h-800v-200h-200zM253 829l40 -124h592l62 124l-94 346q-2 11 -10 18t-18 7h-450q-10 0 -18 -7t-10 -18zM281 24l38 152q2 10 11.5 17t19.5 7h500q10 0 19.5 -7t11.5 -17l38 -152q2 -10 -3.5 -17t-15.5 -7h-600 q-10 0 -15.5 7t-3.5 17z" />
+<glyph unicode="&#xe046;" d="M0 200q0 -41 29.5 -70.5t70.5 -29.5h1000q41 0 70.5 29.5t29.5 70.5v600q0 41 -29.5 70.5t-70.5 29.5h-150q-4 8 -11.5 21.5t-33 48t-53 61t-69 48t-83.5 21.5h-200q-41 0 -82 -20.5t-70 -50t-52 -59t-34 -50.5l-12 -20h-150q-41 0 -70.5 -29.5t-29.5 -70.5v-600z M356 500q0 100 72 172t172 72t172 -72t72 -172t-72 -172t-172 -72t-172 72t-72 172zM494 500q0 -44 31 -75t75 -31t75 31t31 75t-31 75t-75 31t-75 -31t-31 -75zM900 700v100h100v-100h-100z" />
+<glyph unicode="&#xe047;" d="M53 0h365v66q-41 0 -72 11t-49 38t1 71l92 234h391l82 -222q16 -45 -5.5 -88.5t-74.5 -43.5v-66h417v66q-34 1 -74 43q-18 19 -33 42t-21 37l-6 13l-385 998h-93l-399 -1006q-24 -48 -52 -75q-12 -12 -33 -25t-36 -20l-15 -7v-66zM416 521l178 457l46 -140l116 -317h-340 z" />
+<glyph unicode="&#xe048;" d="M100 0v89q41 7 70.5 32.5t29.5 65.5v827q0 28 -1 39.5t-5.5 26t-15.5 21t-29 14t-49 14.5v71l471 -1q120 0 213 -88t93 -228q0 -55 -11.5 -101.5t-28 -74t-33.5 -47.5t-28 -28l-12 -7q8 -3 21.5 -9t48 -31.5t60.5 -58t47.5 -91.5t21.5 -129q0 -84 -59 -156.5t-142 -111 t-162 -38.5h-500zM400 200h161q89 0 153 48.5t64 132.5q0 90 -62.5 154.5t-156.5 64.5h-159v-400zM400 700h139q76 0 130 61.5t54 138.5q0 82 -84 130.5t-239 48.5v-379z" />
+<glyph unicode="&#xe049;" d="M200 0v57q77 7 134.5 40.5t65.5 80.5l173 849q10 56 -10 74t-91 37q-6 1 -10.5 2.5t-9.5 2.5v57h425l2 -57q-33 -8 -62 -25.5t-46 -37t-29.5 -38t-17.5 -30.5l-5 -12l-128 -825q-10 -52 14 -82t95 -36v-57h-500z" />
+<glyph unicode="&#xe050;" d="M-75 200h75v800h-75l125 167l125 -167h-75v-800h75l-125 -167zM300 900v300h150h700h150v-300h-50q0 29 -8 48.5t-18.5 30t-33.5 15t-39.5 5.5t-50.5 1h-200v-850l100 -50v-100h-400v100l100 50v850h-200q-34 0 -50.5 -1t-40 -5.5t-33.5 -15t-18.5 -30t-8.5 -48.5h-49z " />
+<glyph unicode="&#xe051;" d="M33 51l167 125v-75h800v75l167 -125l-167 -125v75h-800v-75zM100 901v300h150h700h150v-300h-50q0 29 -8 48.5t-18 30t-33.5 15t-40 5.5t-50.5 1h-200v-650l100 -50v-100h-400v100l100 50v650h-200q-34 0 -50.5 -1t-39.5 -5.5t-33.5 -15t-18.5 -30t-8 -48.5h-50z" />
+<glyph unicode="&#xe052;" d="M0 50q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 350q0 -20 14.5 -35t35.5 -15h800q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-800q-21 0 -35.5 -14.5t-14.5 -35.5 v-100zM0 650q0 -20 14.5 -35t35.5 -15h1000q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1000q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 950q0 -20 14.5 -35t35.5 -15h600q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-600q-21 0 -35.5 -14.5 t-14.5 -35.5v-100z" />
+<glyph unicode="&#xe053;" d="M0 50q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 650q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5 v-100zM200 350q0 -20 14.5 -35t35.5 -15h700q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-700q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM200 950q0 -20 14.5 -35t35.5 -15h700q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-700q-21 0 -35.5 -14.5 t-14.5 -35.5v-100z" />
+<glyph unicode="&#xe054;" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM100 650v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1000q-21 0 -35.5 15 t-14.5 35zM300 350v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM500 950v100q0 21 14.5 35.5t35.5 14.5h600q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-600 q-21 0 -35.5 15t-14.5 35z" />
+<glyph unicode="&#xe055;" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM0 350v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15 t-14.5 35zM0 650v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM0 950v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100 q-21 0 -35.5 15t-14.5 35z" />
+<glyph unicode="&#xe056;" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15t-14.5 35zM0 350v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15 t-14.5 35zM0 650v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15t-14.5 35zM0 950v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15 t-14.5 35zM300 50v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM300 350v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800 q-21 0 -35.5 15t-14.5 35zM300 650v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM300 950v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15 h-800q-21 0 -35.5 15t-14.5 35z" />
+<glyph unicode="&#xe057;" d="M-101 500v100h201v75l166 -125l-166 -125v75h-201zM300 0h100v1100h-100v-1100zM500 50q0 -20 14.5 -35t35.5 -15h600q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-600q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 350q0 -20 14.5 -35t35.5 -15h300q20 0 35 15t15 35 v100q0 21 -15 35.5t-35 14.5h-300q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 650q0 -20 14.5 -35t35.5 -15h500q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 950q0 -20 14.5 -35t35.5 -15h100q20 0 35 15t15 35v100 q0 21 -15 35.5t-35 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-100z" />
+<glyph unicode="&#xe058;" d="M1 50q0 -20 14.5 -35t35.5 -15h600q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-600q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 350q0 -20 14.5 -35t35.5 -15h300q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-300q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 650 q0 -20 14.5 -35t35.5 -15h500q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 950q0 -20 14.5 -35t35.5 -15h100q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM801 0v1100h100v-1100 h-100zM934 550l167 -125v75h200v100h-200v75z" />
+<glyph unicode="&#xe059;" d="M0 275v650q0 31 22 53t53 22h750q31 0 53 -22t22 -53v-650q0 -31 -22 -53t-53 -22h-750q-31 0 -53 22t-22 53zM900 600l300 300v-600z" />
+<glyph unicode="&#xe060;" d="M0 44v1012q0 18 13 31t31 13h1112q19 0 31.5 -13t12.5 -31v-1012q0 -18 -12.5 -31t-31.5 -13h-1112q-18 0 -31 13t-13 31zM100 263l247 182l298 -131l-74 156l293 318l236 -288v500h-1000v-737zM208 750q0 56 39 95t95 39t95 -39t39 -95t-39 -95t-95 -39t-95 39t-39 95z " />
+<glyph unicode="&#xe062;" d="M148 745q0 124 60.5 231.5t165 172t226.5 64.5q123 0 227 -63t164.5 -169.5t60.5 -229.5t-73 -272q-73 -114 -166.5 -237t-150.5 -189l-57 -66q-10 9 -27 26t-66.5 70.5t-96 109t-104 135.5t-100.5 155q-63 139 -63 262zM342 772q0 -107 75.5 -182.5t181.5 -75.5 q107 0 182.5 75.5t75.5 182.5t-75.5 182t-182.5 75t-182 -75.5t-75 -181.5z" />
+<glyph unicode="&#xe063;" d="M1 600q0 122 47.5 233t127.5 191t191 127.5t233 47.5t233 -47.5t191 -127.5t127.5 -191t47.5 -233t-47.5 -233t-127.5 -191t-191 -127.5t-233 -47.5t-233 47.5t-191 127.5t-127.5 191t-47.5 233zM173 600q0 -177 125.5 -302t301.5 -125v854q-176 0 -301.5 -125 t-125.5 -302z" />
+<glyph unicode="&#xe064;" d="M117 406q0 94 34 186t88.5 172.5t112 159t115 177t87.5 194.5q21 -71 57.5 -142.5t76 -130.5t83 -118.5t82 -117t70 -116t50 -125.5t18.5 -136q0 -89 -39 -165.5t-102 -126.5t-140 -79.5t-156 -33.5q-114 6 -211.5 53t-161.5 139t-64 210zM243 414q14 -82 59.5 -136 t136.5 -80l16 98q-7 6 -18 17t-34 48t-33 77q-15 73 -14 143.5t10 122.5l9 51q-92 -110 -119.5 -185t-12.5 -156z" />
+<glyph unicode="&#xe065;" d="M0 400v300q0 165 117.5 282.5t282.5 117.5q366 -6 397 -14l-186 -186h-311q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v125l200 200v-225q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5 t-117.5 282.5zM436 341l161 50l412 412l-114 113l-405 -405zM995 1015l113 -113l113 113l-21 85l-92 28z" />
+<glyph unicode="&#xe066;" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h261l2 -80q-133 -32 -218 -120h-145q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5l200 153v-53q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5 zM423 524q30 38 81.5 64t103 35.5t99 14t77.5 3.5l29 -1v-209l360 324l-359 318v-216q-7 0 -19 -1t-48 -8t-69.5 -18.5t-76.5 -37t-76.5 -59t-62 -88t-39.5 -121.5z" />
+<glyph unicode="&#xe067;" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q61 0 127 -23l-178 -177h-349q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v69l200 200v-169q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5 t-117.5 282.5zM342 632l283 -284l567 567l-137 137l-430 -431l-146 147z" />
+<glyph unicode="&#xe068;" d="M0 603l300 296v-198h200v200h-200l300 300l295 -300h-195v-200h200v198l300 -296l-300 -300v198h-200v-200h195l-295 -300l-300 300h200v200h-200v-198z" />
+<glyph unicode="&#xe069;" d="M200 50v1000q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-437l500 487v-1100l-500 488v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5z" />
+<glyph unicode="&#xe070;" d="M0 50v1000q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-437l500 487v-487l500 487v-1100l-500 488v-488l-500 488v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5z" />
+<glyph unicode="&#xe071;" d="M136 550l564 550v-487l500 487v-1100l-500 488v-488z" />
+<glyph unicode="&#xe072;" d="M200 0l900 550l-900 550v-1100z" />
+<glyph unicode="&#xe073;" d="M200 150q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v800q0 21 -14.5 35.5t-35.5 14.5h-200q-21 0 -35.5 -14.5t-14.5 -35.5v-800zM600 150q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v800q0 21 -14.5 35.5t-35.5 14.5h-200 q-21 0 -35.5 -14.5t-14.5 -35.5v-800z" />
+<glyph unicode="&#xe074;" d="M200 150q0 -20 14.5 -35t35.5 -15h800q21 0 35.5 15t14.5 35v800q0 21 -14.5 35.5t-35.5 14.5h-800q-21 0 -35.5 -14.5t-14.5 -35.5v-800z" />
+<glyph unicode="&#xe075;" d="M0 0v1100l500 -487v487l564 -550l-564 -550v488z" />
+<glyph unicode="&#xe076;" d="M0 0v1100l500 -487v487l500 -487v437q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-1000q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v438l-500 -488v488z" />
+<glyph unicode="&#xe077;" d="M300 0v1100l500 -487v437q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-1000q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v438z" />
+<glyph unicode="&#xe078;" d="M100 250v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5zM100 500h1100l-550 564z" />
+<glyph unicode="&#xe079;" d="M185 599l592 -592l240 240l-353 353l353 353l-240 240z" />
+<glyph unicode="&#xe080;" d="M272 194l353 353l-353 353l241 240l572 -571l21 -22l-1 -1v-1l-592 -591z" />
+<glyph unicode="&#xe081;" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM300 500h200v-200h200v200h200v200h-200v200h-200v-200h-200v-200z" />
+<glyph unicode="&#xe082;" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM300 500h600v200h-600v-200z" />
+<glyph unicode="&#xe083;" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM246 459l213 -213l141 142l141 -142l213 213l-142 141l142 141l-213 212l-141 -141l-141 142l-212 -213l141 -141 z" />
+<glyph unicode="&#xe084;" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM270 551l276 -277l411 411l-175 174l-236 -236l-102 102z" />
+<glyph unicode="&#xe085;" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM364 700h143q4 0 11.5 -1t11 -1t6.5 3t3 9t1 11t3.5 8.5t3.5 6t5.5 4t6.5 2.5t9 1.5t9 0.5h11.5h12.5 q19 0 30 -10t11 -26q0 -22 -4 -28t-27 -22q-5 -1 -12.5 -3t-27 -13.5t-34 -27t-26.5 -46t-11 -68.5h200q5 3 14 8t31.5 25.5t39.5 45.5t31 69t14 94q0 51 -17.5 89t-42 58t-58.5 32t-58.5 15t-51.5 3q-50 0 -90.5 -12t-75 -38.5t-53.5 -74.5t-19 -114zM500 300h200v100h-200 v-100z" />
+<glyph unicode="&#xe086;" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM400 300h400v100h-100v300h-300v-100h100v-200h-100v-100zM500 800h200v100h-200v-100z" />
+<glyph unicode="&#xe087;" d="M0 500v200h195q31 125 98.5 199.5t206.5 100.5v200h200v-200q54 -20 113 -60t112.5 -105.5t71.5 -134.5h203v-200h-203q-25 -102 -116.5 -186t-180.5 -117v-197h-200v197q-140 27 -208 102.5t-98 200.5h-194zM290 500q24 -73 79.5 -127.5t130.5 -78.5v206h200v-206 q149 48 201 206h-201v200h200q-25 74 -75.5 127t-124.5 77v-204h-200v203q-75 -23 -130 -77t-79 -126h209v-200h-210z" />
+<glyph unicode="&#xe088;" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM356 465l135 135 l-135 135l109 109l135 -135l135 135l109 -109l-135 -135l135 -135l-109 -109l-135 135l-135 -135z" />
+<glyph unicode="&#xe089;" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM322 537l141 141 l87 -87l204 205l142 -142l-346 -345z" />
+<glyph unicode="&#xe090;" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -115 62 -215l568 567q-100 62 -216 62q-171 0 -292.5 -121.5t-121.5 -292.5zM391 245q97 -59 209 -59q171 0 292.5 121.5t121.5 292.5 q0 112 -59 209z" />
+<glyph unicode="&#xe091;" d="M0 547l600 453v-300h600v-300h-600v-301z" />
+<glyph unicode="&#xe092;" d="M0 400v300h600v300l600 -453l-600 -448v301h-600z" />
+<glyph unicode="&#xe093;" d="M204 600l450 600l444 -600h-298v-600h-300v600h-296z" />
+<glyph unicode="&#xe094;" d="M104 600h296v600h300v-600h298l-449 -600z" />
+<glyph unicode="&#xe095;" d="M0 200q6 132 41 238.5t103.5 193t184 138t271.5 59.5v271l600 -453l-600 -448v301q-95 -2 -183 -20t-170 -52t-147 -92.5t-100 -135.5z" />
+<glyph unicode="&#xe096;" d="M0 0v400l129 -129l294 294l142 -142l-294 -294l129 -129h-400zM635 777l142 -142l294 294l129 -129v400h-400l129 -129z" />
+<glyph unicode="&#xe097;" d="M34 176l295 295l-129 129h400v-400l-129 130l-295 -295zM600 600v400l129 -129l295 295l142 -141l-295 -295l129 -130h-400z" />
+<glyph unicode="&#xe101;" d="M23 600q0 118 45.5 224.5t123 184t184 123t224.5 45.5t224.5 -45.5t184 -123t123 -184t45.5 -224.5t-45.5 -224.5t-123 -184t-184 -123t-224.5 -45.5t-224.5 45.5t-184 123t-123 184t-45.5 224.5zM456 851l58 -302q4 -20 21.5 -34.5t37.5 -14.5h54q20 0 37.5 14.5 t21.5 34.5l58 302q4 20 -8 34.5t-32 14.5h-207q-21 0 -33 -14.5t-8 -34.5zM500 300h200v100h-200v-100z" />
+<glyph unicode="&#xe102;" d="M0 800h100v-200h400v300h200v-300h400v200h100v100h-111q1 1 1 6.5t-1.5 15t-3.5 17.5l-34 172q-11 39 -41.5 63t-69.5 24q-32 0 -61 -17l-239 -144q-22 -13 -40 -35q-19 24 -40 36l-238 144q-33 18 -62 18q-39 0 -69.5 -23t-40.5 -61l-35 -177q-2 -8 -3 -18t-1 -15v-6 h-111v-100zM100 0h400v400h-400v-400zM200 900q-3 0 14 48t36 96l18 47l213 -191h-281zM700 0v400h400v-400h-400zM731 900l202 197q5 -12 12 -32.5t23 -64t25 -72t7 -28.5h-269z" />
+<glyph unicode="&#xe103;" d="M0 -22v143l216 193q-9 53 -13 83t-5.5 94t9 113t38.5 114t74 124q47 60 99.5 102.5t103 68t127.5 48t145.5 37.5t184.5 43.5t220 58.5q0 -189 -22 -343t-59 -258t-89 -181.5t-108.5 -120t-122 -68t-125.5 -30t-121.5 -1.5t-107.5 12.5t-87.5 17t-56.5 7.5l-99 -55z M238.5 300.5q19.5 -6.5 86.5 76.5q55 66 367 234q70 38 118.5 69.5t102 79t99 111.5t86.5 148q22 50 24 60t-6 19q-7 5 -17 5t-26.5 -14.5t-33.5 -39.5q-35 -51 -113.5 -108.5t-139.5 -89.5l-61 -32q-369 -197 -458 -401q-48 -111 -28.5 -117.5z" />
+<glyph unicode="&#xe104;" d="M111 408q0 -33 5 -63q9 -56 44 -119.5t105 -108.5q31 -21 64 -16t62 23.5t57 49.5t48 61.5t35 60.5q32 66 39 184.5t-13 157.5q79 -80 122 -164t26 -184q-5 -33 -20.5 -69.5t-37.5 -80.5q-10 -19 -14.5 -29t-12 -26t-9 -23.5t-3 -19t2.5 -15.5t11 -9.5t19.5 -5t30.5 2.5 t42 8q57 20 91 34t87.5 44.5t87 64t65.5 88.5t47 122q38 172 -44.5 341.5t-246.5 278.5q22 -44 43 -129q39 -159 -32 -154q-15 2 -33 9q-79 33 -120.5 100t-44 175.5t48.5 257.5q-13 -8 -34 -23.5t-72.5 -66.5t-88.5 -105.5t-60 -138t-8 -166.5q2 -12 8 -41.5t8 -43t6 -39.5 t3.5 -39.5t-1 -33.5t-6 -31.5t-13.5 -24t-21 -20.5t-31 -12q-38 -10 -67 13t-40.5 61.5t-15 81.5t10.5 75q-52 -46 -83.5 -101t-39 -107t-7.5 -85z" />
+<glyph unicode="&#xe105;" d="M-61 600l26 40q6 10 20 30t49 63.5t74.5 85.5t97 90t116.5 83.5t132.5 59t145.5 23.5t145.5 -23.5t132.5 -59t116.5 -83.5t97 -90t74.5 -85.5t49 -63.5t20 -30l26 -40l-26 -40q-6 -10 -20 -30t-49 -63.5t-74.5 -85.5t-97 -90t-116.5 -83.5t-132.5 -59t-145.5 -23.5 t-145.5 23.5t-132.5 59t-116.5 83.5t-97 90t-74.5 85.5t-49 63.5t-20 30zM120 600q7 -10 40.5 -58t56 -78.5t68 -77.5t87.5 -75t103 -49.5t125 -21.5t123.5 20t100.5 45.5t85.5 71.5t66.5 75.5t58 81.5t47 66q-1 1 -28.5 37.5t-42 55t-43.5 53t-57.5 63.5t-58.5 54 q49 -74 49 -163q0 -124 -88 -212t-212 -88t-212 88t-88 212q0 85 46 158q-102 -87 -226 -258zM377 656q49 -124 154 -191l105 105q-37 24 -75 72t-57 84l-20 36z" />
+<glyph unicode="&#xe106;" d="M-61 600l26 40q6 10 20 30t49 63.5t74.5 85.5t97 90t116.5 83.5t132.5 59t145.5 23.5q61 0 121 -17l37 142h148l-314 -1200h-148l37 143q-82 21 -165 71.5t-140 102t-109.5 112t-72 88.5t-29.5 43zM120 600q210 -282 393 -336l37 141q-107 18 -178.5 101.5t-71.5 193.5 q0 85 46 158q-102 -87 -226 -258zM377 656q49 -124 154 -191l47 47l23 87q-30 28 -59 69t-44 68l-14 26zM780 161l38 145q22 15 44.5 34t46 44t40.5 44t41 50.5t33.5 43.5t33 44t24.5 34q-97 127 -140 175l39 146q67 -54 131.5 -125.5t87.5 -103.5t36 -52l26 -40l-26 -40 q-7 -12 -25.5 -38t-63.5 -79.5t-95.5 -102.5t-124 -100t-146.5 -79z" />
+<glyph unicode="&#xe107;" d="M-97.5 34q13.5 -34 50.5 -34h1294q37 0 50.5 35.5t-7.5 67.5l-642 1056q-20 34 -48 36.5t-48 -29.5l-642 -1066q-21 -32 -7.5 -66zM155 200l445 723l445 -723h-345v100h-200v-100h-345zM500 600l100 -300l100 300v100h-200v-100z" />
+<glyph unicode="&#xe108;" d="M100 262v41q0 20 11 44.5t26 38.5l363 325v339q0 62 44 106t106 44t106 -44t44 -106v-339l363 -325q15 -14 26 -38.5t11 -44.5v-41q0 -20 -12 -26.5t-29 5.5l-359 249v-263q100 -91 100 -113v-64q0 -20 -13 -28.5t-32 0.5l-94 78h-222l-94 -78q-19 -9 -32 -0.5t-13 28.5 v64q0 22 100 113v263l-359 -249q-17 -12 -29 -5.5t-12 26.5z" />
+<glyph unicode="&#xe109;" d="M0 50q0 -20 14.5 -35t35.5 -15h1000q21 0 35.5 15t14.5 35v750h-1100v-750zM0 900h1100v150q0 21 -14.5 35.5t-35.5 14.5h-150v100h-100v-100h-500v100h-100v-100h-150q-21 0 -35.5 -14.5t-14.5 -35.5v-150zM100 100v100h100v-100h-100zM100 300v100h100v-100h-100z M100 500v100h100v-100h-100zM300 100v100h100v-100h-100zM300 300v100h100v-100h-100zM300 500v100h100v-100h-100zM500 100v100h100v-100h-100zM500 300v100h100v-100h-100zM500 500v100h100v-100h-100zM700 100v100h100v-100h-100zM700 300v100h100v-100h-100zM700 500 v100h100v-100h-100zM900 100v100h100v-100h-100zM900 300v100h100v-100h-100zM900 500v100h100v-100h-100z" />
+<glyph unicode="&#xe110;" d="M0 200v200h259l600 600h241v198l300 -295l-300 -300v197h-159l-600 -600h-341zM0 800h259l122 -122l141 142l-181 180h-341v-200zM678 381l141 142l122 -123h159v198l300 -295l-300 -300v197h-241z" />
+<glyph unicode="&#xe111;" d="M0 400v600q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-596l-304 -300v300h-100q-41 0 -70.5 29.5t-29.5 70.5z" />
+<glyph unicode="&#xe112;" d="M100 600v200h300v-250q0 -113 6 -145q17 -92 102 -117q39 -11 92 -11q37 0 66.5 5.5t50 15.5t36 24t24 31.5t14 37.5t7 42t2.5 45t0 47v25v250h300v-200q0 -42 -3 -83t-15 -104t-31.5 -116t-58 -109.5t-89 -96.5t-129 -65.5t-174.5 -25.5t-174.5 25.5t-129 65.5t-89 96.5 t-58 109.5t-31.5 116t-15 104t-3 83zM100 900v300h300v-300h-300zM800 900v300h300v-300h-300z" />
+<glyph unicode="&#xe113;" d="M-30 411l227 -227l352 353l353 -353l226 227l-578 579z" />
+<glyph unicode="&#xe114;" d="M70 797l580 -579l578 579l-226 227l-353 -353l-352 353z" />
+<glyph unicode="&#xe115;" d="M-198 700l299 283l300 -283h-203v-400h385l215 -200h-800v600h-196zM402 1000l215 -200h381v-400h-198l299 -283l299 283h-200v600h-796z" />
+<glyph unicode="&#xe116;" d="M18 939q-5 24 10 42q14 19 39 19h896l38 162q5 17 18.5 27.5t30.5 10.5h94q20 0 35 -14.5t15 -35.5t-15 -35.5t-35 -14.5h-54l-201 -961q-2 -4 -6 -10.5t-19 -17.5t-33 -11h-31v-50q0 -20 -14.5 -35t-35.5 -15t-35.5 15t-14.5 35v50h-300v-50q0 -20 -14.5 -35t-35.5 -15 t-35.5 15t-14.5 35v50h-50q-21 0 -35.5 15t-14.5 35q0 21 14.5 35.5t35.5 14.5h535l48 200h-633q-32 0 -54.5 21t-27.5 43z" />
+<glyph unicode="&#xe117;" d="M0 0v800h1200v-800h-1200zM0 900v100h200q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5h500v-100h-1200z" />
+<glyph unicode="&#xe118;" d="M1 0l300 700h1200l-300 -700h-1200zM1 400v600h200q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5h500v-200h-1000z" />
+<glyph unicode="&#xe119;" d="M302 300h198v600h-198l298 300l298 -300h-198v-600h198l-298 -300z" />
+<glyph unicode="&#xe120;" d="M0 600l300 298v-198h600v198l300 -298l-300 -297v197h-600v-197z" />
+<glyph unicode="&#xe121;" d="M0 100v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM31 400l172 739q5 22 23 41.5t38 19.5h672q19 0 37.5 -22.5t23.5 -45.5l172 -732h-1138zM800 100h100v100h-100v-100z M1000 100h100v100h-100v-100z" />
+<glyph unicode="&#xe122;" d="M-101 600v50q0 24 25 49t50 38l25 13v-250l-11 5.5t-24 14t-30 21.5t-24 27.5t-11 31.5zM100 500v250v8v8v7t0.5 7t1.5 5.5t2 5t3 4t4.5 3.5t6 1.5t7.5 0.5h200l675 250v-850l-675 200h-38l47 -276q2 -12 -3 -17.5t-11 -6t-21 -0.5h-8h-83q-20 0 -34.5 14t-18.5 35 q-55 337 -55 351zM1100 200v850q0 21 14.5 35.5t35.5 14.5q20 0 35 -14.5t15 -35.5v-850q0 -20 -15 -35t-35 -15q-21 0 -35.5 15t-14.5 35z" />
+<glyph unicode="&#xe123;" d="M74 350q0 21 13.5 35.5t33.5 14.5h18l117 173l63 327q15 77 76 140t144 83l-18 32q-6 19 3 32t29 13h94q20 0 29 -10.5t3 -29.5q-18 -36 -18 -37q83 -19 144 -82.5t76 -140.5l63 -327l118 -173h17q20 0 33.5 -14.5t13.5 -35.5q0 -20 -13 -40t-31 -27q-8 -3 -23 -8.5 t-65 -20t-103 -25t-132.5 -19.5t-158.5 -9q-125 0 -245.5 20.5t-178.5 40.5l-58 20q-18 7 -31 27.5t-13 40.5zM497 110q12 -49 40 -79.5t63 -30.5t63 30.5t39 79.5q-48 -6 -102 -6t-103 6z" />
+<glyph unicode="&#xe124;" d="M21 445l233 -45l-78 -224l224 78l45 -233l155 179l155 -179l45 233l224 -78l-78 224l234 45l-180 155l180 156l-234 44l78 225l-224 -78l-45 233l-155 -180l-155 180l-45 -233l-224 78l78 -225l-233 -44l179 -156z" />
+<glyph unicode="&#xe125;" d="M0 200h200v600h-200v-600zM300 275q0 -75 100 -75h61q124 -100 139 -100h250q46 0 83 57l238 344q29 31 29 74v100q0 44 -30.5 84.5t-69.5 40.5h-328q28 118 28 125v150q0 44 -30.5 84.5t-69.5 40.5h-50q-27 0 -51 -20t-38 -48l-96 -198l-145 -196q-20 -26 -20 -63v-400z M400 300v375l150 213l100 212h50v-175l-50 -225h450v-125l-250 -375h-214l-136 100h-100z" />
+<glyph unicode="&#xe126;" d="M0 400v600h200v-600h-200zM300 525v400q0 75 100 75h61q124 100 139 100h250q46 0 83 -57l238 -344q29 -31 29 -74v-100q0 -44 -30.5 -84.5t-69.5 -40.5h-328q28 -118 28 -125v-150q0 -44 -30.5 -84.5t-69.5 -40.5h-50q-27 0 -51 20t-38 48l-96 198l-145 196 q-20 26 -20 63zM400 525l150 -212l100 -213h50v175l-50 225h450v125l-250 375h-214l-136 -100h-100v-375z" />
+<glyph unicode="&#xe127;" d="M8 200v600h200v-600h-200zM308 275v525q0 17 14 35.5t28 28.5l14 9l362 230q14 6 25 6q17 0 29 -12l109 -112q14 -14 14 -34q0 -18 -11 -32l-85 -121h302q85 0 138.5 -38t53.5 -110t-54.5 -111t-138.5 -39h-107l-130 -339q-7 -22 -20.5 -41.5t-28.5 -19.5h-341 q-7 0 -90 81t-83 94zM408 289l100 -89h293l131 339q6 21 19.5 41t28.5 20h203q16 0 25 15t9 36q0 20 -9 34.5t-25 14.5h-457h-6.5h-7.5t-6.5 0.5t-6 1t-5 1.5t-5.5 2.5t-4 4t-4 5.5q-5 12 -5 20q0 14 10 27l147 183l-86 83l-339 -236v-503z" />
+<glyph unicode="&#xe128;" d="M-101 651q0 72 54 110t139 38l302 -1l-85 121q-11 16 -11 32q0 21 14 34l109 113q13 12 29 12q11 0 25 -6l365 -230q7 -4 17 -10.5t26.5 -26t16.5 -36.5v-526q0 -13 -86 -93.5t-94 -80.5h-341q-16 0 -29.5 20t-19.5 41l-130 339h-107q-84 0 -139 39t-55 111zM-1 601h222 q15 0 28.5 -20.5t19.5 -40.5l131 -339h293l107 89v502l-343 237l-87 -83l145 -184q10 -11 10 -26q0 -11 -5 -20q-1 -3 -3.5 -5.5l-4 -4t-5 -2.5t-5.5 -1.5t-6.5 -1t-6.5 -0.5h-7.5h-6.5h-476v-100zM1000 201v600h200v-600h-200z" />
+<glyph unicode="&#xe129;" d="M97 719l230 -363q4 -6 10.5 -15.5t26 -25t36.5 -15.5h525q13 0 94 83t81 90v342q0 15 -20 28.5t-41 19.5l-339 131v106q0 84 -39 139t-111 55t-110 -53.5t-38 -138.5v-302l-121 84q-15 12 -33.5 11.5t-32.5 -13.5l-112 -110q-22 -22 -6 -53zM172 739l83 86l183 -146 q22 -18 47 -5q3 1 5.5 3.5l4 4t2.5 5t1.5 5.5t1 6.5t0.5 6.5v7.5v6.5v456q0 22 25 31t50 -0.5t25 -30.5v-202q0 -16 20 -29.5t41 -19.5l339 -130v-294l-89 -100h-503zM400 0v200h600v-200h-600z" />
+<glyph unicode="&#xe130;" d="M2 585q-16 -31 6 -53l112 -110q13 -13 32 -13.5t34 10.5l121 85q0 -51 -0.5 -153.5t-0.5 -148.5q0 -84 38.5 -138t110.5 -54t111 55t39 139v106l339 131q20 6 40.5 19.5t20.5 28.5v342q0 7 -81 90t-94 83h-525q-17 0 -35.5 -14t-28.5 -28l-10 -15zM77 565l236 339h503 l89 -100v-294l-340 -130q-20 -6 -40 -20t-20 -29v-202q0 -22 -25 -31t-50 0t-25 31v456v14.5t-1.5 11.5t-5 12t-9.5 7q-24 13 -46 -5l-184 -146zM305 1104v200h600v-200h-600z" />
+<glyph unicode="&#xe131;" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM298 701l2 -201h300l-2 -194l402 294l-402 298v-197h-300z" />
+<glyph unicode="&#xe132;" d="M0 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t231.5 47.5q122 0 232.5 -47.5t190.5 -127.5t127.5 -190.5t47.5 -232.5q0 -162 -80 -299.5t-218 -217.5t-300 -80t-299.5 80t-217.5 217.5t-80 299.5zM200 600l402 -294l-2 194h300l2 201h-300v197z" />
+<glyph unicode="&#xe133;" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM300 600h200v-300h200v300h200l-300 400z" />
+<glyph unicode="&#xe134;" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM300 600l300 -400l300 400h-200v300h-200v-300h-200z" />
+<glyph unicode="&#xe135;" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q121 0 231.5 -47.5t190.5 -127.5t127.5 -190.5t47.5 -232.5q0 -162 -80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM254 780q-8 -33 5.5 -92.5t7.5 -87.5q0 -9 17 -44t16 -60 q12 0 23 -5.5t23 -15t20 -13.5q24 -12 108 -42q22 -8 53 -31.5t59.5 -38.5t57.5 -11q8 -18 -15 -55t-20 -57q42 -71 87 -80q0 -6 -3 -15.5t-3.5 -14.5t4.5 -17q104 -3 221 112q30 29 47 47t34.5 49t20.5 62q-14 9 -37 9.5t-36 7.5q-14 7 -49 15t-52 19q-9 0 -39.5 -0.5 t-46.5 -1.5t-39 -6.5t-39 -16.5q-50 -35 -66 -12q-4 2 -3.5 25.5t0.5 25.5q-6 13 -26.5 17t-24.5 7q2 22 -2 41t-16.5 28t-38.5 -20q-23 -25 -42 4q-19 28 -8 58q6 16 22 22q6 -1 26 -1.5t33.5 -4t19.5 -13.5q12 -19 32 -37.5t34 -27.5l14 -8q0 3 9.5 39.5t5.5 57.5 q-4 23 14.5 44.5t22.5 31.5q5 14 10 35t8.5 31t15.5 22.5t34 21.5q-6 18 10 37q8 0 23.5 -1.5t24.5 -1.5t20.5 4.5t20.5 15.5q-10 23 -30.5 42.5t-38 30t-49 26.5t-43.5 23q11 39 2 44q31 -13 58 -14.5t39 3.5l11 4q7 36 -16.5 53.5t-64.5 28.5t-56 23q-19 -3 -37 0 q-15 -12 -36.5 -21t-34.5 -12t-44 -8t-39 -6q-15 -3 -45.5 0.5t-45.5 -2.5q-21 -7 -52 -26.5t-34 -34.5q-3 -11 6.5 -22.5t8.5 -18.5q-3 -34 -27.5 -90.5t-29.5 -79.5zM518 916q3 12 16 30t16 25q10 -10 18.5 -10t14 6t14.5 14.5t16 12.5q0 -24 17 -66.5t17 -43.5 q-9 2 -31 5t-36 5t-32 8t-30 14zM692 1003h1h-1z" />
+<glyph unicode="&#xe136;" d="M0 164.5q0 21.5 15 37.5l600 599q-33 101 6 201.5t135 154.5q164 92 306 -9l-259 -138l145 -232l251 126q13 -175 -151 -267q-123 -70 -253 -23l-596 -596q-15 -16 -36.5 -16t-36.5 16l-111 110q-15 15 -15 36.5z" />
+<glyph unicode="&#xe137;" horiz-adv-x="1220" d="M0 196v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM0 596v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000 q-41 0 -70.5 29.5t-29.5 70.5zM0 996v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM600 596h500v100h-500v-100zM800 196h300v100h-300v-100zM900 996h200v100h-200v-100z" />
+<glyph unicode="&#xe138;" d="M100 1100v100h1000v-100h-1000zM150 1000h900l-350 -500v-300l-200 -200v500z" />
+<glyph unicode="&#xe139;" d="M0 200v200h1200v-200q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM0 500v400q0 41 29.5 70.5t70.5 29.5h300v100q0 41 29.5 70.5t70.5 29.5h200q41 0 70.5 -29.5t29.5 -70.5v-100h300q41 0 70.5 -29.5t29.5 -70.5v-400h-500v100h-200v-100h-500z M500 1000h200v100h-200v-100z" />
+<glyph unicode="&#xe140;" d="M0 0v400l129 -129l200 200l142 -142l-200 -200l129 -129h-400zM0 800l129 129l200 -200l142 142l-200 200l129 129h-400v-400zM729 329l142 142l200 -200l129 129v-400h-400l129 129zM729 871l200 200l-129 129h400v-400l-129 129l-200 -200z" />
+<glyph unicode="&#xe141;" d="M0 596q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM182 596q0 -172 121.5 -293t292.5 -121t292.5 121t121.5 293q0 171 -121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM291 655 q0 23 15.5 38.5t38.5 15.5t39 -16t16 -38q0 -23 -16 -39t-39 -16q-22 0 -38 16t-16 39zM400 850q0 22 16 38.5t39 16.5q22 0 38 -16t16 -39t-16 -39t-38 -16q-23 0 -39 16.5t-16 38.5zM514 609q0 32 20.5 56.5t51.5 29.5l122 126l1 1q-9 14 -9 28q0 22 16 38.5t39 16.5 q22 0 38 -16t16 -39t-16 -39t-38 -16q-14 0 -29 10l-55 -145q17 -22 17 -51q0 -36 -25.5 -61.5t-61.5 -25.5t-61.5 25.5t-25.5 61.5zM800 655q0 22 16 38t39 16t38.5 -15.5t15.5 -38.5t-16 -39t-38 -16q-23 0 -39 16t-16 39z" />
+<glyph unicode="&#xe142;" d="M-40 375q-13 -95 35 -173q35 -57 94 -89t129 -32q63 0 119 28q33 16 65 40.5t52.5 45.5t59.5 64q40 44 57 61l394 394q35 35 47 84t-3 96q-27 87 -117 104q-20 2 -29 2q-46 0 -78.5 -16.5t-67.5 -51.5l-389 -396l-7 -7l69 -67l377 373q20 22 39 38q23 23 50 23 q38 0 53 -36q16 -39 -20 -75l-547 -547q-52 -52 -125 -52q-55 0 -100 33t-54 96q-5 35 2.5 66t31.5 63t42 50t56 54q24 21 44 41l348 348q52 52 82.5 79.5t84 54t107.5 26.5q25 0 48 -4q95 -17 154 -94.5t51 -175.5q-7 -101 -98 -192l-252 -249l-253 -256l7 -7l69 -60 l517 511q67 67 95 157t11 183q-16 87 -67 154t-130 103q-69 33 -152 33q-107 0 -197 -55q-40 -24 -111 -95l-512 -512q-68 -68 -81 -163z" />
+<glyph unicode="&#xe143;" d="M80 784q0 131 98.5 229.5t230.5 98.5q143 0 241 -129q103 129 246 129q129 0 226 -98.5t97 -229.5q0 -46 -17.5 -91t-61 -99t-77 -89.5t-104.5 -105.5q-197 -191 -293 -322l-17 -23l-16 23q-43 58 -100 122.5t-92 99.5t-101 100q-71 70 -104.5 105.5t-77 89.5t-61 99 t-17.5 91zM250 784q0 -27 30.5 -70t61.5 -75.5t95 -94.5l22 -22q93 -90 190 -201q82 92 195 203l12 12q64 62 97.5 97t64.5 79t31 72q0 71 -48 119.5t-105 48.5q-74 0 -132 -83l-118 -171l-114 174q-51 80 -123 80q-60 0 -109.5 -49.5t-49.5 -118.5z" />
+<glyph unicode="&#xe144;" d="M57 353q0 -95 66 -159l141 -142q68 -66 159 -66q93 0 159 66l283 283q66 66 66 159t-66 159l-141 141q-8 9 -19 17l-105 -105l212 -212l-389 -389l-247 248l95 95l-18 18q-46 45 -75 101l-55 -55q-66 -66 -66 -159zM269 706q0 -93 66 -159l141 -141q7 -7 19 -17l105 105 l-212 212l389 389l247 -247l-95 -96l18 -17q47 -49 77 -100l29 29q35 35 62.5 88t27.5 96q0 93 -66 159l-141 141q-66 66 -159 66q-95 0 -159 -66l-283 -283q-66 -64 -66 -159z" />
+<glyph unicode="&#xe145;" d="M200 100v953q0 21 30 46t81 48t129 38t163 15t162 -15t127 -38t79 -48t29 -46v-953q0 -41 -29.5 -70.5t-70.5 -29.5h-600q-41 0 -70.5 29.5t-29.5 70.5zM300 300h600v700h-600v-700zM496 150q0 -43 30.5 -73.5t73.5 -30.5t73.5 30.5t30.5 73.5t-30.5 73.5t-73.5 30.5 t-73.5 -30.5t-30.5 -73.5z" />
+<glyph unicode="&#xe146;" d="M0 0l303 380l207 208l-210 212h300l267 279l-35 36q-15 14 -15 35t15 35q14 15 35 15t35 -15l283 -282q15 -15 15 -36t-15 -35q-14 -15 -35 -15t-35 15l-36 35l-279 -267v-300l-212 210l-208 -207z" />
+<glyph unicode="&#xe148;" d="M295 433h139q5 -77 48.5 -126.5t117.5 -64.5v335q-6 1 -15.5 4t-11.5 3q-46 14 -79 26.5t-72 36t-62.5 52t-40 72.5t-16.5 99q0 92 44 159.5t109 101t144 40.5v78h100v-79q38 -4 72.5 -13.5t75.5 -31.5t71 -53.5t51.5 -84t24.5 -118.5h-159q-8 72 -35 109.5t-101 50.5 v-307l64 -14q34 -7 64 -16.5t70 -31.5t67.5 -52t47.5 -80.5t20 -112.5q0 -139 -89 -224t-244 -96v-77h-100v78q-152 17 -237 104q-40 40 -52.5 93.5t-15.5 139.5zM466 889q0 -29 8 -51t16.5 -34t29.5 -22.5t31 -13.5t38 -10q7 -2 11 -3v274q-61 -8 -97.5 -37.5t-36.5 -102.5 zM700 237q170 18 170 151q0 64 -44 99.5t-126 60.5v-311z" />
+<glyph unicode="&#xe149;" d="M100 600v100h166q-24 49 -44 104q-10 26 -14.5 55.5t-3 72.5t25 90t68.5 87q97 88 263 88q129 0 230 -89t101 -208h-153q0 52 -34 89.5t-74 51.5t-76 14q-37 0 -79 -14.5t-62 -35.5q-41 -44 -41 -101q0 -28 16.5 -69.5t28 -62.5t41.5 -72h241v-100h-197q8 -50 -2.5 -115 t-31.5 -94q-41 -59 -99 -113q35 11 84 18t70 7q33 1 103 -16t103 -17q76 0 136 30l50 -147q-41 -25 -80.5 -36.5t-59 -13t-61.5 -1.5q-23 0 -128 33t-155 29q-39 -4 -82 -17t-66 -25l-24 -11l-55 145l16.5 11t15.5 10t13.5 9.5t14.5 12t14.5 14t17.5 18.5q48 55 54 126.5 t-30 142.5h-221z" />
+<glyph unicode="&#xe150;" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM602 900l298 300l298 -300h-198v-900h-200v900h-198z" />
+<glyph unicode="&#xe151;" d="M2 300h198v900h200v-900h198l-298 -300zM700 0v200h100v-100h200v-100h-300zM700 400v100h300v-200h-99v-100h-100v100h99v100h-200zM700 700v500h300v-500h-100v100h-100v-100h-100zM801 900h100v200h-100v-200z" />
+<glyph unicode="&#xe152;" d="M2 300h198v900h200v-900h198l-298 -300zM700 0v500h300v-500h-100v100h-100v-100h-100zM700 700v200h100v-100h200v-100h-300zM700 1100v100h300v-200h-99v-100h-100v100h99v100h-200zM801 200h100v200h-100v-200z" />
+<glyph unicode="&#xe153;" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM800 100v400h300v-500h-100v100h-200zM800 1100v100h200v-500h-100v400h-100zM901 200h100v200h-100v-200z" />
+<glyph unicode="&#xe154;" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM800 400v100h200v-500h-100v400h-100zM800 800v400h300v-500h-100v100h-200zM901 900h100v200h-100v-200z" />
+<glyph unicode="&#xe155;" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM700 100v200h500v-200h-500zM700 400v200h400v-200h-400zM700 700v200h300v-200h-300zM700 1000v200h200v-200h-200z" />
+<glyph unicode="&#xe156;" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM700 100v200h200v-200h-200zM700 400v200h300v-200h-300zM700 700v200h400v-200h-400zM700 1000v200h500v-200h-500z" />
+<glyph unicode="&#xe157;" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q162 0 281 -118.5t119 -281.5v-300q0 -165 -118.5 -282.5t-281.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500z" />
+<glyph unicode="&#xe158;" d="M0 400v300q0 163 119 281.5t281 118.5h300q165 0 282.5 -117.5t117.5 -282.5v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-163 0 -281.5 117.5t-118.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM400 300l333 250l-333 250v-500z" />
+<glyph unicode="&#xe159;" d="M0 400v300q0 163 117.5 281.5t282.5 118.5h300q163 0 281.5 -119t118.5 -281v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM300 700l250 -333l250 333h-500z" />
+<glyph unicode="&#xe160;" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q165 0 282.5 -117.5t117.5 -282.5v-300q0 -162 -118.5 -281t-281.5 -119h-300q-165 0 -282.5 118.5t-117.5 281.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM300 400h500l-250 333z" />
+<glyph unicode="&#xe161;" d="M0 400v300h300v200l400 -350l-400 -350v200h-300zM500 0v200h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5h-500v200h400q165 0 282.5 -117.5t117.5 -282.5v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-400z" />
+<glyph unicode="&#xe162;" d="M217 519q8 -19 31 -19h302q-155 -438 -160 -458q-5 -21 4 -32l9 -8h9q14 0 26 15q11 13 274.5 321.5t264.5 308.5q14 19 5 36q-8 17 -31 17l-301 -1q1 4 78 219.5t79 227.5q2 15 -5 27l-9 9h-9q-15 0 -25 -16q-4 -6 -98 -111.5t-228.5 -257t-209.5 -237.5q-16 -19 -6 -41 z" />
+<glyph unicode="&#xe163;" d="M0 400q0 -165 117.5 -282.5t282.5 -117.5h300q47 0 100 15v185h-500q-41 0 -70.5 29.5t-29.5 70.5v500q0 41 29.5 70.5t70.5 29.5h500v185q-14 4 -114 7.5t-193 5.5l-93 2q-165 0 -282.5 -117.5t-117.5 -282.5v-300zM600 400v300h300v200l400 -350l-400 -350v200h-300z " />
+<glyph unicode="&#xe164;" d="M0 400q0 -165 117.5 -282.5t282.5 -117.5h300q163 0 281.5 117.5t118.5 282.5v98l-78 73l-122 -123v-148q0 -41 -29.5 -70.5t-70.5 -29.5h-500q-41 0 -70.5 29.5t-29.5 70.5v500q0 41 29.5 70.5t70.5 29.5h156l118 122l-74 78h-100q-165 0 -282.5 -117.5t-117.5 -282.5 v-300zM496 709l353 342l-149 149h500v-500l-149 149l-342 -353z" />
+<glyph unicode="&#xe165;" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM406 600 q0 80 57 137t137 57t137 -57t57 -137t-57 -137t-137 -57t-137 57t-57 137z" />
+<glyph unicode="&#xe166;" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 800l445 -500l450 500h-295v400h-300v-400h-300zM900 150h100v50h-100v-50z" />
+<glyph unicode="&#xe167;" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 700h300v-300h300v300h295l-445 500zM900 150h100v50h-100v-50z" />
+<glyph unicode="&#xe168;" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 705l305 -305l596 596l-154 155l-442 -442l-150 151zM900 150h100v50h-100v-50z" />
+<glyph unicode="&#xe169;" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 988l97 -98l212 213l-97 97zM200 400l697 1l3 699l-250 -239l-149 149l-212 -212l149 -149zM900 150h100v50h-100v-50z" />
+<glyph unicode="&#xe170;" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM200 612l212 -212l98 97l-213 212zM300 1200l239 -250l-149 -149l212 -212l149 148l249 -237l-1 697zM900 150h100v50h-100v-50z" />
+<glyph unicode="&#xe171;" d="M23 415l1177 784v-1079l-475 272l-310 -393v416h-392zM494 210l672 938l-672 -712v-226z" />
+<glyph unicode="&#xe172;" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-850q0 -21 -15 -35.5t-35 -14.5h-150v400h-700v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 1000h100v200h-100v-200z" />
+<glyph unicode="&#xe173;" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-218l-276 -275l-120 120l-126 -127h-378v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM581 306l123 123l120 -120l353 352l123 -123l-475 -476zM600 1000h100v200h-100v-200z" />
+<glyph unicode="&#xe174;" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-269l-103 -103l-170 170l-298 -298h-329v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 1000h100v200h-100v-200zM700 133l170 170l-170 170l127 127l170 -170l170 170l127 -128l-170 -169l170 -170 l-127 -127l-170 170l-170 -170z" />
+<glyph unicode="&#xe175;" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-300h-400v-200h-500v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 300l300 -300l300 300h-200v300h-200v-300h-200zM600 1000v200h100v-200h-100z" />
+<glyph unicode="&#xe176;" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-402l-200 200l-298 -298h-402v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 300h200v-300h200v300h200l-300 300zM600 1000v200h100v-200h-100z" />
+<glyph unicode="&#xe177;" d="M0 250q0 -21 14.5 -35.5t35.5 -14.5h1100q21 0 35.5 14.5t14.5 35.5v550h-1200v-550zM0 900h1200v150q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-150zM100 300v200h400v-200h-400z" />
+<glyph unicode="&#xe178;" d="M0 400l300 298v-198h400v-200h-400v-198zM100 800v200h100v-200h-100zM300 800v200h100v-200h-100zM500 800v200h400v198l300 -298l-300 -298v198h-400zM800 300v200h100v-200h-100zM1000 300h100v200h-100v-200z" />
+<glyph unicode="&#xe179;" d="M100 700v400l50 100l50 -100v-300h100v300l50 100l50 -100v-300h100v300l50 100l50 -100v-400l-100 -203v-447q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v447zM800 597q0 -29 10.5 -55.5t25 -43t29 -28.5t25.5 -18l10 -5v-397q0 -21 14.5 -35.5 t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v1106q0 31 -18 40.5t-44 -7.5l-276 -116q-25 -17 -43.5 -51.5t-18.5 -65.5v-359z" />
+<glyph unicode="&#xe180;" d="M100 0h400v56q-75 0 -87.5 6t-12.5 44v394h500v-394q0 -38 -12.5 -44t-87.5 -6v-56h400v56q-4 0 -11 0.5t-24 3t-30 7t-24 15t-11 24.5v888q0 22 25 34.5t50 13.5l25 2v56h-400v-56q75 0 87.5 -6t12.5 -44v-394h-500v394q0 38 12.5 44t87.5 6v56h-400v-56q4 0 11 -0.5 t24 -3t30 -7t24 -15t11 -24.5v-888q0 -22 -25 -34.5t-50 -13.5l-25 -2v-56z" />
+<glyph unicode="&#xe181;" d="M0 300q0 -41 29.5 -70.5t70.5 -29.5h300q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5h-300q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM100 100h400l200 200h105l295 98v-298h-425l-100 -100h-375zM100 300v200h300v-200h-300zM100 600v200h300v-200h-300z M100 1000h400l200 -200v-98l295 98h105v200h-425l-100 100h-375zM700 402v163l400 133v-163z" />
+<glyph unicode="&#xe182;" d="M16.5 974.5q0.5 -21.5 16 -90t46.5 -140t104 -177.5t175 -208q103 -103 207.5 -176t180 -103.5t137 -47t92.5 -16.5l31 1l163 162q17 18 13.5 41t-22.5 37l-192 136q-19 14 -45 12t-42 -19l-118 -118q-142 101 -268 227t-227 268l118 118q17 17 20 41.5t-11 44.5 l-139 194q-14 19 -36.5 22t-40.5 -14l-162 -162q-1 -11 -0.5 -32.5z" />
+<glyph unicode="&#xe183;" d="M0 50v212q0 20 10.5 45.5t24.5 39.5l365 303v50q0 4 1 10.5t12 22.5t30 28.5t60 23t97 10.5t97 -10t60 -23.5t30 -27.5t12 -24l1 -10v-50l365 -303q14 -14 24.5 -39.5t10.5 -45.5v-212q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-20 0 -35 14.5t-15 35.5zM0 712 q0 -21 14.5 -33.5t34.5 -8.5l202 33q20 4 34.5 21t14.5 38v146q141 24 300 24t300 -24v-146q0 -21 14.5 -38t34.5 -21l202 -33q20 -4 34.5 8.5t14.5 33.5v200q-6 8 -19 20.5t-63 45t-112 57t-171 45t-235 20.5q-92 0 -175 -10.5t-141.5 -27t-108.5 -36.5t-81.5 -40 t-53.5 -36.5t-31 -27.5l-9 -10v-200z" />
+<glyph unicode="&#xe184;" d="M100 0v100h1100v-100h-1100zM175 200h950l-125 150v250l100 100v400h-100v-200h-100v200h-200v-200h-100v200h-200v-200h-100v200h-100v-400l100 -100v-250z" />
+<glyph unicode="&#xe185;" d="M100 0h300v400q0 41 -29.5 70.5t-70.5 29.5h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-400zM500 0v1000q0 41 29.5 70.5t70.5 29.5h100q41 0 70.5 -29.5t29.5 -70.5v-1000h-300zM900 0v700q0 41 29.5 70.5t70.5 29.5h100q41 0 70.5 -29.5t29.5 -70.5v-700h-300z" />
+<glyph unicode="&#xe186;" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v300h-200v100h200v100h-300v-300h200v-100h-200v-100zM600 300h200v100h100v300h-100v100h-200v-500 zM700 400v300h100v-300h-100z" />
+<glyph unicode="&#xe187;" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h100v200h100v-200h100v500h-100v-200h-100v200h-100v-500zM600 300h200v100h100v300h-100v100h-200v-500 zM700 400v300h100v-300h-100z" />
+<glyph unicode="&#xe188;" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v100h-200v300h200v100h-300v-500zM600 300h300v100h-200v300h200v100h-300v-500z" />
+<glyph unicode="&#xe189;" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 550l300 -150v300zM600 400l300 150l-300 150v-300z" />
+<glyph unicode="&#xe190;" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300v500h700v-500h-700zM300 400h130q41 0 68 42t27 107t-28.5 108t-66.5 43h-130v-300zM575 549 q0 -65 27 -107t68 -42h130v300h-130q-38 0 -66.5 -43t-28.5 -108z" />
+<glyph unicode="&#xe191;" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v300h-200v100h200v100h-300v-300h200v-100h-200v-100zM601 300h100v100h-100v-100zM700 700h100 v-400h100v500h-200v-100z" />
+<glyph unicode="&#xe192;" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v400h-200v100h-100v-500zM301 400v200h100v-200h-100zM601 300h100v100h-100v-100zM700 700h100 v-400h100v500h-200v-100z" />
+<glyph unicode="&#xe193;" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 700v100h300v-300h-99v-100h-100v100h99v200h-200zM201 300v100h100v-100h-100zM601 300v100h100v-100h-100z M700 700v100h200v-500h-100v400h-100z" />
+<glyph unicode="&#xe194;" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM400 500v200 l100 100h300v-100h-300v-200h300v-100h-300z" />
+<glyph unicode="&#xe195;" d="M0 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM182 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM400 400v400h300 l100 -100v-100h-100v100h-200v-100h200v-100h-200v-100h-100zM700 400v100h100v-100h-100z" />
+<glyph unicode="&#xe197;" d="M-14 494q0 -80 56.5 -137t135.5 -57h222v300h400v-300h128q120 0 205 86.5t85 207.5t-85 207t-205 86q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5zM300 200h200v300h200v-300h200 l-300 -300z" />
+<glyph unicode="&#xe198;" d="M-14 494q0 -80 56.5 -137t135.5 -57h8l414 414l403 -403q94 26 154.5 104.5t60.5 178.5q0 120 -85 206.5t-205 86.5q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5zM300 200l300 300 l300 -300h-200v-300h-200v300h-200z" />
+<glyph unicode="&#xe199;" d="M100 200h400v-155l-75 -45h350l-75 45v155h400l-270 300h170l-270 300h170l-300 333l-300 -333h170l-270 -300h170z" />
+<glyph unicode="&#xe200;" d="M121 700q0 -53 28.5 -97t75.5 -65q-4 -16 -4 -38q0 -74 52.5 -126.5t126.5 -52.5q56 0 100 30v-306l-75 -45h350l-75 45v306q46 -30 100 -30q74 0 126.5 52.5t52.5 126.5q0 24 -9 55q50 32 79.5 83t29.5 112q0 90 -61.5 155.5t-150.5 71.5q-26 89 -99.5 145.5 t-167.5 56.5q-116 0 -197.5 -81.5t-81.5 -197.5q0 -4 1 -11.5t1 -11.5q-14 2 -23 2q-74 0 -126.5 -52.5t-52.5 -126.5z" />
+</font>
+</defs></svg> 

externals/fmt/doc/html/_static/language_data.js

@@ -0,0 +1,297 @@
+/*
+ * language_data.js
+ * ~~~~~~~~~~~~~~~~
+ *
+ * This script contains the language-specific data used by searchtools.js,
+ * namely the list of stopwords, stemmer, scorer and splitter.
+ *
+ * :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS.
+ * :license: BSD, see LICENSE for details.
+ *
+ */
+
+var stopwords = ["a","and","are","as","at","be","but","by","for","if","in","into","is","it","near","no","not","of","on","or","such","that","the","their","then","there","these","they","this","to","was","will","with"];
+
+
+/* Non-minified version JS is _stemmer.js if file is provided */ 
+/**
+ * Porter Stemmer
+ */
+var Stemmer = function() {
+
+  var step2list = {
+    ational: 'ate',
+    tional: 'tion',
+    enci: 'ence',
+    anci: 'ance',
+    izer: 'ize',
+    bli: 'ble',
+    alli: 'al',
+    entli: 'ent',
+    eli: 'e',
+    ousli: 'ous',
+    ization: 'ize',
+    ation: 'ate',
+    ator: 'ate',
+    alism: 'al',
+    iveness: 'ive',
+    fulness: 'ful',
+    ousness: 'ous',
+    aliti: 'al',
+    iviti: 'ive',
+    biliti: 'ble',
+    logi: 'log'
+  };
+
+  var step3list = {
+    icate: 'ic',
+    ative: '',
+    alize: 'al',
+    iciti: 'ic',
+    ical: 'ic',
+    ful: '',
+    ness: ''
+  };
+
+  var c = "[^aeiou]";          // consonant
+  var v = "[aeiouy]";          // vowel
+  var C = c + "[^aeiouy]*";    // consonant sequence
+  var V = v + "[aeiou]*";      // vowel sequence
+
+  var mgr0 = "^(" + C + ")?" + V + C;                      // [C]VC... is m>0
+  var meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$";    // [C]VC[V] is m=1
+  var mgr1 = "^(" + C + ")?" + V + C + V + C;              // [C]VCVC... is m>1
+  var s_v   = "^(" + C + ")?" + v;                         // vowel in stem
+
+  this.stemWord = function (w) {
+    var stem;
+    var suffix;
+    var firstch;
+    var origword = w;
+
+    if (w.length < 3)
+      return w;
+
+    var re;
+    var re2;
+    var re3;
+    var re4;
+
+    firstch = w.substr(0,1);
+    if (firstch == "y")
+      w = firstch.toUpperCase() + w.substr(1);
+
+    // Step 1a
+    re = /^(.+?)(ss|i)es$/;
+    re2 = /^(.+?)([^s])s$/;
+
+    if (re.test(w))
+      w = w.replace(re,"$1$2");
+    else if (re2.test(w))
+      w = w.replace(re2,"$1$2");
+
+    // Step 1b
+    re = /^(.+?)eed$/;
+    re2 = /^(.+?)(ed|ing)$/;
+    if (re.test(w)) {
+      var fp = re.exec(w);
+      re = new RegExp(mgr0);
+      if (re.test(fp[1])) {
+        re = /.$/;
+        w = w.replace(re,"");
+      }
+    }
+    else if (re2.test(w)) {
+      var fp = re2.exec(w);
+      stem = fp[1];
+      re2 = new RegExp(s_v);
+      if (re2.test(stem)) {
+        w = stem;
+        re2 = /(at|bl|iz)$/;
+        re3 = new RegExp("([^aeiouylsz])\\1$");
+        re4 = new RegExp("^" + C + v + "[^aeiouwxy]$");
+        if (re2.test(w))
+          w = w + "e";
+        else if (re3.test(w)) {
+          re = /.$/;
+          w = w.replace(re,"");
+        }
+        else if (re4.test(w))
+          w = w + "e";
+      }
+    }
+
+    // Step 1c
+    re = /^(.+?)y$/;
+    if (re.test(w)) {
+      var fp = re.exec(w);
+      stem = fp[1];
+      re = new RegExp(s_v);
+      if (re.test(stem))
+        w = stem + "i";
+    }
+
+    // Step 2
+    re = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/;
+    if (re.test(w)) {
+      var fp = re.exec(w);
+      stem = fp[1];
+      suffix = fp[2];
+      re = new RegExp(mgr0);
+      if (re.test(stem))
+        w = stem + step2list[suffix];
+    }
+
+    // Step 3
+    re = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/;
+    if (re.test(w)) {
+      var fp = re.exec(w);
+      stem = fp[1];
+      suffix = fp[2];
+      re = new RegExp(mgr0);
+      if (re.test(stem))
+        w = stem + step3list[suffix];
+    }
+
+    // Step 4
+    re = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/;
+    re2 = /^(.+?)(s|t)(ion)$/;
+    if (re.test(w)) {
+      var fp = re.exec(w);
+      stem = fp[1];
+      re = new RegExp(mgr1);
+      if (re.test(stem))
+        w = stem;
+    }
+    else if (re2.test(w)) {
+      var fp = re2.exec(w);
+      stem = fp[1] + fp[2];
+      re2 = new RegExp(mgr1);
+      if (re2.test(stem))
+        w = stem;
+    }
+
+    // Step 5
+    re = /^(.+?)e$/;
+    if (re.test(w)) {
+      var fp = re.exec(w);
+      stem = fp[1];
+      re = new RegExp(mgr1);
+      re2 = new RegExp(meq1);
+      re3 = new RegExp("^" + C + v + "[^aeiouwxy]$");
+      if (re.test(stem) || (re2.test(stem) && !(re3.test(stem))))
+        w = stem;
+    }
+    re = /ll$/;
+    re2 = new RegExp(mgr1);
+    if (re.test(w) && re2.test(w)) {
+      re = /.$/;
+      w = w.replace(re,"");
+    }
+
+    // and turn initial Y back to y
+    if (firstch == "y")
+      w = firstch.toLowerCase() + w.substr(1);
+    return w;
+  }
+}
+
+
+
+
+
+var splitChars = (function() {
+    var result = {};
+    var singles = [96, 180, 187, 191, 215, 247, 749, 885, 903, 907, 909, 930, 1014, 1648,
+         1748, 1809, 2416, 2473, 2481, 2526, 2601, 2609, 2612, 2615, 2653, 2702,
+         2706, 2729, 2737, 2740, 2857, 2865, 2868, 2910, 2928, 2948, 2961, 2971,
+         2973, 3085, 3089, 3113, 3124, 3213, 3217, 3241, 3252, 3295, 3341, 3345,
+         3369, 3506, 3516, 3633, 3715, 3721, 3736, 3744, 3748, 3750, 3756, 3761,
+         3781, 3912, 4239, 4347, 4681, 4695, 4697, 4745, 4785, 4799, 4801, 4823,
+         4881, 5760, 5901, 5997, 6313, 7405, 8024, 8026, 8028, 8030, 8117, 8125,
+         8133, 8181, 8468, 8485, 8487, 8489, 8494, 8527, 11311, 11359, 11687, 11695,
+         11703, 11711, 11719, 11727, 11735, 12448, 12539, 43010, 43014, 43019, 43587,
+         43696, 43713, 64286, 64297, 64311, 64317, 64319, 64322, 64325, 65141];
+    var i, j, start, end;
+    for (i = 0; i < singles.length; i++) {
+        result[singles[i]] = true;
+    }
+    var ranges = [[0, 47], [58, 64], [91, 94], [123, 169], [171, 177], [182, 184], [706, 709],
+         [722, 735], [741, 747], [751, 879], [888, 889], [894, 901], [1154, 1161],
+         [1318, 1328], [1367, 1368], [1370, 1376], [1416, 1487], [1515, 1519], [1523, 1568],
+         [1611, 1631], [1642, 1645], [1750, 1764], [1767, 1773], [1789, 1790], [1792, 1807],
+         [1840, 1868], [1958, 1968], [1970, 1983], [2027, 2035], [2038, 2041], [2043, 2047],
+         [2070, 2073], [2075, 2083], [2085, 2087], [2089, 2307], [2362, 2364], [2366, 2383],
+         [2385, 2391], [2402, 2405], [2419, 2424], [2432, 2436], [2445, 2446], [2449, 2450],
+         [2483, 2485], [2490, 2492], [2494, 2509], [2511, 2523], [2530, 2533], [2546, 2547],
+         [2554, 2564], [2571, 2574], [2577, 2578], [2618, 2648], [2655, 2661], [2672, 2673],
+         [2677, 2692], [2746, 2748], [2750, 2767], [2769, 2783], [2786, 2789], [2800, 2820],
+         [2829, 2830], [2833, 2834], [2874, 2876], [2878, 2907], [2914, 2917], [2930, 2946],
+         [2955, 2957], [2966, 2968], [2976, 2978], [2981, 2983], [2987, 2989], [3002, 3023],
+         [3025, 3045], [3059, 3076], [3130, 3132], [3134, 3159], [3162, 3167], [3170, 3173],
+         [3184, 3191], [3199, 3204], [3258, 3260], [3262, 3293], [3298, 3301], [3312, 3332],
+         [3386, 3388], [3390, 3423], [3426, 3429], [3446, 3449], [3456, 3460], [3479, 3481],
+         [3518, 3519], [3527, 3584], [3636, 3647], [3655, 3663], [3674, 3712], [3717, 3718],
+         [3723, 3724], [3726, 3731], [3752, 3753], [3764, 3772], [3774, 3775], [3783, 3791],
+         [3802, 3803], [3806, 3839], [3841, 3871], [3892, 3903], [3949, 3975], [3980, 4095],
+         [4139, 4158], [4170, 4175], [4182, 4185], [4190, 4192], [4194, 4196], [4199, 4205],
+         [4209, 4212], [4226, 4237], [4250, 4255], [4294, 4303], [4349, 4351], [4686, 4687],
+         [4702, 4703], [4750, 4751], [4790, 4791], [4806, 4807], [4886, 4887], [4955, 4968],
+         [4989, 4991], [5008, 5023], [5109, 5120], [5741, 5742], [5787, 5791], [5867, 5869],
+         [5873, 5887], [5906, 5919], [5938, 5951], [5970, 5983], [6001, 6015], [6068, 6102],
+         [6104, 6107], [6109, 6111], [6122, 6127], [6138, 6159], [6170, 6175], [6264, 6271],
+         [6315, 6319], [6390, 6399], [6429, 6469], [6510, 6511], [6517, 6527], [6572, 6592],
+         [6600, 6607], [6619, 6655], [6679, 6687], [6741, 6783], [6794, 6799], [6810, 6822],
+         [6824, 6916], [6964, 6980], [6988, 6991], [7002, 7042], [7073, 7085], [7098, 7167],
+         [7204, 7231], [7242, 7244], [7294, 7400], [7410, 7423], [7616, 7679], [7958, 7959],
+         [7966, 7967], [8006, 8007], [8014, 8015], [8062, 8063], [8127, 8129], [8141, 8143],
+         [8148, 8149], [8156, 8159], [8173, 8177], [8189, 8303], [8306, 8307], [8314, 8318],
+         [8330, 8335], [8341, 8449], [8451, 8454], [8456, 8457], [8470, 8472], [8478, 8483],
+         [8506, 8507], [8512, 8516], [8522, 8525], [8586, 9311], [9372, 9449], [9472, 10101],
+         [10132, 11263], [11493, 11498], [11503, 11516], [11518, 11519], [11558, 11567],
+         [11622, 11630], [11632, 11647], [11671, 11679], [11743, 11822], [11824, 12292],
+         [12296, 12320], [12330, 12336], [12342, 12343], [12349, 12352], [12439, 12444],
+         [12544, 12548], [12590, 12592], [12687, 12689], [12694, 12703], [12728, 12783],
+         [12800, 12831], [12842, 12880], [12896, 12927], [12938, 12976], [12992, 13311],
+         [19894, 19967], [40908, 40959], [42125, 42191], [42238, 42239], [42509, 42511],
+         [42540, 42559], [42592, 42593], [42607, 42622], [42648, 42655], [42736, 42774],
+         [42784, 42785], [42889, 42890], [42893, 43002], [43043, 43055], [43062, 43071],
+         [43124, 43137], [43188, 43215], [43226, 43249], [43256, 43258], [43260, 43263],
+         [43302, 43311], [43335, 43359], [43389, 43395], [43443, 43470], [43482, 43519],
+         [43561, 43583], [43596, 43599], [43610, 43615], [43639, 43641], [43643, 43647],
+         [43698, 43700], [43703, 43704], [43710, 43711], [43715, 43738], [43742, 43967],
+         [44003, 44015], [44026, 44031], [55204, 55215], [55239, 55242], [55292, 55295],
+         [57344, 63743], [64046, 64047], [64110, 64111], [64218, 64255], [64263, 64274],
+         [64280, 64284], [64434, 64466], [64830, 64847], [64912, 64913], [64968, 65007],
+         [65020, 65135], [65277, 65295], [65306, 65312], [65339, 65344], [65371, 65381],
+         [65471, 65473], [65480, 65481], [65488, 65489], [65496, 65497]];
+    for (i = 0; i < ranges.length; i++) {
+        start = ranges[i][0];
+        end = ranges[i][1];
+        for (j = start; j <= end; j++) {
+            result[j] = true;
+        }
+    }
+    return result;
+})();
+
+function splitQuery(query) {
+    var result = [];
+    var start = -1;
+    for (var i = 0; i < query.length; i++) {
+        if (splitChars[query.charCodeAt(i)]) {
+            if (start !== -1) {
+                result.push(query.slice(start, i));
+                start = -1;
+            }
+        } else if (start === -1) {
+            start = i;
+        }
+    }
+    if (start !== -1) {
+        result.push(query.slice(start));
+    }
+    return result;
+}
+
+

externals/fmt/doc/html/_static/pygments.css

@@ -0,0 +1,74 @@
+pre { line-height: 125%; }
+td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; }
+span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; }
+td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; }
+span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; }
+.highlight .hll { background-color: #ffffcc }
+.highlight { background: #eeffcc; }
+.highlight .c { color: #408090; font-style: italic } /* Comment */
+.highlight .err { border: 1px solid #FF0000 } /* Error */
+.highlight .k { color: #007020; font-weight: bold } /* Keyword */
+.highlight .o { color: #666666 } /* Operator */
+.highlight .ch { color: #408090; font-style: italic } /* Comment.Hashbang */
+.highlight .cm { color: #408090; font-style: italic } /* Comment.Multiline */
+.highlight .cp { color: #007020 } /* Comment.Preproc */
+.highlight .cpf { color: #408090; font-style: italic } /* Comment.PreprocFile */
+.highlight .c1 { color: #408090; font-style: italic } /* Comment.Single */
+.highlight .cs { color: #408090; background-color: #fff0f0 } /* Comment.Special */
+.highlight .gd { color: #A00000 } /* Generic.Deleted */
+.highlight .ge { font-style: italic } /* Generic.Emph */
+.highlight .gr { color: #FF0000 } /* Generic.Error */
+.highlight .gh { color: #000080; font-weight: bold } /* Generic.Heading */
+.highlight .gi { color: #00A000 } /* Generic.Inserted */
+.highlight .go { color: #333333 } /* Generic.Output */
+.highlight .gp { color: #c65d09; font-weight: bold } /* Generic.Prompt */
+.highlight .gs { font-weight: bold } /* Generic.Strong */
+.highlight .gu { color: #800080; font-weight: bold } /* Generic.Subheading */
+.highlight .gt { color: #0044DD } /* Generic.Traceback */
+.highlight .kc { color: #007020; font-weight: bold } /* Keyword.Constant */
+.highlight .kd { color: #007020; font-weight: bold } /* Keyword.Declaration */
+.highlight .kn { color: #007020; font-weight: bold } /* Keyword.Namespace */
+.highlight .kp { color: #007020 } /* Keyword.Pseudo */
+.highlight .kr { color: #007020; font-weight: bold } /* Keyword.Reserved */
+.highlight .kt { color: #902000 } /* Keyword.Type */
+.highlight .m { color: #208050 } /* Literal.Number */
+.highlight .s { color: #4070a0 } /* Literal.String */
+.highlight .na { color: #4070a0 } /* Name.Attribute */
+.highlight .nb { color: #007020 } /* Name.Builtin */
+.highlight .nc { color: #0e84b5; font-weight: bold } /* Name.Class */
+.highlight .no { color: #60add5 } /* Name.Constant */
+.highlight .nd { color: #555555; font-weight: bold } /* Name.Decorator */
+.highlight .ni { color: #d55537; font-weight: bold } /* Name.Entity */
+.highlight .ne { color: #007020 } /* Name.Exception */
+.highlight .nf { color: #06287e } /* Name.Function */
+.highlight .nl { color: #002070; font-weight: bold } /* Name.Label */
+.highlight .nn { color: #0e84b5; font-weight: bold } /* Name.Namespace */
+.highlight .nt { color: #062873; font-weight: bold } /* Name.Tag */
+.highlight .nv { color: #bb60d5 } /* Name.Variable */
+.highlight .ow { color: #007020; font-weight: bold } /* Operator.Word */
+.highlight .w { color: #bbbbbb } /* Text.Whitespace */
+.highlight .mb { color: #208050 } /* Literal.Number.Bin */
+.highlight .mf { color: #208050 } /* Literal.Number.Float */
+.highlight .mh { color: #208050 } /* Literal.Number.Hex */
+.highlight .mi { color: #208050 } /* Literal.Number.Integer */
+.highlight .mo { color: #208050 } /* Literal.Number.Oct */
+.highlight .sa { color: #4070a0 } /* Literal.String.Affix */
+.highlight .sb { color: #4070a0 } /* Literal.String.Backtick */
+.highlight .sc { color: #4070a0 } /* Literal.String.Char */
+.highlight .dl { color: #4070a0 } /* Literal.String.Delimiter */
+.highlight .sd { color: #4070a0; font-style: italic } /* Literal.String.Doc */
+.highlight .s2 { color: #4070a0 } /* Literal.String.Double */
+.highlight .se { color: #4070a0; font-weight: bold } /* Literal.String.Escape */
+.highlight .sh { color: #4070a0 } /* Literal.String.Heredoc */
+.highlight .si { color: #70a0d0; font-style: italic } /* Literal.String.Interpol */
+.highlight .sx { color: #c65d09 } /* Literal.String.Other */
+.highlight .sr { color: #235388 } /* Literal.String.Regex */
+.highlight .s1 { color: #4070a0 } /* Literal.String.Single */
+.highlight .ss { color: #517918 } /* Literal.String.Symbol */
+.highlight .bp { color: #007020 } /* Name.Builtin.Pseudo */
+.highlight .fm { color: #06287e } /* Name.Function.Magic */
+.highlight .vc { color: #bb60d5 } /* Name.Variable.Class */
+.highlight .vg { color: #bb60d5 } /* Name.Variable.Global */
+.highlight .vi { color: #bb60d5 } /* Name.Variable.Instance */
+.highlight .vm { color: #bb60d5 } /* Name.Variable.Magic */
+.highlight .il { color: #208050 } /* Literal.Number.Integer.Long */

externals/fmt/doc/html/_static/searchtools.js

@@ -0,0 +1,514 @@
+/*
+ * searchtools.js
+ * ~~~~~~~~~~~~~~~~
+ *
+ * Sphinx JavaScript utilities for the full-text search.
+ *
+ * :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS.
+ * :license: BSD, see LICENSE for details.
+ *
+ */
+
+if (!Scorer) {
+  /**
+   * Simple result scoring code.
+   */
+  var Scorer = {
+    // Implement the following function to further tweak the score for each result
+    // The function takes a result array [filename, title, anchor, descr, score]
+    // and returns the new score.
+    /*
+    score: function(result) {
+      return result[4];
+    },
+    */
+
+    // query matches the full name of an object
+    objNameMatch: 11,
+    // or matches in the last dotted part of the object name
+    objPartialMatch: 6,
+    // Additive scores depending on the priority of the object
+    objPrio: {0:  15,   // used to be importantResults
+              1:  5,   // used to be objectResults
+              2: -5},  // used to be unimportantResults
+    //  Used when the priority is not in the mapping.
+    objPrioDefault: 0,
+
+    // query found in title
+    title: 15,
+    partialTitle: 7,
+    // query found in terms
+    term: 5,
+    partialTerm: 2
+  };
+}
+
+if (!splitQuery) {
+  function splitQuery(query) {
+    return query.split(/\s+/);
+  }
+}
+
+/**
+ * Search Module
+ */
+var Search = {
+
+  _index : null,
+  _queued_query : null,
+  _pulse_status : -1,
+
+  htmlToText : function(htmlString) {
+      var virtualDocument = document.implementation.createHTMLDocument('virtual');
+      var htmlElement = $(htmlString, virtualDocument);
+      htmlElement.find('.headerlink').remove();
+      docContent = htmlElement.find('[role=main]')[0];
+      if(docContent === undefined) {
+          console.warn("Content block not found. Sphinx search tries to obtain it " +
+                       "via '[role=main]'. Could you check your theme or template.");
+          return "";
+      }
+      return docContent.textContent || docContent.innerText;
+  },
+
+  init : function() {
+      var params = $.getQueryParameters();
+      if (params.q) {
+          var query = params.q[0];
+          $('input[name="q"]')[0].value = query;
+          this.performSearch(query);
+      }
+  },
+
+  loadIndex : function(url) {
+    $.ajax({type: "GET", url: url, data: null,
+            dataType: "script", cache: true,
+            complete: function(jqxhr, textstatus) {
+              if (textstatus != "success") {
+                document.getElementById("searchindexloader").src = url;
+              }
+            }});
+  },
+
+  setIndex : function(index) {
+    var q;
+    this._index = index;
+    if ((q = this._queued_query) !== null) {
+      this._queued_query = null;
+      Search.query(q);
+    }
+  },
+
+  hasIndex : function() {
+      return this._index !== null;
+  },
+
+  deferQuery : function(query) {
+      this._queued_query = query;
+  },
+
+  stopPulse : function() {
+      this._pulse_status = 0;
+  },
+
+  startPulse : function() {
+    if (this._pulse_status >= 0)
+        return;
+    function pulse() {
+      var i;
+      Search._pulse_status = (Search._pulse_status + 1) % 4;
+      var dotString = '';
+      for (i = 0; i < Search._pulse_status; i++)
+        dotString += '.';
+      Search.dots.text(dotString);
+      if (Search._pulse_status > -1)
+        window.setTimeout(pulse, 500);
+    }
+    pulse();
+  },
+
+  /**
+   * perform a search for something (or wait until index is loaded)
+   */
+  performSearch : function(query) {
+    // create the required interface elements
+    this.out = $('#search-results');
+    this.title = $('<h2>' + _('Searching') + '</h2>').appendTo(this.out);
+    this.dots = $('<span></span>').appendTo(this.title);
+    this.status = $('<p class="search-summary">&nbsp;</p>').appendTo(this.out);
+    this.output = $('<ul class="search"/>').appendTo(this.out);
+
+    $('#search-progress').text(_('Preparing search...'));
+    this.startPulse();
+
+    // index already loaded, the browser was quick!
+    if (this.hasIndex())
+      this.query(query);
+    else
+      this.deferQuery(query);
+  },
+
+  /**
+   * execute search (requires search index to be loaded)
+   */
+  query : function(query) {
+    var i;
+
+    // stem the searchterms and add them to the correct list
+    var stemmer = new Stemmer();
+    var searchterms = [];
+    var excluded = [];
+    var hlterms = [];
+    var tmp = splitQuery(query);
+    var objectterms = [];
+    for (i = 0; i < tmp.length; i++) {
+      if (tmp[i] !== "") {
+          objectterms.push(tmp[i].toLowerCase());
+      }
+
+      if ($u.indexOf(stopwords, tmp[i].toLowerCase()) != -1 || tmp[i] === "") {
+        // skip this "word"
+        continue;
+      }
+      // stem the word
+      var word = stemmer.stemWord(tmp[i].toLowerCase());
+      // prevent stemmer from cutting word smaller than two chars
+      if(word.length < 3 && tmp[i].length >= 3) {
+        word = tmp[i];
+      }
+      var toAppend;
+      // select the correct list
+      if (word[0] == '-') {
+        toAppend = excluded;
+        word = word.substr(1);
+      }
+      else {
+        toAppend = searchterms;
+        hlterms.push(tmp[i].toLowerCase());
+      }
+      // only add if not already in the list
+      if (!$u.contains(toAppend, word))
+        toAppend.push(word);
+    }
+    var highlightstring = '?highlight=' + $.urlencode(hlterms.join(" "));
+
+    // console.debug('SEARCH: searching for:');
+    // console.info('required: ', searchterms);
+    // console.info('excluded: ', excluded);
+
+    // prepare search
+    var terms = this._index.terms;
+    var titleterms = this._index.titleterms;
+
+    // array of [filename, title, anchor, descr, score]
+    var results = [];
+    $('#search-progress').empty();
+
+    // lookup as object
+    for (i = 0; i < objectterms.length; i++) {
+      var others = [].concat(objectterms.slice(0, i),
+                             objectterms.slice(i+1, objectterms.length));
+      results = results.concat(this.performObjectSearch(objectterms[i], others));
+    }
+
+    // lookup as search terms in fulltext
+    results = results.concat(this.performTermsSearch(searchterms, excluded, terms, titleterms));
+
+    // let the scorer override scores with a custom scoring function
+    if (Scorer.score) {
+      for (i = 0; i < results.length; i++)
+        results[i][4] = Scorer.score(results[i]);
+    }
+
+    // now sort the results by score (in opposite order of appearance, since the
+    // display function below uses pop() to retrieve items) and then
+    // alphabetically
+    results.sort(function(a, b) {
+      var left = a[4];
+      var right = b[4];
+      if (left > right) {
+        return 1;
+      } else if (left < right) {
+        return -1;
+      } else {
+        // same score: sort alphabetically
+        left = a[1].toLowerCase();
+        right = b[1].toLowerCase();
+        return (left > right) ? -1 : ((left < right) ? 1 : 0);
+      }
+    });
+
+    // for debugging
+    //Search.lastresults = results.slice();  // a copy
+    //console.info('search results:', Search.lastresults);
+
+    // print the results
+    var resultCount = results.length;
+    function displayNextItem() {
+      // results left, load the summary and display it
+      if (results.length) {
+        var item = results.pop();
+        var listItem = $('<li style="display:none"></li>');
+        var requestUrl = "";
+        var linkUrl = "";
+        if (DOCUMENTATION_OPTIONS.BUILDER === 'dirhtml') {
+          // dirhtml builder
+          var dirname = item[0] + '/';
+          if (dirname.match(/\/index\/$/)) {
+            dirname = dirname.substring(0, dirname.length-6);
+          } else if (dirname == 'index/') {
+            dirname = '';
+          }
+          requestUrl = DOCUMENTATION_OPTIONS.URL_ROOT + dirname;
+          linkUrl = requestUrl;
+
+        } else {
+          // normal html builders
+          requestUrl = DOCUMENTATION_OPTIONS.URL_ROOT + item[0] + DOCUMENTATION_OPTIONS.FILE_SUFFIX;
+          linkUrl = item[0] + DOCUMENTATION_OPTIONS.LINK_SUFFIX;
+        }
+        listItem.append($('<a/>').attr('href',
+            linkUrl +
+            highlightstring + item[2]).html(item[1]));
+        if (item[3]) {
+          listItem.append($('<span> (' + item[3] + ')</span>'));
+          Search.output.append(listItem);
+          listItem.slideDown(5, function() {
+            displayNextItem();
+          });
+        } else if (DOCUMENTATION_OPTIONS.HAS_SOURCE) {
+          $.ajax({url: requestUrl,
+                  dataType: "text",
+                  complete: function(jqxhr, textstatus) {
+                    var data = jqxhr.responseText;
+                    if (data !== '' && data !== undefined) {
+                      listItem.append(Search.makeSearchSummary(data, searchterms, hlterms));
+                    }
+                    Search.output.append(listItem);
+                    listItem.slideDown(5, function() {
+                      displayNextItem();
+                    });
+                  }});
+        } else {
+          // no source available, just display title
+          Search.output.append(listItem);
+          listItem.slideDown(5, function() {
+            displayNextItem();
+          });
+        }
+      }
+      // search finished, update title and status message
+      else {
+        Search.stopPulse();
+        Search.title.text(_('Search Results'));
+        if (!resultCount)
+          Search.status.text(_('Your search did not match any documents. Please make sure that all words are spelled correctly and that you\'ve selected enough categories.'));
+        else
+            Search.status.text(_('Search finished, found %s page(s) matching the search query.').replace('%s', resultCount));
+        Search.status.fadeIn(500);
+      }
+    }
+    displayNextItem();
+  },
+
+  /**
+   * search for object names
+   */
+  performObjectSearch : function(object, otherterms) {
+    var filenames = this._index.filenames;
+    var docnames = this._index.docnames;
+    var objects = this._index.objects;
+    var objnames = this._index.objnames;
+    var titles = this._index.titles;
+
+    var i;
+    var results = [];
+
+    for (var prefix in objects) {
+      for (var name in objects[prefix]) {
+        var fullname = (prefix ? prefix + '.' : '') + name;
+        var fullnameLower = fullname.toLowerCase()
+        if (fullnameLower.indexOf(object) > -1) {
+          var score = 0;
+          var parts = fullnameLower.split('.');
+          // check for different match types: exact matches of full name or
+          // "last name" (i.e. last dotted part)
+          if (fullnameLower == object || parts[parts.length - 1] == object) {
+            score += Scorer.objNameMatch;
+          // matches in last name
+          } else if (parts[parts.length - 1].indexOf(object) > -1) {
+            score += Scorer.objPartialMatch;
+          }
+          var match = objects[prefix][name];
+          var objname = objnames[match[1]][2];
+          var title = titles[match[0]];
+          // If more than one term searched for, we require other words to be
+          // found in the name/title/description
+          if (otherterms.length > 0) {
+            var haystack = (prefix + ' ' + name + ' ' +
+                            objname + ' ' + title).toLowerCase();
+            var allfound = true;
+            for (i = 0; i < otherterms.length; i++) {
+              if (haystack.indexOf(otherterms[i]) == -1) {
+                allfound = false;
+                break;
+              }
+            }
+            if (!allfound) {
+              continue;
+            }
+          }
+          var descr = objname + _(', in ') + title;
+
+          var anchor = match[3];
+          if (anchor === '')
+            anchor = fullname;
+          else if (anchor == '-')
+            anchor = objnames[match[1]][1] + '-' + fullname;
+          // add custom score for some objects according to scorer
+          if (Scorer.objPrio.hasOwnProperty(match[2])) {
+            score += Scorer.objPrio[match[2]];
+          } else {
+            score += Scorer.objPrioDefault;
+          }
+          results.push([docnames[match[0]], fullname, '#'+anchor, descr, score, filenames[match[0]]]);
+        }
+      }
+    }
+
+    return results;
+  },
+
+  /**
+   * search for full-text terms in the index
+   */
+  performTermsSearch : function(searchterms, excluded, terms, titleterms) {
+    var docnames = this._index.docnames;
+    var filenames = this._index.filenames;
+    var titles = this._index.titles;
+
+    var i, j, file;
+    var fileMap = {};
+    var scoreMap = {};
+    var results = [];
+
+    // perform the search on the required terms
+    for (i = 0; i < searchterms.length; i++) {
+      var word = searchterms[i];
+      var files = [];
+      var _o = [
+        {files: terms[word], score: Scorer.term},
+        {files: titleterms[word], score: Scorer.title}
+      ];
+      // add support for partial matches
+      if (word.length > 2) {
+        for (var w in terms) {
+          if (w.match(word) && !terms[word]) {
+            _o.push({files: terms[w], score: Scorer.partialTerm})
+          }
+        }
+        for (var w in titleterms) {
+          if (w.match(word) && !titleterms[word]) {
+              _o.push({files: titleterms[w], score: Scorer.partialTitle})
+          }
+        }
+      }
+
+      // no match but word was a required one
+      if ($u.every(_o, function(o){return o.files === undefined;})) {
+        break;
+      }
+      // found search word in contents
+      $u.each(_o, function(o) {
+        var _files = o.files;
+        if (_files === undefined)
+          return
+
+        if (_files.length === undefined)
+          _files = [_files];
+        files = files.concat(_files);
+
+        // set score for the word in each file to Scorer.term
+        for (j = 0; j < _files.length; j++) {
+          file = _files[j];
+          if (!(file in scoreMap))
+            scoreMap[file] = {};
+          scoreMap[file][word] = o.score;
+        }
+      });
+
+      // create the mapping
+      for (j = 0; j < files.length; j++) {
+        file = files[j];
+        if (file in fileMap && fileMap[file].indexOf(word) === -1)
+          fileMap[file].push(word);
+        else
+          fileMap[file] = [word];
+      }
+    }
+
+    // now check if the files don't contain excluded terms
+    for (file in fileMap) {
+      var valid = true;
+
+      // check if all requirements are matched
+      var filteredTermCount = // as search terms with length < 3 are discarded: ignore
+        searchterms.filter(function(term){return term.length > 2}).length
+      if (
+        fileMap[file].length != searchterms.length &&
+        fileMap[file].length != filteredTermCount
+      ) continue;
+
+      // ensure that none of the excluded terms is in the search result
+      for (i = 0; i < excluded.length; i++) {
+        if (terms[excluded[i]] == file ||
+            titleterms[excluded[i]] == file ||
+            $u.contains(terms[excluded[i]] || [], file) ||
+            $u.contains(titleterms[excluded[i]] || [], file)) {
+          valid = false;
+          break;
+        }
+      }
+
+      // if we have still a valid result we can add it to the result list
+      if (valid) {
+        // select one (max) score for the file.
+        // for better ranking, we should calculate ranking by using words statistics like basic tf-idf...
+        var score = $u.max($u.map(fileMap[file], function(w){return scoreMap[file][w]}));
+        results.push([docnames[file], titles[file], '', null, score, filenames[file]]);
+      }
+    }
+    return results;
+  },
+
+  /**
+   * helper function to return a node containing the
+   * search summary for a given text. keywords is a list
+   * of stemmed words, hlwords is the list of normal, unstemmed
+   * words. the first one is used to find the occurrence, the
+   * latter for highlighting it.
+   */
+  makeSearchSummary : function(htmlText, keywords, hlwords) {
+    var text = Search.htmlToText(htmlText);
+    var textLower = text.toLowerCase();
+    var start = 0;
+    $.each(keywords, function() {
+      var i = textLower.indexOf(this.toLowerCase());
+      if (i > -1)
+        start = i;
+    });
+    start = Math.max(start - 120, 0);
+    var excerpt = ((start > 0) ? '...' : '') +
+      $.trim(text.substr(start, 240)) +
+      ((start + 240 - text.length) ? '...' : '');
+    var rv = $('<div class="context"></div>').text(excerpt);
+    $.each(hlwords, function() {
+      rv = rv.highlightText(this, 'highlighted');
+    });
+    return rv;
+  }
+};
+
+$(document).ready(function() {
+  Search.init();
+});

externals/fmt/doc/html/_static/underscore-1.3.1.js

@@ -0,0 +1,999 @@
+//     Underscore.js 1.3.1
+//     (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc.
+//     Underscore is freely distributable under the MIT license.
+//     Portions of Underscore are inspired or borrowed from Prototype,
+//     Oliver Steele's Functional, and John Resig's Micro-Templating.
+//     For all details and documentation:
+//     http://documentcloud.github.com/underscore
+
+(function() {
+
+  // Baseline setup
+  // --------------
+
+  // Establish the root object, `window` in the browser, or `global` on the server.
+  var root = this;
+
+  // Save the previous value of the `_` variable.
+  var previousUnderscore = root._;
+
+  // Establish the object that gets returned to break out of a loop iteration.
+  var breaker = {};
+
+  // Save bytes in the minified (but not gzipped) version:
+  var ArrayProto = Array.prototype, ObjProto = Object.prototype, FuncProto = Function.prototype;
+
+  // Create quick reference variables for speed access to core prototypes.
+  var slice            = ArrayProto.slice,
+      unshift          = ArrayProto.unshift,
+      toString         = ObjProto.toString,
+      hasOwnProperty   = ObjProto.hasOwnProperty;
+
+  // All **ECMAScript 5** native function implementations that we hope to use
+  // are declared here.
+  var
+    nativeForEach      = ArrayProto.forEach,
+    nativeMap          = ArrayProto.map,
+    nativeReduce       = ArrayProto.reduce,
+    nativeReduceRight  = ArrayProto.reduceRight,
+    nativeFilter       = ArrayProto.filter,
+    nativeEvery        = ArrayProto.every,
+    nativeSome         = ArrayProto.some,
+    nativeIndexOf      = ArrayProto.indexOf,
+    nativeLastIndexOf  = ArrayProto.lastIndexOf,
+    nativeIsArray      = Array.isArray,
+    nativeKeys         = Object.keys,
+    nativeBind         = FuncProto.bind;
+
+  // Create a safe reference to the Underscore object for use below.
+  var _ = function(obj) { return new wrapper(obj); };
+
+  // Export the Underscore object for **Node.js**, with
+  // backwards-compatibility for the old `require()` API. If we're in
+  // the browser, add `_` as a global object via a string identifier,
+  // for Closure Compiler "advanced" mode.
+  if (typeof exports !== 'undefined') {
+    if (typeof module !== 'undefined' && module.exports) {
+      exports = module.exports = _;
+    }
+    exports._ = _;
+  } else {
+    root['_'] = _;
+  }
+
+  // Current version.
+  _.VERSION = '1.3.1';
+
+  // Collection Functions
+  // --------------------
+
+  // The cornerstone, an `each` implementation, aka `forEach`.
+  // Handles objects with the built-in `forEach`, arrays, and raw objects.
+  // Delegates to **ECMAScript 5**'s native `forEach` if available.
+  var each = _.each = _.forEach = function(obj, iterator, context) {
+    if (obj == null) return;
+    if (nativeForEach && obj.forEach === nativeForEach) {
+      obj.forEach(iterator, context);
+    } else if (obj.length === +obj.length) {
+      for (var i = 0, l = obj.length; i < l; i++) {
+        if (i in obj && iterator.call(context, obj[i], i, obj) === breaker) return;
+      }
+    } else {
+      for (var key in obj) {
+        if (_.has(obj, key)) {
+          if (iterator.call(context, obj[key], key, obj) === breaker) return;
+        }
+      }
+    }
+  };
+
+  // Return the results of applying the iterator to each element.
+  // Delegates to **ECMAScript 5**'s native `map` if available.
+  _.map = _.collect = function(obj, iterator, context) {
+    var results = [];
+    if (obj == null) return results;
+    if (nativeMap && obj.map === nativeMap) return obj.map(iterator, context);
+    each(obj, function(value, index, list) {
+      results[results.length] = iterator.call(context, value, index, list);
+    });
+    if (obj.length === +obj.length) results.length = obj.length;
+    return results;
+  };
+
+  // **Reduce** builds up a single result from a list of values, aka `inject`,
+  // or `foldl`. Delegates to **ECMAScript 5**'s native `reduce` if available.
+  _.reduce = _.foldl = _.inject = function(obj, iterator, memo, context) {
+    var initial = arguments.length > 2;
+    if (obj == null) obj = [];
+    if (nativeReduce && obj.reduce === nativeReduce) {
+      if (context) iterator = _.bind(iterator, context);
+      return initial ? obj.reduce(iterator, memo) : obj.reduce(iterator);
+    }
+    each(obj, function(value, index, list) {
+      if (!initial) {
+        memo = value;
+        initial = true;
+      } else {
+        memo = iterator.call(context, memo, value, index, list);
+      }
+    });
+    if (!initial) throw new TypeError('Reduce of empty array with no initial value');
+    return memo;
+  };
+
+  // The right-associative version of reduce, also known as `foldr`.
+  // Delegates to **ECMAScript 5**'s native `reduceRight` if available.
+  _.reduceRight = _.foldr = function(obj, iterator, memo, context) {
+    var initial = arguments.length > 2;
+    if (obj == null) obj = [];
+    if (nativeReduceRight && obj.reduceRight === nativeReduceRight) {
+      if (context) iterator = _.bind(iterator, context);
+      return initial ? obj.reduceRight(iterator, memo) : obj.reduceRight(iterator);
+    }
+    var reversed = _.toArray(obj).reverse();
+    if (context && !initial) iterator = _.bind(iterator, context);
+    return initial ? _.reduce(reversed, iterator, memo, context) : _.reduce(reversed, iterator);
+  };
+
+  // Return the first value which passes a truth test. Aliased as `detect`.
+  _.find = _.detect = function(obj, iterator, context) {
+    var result;
+    any(obj, function(value, index, list) {
+      if (iterator.call(context, value, index, list)) {
+        result = value;
+        return true;
+      }
+    });
+    return result;
+  };
+
+  // Return all the elements that pass a truth test.
+  // Delegates to **ECMAScript 5**'s native `filter` if available.
+  // Aliased as `select`.
+  _.filter = _.select = function(obj, iterator, context) {
+    var results = [];
+    if (obj == null) return results;
+    if (nativeFilter && obj.filter === nativeFilter) return obj.filter(iterator, context);
+    each(obj, function(value, index, list) {
+      if (iterator.call(context, value, index, list)) results[results.length] = value;
+    });
+    return results;
+  };
+
+  // Return all the elements for which a truth test fails.
+  _.reject = function(obj, iterator, context) {
+    var results = [];
+    if (obj == null) return results;
+    each(obj, function(value, index, list) {
+      if (!iterator.call(context, value, index, list)) results[results.length] = value;
+    });
+    return results;
+  };
+
+  // Determine whether all of the elements match a truth test.
+  // Delegates to **ECMAScript 5**'s native `every` if available.
+  // Aliased as `all`.
+  _.every = _.all = function(obj, iterator, context) {
+    var result = true;
+    if (obj == null) return result;
+    if (nativeEvery && obj.every === nativeEvery) return obj.every(iterator, context);
+    each(obj, function(value, index, list) {
+      if (!(result = result && iterator.call(context, value, index, list))) return breaker;
+    });
+    return result;
+  };
+
+  // Determine if at least one element in the object matches a truth test.
+  // Delegates to **ECMAScript 5**'s native `some` if available.
+  // Aliased as `any`.
+  var any = _.some = _.any = function(obj, iterator, context) {
+    iterator || (iterator = _.identity);
+    var result = false;
+    if (obj == null) return result;
+    if (nativeSome && obj.some === nativeSome) return obj.some(iterator, context);
+    each(obj, function(value, index, list) {
+      if (result || (result = iterator.call(context, value, index, list))) return breaker;
+    });
+    return !!result;
+  };
+
+  // Determine if a given value is included in the array or object using `===`.
+  // Aliased as `contains`.
+  _.include = _.contains = function(obj, target) {
+    var found = false;
+    if (obj == null) return found;
+    if (nativeIndexOf && obj.indexOf === nativeIndexOf) return obj.indexOf(target) != -1;
+    found = any(obj, function(value) {
+      return value === target;
+    });
+    return found;
+  };
+
+  // Invoke a method (with arguments) on every item in a collection.
+  _.invoke = function(obj, method) {
+    var args = slice.call(arguments, 2);
+    return _.map(obj, function(value) {
+      return (_.isFunction(method) ? method || value : value[method]).apply(value, args);
+    });
+  };
+
+  // Convenience version of a common use case of `map`: fetching a property.
+  _.pluck = function(obj, key) {
+    return _.map(obj, function(value){ return value[key]; });
+  };
+
+  // Return the maximum element or (element-based computation).
+  _.max = function(obj, iterator, context) {
+    if (!iterator && _.isArray(obj)) return Math.max.apply(Math, obj);
+    if (!iterator && _.isEmpty(obj)) return -Infinity;
+    var result = {computed : -Infinity};
+    each(obj, function(value, index, list) {
+      var computed = iterator ? iterator.call(context, value, index, list) : value;
+      computed >= result.computed && (result = {value : value, computed : computed});
+    });
+    return result.value;
+  };
+
+  // Return the minimum element (or element-based computation).
+  _.min = function(obj, iterator, context) {
+    if (!iterator && _.isArray(obj)) return Math.min.apply(Math, obj);
+    if (!iterator && _.isEmpty(obj)) return Infinity;
+    var result = {computed : Infinity};
+    each(obj, function(value, index, list) {
+      var computed = iterator ? iterator.call(context, value, index, list) : value;
+      computed < result.computed && (result = {value : value, computed : computed});
+    });
+    return result.value;
+  };
+
+  // Shuffle an array.
+  _.shuffle = function(obj) {
+    var shuffled = [], rand;
+    each(obj, function(value, index, list) {
+      if (index == 0) {
+        shuffled[0] = value;
+      } else {
+        rand = Math.floor(Math.random() * (index + 1));
+        shuffled[index] = shuffled[rand];
+        shuffled[rand] = value;
+      }
+    });
+    return shuffled;
+  };
+
+  // Sort the object's values by a criterion produced by an iterator.
+  _.sortBy = function(obj, iterator, context) {
+    return _.pluck(_.map(obj, function(value, index, list) {
+      return {
+        value : value,
+        criteria : iterator.call(context, value, index, list)
+      };
+    }).sort(function(left, right) {
+      var a = left.criteria, b = right.criteria;
+      return a < b ? -1 : a > b ? 1 : 0;
+    }), 'value');
+  };
+
+  // Groups the object's values by a criterion. Pass either a string attribute
+  // to group by, or a function that returns the criterion.
+  _.groupBy = function(obj, val) {
+    var result = {};
+    var iterator = _.isFunction(val) ? val : function(obj) { return obj[val]; };
+    each(obj, function(value, index) {
+      var key = iterator(value, index);
+      (result[key] || (result[key] = [])).push(value);
+    });
+    return result;
+  };
+
+  // Use a comparator function to figure out at what index an object should
+  // be inserted so as to maintain order. Uses binary search.
+  _.sortedIndex = function(array, obj, iterator) {
+    iterator || (iterator = _.identity);
+    var low = 0, high = array.length;
+    while (low < high) {
+      var mid = (low + high) >> 1;
+      iterator(array[mid]) < iterator(obj) ? low = mid + 1 : high = mid;
+    }
+    return low;
+  };
+
+  // Safely convert anything iterable into a real, live array.
+  _.toArray = function(iterable) {
+    if (!iterable)                return [];
+    if (iterable.toArray)         return iterable.toArray();
+    if (_.isArray(iterable))      return slice.call(iterable);
+    if (_.isArguments(iterable))  return slice.call(iterable);
+    return _.values(iterable);
+  };
+
+  // Return the number of elements in an object.
+  _.size = function(obj) {
+    return _.toArray(obj).length;
+  };
+
+  // Array Functions
+  // ---------------
+
+  // Get the first element of an array. Passing **n** will return the first N
+  // values in the array. Aliased as `head`. The **guard** check allows it to work
+  // with `_.map`.
+  _.first = _.head = function(array, n, guard) {
+    return (n != null) && !guard ? slice.call(array, 0, n) : array[0];
+  };
+
+  // Returns everything but the last entry of the array. Especcialy useful on
+  // the arguments object. Passing **n** will return all the values in
+  // the array, excluding the last N. The **guard** check allows it to work with
+  // `_.map`.
+  _.initial = function(array, n, guard) {
+    return slice.call(array, 0, array.length - ((n == null) || guard ? 1 : n));
+  };
+
+  // Get the last element of an array. Passing **n** will return the last N
+  // values in the array. The **guard** check allows it to work with `_.map`.
+  _.last = function(array, n, guard) {
+    if ((n != null) && !guard) {
+      return slice.call(array, Math.max(array.length - n, 0));
+    } else {
+      return array[array.length - 1];
+    }
+  };
+
+  // Returns everything but the first entry of the array. Aliased as `tail`.
+  // Especially useful on the arguments object. Passing an **index** will return
+  // the rest of the values in the array from that index onward. The **guard**
+  // check allows it to work with `_.map`.
+  _.rest = _.tail = function(array, index, guard) {
+    return slice.call(array, (index == null) || guard ? 1 : index);
+  };
+
+  // Trim out all falsy values from an array.
+  _.compact = function(array) {
+    return _.filter(array, function(value){ return !!value; });
+  };
+
+  // Return a completely flattened version of an array.
+  _.flatten = function(array, shallow) {
+    return _.reduce(array, function(memo, value) {
+      if (_.isArray(value)) return memo.concat(shallow ? value : _.flatten(value));
+      memo[memo.length] = value;
+      return memo;
+    }, []);
+  };
+
+  // Return a version of the array that does not contain the specified value(s).
+  _.without = function(array) {
+    return _.difference(array, slice.call(arguments, 1));
+  };
+
+  // Produce a duplicate-free version of the array. If the array has already
+  // been sorted, you have the option of using a faster algorithm.
+  // Aliased as `unique`.
+  _.uniq = _.unique = function(array, isSorted, iterator) {
+    var initial = iterator ? _.map(array, iterator) : array;
+    var result = [];
+    _.reduce(initial, function(memo, el, i) {
+      if (0 == i || (isSorted === true ? _.last(memo) != el : !_.include(memo, el))) {
+        memo[memo.length] = el;
+        result[result.length] = array[i];
+      }
+      return memo;
+    }, []);
+    return result;
+  };
+
+  // Produce an array that contains the union: each distinct element from all of
+  // the passed-in arrays.
+  _.union = function() {
+    return _.uniq(_.flatten(arguments, true));
+  };
+
+  // Produce an array that contains every item shared between all the
+  // passed-in arrays. (Aliased as "intersect" for back-compat.)
+  _.intersection = _.intersect = function(array) {
+    var rest = slice.call(arguments, 1);
+    return _.filter(_.uniq(array), function(item) {
+      return _.every(rest, function(other) {
+        return _.indexOf(other, item) >= 0;
+      });
+    });
+  };
+
+  // Take the difference between one array and a number of other arrays.
+  // Only the elements present in just the first array will remain.
+  _.difference = function(array) {
+    var rest = _.flatten(slice.call(arguments, 1));
+    return _.filter(array, function(value){ return !_.include(rest, value); });
+  };
+
+  // Zip together multiple lists into a single array -- elements that share
+  // an index go together.
+  _.zip = function() {
+    var args = slice.call(arguments);
+    var length = _.max(_.pluck(args, 'length'));
+    var results = new Array(length);
+    for (var i = 0; i < length; i++) results[i] = _.pluck(args, "" + i);
+    return results;
+  };
+
+  // If the browser doesn't supply us with indexOf (I'm looking at you, **MSIE**),
+  // we need this function. Return the position of the first occurrence of an
+  // item in an array, or -1 if the item is not included in the array.
+  // Delegates to **ECMAScript 5**'s native `indexOf` if available.
+  // If the array is large and already in sort order, pass `true`
+  // for **isSorted** to use binary search.
+  _.indexOf = function(array, item, isSorted) {
+    if (array == null) return -1;
+    var i, l;
+    if (isSorted) {
+      i = _.sortedIndex(array, item);
+      return array[i] === item ? i : -1;
+    }
+    if (nativeIndexOf && array.indexOf === nativeIndexOf) return array.indexOf(item);
+    for (i = 0, l = array.length; i < l; i++) if (i in array && array[i] === item) return i;
+    return -1;
+  };
+
+  // Delegates to **ECMAScript 5**'s native `lastIndexOf` if available.
+  _.lastIndexOf = function(array, item) {
+    if (array == null) return -1;
+    if (nativeLastIndexOf && array.lastIndexOf === nativeLastIndexOf) return array.lastIndexOf(item);
+    var i = array.length;
+    while (i--) if (i in array && array[i] === item) return i;
+    return -1;
+  };
+
+  // Generate an integer Array containing an arithmetic progression. A port of
+  // the native Python `range()` function. See
+  // [the Python documentation](http://docs.python.org/library/functions.html#range).
+  _.range = function(start, stop, step) {
+    if (arguments.length <= 1) {
+      stop = start || 0;
+      start = 0;
+    }
+    step = arguments[2] || 1;
+
+    var len = Math.max(Math.ceil((stop - start) / step), 0);
+    var idx = 0;
+    var range = new Array(len);
+
+    while(idx < len) {
+      range[idx++] = start;
+      start += step;
+    }
+
+    return range;
+  };
+
+  // Function (ahem) Functions
+  // ------------------
+
+  // Reusable constructor function for prototype setting.
+  var ctor = function(){};
+
+  // Create a function bound to a given object (assigning `this`, and arguments,
+  // optionally). Binding with arguments is also known as `curry`.
+  // Delegates to **ECMAScript 5**'s native `Function.bind` if available.
+  // We check for `func.bind` first, to fail fast when `func` is undefined.
+  _.bind = function bind(func, context) {
+    var bound, args;
+    if (func.bind === nativeBind && nativeBind) return nativeBind.apply(func, slice.call(arguments, 1));
+    if (!_.isFunction(func)) throw new TypeError;
+    args = slice.call(arguments, 2);
+    return bound = function() {
+      if (!(this instanceof bound)) return func.apply(context, args.concat(slice.call(arguments)));
+      ctor.prototype = func.prototype;
+      var self = new ctor;
+      var result = func.apply(self, args.concat(slice.call(arguments)));
+      if (Object(result) === result) return result;
+      return self;
+    };
+  };
+
+  // Bind all of an object's methods to that object. Useful for ensuring that
+  // all callbacks defined on an object belong to it.
+  _.bindAll = function(obj) {
+    var funcs = slice.call(arguments, 1);
+    if (funcs.length == 0) funcs = _.functions(obj);
+    each(funcs, function(f) { obj[f] = _.bind(obj[f], obj); });
+    return obj;
+  };
+
+  // Memoize an expensive function by storing its results.
+  _.memoize = function(func, hasher) {
+    var memo = {};
+    hasher || (hasher = _.identity);
+    return function() {
+      var key = hasher.apply(this, arguments);
+      return _.has(memo, key) ? memo[key] : (memo[key] = func.apply(this, arguments));
+    };
+  };
+
+  // Delays a function for the given number of milliseconds, and then calls
+  // it with the arguments supplied.
+  _.delay = function(func, wait) {
+    var args = slice.call(arguments, 2);
+    return setTimeout(function(){ return func.apply(func, args); }, wait);
+  };
+
+  // Defers a function, scheduling it to run after the current call stack has
+  // cleared.
+  _.defer = function(func) {
+    return _.delay.apply(_, [func, 1].concat(slice.call(arguments, 1)));
+  };
+
+  // Returns a function, that, when invoked, will only be triggered at most once
+  // during a given window of time.
+  _.throttle = function(func, wait) {
+    var context, args, timeout, throttling, more;
+    var whenDone = _.debounce(function(){ more = throttling = false; }, wait);
+    return function() {
+      context = this; args = arguments;
+      var later = function() {
+        timeout = null;
+        if (more) func.apply(context, args);
+        whenDone();
+      };
+      if (!timeout) timeout = setTimeout(later, wait);
+      if (throttling) {
+        more = true;
+      } else {
+        func.apply(context, args);
+      }
+      whenDone();
+      throttling = true;
+    };
+  };
+
+  // Returns a function, that, as long as it continues to be invoked, will not
+  // be triggered. The function will be called after it stops being called for
+  // N milliseconds.
+  _.debounce = function(func, wait) {
+    var timeout;
+    return function() {
+      var context = this, args = arguments;
+      var later = function() {
+        timeout = null;
+        func.apply(context, args);
+      };
+      clearTimeout(timeout);
+      timeout = setTimeout(later, wait);
+    };
+  };
+
+  // Returns a function that will be executed at most one time, no matter how
+  // often you call it. Useful for lazy initialization.
+  _.once = function(func) {
+    var ran = false, memo;
+    return function() {
+      if (ran) return memo;
+      ran = true;
+      return memo = func.apply(this, arguments);
+    };
+  };
+
+  // Returns the first function passed as an argument to the second,
+  // allowing you to adjust arguments, run code before and after, and
+  // conditionally execute the original function.
+  _.wrap = function(func, wrapper) {
+    return function() {
+      var args = [func].concat(slice.call(arguments, 0));
+      return wrapper.apply(this, args);
+    };
+  };
+
+  // Returns a function that is the composition of a list of functions, each
+  // consuming the return value of the function that follows.
+  _.compose = function() {
+    var funcs = arguments;
+    return function() {
+      var args = arguments;
+      for (var i = funcs.length - 1; i >= 0; i--) {
+        args = [funcs[i].apply(this, args)];
+      }
+      return args[0];
+    };
+  };
+
+  // Returns a function that will only be executed after being called N times.
+  _.after = function(times, func) {
+    if (times <= 0) return func();
+    return function() {
+      if (--times < 1) { return func.apply(this, arguments); }
+    };
+  };
+
+  // Object Functions
+  // ----------------
+
+  // Retrieve the names of an object's properties.
+  // Delegates to **ECMAScript 5**'s native `Object.keys`
+  _.keys = nativeKeys || function(obj) {
+    if (obj !== Object(obj)) throw new TypeError('Invalid object');
+    var keys = [];
+    for (var key in obj) if (_.has(obj, key)) keys[keys.length] = key;
+    return keys;
+  };
+
+  // Retrieve the values of an object's properties.
+  _.values = function(obj) {
+    return _.map(obj, _.identity);
+  };
+
+  // Return a sorted list of the function names available on the object.
+  // Aliased as `methods`
+  _.functions = _.methods = function(obj) {
+    var names = [];
+    for (var key in obj) {
+      if (_.isFunction(obj[key])) names.push(key);
+    }
+    return names.sort();
+  };
+
+  // Extend a given object with all the properties in passed-in object(s).
+  _.extend = function(obj) {
+    each(slice.call(arguments, 1), function(source) {
+      for (var prop in source) {
+        obj[prop] = source[prop];
+      }
+    });
+    return obj;
+  };
+
+  // Fill in a given object with default properties.
+  _.defaults = function(obj) {
+    each(slice.call(arguments, 1), function(source) {
+      for (var prop in source) {
+        if (obj[prop] == null) obj[prop] = source[prop];
+      }
+    });
+    return obj;
+  };
+
+  // Create a (shallow-cloned) duplicate of an object.
+  _.clone = function(obj) {
+    if (!_.isObject(obj)) return obj;
+    return _.isArray(obj) ? obj.slice() : _.extend({}, obj);
+  };
+
+  // Invokes interceptor with the obj, and then returns obj.
+  // The primary purpose of this method is to "tap into" a method chain, in
+  // order to perform operations on intermediate results within the chain.
+  _.tap = function(obj, interceptor) {
+    interceptor(obj);
+    return obj;
+  };
+
+  // Internal recursive comparison function.
+  function eq(a, b, stack) {
+    // Identical objects are equal. `0 === -0`, but they aren't identical.
+    // See the Harmony `egal` proposal: http://wiki.ecmascript.org/doku.php?id=harmony:egal.
+    if (a === b) return a !== 0 || 1 / a == 1 / b;
+    // A strict comparison is necessary because `null == undefined`.
+    if (a == null || b == null) return a === b;
+    // Unwrap any wrapped objects.
+    if (a._chain) a = a._wrapped;
+    if (b._chain) b = b._wrapped;
+    // Invoke a custom `isEqual` method if one is provided.
+    if (a.isEqual && _.isFunction(a.isEqual)) return a.isEqual(b);
+    if (b.isEqual && _.isFunction(b.isEqual)) return b.isEqual(a);
+    // Compare `[[Class]]` names.
+    var className = toString.call(a);
+    if (className != toString.call(b)) return false;
+    switch (className) {
+      // Strings, numbers, dates, and booleans are compared by value.
+      case '[object String]':
+        // Primitives and their corresponding object wrappers are equivalent; thus, `"5"` is
+        // equivalent to `new String("5")`.
+        return a == String(b);
+      case '[object Number]':
+        // `NaN`s are equivalent, but non-reflexive. An `egal` comparison is performed for
+        // other numeric values.
+        return a != +a ? b != +b : (a == 0 ? 1 / a == 1 / b : a == +b);
+      case '[object Date]':
+      case '[object Boolean]':
+        // Coerce dates and booleans to numeric primitive values. Dates are compared by their
+        // millisecond representations. Note that invalid dates with millisecond representations
+        // of `NaN` are not equivalent.
+        return +a == +b;
+      // RegExps are compared by their source patterns and flags.
+      case '[object RegExp]':
+        return a.source == b.source &&
+               a.global == b.global &&
+               a.multiline == b.multiline &&
+               a.ignoreCase == b.ignoreCase;
+    }
+    if (typeof a != 'object' || typeof b != 'object') return false;
+    // Assume equality for cyclic structures. The algorithm for detecting cyclic
+    // structures is adapted from ES 5.1 section 15.12.3, abstract operation `JO`.
+    var length = stack.length;
+    while (length--) {
+      // Linear search. Performance is inversely proportional to the number of
+      // unique nested structures.
+      if (stack[length] == a) return true;
+    }
+    // Add the first object to the stack of traversed objects.
+    stack.push(a);
+    var size = 0, result = true;
+    // Recursively compare objects and arrays.
+    if (className == '[object Array]') {
+      // Compare array lengths to determine if a deep comparison is necessary.
+      size = a.length;
+      result = size == b.length;
+      if (result) {
+        // Deep compare the contents, ignoring non-numeric properties.
+        while (size--) {
+          // Ensure commutative equality for sparse arrays.
+          if (!(result = size in a == size in b && eq(a[size], b[size], stack))) break;
+        }
+      }
+    } else {
+      // Objects with different constructors are not equivalent.
+      if ('constructor' in a != 'constructor' in b || a.constructor != b.constructor) return false;
+      // Deep compare objects.
+      for (var key in a) {
+        if (_.has(a, key)) {
+          // Count the expected number of properties.
+          size++;
+          // Deep compare each member.
+          if (!(result = _.has(b, key) && eq(a[key], b[key], stack))) break;
+        }
+      }
+      // Ensure that both objects contain the same number of properties.
+      if (result) {
+        for (key in b) {
+          if (_.has(b, key) && !(size--)) break;
+        }
+        result = !size;
+      }
+    }
+    // Remove the first object from the stack of traversed objects.
+    stack.pop();
+    return result;
+  }
+
+  // Perform a deep comparison to check if two objects are equal.
+  _.isEqual = function(a, b) {
+    return eq(a, b, []);
+  };
+
+  // Is a given array, string, or object empty?
+  // An "empty" object has no enumerable own-properties.
+  _.isEmpty = function(obj) {
+    if (_.isArray(obj) || _.isString(obj)) return obj.length === 0;
+    for (var key in obj) if (_.has(obj, key)) return false;
+    return true;
+  };
+
+  // Is a given value a DOM element?
+  _.isElement = function(obj) {
+    return !!(obj && obj.nodeType == 1);
+  };
+
+  // Is a given value an array?
+  // Delegates to ECMA5's native Array.isArray
+  _.isArray = nativeIsArray || function(obj) {
+    return toString.call(obj) == '[object Array]';
+  };
+
+  // Is a given variable an object?
+  _.isObject = function(obj) {
+    return obj === Object(obj);
+  };
+
+  // Is a given variable an arguments object?
+  _.isArguments = function(obj) {
+    return toString.call(obj) == '[object Arguments]';
+  };
+  if (!_.isArguments(arguments)) {
+    _.isArguments = function(obj) {
+      return !!(obj && _.has(obj, 'callee'));
+    };
+  }
+
+  // Is a given value a function?
+  _.isFunction = function(obj) {
+    return toString.call(obj) == '[object Function]';
+  };
+
+  // Is a given value a string?
+  _.isString = function(obj) {
+    return toString.call(obj) == '[object String]';
+  };
+
+  // Is a given value a number?
+  _.isNumber = function(obj) {
+    return toString.call(obj) == '[object Number]';
+  };
+
+  // Is the given value `NaN`?
+  _.isNaN = function(obj) {
+    // `NaN` is the only value for which `===` is not reflexive.
+    return obj !== obj;
+  };
+
+  // Is a given value a boolean?
+  _.isBoolean = function(obj) {
+    return obj === true || obj === false || toString.call(obj) == '[object Boolean]';
+  };
+
+  // Is a given value a date?
+  _.isDate = function(obj) {
+    return toString.call(obj) == '[object Date]';
+  };
+
+  // Is the given value a regular expression?
+  _.isRegExp = function(obj) {
+    return toString.call(obj) == '[object RegExp]';
+  };
+
+  // Is a given value equal to null?
+  _.isNull = function(obj) {
+    return obj === null;
+  };
+
+  // Is a given variable undefined?
+  _.isUndefined = function(obj) {
+    return obj === void 0;
+  };
+
+  // Has own property?
+  _.has = function(obj, key) {
+    return hasOwnProperty.call(obj, key);
+  };
+
+  // Utility Functions
+  // -----------------
+
+  // Run Underscore.js in *noConflict* mode, returning the `_` variable to its
+  // previous owner. Returns a reference to the Underscore object.
+  _.noConflict = function() {
+    root._ = previousUnderscore;
+    return this;
+  };
+
+  // Keep the identity function around for default iterators.
+  _.identity = function(value) {
+    return value;
+  };
+
+  // Run a function **n** times.
+  _.times = function (n, iterator, context) {
+    for (var i = 0; i < n; i++) iterator.call(context, i);
+  };
+
+  // Escape a string for HTML interpolation.
+  _.escape = function(string) {
+    return (''+string).replace(/&/g, '&amp;').replace(/</g, '&lt;').replace(/>/g, '&gt;').replace(/"/g, '&quot;').replace(/'/g, '&#x27;').replace(/\//g,'&#x2F;');
+  };
+
+  // Add your own custom functions to the Underscore object, ensuring that
+  // they're correctly added to the OOP wrapper as well.
+  _.mixin = function(obj) {
+    each(_.functions(obj), function(name){
+      addToWrapper(name, _[name] = obj[name]);
+    });
+  };
+
+  // Generate a unique integer id (unique within the entire client session).
+  // Useful for temporary DOM ids.
+  var idCounter = 0;
+  _.uniqueId = function(prefix) {
+    var id = idCounter++;
+    return prefix ? prefix + id : id;
+  };
+
+  // By default, Underscore uses ERB-style template delimiters, change the
+  // following template settings to use alternative delimiters.
+  _.templateSettings = {
+    evaluate    : /<%([\s\S]+?)%>/g,
+    interpolate : /<%=([\s\S]+?)%>/g,
+    escape      : /<%-([\s\S]+?)%>/g
+  };
+
+  // When customizing `templateSettings`, if you don't want to define an
+  // interpolation, evaluation or escaping regex, we need one that is
+  // guaranteed not to match.
+  var noMatch = /.^/;
+
+  // Within an interpolation, evaluation, or escaping, remove HTML escaping
+  // that had been previously added.
+  var unescape = function(code) {
+    return code.replace(/\\\\/g, '\\').replace(/\\'/g, "'");
+  };
+
+  // JavaScript micro-templating, similar to John Resig's implementation.
+  // Underscore templating handles arbitrary delimiters, preserves whitespace,
+  // and correctly escapes quotes within interpolated code.
+  _.template = function(str, data) {
+    var c  = _.templateSettings;
+    var tmpl = 'var __p=[],print=function(){__p.push.apply(__p,arguments);};' +
+      'with(obj||{}){__p.push(\'' +
+      str.replace(/\\/g, '\\\\')
+         .replace(/'/g, "\\'")
+         .replace(c.escape || noMatch, function(match, code) {
+           return "',_.escape(" + unescape(code) + "),'";
+         })
+         .replace(c.interpolate || noMatch, function(match, code) {
+           return "'," + unescape(code) + ",'";
+         })
+         .replace(c.evaluate || noMatch, function(match, code) {
+           return "');" + unescape(code).replace(/[\r\n\t]/g, ' ') + ";__p.push('";
+         })
+         .replace(/\r/g, '\\r')
+         .replace(/\n/g, '\\n')
+         .replace(/\t/g, '\\t')
+         + "');}return __p.join('');";
+    var func = new Function('obj', '_', tmpl);
+    if (data) return func(data, _);
+    return function(data) {
+      return func.call(this, data, _);
+    };
+  };
+
+  // Add a "chain" function, which will delegate to the wrapper.
+  _.chain = function(obj) {
+    return _(obj).chain();
+  };
+
+  // The OOP Wrapper
+  // ---------------
+
+  // If Underscore is called as a function, it returns a wrapped object that
+  // can be used OO-style. This wrapper holds altered versions of all the
+  // underscore functions. Wrapped objects may be chained.
+  var wrapper = function(obj) { this._wrapped = obj; };
+
+  // Expose `wrapper.prototype` as `_.prototype`
+  _.prototype = wrapper.prototype;
+
+  // Helper function to continue chaining intermediate results.
+  var result = function(obj, chain) {
+    return chain ? _(obj).chain() : obj;
+  };
+
+  // A method to easily add functions to the OOP wrapper.
+  var addToWrapper = function(name, func) {
+    wrapper.prototype[name] = function() {
+      var args = slice.call(arguments);
+      unshift.call(args, this._wrapped);
+      return result(func.apply(_, args), this._chain);
+    };
+  };
+
+  // Add all of the Underscore functions to the wrapper object.
+  _.mixin(_);
+
+  // Add all mutator Array functions to the wrapper.
+  each(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(name) {
+    var method = ArrayProto[name];
+    wrapper.prototype[name] = function() {
+      var wrapped = this._wrapped;
+      method.apply(wrapped, arguments);
+      var length = wrapped.length;
+      if ((name == 'shift' || name == 'splice') && length === 0) delete wrapped[0];
+      return result(wrapped, this._chain);
+    };
+  });
+
+  // Add all accessor Array functions to the wrapper.
+  each(['concat', 'join', 'slice'], function(name) {
+    var method = ArrayProto[name];
+    wrapper.prototype[name] = function() {
+      return result(method.apply(this._wrapped, arguments), this._chain);
+    };
+  });
+
+  // Start chaining a wrapped Underscore object.
+  wrapper.prototype.chain = function() {
+    this._chain = true;
+    return this;
+  };
+
+  // Extracts the result from a wrapped and chained object.
+  wrapper.prototype.value = function() {
+    return this._wrapped;
+  };
+
+}).call(this);

externals/fmt/doc/html/_static/underscore.js

@@ -0,0 +1,31 @@
+// Underscore.js 1.3.1
+// (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc.
+// Underscore is freely distributable under the MIT license.
+// Portions of Underscore are inspired or borrowed from Prototype,
+// Oliver Steele's Functional, and John Resig's Micro-Templating.
+// For all details and documentation:
+// http://documentcloud.github.com/underscore
+(function(){function q(a,c,d){if(a===c)return a!==0||1/a==1/c;if(a==null||c==null)return a===c;if(a._chain)a=a._wrapped;if(c._chain)c=c._wrapped;if(a.isEqual&&b.isFunction(a.isEqual))return a.isEqual(c);if(c.isEqual&&b.isFunction(c.isEqual))return c.isEqual(a);var e=l.call(a);if(e!=l.call(c))return false;switch(e){case "[object String]":return a==String(c);case "[object Number]":return a!=+a?c!=+c:a==0?1/a==1/c:a==+c;case "[object Date]":case "[object Boolean]":return+a==+c;case "[object RegExp]":return a.source==
+c.source&&a.global==c.global&&a.multiline==c.multiline&&a.ignoreCase==c.ignoreCase}if(typeof a!="object"||typeof c!="object")return false;for(var f=d.length;f--;)if(d[f]==a)return true;d.push(a);var f=0,g=true;if(e=="[object Array]"){if(f=a.length,g=f==c.length)for(;f--;)if(!(g=f in a==f in c&&q(a[f],c[f],d)))break}else{if("constructor"in a!="constructor"in c||a.constructor!=c.constructor)return false;for(var h in a)if(b.has(a,h)&&(f++,!(g=b.has(c,h)&&q(a[h],c[h],d))))break;if(g){for(h in c)if(b.has(c,
+h)&&!f--)break;g=!f}}d.pop();return g}var r=this,G=r._,n={},k=Array.prototype,o=Object.prototype,i=k.slice,H=k.unshift,l=o.toString,I=o.hasOwnProperty,w=k.forEach,x=k.map,y=k.reduce,z=k.reduceRight,A=k.filter,B=k.every,C=k.some,p=k.indexOf,D=k.lastIndexOf,o=Array.isArray,J=Object.keys,s=Function.prototype.bind,b=function(a){return new m(a)};if(typeof exports!=="undefined"){if(typeof module!=="undefined"&&module.exports)exports=module.exports=b;exports._=b}else r._=b;b.VERSION="1.3.1";var j=b.each=
+b.forEach=function(a,c,d){if(a!=null)if(w&&a.forEach===w)a.forEach(c,d);else if(a.length===+a.length)for(var e=0,f=a.length;e<f;e++){if(e in a&&c.call(d,a[e],e,a)===n)break}else for(e in a)if(b.has(a,e)&&c.call(d,a[e],e,a)===n)break};b.map=b.collect=function(a,c,b){var e=[];if(a==null)return e;if(x&&a.map===x)return a.map(c,b);j(a,function(a,g,h){e[e.length]=c.call(b,a,g,h)});if(a.length===+a.length)e.length=a.length;return e};b.reduce=b.foldl=b.inject=function(a,c,d,e){var f=arguments.length>2;a==
+null&&(a=[]);if(y&&a.reduce===y)return e&&(c=b.bind(c,e)),f?a.reduce(c,d):a.reduce(c);j(a,function(a,b,i){f?d=c.call(e,d,a,b,i):(d=a,f=true)});if(!f)throw new TypeError("Reduce of empty array with no initial value");return d};b.reduceRight=b.foldr=function(a,c,d,e){var f=arguments.length>2;a==null&&(a=[]);if(z&&a.reduceRight===z)return e&&(c=b.bind(c,e)),f?a.reduceRight(c,d):a.reduceRight(c);var g=b.toArray(a).reverse();e&&!f&&(c=b.bind(c,e));return f?b.reduce(g,c,d,e):b.reduce(g,c)};b.find=b.detect=
+function(a,c,b){var e;E(a,function(a,g,h){if(c.call(b,a,g,h))return e=a,true});return e};b.filter=b.select=function(a,c,b){var e=[];if(a==null)return e;if(A&&a.filter===A)return a.filter(c,b);j(a,function(a,g,h){c.call(b,a,g,h)&&(e[e.length]=a)});return e};b.reject=function(a,c,b){var e=[];if(a==null)return e;j(a,function(a,g,h){c.call(b,a,g,h)||(e[e.length]=a)});return e};b.every=b.all=function(a,c,b){var e=true;if(a==null)return e;if(B&&a.every===B)return a.every(c,b);j(a,function(a,g,h){if(!(e=
+e&&c.call(b,a,g,h)))return n});return e};var E=b.some=b.any=function(a,c,d){c||(c=b.identity);var e=false;if(a==null)return e;if(C&&a.some===C)return a.some(c,d);j(a,function(a,b,h){if(e||(e=c.call(d,a,b,h)))return n});return!!e};b.include=b.contains=function(a,c){var b=false;if(a==null)return b;return p&&a.indexOf===p?a.indexOf(c)!=-1:b=E(a,function(a){return a===c})};b.invoke=function(a,c){var d=i.call(arguments,2);return b.map(a,function(a){return(b.isFunction(c)?c||a:a[c]).apply(a,d)})};b.pluck=
+function(a,c){return b.map(a,function(a){return a[c]})};b.max=function(a,c,d){if(!c&&b.isArray(a))return Math.max.apply(Math,a);if(!c&&b.isEmpty(a))return-Infinity;var e={computed:-Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b>=e.computed&&(e={value:a,computed:b})});return e.value};b.min=function(a,c,d){if(!c&&b.isArray(a))return Math.min.apply(Math,a);if(!c&&b.isEmpty(a))return Infinity;var e={computed:Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b<e.computed&&(e={value:a,computed:b})});
+return e.value};b.shuffle=function(a){var b=[],d;j(a,function(a,f){f==0?b[0]=a:(d=Math.floor(Math.random()*(f+1)),b[f]=b[d],b[d]=a)});return b};b.sortBy=function(a,c,d){return b.pluck(b.map(a,function(a,b,g){return{value:a,criteria:c.call(d,a,b,g)}}).sort(function(a,b){var c=a.criteria,d=b.criteria;return c<d?-1:c>d?1:0}),"value")};b.groupBy=function(a,c){var d={},e=b.isFunction(c)?c:function(a){return a[c]};j(a,function(a,b){var c=e(a,b);(d[c]||(d[c]=[])).push(a)});return d};b.sortedIndex=function(a,
+c,d){d||(d=b.identity);for(var e=0,f=a.length;e<f;){var g=e+f>>1;d(a[g])<d(c)?e=g+1:f=g}return e};b.toArray=function(a){return!a?[]:a.toArray?a.toArray():b.isArray(a)?i.call(a):b.isArguments(a)?i.call(a):b.values(a)};b.size=function(a){return b.toArray(a).length};b.first=b.head=function(a,b,d){return b!=null&&!d?i.call(a,0,b):a[0]};b.initial=function(a,b,d){return i.call(a,0,a.length-(b==null||d?1:b))};b.last=function(a,b,d){return b!=null&&!d?i.call(a,Math.max(a.length-b,0)):a[a.length-1]};b.rest=
+b.tail=function(a,b,d){return i.call(a,b==null||d?1:b)};b.compact=function(a){return b.filter(a,function(a){return!!a})};b.flatten=function(a,c){return b.reduce(a,function(a,e){if(b.isArray(e))return a.concat(c?e:b.flatten(e));a[a.length]=e;return a},[])};b.without=function(a){return b.difference(a,i.call(arguments,1))};b.uniq=b.unique=function(a,c,d){var d=d?b.map(a,d):a,e=[];b.reduce(d,function(d,g,h){if(0==h||(c===true?b.last(d)!=g:!b.include(d,g)))d[d.length]=g,e[e.length]=a[h];return d},[]);
+return e};b.union=function(){return b.uniq(b.flatten(arguments,true))};b.intersection=b.intersect=function(a){var c=i.call(arguments,1);return b.filter(b.uniq(a),function(a){return b.every(c,function(c){return b.indexOf(c,a)>=0})})};b.difference=function(a){var c=b.flatten(i.call(arguments,1));return b.filter(a,function(a){return!b.include(c,a)})};b.zip=function(){for(var a=i.call(arguments),c=b.max(b.pluck(a,"length")),d=Array(c),e=0;e<c;e++)d[e]=b.pluck(a,""+e);return d};b.indexOf=function(a,c,
+d){if(a==null)return-1;var e;if(d)return d=b.sortedIndex(a,c),a[d]===c?d:-1;if(p&&a.indexOf===p)return a.indexOf(c);for(d=0,e=a.length;d<e;d++)if(d in a&&a[d]===c)return d;return-1};b.lastIndexOf=function(a,b){if(a==null)return-1;if(D&&a.lastIndexOf===D)return a.lastIndexOf(b);for(var d=a.length;d--;)if(d in a&&a[d]===b)return d;return-1};b.range=function(a,b,d){arguments.length<=1&&(b=a||0,a=0);for(var d=arguments[2]||1,e=Math.max(Math.ceil((b-a)/d),0),f=0,g=Array(e);f<e;)g[f++]=a,a+=d;return g};
+var F=function(){};b.bind=function(a,c){var d,e;if(a.bind===s&&s)return s.apply(a,i.call(arguments,1));if(!b.isFunction(a))throw new TypeError;e=i.call(arguments,2);return d=function(){if(!(this instanceof d))return a.apply(c,e.concat(i.call(arguments)));F.prototype=a.prototype;var b=new F,g=a.apply(b,e.concat(i.call(arguments)));return Object(g)===g?g:b}};b.bindAll=function(a){var c=i.call(arguments,1);c.length==0&&(c=b.functions(a));j(c,function(c){a[c]=b.bind(a[c],a)});return a};b.memoize=function(a,
+c){var d={};c||(c=b.identity);return function(){var e=c.apply(this,arguments);return b.has(d,e)?d[e]:d[e]=a.apply(this,arguments)}};b.delay=function(a,b){var d=i.call(arguments,2);return setTimeout(function(){return a.apply(a,d)},b)};b.defer=function(a){return b.delay.apply(b,[a,1].concat(i.call(arguments,1)))};b.throttle=function(a,c){var d,e,f,g,h,i=b.debounce(function(){h=g=false},c);return function(){d=this;e=arguments;var b;f||(f=setTimeout(function(){f=null;h&&a.apply(d,e);i()},c));g?h=true:
+a.apply(d,e);i();g=true}};b.debounce=function(a,b){var d;return function(){var e=this,f=arguments;clearTimeout(d);d=setTimeout(function(){d=null;a.apply(e,f)},b)}};b.once=function(a){var b=false,d;return function(){if(b)return d;b=true;return d=a.apply(this,arguments)}};b.wrap=function(a,b){return function(){var d=[a].concat(i.call(arguments,0));return b.apply(this,d)}};b.compose=function(){var a=arguments;return function(){for(var b=arguments,d=a.length-1;d>=0;d--)b=[a[d].apply(this,b)];return b[0]}};
+b.after=function(a,b){return a<=0?b():function(){if(--a<1)return b.apply(this,arguments)}};b.keys=J||function(a){if(a!==Object(a))throw new TypeError("Invalid object");var c=[],d;for(d in a)b.has(a,d)&&(c[c.length]=d);return c};b.values=function(a){return b.map(a,b.identity)};b.functions=b.methods=function(a){var c=[],d;for(d in a)b.isFunction(a[d])&&c.push(d);return c.sort()};b.extend=function(a){j(i.call(arguments,1),function(b){for(var d in b)a[d]=b[d]});return a};b.defaults=function(a){j(i.call(arguments,
+1),function(b){for(var d in b)a[d]==null&&(a[d]=b[d])});return a};b.clone=function(a){return!b.isObject(a)?a:b.isArray(a)?a.slice():b.extend({},a)};b.tap=function(a,b){b(a);return a};b.isEqual=function(a,b){return q(a,b,[])};b.isEmpty=function(a){if(b.isArray(a)||b.isString(a))return a.length===0;for(var c in a)if(b.has(a,c))return false;return true};b.isElement=function(a){return!!(a&&a.nodeType==1)};b.isArray=o||function(a){return l.call(a)=="[object Array]"};b.isObject=function(a){return a===Object(a)};
+b.isArguments=function(a){return l.call(a)=="[object Arguments]"};if(!b.isArguments(arguments))b.isArguments=function(a){return!(!a||!b.has(a,"callee"))};b.isFunction=function(a){return l.call(a)=="[object Function]"};b.isString=function(a){return l.call(a)=="[object String]"};b.isNumber=function(a){return l.call(a)=="[object Number]"};b.isNaN=function(a){return a!==a};b.isBoolean=function(a){return a===true||a===false||l.call(a)=="[object Boolean]"};b.isDate=function(a){return l.call(a)=="[object Date]"};
+b.isRegExp=function(a){return l.call(a)=="[object RegExp]"};b.isNull=function(a){return a===null};b.isUndefined=function(a){return a===void 0};b.has=function(a,b){return I.call(a,b)};b.noConflict=function(){r._=G;return this};b.identity=function(a){return a};b.times=function(a,b,d){for(var e=0;e<a;e++)b.call(d,e)};b.escape=function(a){return(""+a).replace(/&/g,"&amp;").replace(/</g,"&lt;").replace(/>/g,"&gt;").replace(/"/g,"&quot;").replace(/'/g,"&#x27;").replace(/\//g,"&#x2F;")};b.mixin=function(a){j(b.functions(a),
+function(c){K(c,b[c]=a[c])})};var L=0;b.uniqueId=function(a){var b=L++;return a?a+b:b};b.templateSettings={evaluate:/<%([\s\S]+?)%>/g,interpolate:/<%=([\s\S]+?)%>/g,escape:/<%-([\s\S]+?)%>/g};var t=/.^/,u=function(a){return a.replace(/\\\\/g,"\\").replace(/\\'/g,"'")};b.template=function(a,c){var d=b.templateSettings,d="var __p=[],print=function(){__p.push.apply(__p,arguments);};with(obj||{}){__p.push('"+a.replace(/\\/g,"\\\\").replace(/'/g,"\\'").replace(d.escape||t,function(a,b){return"',_.escape("+
+u(b)+"),'"}).replace(d.interpolate||t,function(a,b){return"',"+u(b)+",'"}).replace(d.evaluate||t,function(a,b){return"');"+u(b).replace(/[\r\n\t]/g," ")+";__p.push('"}).replace(/\r/g,"\\r").replace(/\n/g,"\\n").replace(/\t/g,"\\t")+"');}return __p.join('');",e=new Function("obj","_",d);return c?e(c,b):function(a){return e.call(this,a,b)}};b.chain=function(a){return b(a).chain()};var m=function(a){this._wrapped=a};b.prototype=m.prototype;var v=function(a,c){return c?b(a).chain():a},K=function(a,c){m.prototype[a]=
+function(){var a=i.call(arguments);H.call(a,this._wrapped);return v(c.apply(b,a),this._chain)}};b.mixin(b);j("pop,push,reverse,shift,sort,splice,unshift".split(","),function(a){var b=k[a];m.prototype[a]=function(){var d=this._wrapped;b.apply(d,arguments);var e=d.length;(a=="shift"||a=="splice")&&e===0&&delete d[0];return v(d,this._chain)}});j(["concat","join","slice"],function(a){var b=k[a];m.prototype[a]=function(){return v(b.apply(this._wrapped,arguments),this._chain)}});m.prototype.chain=function(){this._chain=
+true;return this};m.prototype.value=function(){return this._wrapped}}).call(this);

externals/fmt/doc/html/contents.html

@@ -0,0 +1,189 @@
+<!DOCTYPE html>
+
+
+<html lang="en">
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="X-UA-Compatible" content="IE=edge">
+    <meta name="viewport" content="width=device-width, initial-scale=1">
+    
+    <meta name="generator" content="Docutils 0.17.1: http://docutils.sourceforge.net/" />
+
+    <title>Contents &mdash; fmt 9.1.0 documentation</title>
+    
+    <link rel="stylesheet" href="_static/basic.css" type="text/css" />
+    <link rel="stylesheet" href="_static/pygments.css" type="text/css" />
+    <link rel="stylesheet" href="_static/breathe.css" type="text/css" />
+    
+    <script type="text/javascript">
+      var DOCUMENTATION_OPTIONS = {
+        URL_ROOT:    './',
+        VERSION:     '9.1.0',
+        COLLAPSE_INDEX: false,
+        FILE_SUFFIX: '.html',
+        LINK_SUFFIX: '.html',
+        SOURCELINK_SUFFIX: '.txt',
+        HAS_SOURCE:  true,
+        SOURCELINK_SUFFIX:  '.txt'
+      };
+    </script>
+    <script src="_static/jquery.js"></script>
+    <script src="_static/underscore.js"></script>
+    <script src="_static/doctools.js"></script>
+    <script src="_static/language_data.js"></script>
+    <link rel="index" title="Index" href="genindex.html" />
+    <link rel="search" title="Search" href="search.html" />
+<meta name="description" content="Small, safe and fast formatting library">
+<meta name="keywords" content="C++, formatting, printf, string, library">
+<meta name="author" content="Victor Zverovich">
+<link rel="stylesheet" href="_static/fmt.css">
+
+<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
+<script>
+  window.dataLayer = window.dataLayer || [];
+  function gtag(){dataLayer.push(arguments);}
+  gtag('js', new Date());
+
+  gtag('config', 'UA-20116650-4');
+</script>
+
+  </head>
+  <body role="document">
+<nav class="navbar navbar-inverse">
+  <div class="tb-container">
+    <div class="row">
+      <div class="navbar-content">
+        
+        <div class="navbar-header">
+          <button type="button" class="navbar-toggle collapsed"
+                  data-toggle="collapse" data-target=".navbar-collapse">
+            <span class="sr-only">Toggle navigation</span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+          </button>
+          <a class="navbar-brand" href="index.html">{fmt}</a>
+        </div>
+
+        
+        <div class="collapse navbar-collapse">
+          <ul class="nav navbar-nav">
+            <li class="dropdown">
+              <a href="#" class="dropdown-toggle" data-toggle="dropdown"
+                 role="button" aria-expanded="false">9.1.0
+                <span class="caret"></span></a>
+              <ul class="dropdown-menu" role="menu">
+                
+                <li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
+                
+                <li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
+                
+                <li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
+                
+              </ul>
+            </li>
+            
+              
+              <li class="active"><a href="contents.html">Contents
+                <span class="sr-only">(current)</span></a></li>
+              
+            
+              
+              <li><a href="usage.html">Usage</a></li>
+              
+            
+              
+              <li><a href="api.html">API</a></li>
+              
+            
+              
+              <li><a href="syntax.html">Syntax</a></li>
+              
+            
+          </ul>
+          
+            
+<form class="navbar-form navbar-right" role="search" action="search.html"
+      method="get">
+  <div class="form-group">
+    <input type="text" name="q" class="form-control"
+           placeholder="Search" >
+  </div>
+  <input type="hidden" name="check_keywords" value="yes" />
+  <input type="hidden" name="area" value="default" />
+  
+</form>
+          
+        </div> 
+      </div> 
+    </div> 
+  </div> 
+</nav>
+
+
+
+<div class="tb-container">
+  <div class="row">
+    
+
+    <div class="content">
+      
+  <section id="contents">
+<h1>Contents<a class="headerlink" href="#contents" title="Permalink to this headline">¶</a></h1>
+<div class="toctree-wrapper compound">
+<ul>
+<li class="toctree-l1"><a class="reference internal" href="usage.html">Usage</a><ul>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#building-the-library">Building the Library</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#installing-the-library">Installing the Library</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#usage-with-cmake">Usage with CMake</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#usage-with-build2">Usage with build2</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#building-the-documentation">Building the Documentation</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#conda">Conda</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#vcpkg">Vcpkg</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#lhelper">LHelper</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#android-ndk">Android NDK</a></li>
+<li class="toctree-l2"><a class="reference internal" href="usage.html#homebrew">Homebrew</a></li>
+</ul>
+</li>
+<li class="toctree-l1"><a class="reference internal" href="api.html">API Reference</a><ul>
+<li class="toctree-l2"><a class="reference internal" href="api.html#core-api">Core API</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#format-api">Format API</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#range-and-tuple-formatting">Range and Tuple Formatting</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#date-and-time-formatting">Date and Time Formatting</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#standard-library-types-formatting">Standard Library Types Formatting</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#format-string-compilation">Format String Compilation</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#terminal-color-and-text-style">Terminal Color and Text Style</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#system-apis">System APIs</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#std-ostream-support"><code class="docutils literal notranslate"><span class="pre">std::ostream</span></code> Support</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#printf-formatting"><code class="docutils literal notranslate"><span class="pre">printf</span></code> Formatting</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#wchar-t-support"><code class="docutils literal notranslate"><span class="pre">wchar_t</span></code> Support</a></li>
+<li class="toctree-l2"><a class="reference internal" href="api.html#compatibility-with-c-20-std-format">Compatibility with C++20 <code class="docutils literal notranslate"><span class="pre">std::format</span></code></a></li>
+</ul>
+</li>
+<li class="toctree-l1"><a class="reference internal" href="syntax.html">Format String Syntax</a><ul>
+<li class="toctree-l2"><a class="reference internal" href="syntax.html#format-specification-mini-language">Format Specification Mini-Language</a></li>
+<li class="toctree-l2"><a class="reference internal" href="syntax.html#chrono-format-specifications">Chrono Format Specifications</a></li>
+<li class="toctree-l2"><a class="reference internal" href="syntax.html#range-format-specifications">Range Format Specifications</a></li>
+<li class="toctree-l2"><a class="reference internal" href="syntax.html#format-examples">Format Examples</a></li>
+</ul>
+</li>
+</ul>
+</div>
+</section>
+
+
+    </div>
+  </div>
+</div>
+
+
+
+    <div class="footer" role="contentinfo">
+        &copy; Copyright 2012-present, Victor Zverovich.
+      Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
+    </div>
+
+<script src="_static/bootstrap.min.js"></script>
+
+  </body>
+</html>

externals/fmt/doc/html/genindex.html

@@ -0,0 +1,312 @@
+<!DOCTYPE html>
+
+
+<html lang="en">
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="X-UA-Compatible" content="IE=edge">
+    <meta name="viewport" content="width=device-width, initial-scale=1">
+    
+    
+    <title>Index &mdash; fmt 9.1.0 documentation</title>
+    
+    <link rel="stylesheet" href="_static/basic.css" type="text/css" />
+    <link rel="stylesheet" href="_static/pygments.css" type="text/css" />
+    <link rel="stylesheet" href="_static/breathe.css" type="text/css" />
+    
+    <script type="text/javascript">
+      var DOCUMENTATION_OPTIONS = {
+        URL_ROOT:    './',
+        VERSION:     '9.1.0',
+        COLLAPSE_INDEX: false,
+        FILE_SUFFIX: '.html',
+        LINK_SUFFIX: '.html',
+        SOURCELINK_SUFFIX: '.txt',
+        HAS_SOURCE:  true,
+        SOURCELINK_SUFFIX:  '.txt'
+      };
+    </script>
+    <script src="_static/jquery.js"></script>
+    <script src="_static/underscore.js"></script>
+    <script src="_static/doctools.js"></script>
+    <script src="_static/language_data.js"></script>
+    <link rel="index" title="Index" href="#" />
+    <link rel="search" title="Search" href="search.html" />
+<meta name="description" content="Small, safe and fast formatting library">
+<meta name="keywords" content="C++, formatting, printf, string, library">
+<meta name="author" content="Victor Zverovich">
+<link rel="stylesheet" href="_static/fmt.css">
+
+<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
+<script>
+  window.dataLayer = window.dataLayer || [];
+  function gtag(){dataLayer.push(arguments);}
+  gtag('js', new Date());
+
+  gtag('config', 'UA-20116650-4');
+</script>
+
+  </head>
+  <body role="document">
+<nav class="navbar navbar-inverse">
+  <div class="tb-container">
+    <div class="row">
+      <div class="navbar-content">
+        
+        <div class="navbar-header">
+          <button type="button" class="navbar-toggle collapsed"
+                  data-toggle="collapse" data-target=".navbar-collapse">
+            <span class="sr-only">Toggle navigation</span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+          </button>
+          <a class="navbar-brand" href="index.html">{fmt}</a>
+        </div>
+
+        
+        <div class="collapse navbar-collapse">
+          <ul class="nav navbar-nav">
+            <li class="dropdown">
+              <a href="#" class="dropdown-toggle" data-toggle="dropdown"
+                 role="button" aria-expanded="false">9.1.0
+                <span class="caret"></span></a>
+              <ul class="dropdown-menu" role="menu">
+                
+                <li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
+                
+                <li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
+                
+                <li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
+                
+              </ul>
+            </li>
+            
+              
+              <li><a href="contents.html">Contents</a></li>
+              
+            
+              
+              <li><a href="usage.html">Usage</a></li>
+              
+            
+              
+              <li><a href="api.html">API</a></li>
+              
+            
+              
+              <li><a href="syntax.html">Syntax</a></li>
+              
+            
+          </ul>
+          
+            
+<form class="navbar-form navbar-right" role="search" action="search.html"
+      method="get">
+  <div class="form-group">
+    <input type="text" name="q" class="form-control"
+           placeholder="Search" >
+  </div>
+  <input type="hidden" name="check_keywords" value="yes" />
+  <input type="hidden" name="area" value="default" />
+  
+</form>
+          
+        </div> 
+      </div> 
+    </div> 
+  </div> 
+</nav>
+
+
+
+<div class="tb-container">
+  <div class="row">
+    
+
+    <div class="content">
+      
+
+<h1 id="index">Index</h1>
+
+<div class="genindex-jumpbox">
+ <a href="#F"><strong>F</strong></a>
+ 
+</div>
+<h2 id="F">F</h2>
+<table style="width: 100%" class="indextable genindextable"><tr>
+  <td style="width: 33%; vertical-align: top;"><ul>
+      <li><a href="api.html#_CPPv4I00EN3fmt3argEN6detail9named_argI4Char1TEEPK4CharRK1T">fmt::arg (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt16basic_format_argE">fmt::basic_format_arg (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt17basic_format_argsE">fmt::basic_format_args (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4IDpEN3fmt17basic_format_args17basic_format_argsERK16format_arg_storeI7ContextDp4ArgsE">fmt::basic_format_args::basic_format_args (C++ function)</a>, <a href="api.html#_CPPv4N3fmt17basic_format_args17basic_format_argsEPK10format_argi">[1]</a>, <a href="api.html#_CPPv4N3fmt17basic_format_args17basic_format_argsERK24dynamic_format_arg_storeI7ContextE">[2]</a>
+</li>
+      <li><a href="api.html#_CPPv4NK3fmt17basic_format_args3getEi">fmt::basic_format_args::get (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I00EN3fmt20basic_format_contextE">fmt::basic_format_context (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt20basic_format_context20basic_format_contextE8OutputIt17basic_format_argsI20basic_format_contextEN6detail10locale_refE">fmt::basic_format_context::basic_format_context (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt20basic_format_context9char_typeE">fmt::basic_format_context::char_type (C++ type)</a>
+</li>
+      <li><a href="api.html#_CPPv4I00EN3fmt26basic_format_parse_contextE">fmt::basic_format_parse_context (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt26basic_format_parse_context10advance_toE8iterator">fmt::basic_format_parse_context::advance_to (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4NK3fmt26basic_format_parse_context5beginEv">fmt::basic_format_parse_context::begin (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt26basic_format_parse_context12check_arg_idEi">fmt::basic_format_parse_context::check_arg_id (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4NK3fmt26basic_format_parse_context3endEv">fmt::basic_format_parse_context::end (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt26basic_format_parse_context11next_arg_idEv">fmt::basic_format_parse_context::next_arg_id (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0DpEN3fmt19basic_format_stringE">fmt::basic_format_string (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0_6size_t0EN3fmt19basic_memory_bufferE">fmt::basic_memory_buffer (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt19basic_memory_buffer19basic_memory_bufferERR19basic_memory_buffer">fmt::basic_memory_buffer::basic_memory_buffer (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt19basic_memory_buffer4growE6size_t">fmt::basic_memory_buffer::grow (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt19basic_memory_bufferaSERR19basic_memory_buffer">fmt::basic_memory_buffer::operator= (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt19basic_memory_buffer7reserveE6size_t">fmt::basic_memory_buffer::reserve (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt19basic_memory_buffer6resizeE6size_t">fmt::basic_memory_buffer::resize (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt17basic_string_viewE">fmt::basic_string_view (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4I00EN3fmt17basic_string_view17basic_string_viewERKNSt12basic_stringI4Char6Traits5AllocEE">fmt::basic_string_view::basic_string_view (C++ function)</a>, <a href="api.html#_CPPv4N3fmt17basic_string_view17basic_string_viewEPK4Char">[1]</a>, <a href="api.html#_CPPv4N3fmt17basic_string_view17basic_string_viewEPK4Char6size_t">[2]</a>
+</li>
+      <li><a href="api.html#_CPPv4NK3fmt17basic_string_view4dataEv">fmt::basic_string_view::data (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4NK3fmt17basic_string_view4sizeEv">fmt::basic_string_view::size (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt2bgEN6detail10color_typeE">fmt::bg (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt6detail6bufferE">fmt::detail::buffer (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt6detail6buffer6appendEvPK1UPK1U">fmt::detail::buffer::append (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4NK3fmt6detail6buffer8capacityEv">fmt::detail::buffer::capacity (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt6detail6buffer5clearEv">fmt::detail::buffer::clear (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt6detail6buffer4dataEv">fmt::detail::buffer::data (C++ function)</a>, <a href="api.html#_CPPv4NK3fmt6detail6buffer4dataEv">[1]</a>
+</li>
+      <li><a href="api.html#_CPPv4NK3fmt6detail6buffer4sizeEv">fmt::detail::buffer::size (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt24dynamic_format_arg_storeE">fmt::dynamic_format_arg_store (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt2fgEN6detail10color_typeE">fmt::fg (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4IDpEN3fmt6formatENSt6stringE13format_stringIDp1TEDpRR1T">fmt::format (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0DpEN3fmt16format_arg_storeE">fmt::format_arg_store (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt11format_argsE">fmt::format_args (C++ type)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt14format_contextE">fmt::format_context (C++ type)</a>
+</li>
+  </ul></td>
+  <td style="width: 33%; vertical-align: top;"><ul>
+      <li><a href="api.html#_CPPv4IDpEN3fmt13format_stringE">fmt::format_string (C++ type)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt19format_system_errorERN6detail6bufferIcEEiPKc">fmt::format_system_error (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0DpEN3fmt9format_toE8OutputIt8OutputIt13format_stringIDp1TEDpRR1T">fmt::format_to (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0DpEN3fmt11format_to_nE18format_to_n_resultI8OutputItE8OutputIt6size_t13format_stringIDp1TEDpRR1T">fmt::format_to_n (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt18format_to_n_resultE">fmt::format_to_n_result (C++ struct)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt18format_to_n_result3outE">fmt::format_to_n_result::out (C++ member)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt18format_to_n_result4sizeE">fmt::format_to_n_result::size (C++ member)</a>
+</li>
+      <li><a href="api.html#_CPPv4IDpEN3fmt14formatted_sizeE6size_t13format_stringIDp1TEDpRR1T">fmt::formatted_size (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0Dp0EN3fmt7fprintfEiPNSt4FILEERK1SDpRK1T">fmt::fprintf (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt6gmtimeENSt6time_tE">fmt::gmtime (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt12group_digitsE17group_digits_viewI1TE1T">fmt::group_digits (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt7is_charE">fmt::is_char (C++ struct)</a>
+</li>
+      <li><a href="api.html#_CPPv4I00EN3fmt4joinE9join_viewI2It8SentinelE2It8Sentinel11string_view">fmt::join (C++ function)</a>, <a href="api.html#_CPPv4I0EN3fmt4joinE9join_viewIN6detail10iterator_tI5RangeEEN6detail10sentinel_tI5RangeEEERR5Range11string_view">[1]</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt9localtimeENSt6time_tE">fmt::localtime (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0DpEN3fmt16make_format_argsE16format_arg_storeI7ContextDp14remove_cvref_tI4ArgsEEDpRR4Args">fmt::make_format_args (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I_N15detail_exported12fixed_stringEEN3fmtli2_aEDav">fmt::operator&#34;&#34;_a (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I_N15detail_exported12fixed_stringEEN3fmtli3_cfEDav">fmt::operator&#34;&#34;_cf (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt7ostreamE">fmt::ostream (C++ class)</a>
+</li>
+      <li><a href="api.html#_CPPv4IDpEN3fmt7ostream11output_fileE7ostream12cstring_viewDp1T">fmt::ostream::output_file (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4IDpEN3fmt7ostream5printEv13format_stringIDp1TEDpRR1T">fmt::ostream::print (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0DpEN3fmt5printEvRK10text_styleRK1SDpRK4Args">fmt::print (C++ function)</a>, <a href="api.html#_CPPv4IDpEN3fmt5printEv13format_stringIDp1TEDpRR1T">[1]</a>, <a href="api.html#_CPPv4IDpEN3fmt5printEvPNSt4FILEE13format_stringIDp1TEDpRR1T">[2]</a>, <a href="api.html#_CPPv4IDpEN3fmt5printEvRNSt7ostreamE13format_stringIDp1TEDpRR1T">[3]</a>
+</li>
+      <li><a href="api.html#_CPPv4I0DpEN3fmt6printfEiRK1SDpRK1T">fmt::printf (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt3ptrEPKv1T">fmt::ptr (C++ function)</a>, <a href="api.html#_CPPv4I0EN3fmt3ptrEPKvRKNSt10shared_ptrI1TEE">[1]</a>, <a href="api.html#_CPPv4I0EN3fmt3ptrEPKvRKNSt10unique_ptrI1TEE">[2]</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt7runtimeE11string_view">fmt::runtime (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0Dp0EN3fmt7sprintfENSt12basic_stringI4CharEERK1SDpRK1T">fmt::sprintf (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt8streamedEN6detail13streamed_viewI1TEERK1T">fmt::streamed (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt11string_viewE">fmt::string_view (C++ type)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt6styledEN6detail10styled_argI14remove_cvref_tI1TEEERK1T10text_style">fmt::styled (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4IDpEN3fmt12system_errorENSt12system_errorEi13format_stringIDp1TEDpRR1T">fmt::system_error (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt9to_stringENSt6stringERK1T">fmt::to_string (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt10to_wstringENSt7wstringERK1T">fmt::to_wstring (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4I0EN3fmt10underlyingE12underlying_tI4EnumE4Enum">fmt::underlying (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt7vformatE11string_view11format_args">fmt::vformat (C++ function)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt6vprintE11string_view11format_args">fmt::vprint (C++ function)</a>, <a href="api.html#_CPPv4N3fmt6vprintEPNSt4FILEE11string_view11format_args">[1]</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt15wformat_contextE">fmt::wformat_context (C++ type)</a>
+</li>
+      <li><a href="api.html#_CPPv4N3fmt12wstring_viewE">fmt::wstring_view (C++ type)</a>
+</li>
+      <li><a href="api.html#c.FMT_COMPILE">FMT_COMPILE (C macro)</a>
+</li>
+      <li><a href="api.html#c.FMT_STRING">FMT_STRING (C macro)</a>
+</li>
+  </ul></td>
+</tr></table>
+
+
+
+    </div>
+  </div>
+</div>
+
+
+
+    <div class="footer" role="contentinfo">
+        &copy; Copyright 2012-present, Victor Zverovich.
+      Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
+    </div>
+
+<script src="_static/bootstrap.min.js"></script>
+
+  </body>
+</html>

externals/fmt/doc/html/index.html

@@ -0,0 +1,325 @@
+<!DOCTYPE html>
+
+
+<html lang="en">
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="X-UA-Compatible" content="IE=edge">
+    <meta name="viewport" content="width=device-width, initial-scale=1">
+    
+    <meta name="generator" content="Docutils 0.17.1: http://docutils.sourceforge.net/" />
+
+    <title>Overview &mdash; fmt 9.1.0 documentation</title>
+    
+    <link rel="stylesheet" href="_static/basic.css" type="text/css" />
+    <link rel="stylesheet" href="_static/pygments.css" type="text/css" />
+    <link rel="stylesheet" href="_static/breathe.css" type="text/css" />
+    
+    <script type="text/javascript">
+      var DOCUMENTATION_OPTIONS = {
+        URL_ROOT:    './',
+        VERSION:     '9.1.0',
+        COLLAPSE_INDEX: false,
+        FILE_SUFFIX: '.html',
+        LINK_SUFFIX: '.html',
+        SOURCELINK_SUFFIX: '.txt',
+        HAS_SOURCE:  true,
+        SOURCELINK_SUFFIX:  '.txt'
+      };
+    </script>
+    <script src="_static/jquery.js"></script>
+    <script src="_static/underscore.js"></script>
+    <script src="_static/doctools.js"></script>
+    <script src="_static/language_data.js"></script>
+    <link rel="index" title="Index" href="genindex.html" />
+    <link rel="search" title="Search" href="search.html" />
+<meta name="description" content="Small, safe and fast formatting library">
+<meta name="keywords" content="C++, formatting, printf, string, library">
+<meta name="author" content="Victor Zverovich">
+<link rel="stylesheet" href="_static/fmt.css">
+
+<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
+<script>
+  window.dataLayer = window.dataLayer || [];
+  function gtag(){dataLayer.push(arguments);}
+  gtag('js', new Date());
+
+  gtag('config', 'UA-20116650-4');
+</script>
+
+  </head>
+  <body role="document">
+<nav class="navbar navbar-inverse">
+  <div class="tb-container">
+    <div class="row">
+      <div class="navbar-content">
+        
+        <div class="navbar-header">
+          <button type="button" class="navbar-toggle collapsed"
+                  data-toggle="collapse" data-target=".navbar-collapse">
+            <span class="sr-only">Toggle navigation</span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+          </button>
+          <a class="navbar-brand" href="index.html">{fmt}</a>
+        </div>
+
+        
+        <div class="collapse navbar-collapse">
+          <ul class="nav navbar-nav">
+            <li class="dropdown">
+              <a href="#" class="dropdown-toggle" data-toggle="dropdown"
+                 role="button" aria-expanded="false">9.1.0
+                <span class="caret"></span></a>
+              <ul class="dropdown-menu" role="menu">
+                
+                <li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
+                
+                <li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
+                
+                <li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
+                
+              </ul>
+            </li>
+            
+              
+              <li><a href="contents.html">Contents</a></li>
+              
+            
+              
+              <li><a href="usage.html">Usage</a></li>
+              
+            
+              
+              <li><a href="api.html">API</a></li>
+              
+            
+              
+              <li><a href="syntax.html">Syntax</a></li>
+              
+            
+          </ul>
+          
+            
+<form class="navbar-form navbar-right" role="search" action="search.html"
+      method="get">
+  <div class="form-group">
+    <input type="text" name="q" class="form-control"
+           placeholder="Search" >
+  </div>
+  <input type="hidden" name="check_keywords" value="yes" />
+  <input type="hidden" name="area" value="default" />
+  
+</form>
+          
+        </div> 
+      </div> 
+    </div> 
+  </div> 
+</nav>
+
+
+<div class="jumbotron">
+  <div class="tb-container">
+    <h1>{fmt}</h1>
+    <p class="lead">A modern formatting library</p>
+    <div class="btn-group" role="group">
+      
+      <a class="btn btn-success"
+         href="https://github.com/fmtlib/fmt/releases/download/9.1.0/fmt-9.1.0.zip">
+           <span class="glyphicon glyphicon-download"></span> Download
+      </a>
+      <button type="button" class="btn btn-success dropdown-toggle"
+        data-toggle="dropdown"><span class="caret"></span></button>
+      <ul class="dropdown-menu">
+      
+      
+        <li><a href="https://github.com/fmtlib/fmt/releases/download/9.1.0/fmt-9.1.0.zip">Version 9.1.0
+          </a></li>
+      
+      
+        <li><a href="https://github.com/fmtlib/fmt/releases/download/9.0.0/fmt-9.0.0.zip">Version 9.0.0
+          </a></li>
+      
+      
+        <li><a href="https://github.com/fmtlib/fmt/releases/download/8.1.1/fmt-8.1.1.zip">Version 8.1.1
+          </a></li>
+      
+      </ul>
+    </div>
+  </div>
+</div>
+
+
+
+<div class="tb-container">
+  <div class="row">
+    
+
+    <div class="content">
+      
+  <section id="overview">
+<h1>Overview<a class="headerlink" href="#overview" title="Permalink to this headline">¶</a></h1>
+<p><strong>{fmt}</strong> is an open-source formatting library providing a fast and safe
+alternative to C stdio and C++ iostreams.</p>
+<div class="panel panel-default">
+  <div class="panel-heading">What users say:</div>
+  <div class="panel-body">
+    Thanks for creating this library. It’s been a hole in C++ for
+    a long time. I’ve used both <code>boost::format</code> and
+    <code>loki::SPrintf</code>, and neither felt like the right answer.
+    This does.
+  </div>
+</div><section id="format-api">
+<span id="format-api-intro"></span><h2>Format API<a class="headerlink" href="#format-api" title="Permalink to this headline">¶</a></h2>
+<p>The format API is similar in spirit to the C <code class="docutils literal notranslate"><span class="pre">printf</span></code> family of function but
+is safer, simpler and several times <a class="reference external" href="https://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html">faster</a>
+than common standard library implementations.
+The <a class="reference external" href="syntax.html">format string syntax</a> is similar to the one used by
+<a class="reference external" href="https://docs.python.org/3/library/stdtypes.html#str.format">str.format</a> in
+Python:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">std</span><span class="o">::</span><span class="n">string</span><span class="w"> </span><span class="n">s</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;The answer is {}.&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
+</pre></div>
+</div>
+<p>The <code class="docutils literal notranslate"><span class="pre">fmt::format</span></code> function returns a string “The answer is 42.”. You can use
+<code class="docutils literal notranslate"><span class="pre">fmt::memory_buffer</span></code> to avoid constructing <code class="docutils literal notranslate"><span class="pre">std::string</span></code>:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="k">auto</span><span class="w"> </span><span class="n">out</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">memory_buffer</span><span class="p">();</span><span class="w"></span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format_to</span><span class="p">(</span><span class="n">std</span><span class="o">::</span><span class="n">back_inserter</span><span class="p">(</span><span class="n">out</span><span class="p">),</span><span class="w"></span>
+<span class="w">          </span><span class="s">&quot;For a moment, {} happened.&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;nothing&quot;</span><span class="p">);</span><span class="w"></span>
+<span class="k">auto</span><span class="w"> </span><span class="n">data</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">out</span><span class="p">.</span><span class="n">data</span><span class="p">();</span><span class="w"> </span><span class="c1">// pointer to the formatted data</span>
+<span class="k">auto</span><span class="w"> </span><span class="n">size</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">out</span><span class="p">.</span><span class="n">size</span><span class="p">();</span><span class="w"> </span><span class="c1">// size of the formatted data</span>
+</pre></div>
+</div>
+<p>The <code class="docutils literal notranslate"><span class="pre">fmt::print</span></code> function performs formatting and writes the result to a stream:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="n">stderr</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;System error code = {}</span><span class="se">\n</span><span class="s">&quot;</span><span class="p">,</span><span class="w"> </span><span class="n">errno</span><span class="p">);</span><span class="w"></span>
+</pre></div>
+</div>
+<p>If you omit the file argument the function will print to <code class="docutils literal notranslate"><span class="pre">stdout</span></code>:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">&quot;Don&#39;t {}</span><span class="se">\n</span><span class="s">&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;panic&quot;</span><span class="p">);</span><span class="w"></span>
+</pre></div>
+</div>
+<p>The format API also supports positional arguments useful for localization:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">&quot;I&#39;d rather be {1} than {0}.&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;right&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;happy&quot;</span><span class="p">);</span><span class="w"></span>
+</pre></div>
+</div>
+<p>You can pass named arguments with <code class="docutils literal notranslate"><span class="pre">fmt::arg</span></code>:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">&quot;Hello, {name}! The answer is {number}. Goodbye, {name}.&quot;</span><span class="p">,</span><span class="w"></span>
+<span class="w">           </span><span class="n">fmt</span><span class="o">::</span><span class="n">arg</span><span class="p">(</span><span class="s">&quot;name&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;World&quot;</span><span class="p">),</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">arg</span><span class="p">(</span><span class="s">&quot;number&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">));</span><span class="w"></span>
+</pre></div>
+</div>
+<p>If your compiler supports C++11 user-defined literals, the suffix <code class="docutils literal notranslate"><span class="pre">_a</span></code> offers
+an alternative, slightly terser syntax for named arguments:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="k">using</span><span class="w"> </span><span class="k">namespace</span><span class="w"> </span><span class="nn">fmt</span><span class="o">::</span><span class="nn">literals</span><span class="p">;</span><span class="w"></span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">&quot;Hello, {name}! The answer is {number}. Goodbye, {name}.&quot;</span><span class="p">,</span><span class="w"></span>
+<span class="w">           </span><span class="s">&quot;name&quot;</span><span class="n">_a</span><span class="o">=</span><span class="s">&quot;World&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;number&quot;</span><span class="n">_a</span><span class="o">=</span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
+</pre></div>
+</div>
+</section>
+<section id="safety">
+<span id="id1"></span><h2>Safety<a class="headerlink" href="#safety" title="Permalink to this headline">¶</a></h2>
+<p>The library is fully type safe, automatic memory management prevents buffer
+overflow, errors in format strings are reported using exceptions or at compile
+time. For example, the code</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;The answer is {:d}&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;forty-two&quot;</span><span class="p">);</span><span class="w"></span>
+</pre></div>
+</div>
+<p>throws the <code class="docutils literal notranslate"><span class="pre">format_error</span></code> exception because the argument <code class="docutils literal notranslate"><span class="pre">&quot;forty-two&quot;</span></code> is a
+string while the format code <code class="docutils literal notranslate"><span class="pre">d</span></code> only applies to integers.</p>
+<p>The code</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">format</span><span class="p">(</span><span class="n">FMT_STRING</span><span class="p">(</span><span class="s">&quot;The answer is {:d}&quot;</span><span class="p">),</span><span class="w"> </span><span class="s">&quot;forty-two&quot;</span><span class="p">);</span><span class="w"></span>
+</pre></div>
+</div>
+<p>reports a compile-time error on compilers that support relaxed <code class="docutils literal notranslate"><span class="pre">constexpr</span></code>.
+See <a class="reference external" href="api.html#compile-time-format-string-checks">here</a> for details.</p>
+<p>The following code</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span>fmt::format(&quot;Cyrillic letter {}&quot;, L&#39;\x42e&#39;);
+</pre></div>
+</div>
+<p>produces a compile-time error because wide character <code class="docutils literal notranslate"><span class="pre">L'\x42e'</span></code> cannot be
+formatted into a narrow string. For comparison, writing a wide character to
+<code class="docutils literal notranslate"><span class="pre">std::ostream</span></code> results in its numeric value being written to the stream
+(i.e. 1070 instead of letter ‘ю’ which is represented by <code class="docutils literal notranslate"><span class="pre">L'\x42e'</span></code> if we
+use Unicode) which is rarely desirable.</p>
+</section>
+<section id="compact-binary-code">
+<h2>Compact Binary Code<a class="headerlink" href="#compact-binary-code" title="Permalink to this headline">¶</a></h2>
+<p>The library produces compact per-call compiled code. For example
+(<a class="reference external" href="https://godbolt.org/g/TZU4KF">godbolt</a>),</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="cp">#include</span><span class="w"> </span><span class="cpf">&lt;fmt/core.h&gt;</span><span class="cp"></span>
+
+<span class="kt">int</span><span class="w"> </span><span class="nf">main</span><span class="p">()</span><span class="w"> </span><span class="p">{</span><span class="w"></span>
+<span class="w">  </span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">&quot;The answer is {}.&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
+<span class="p">}</span><span class="w"></span>
+</pre></div>
+</div>
+<p>compiles to just</p>
+<div class="highlight-asm notranslate"><div class="highlight"><pre><span></span>main: # @main
+  sub rsp, 24
+  mov qword ptr [rsp], 42
+  mov rcx, rsp
+  mov edi, offset .L.str
+  mov esi, 17
+  mov edx, 1
+  call fmt::v7::vprint(fmt::v7::basic_string_view&lt;char&gt;, fmt::v7::format_args)
+  xor eax, eax
+  add rsp, 24
+  ret
+.L.str:
+  .asciz &quot;The answer is {}.&quot;
+</pre></div>
+</div>
+</section>
+<section id="portability">
+<span id="id2"></span><h2>Portability<a class="headerlink" href="#portability" title="Permalink to this headline">¶</a></h2>
+<p>The library is highly portable and relies only on a small set of C++11 features:</p>
+<ul class="simple">
+<li><p>variadic templates</p></li>
+<li><p>type traits</p></li>
+<li><p>rvalue references</p></li>
+<li><p>decltype</p></li>
+<li><p>trailing return types</p></li>
+<li><p>deleted functions</p></li>
+<li><p>alias templates</p></li>
+</ul>
+<p>These are available in GCC 4.8, Clang 3.4, MSVC 19.0 (2015) and more recent
+compiler version. For older compilers use {fmt} <a class="reference external" href="https://github.com/fmtlib/fmt/releases/tag/4.1.0">version 4.x</a> which is maintained and
+only requires C++98.</p>
+<p>The output of all formatting functions is consistent across platforms.
+For example,</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">&quot;{}&quot;</span><span class="p">,</span><span class="w"> </span><span class="n">std</span><span class="o">::</span><span class="n">numeric_limits</span><span class="o">&lt;</span><span class="kt">double</span><span class="o">&gt;::</span><span class="n">infinity</span><span class="p">());</span><span class="w"></span>
+</pre></div>
+</div>
+<p>always prints <code class="docutils literal notranslate"><span class="pre">inf</span></code> while the output of <code class="docutils literal notranslate"><span class="pre">printf</span></code> is platform-dependent.</p>
+</section>
+<section id="ease-of-use">
+<span id="id3"></span><h2>Ease of Use<a class="headerlink" href="#ease-of-use" title="Permalink to this headline">¶</a></h2>
+<p>{fmt} has a small self-contained code base with the core library consisting of
+just three header files and no external dependencies.
+A permissive MIT <a class="reference external" href="https://github.com/fmtlib/fmt#license">license</a> allows
+using the library both in open-source and commercial projects.</p>
+<p><a class="reference external" href="contents.html">Learn more…</a></p>
+<a class="btn btn-success" href="https://github.com/fmtlib/fmt">GitHub Repository</a>
+
+<div class="section footer">
+  <iframe src="https://ghbtns.com/github-btn.html?user=fmtlib&amp;repo=fmt&amp;type=watch&amp;count=true"
+          class="github-btn" width="100" height="20"></iframe>
+</div></section>
+</section>
+
+
+    </div>
+  </div>
+</div>
+
+
+
+    <div class="footer" role="contentinfo">
+        &copy; Copyright 2012-present, Victor Zverovich.
+      Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
+    </div>
+
+<script src="_static/bootstrap.min.js"></script>
+
+  </body>
+</html>

externals/fmt/doc/html/search.html

@@ -0,0 +1,171 @@
+<!DOCTYPE html>
+
+
+<html lang="en">
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="X-UA-Compatible" content="IE=edge">
+    <meta name="viewport" content="width=device-width, initial-scale=1">
+    
+    
+    <title>Search &mdash; fmt 9.1.0 documentation</title>
+    
+    <link rel="stylesheet" href="_static/basic.css" type="text/css" />
+    <link rel="stylesheet" href="_static/pygments.css" type="text/css" />
+    <link rel="stylesheet" href="_static/breathe.css" type="text/css" />
+    
+    <script type="text/javascript">
+      var DOCUMENTATION_OPTIONS = {
+        URL_ROOT:    './',
+        VERSION:     '9.1.0',
+        COLLAPSE_INDEX: false,
+        FILE_SUFFIX: '.html',
+        LINK_SUFFIX: '.html',
+        SOURCELINK_SUFFIX: '.txt',
+        HAS_SOURCE:  true,
+        SOURCELINK_SUFFIX:  '.txt'
+      };
+    </script>
+    <script src="_static/jquery.js"></script>
+    <script src="_static/underscore.js"></script>
+    <script src="_static/doctools.js"></script>
+    <script src="_static/language_data.js"></script>
+    <script src="_static/searchtools.js"></script>
+    <link rel="index" title="Index" href="genindex.html" />
+    <link rel="search" title="Search" href="#" />
+  <script type="text/javascript">
+    jQuery(function() { Search.loadIndex("searchindex.js"); });
+  </script>
+  
+  <script type="text/javascript" id="searchindexloader"></script>
+  
+<meta name="description" content="Small, safe and fast formatting library">
+<meta name="keywords" content="C++, formatting, printf, string, library">
+<meta name="author" content="Victor Zverovich">
+<link rel="stylesheet" href="_static/fmt.css">
+
+<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
+<script>
+  window.dataLayer = window.dataLayer || [];
+  function gtag(){dataLayer.push(arguments);}
+  gtag('js', new Date());
+
+  gtag('config', 'UA-20116650-4');
+</script>
+
+
+  </head>
+  <body role="document">
+<nav class="navbar navbar-inverse">
+  <div class="tb-container">
+    <div class="row">
+      <div class="navbar-content">
+        
+        <div class="navbar-header">
+          <button type="button" class="navbar-toggle collapsed"
+                  data-toggle="collapse" data-target=".navbar-collapse">
+            <span class="sr-only">Toggle navigation</span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+          </button>
+          <a class="navbar-brand" href="index.html">{fmt}</a>
+        </div>
+
+        
+        <div class="collapse navbar-collapse">
+          <ul class="nav navbar-nav">
+            <li class="dropdown">
+              <a href="#" class="dropdown-toggle" data-toggle="dropdown"
+                 role="button" aria-expanded="false">9.1.0
+                <span class="caret"></span></a>
+              <ul class="dropdown-menu" role="menu">
+                
+                <li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
+                
+                <li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
+                
+                <li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
+                
+              </ul>
+            </li>
+            
+              
+              <li><a href="contents.html">Contents</a></li>
+              
+            
+              
+              <li><a href="usage.html">Usage</a></li>
+              
+            
+              
+              <li><a href="api.html">API</a></li>
+              
+            
+              
+              <li><a href="syntax.html">Syntax</a></li>
+              
+            
+          </ul>
+          
+        </div> 
+      </div> 
+    </div> 
+  </div> 
+</nav>
+
+
+
+<div class="tb-container">
+  <div class="row">
+    
+
+    <div class="content">
+      
+  <h1 id="search-documentation">Search</h1>
+  <div id="fallback" class="admonition warning">
+  <script type="text/javascript">$('#fallback').hide();</script>
+  <p>
+    Please activate JavaScript to enable the search
+    functionality.
+  </p>
+  </div>
+  <p>
+    From here you can search these documents. Enter your search
+    words into the box below and click "search". Note that the search
+    function will automatically search for all of the words. Pages
+    containing fewer words won't appear in the result list.
+  </p>
+  
+<form class="form-inline" role="search" action="#"
+      method="get">
+  <div class="form-group">
+    <input type="text" name="q" class="form-control"
+            >
+  </div>
+  <input type="hidden" name="check_keywords" value="yes" />
+  <input type="hidden" name="area" value="default" />
+  
+    <input type="submit" class="btn btn-default" value="search">
+  
+</form>
+  
+  <div id="search-results">
+  
+  </div>
+
+    </div>
+  </div>
+</div>
+
+
+
+    <div class="footer" role="contentinfo">
+        &copy; Copyright 2012-present, Victor Zverovich.
+      Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
+    </div>
+
+<script src="_static/bootstrap.min.js"></script>
+
+  </body>
+</html>

externals/fmt/doc/html/syntax.html

@@ -0,0 +1,657 @@
+<!DOCTYPE html>
+
+
+<html lang="en">
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="X-UA-Compatible" content="IE=edge">
+    <meta name="viewport" content="width=device-width, initial-scale=1">
+    
+    <meta name="generator" content="Docutils 0.17.1: http://docutils.sourceforge.net/" />
+
+    <title>Format String Syntax &mdash; fmt 9.1.0 documentation</title>
+    
+    <link rel="stylesheet" href="_static/basic.css" type="text/css" />
+    <link rel="stylesheet" href="_static/pygments.css" type="text/css" />
+    <link rel="stylesheet" href="_static/breathe.css" type="text/css" />
+    
+    <script type="text/javascript">
+      var DOCUMENTATION_OPTIONS = {
+        URL_ROOT:    './',
+        VERSION:     '9.1.0',
+        COLLAPSE_INDEX: false,
+        FILE_SUFFIX: '.html',
+        LINK_SUFFIX: '.html',
+        SOURCELINK_SUFFIX: '.txt',
+        HAS_SOURCE:  true,
+        SOURCELINK_SUFFIX:  '.txt'
+      };
+    </script>
+    <script src="_static/jquery.js"></script>
+    <script src="_static/underscore.js"></script>
+    <script src="_static/doctools.js"></script>
+    <script src="_static/language_data.js"></script>
+    <link rel="index" title="Index" href="genindex.html" />
+    <link rel="search" title="Search" href="search.html" />
+<meta name="description" content="Small, safe and fast formatting library">
+<meta name="keywords" content="C++, formatting, printf, string, library">
+<meta name="author" content="Victor Zverovich">
+<link rel="stylesheet" href="_static/fmt.css">
+
+<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
+<script>
+  window.dataLayer = window.dataLayer || [];
+  function gtag(){dataLayer.push(arguments);}
+  gtag('js', new Date());
+
+  gtag('config', 'UA-20116650-4');
+</script>
+
+  </head>
+  <body role="document">
+<nav class="navbar navbar-inverse">
+  <div class="tb-container">
+    <div class="row">
+      <div class="navbar-content">
+        
+        <div class="navbar-header">
+          <button type="button" class="navbar-toggle collapsed"
+                  data-toggle="collapse" data-target=".navbar-collapse">
+            <span class="sr-only">Toggle navigation</span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+          </button>
+          <a class="navbar-brand" href="index.html">{fmt}</a>
+        </div>
+
+        
+        <div class="collapse navbar-collapse">
+          <ul class="nav navbar-nav">
+            <li class="dropdown">
+              <a href="#" class="dropdown-toggle" data-toggle="dropdown"
+                 role="button" aria-expanded="false">9.1.0
+                <span class="caret"></span></a>
+              <ul class="dropdown-menu" role="menu">
+                
+                <li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
+                
+                <li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
+                
+                <li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
+                
+              </ul>
+            </li>
+            
+              
+              <li><a href="contents.html">Contents</a></li>
+              
+            
+              
+              <li><a href="usage.html">Usage</a></li>
+              
+            
+              
+              <li><a href="api.html">API</a></li>
+              
+            
+              
+              <li class="active"><a href="syntax.html">Syntax
+                <span class="sr-only">(current)</span></a></li>
+              
+            
+          </ul>
+          
+            
+<form class="navbar-form navbar-right" role="search" action="search.html"
+      method="get">
+  <div class="form-group">
+    <input type="text" name="q" class="form-control"
+           placeholder="Search" >
+  </div>
+  <input type="hidden" name="check_keywords" value="yes" />
+  <input type="hidden" name="area" value="default" />
+  
+</form>
+          
+        </div> 
+      </div> 
+    </div> 
+  </div> 
+</nav>
+
+
+
+<div class="tb-container">
+  <div class="row">
+    
+
+    <div class="content">
+      
+  <section id="format-string-syntax">
+<span id="syntax"></span><h1>Format String Syntax<a class="headerlink" href="#format-string-syntax" title="Permalink to this headline">¶</a></h1>
+<p>Formatting functions such as <a class="reference internal" href="api.html#format"><span class="std std-ref">fmt::format()</span></a> and
+<a class="reference internal" href="api.html#print"><span class="std std-ref">fmt::print()</span></a> use the same format string syntax described in this
+section.</p>
+<p>Format strings contain “replacement fields” surrounded by curly braces <code class="docutils literal notranslate"><span class="pre">{}</span></code>.
+Anything that is not contained in braces is considered literal text, which is
+copied unchanged to the output.  If you need to include a brace character in the
+literal text, it can be escaped by doubling: <code class="docutils literal notranslate"><span class="pre">{{</span></code> and <code class="docutils literal notranslate"><span class="pre">}}</span></code>.</p>
+<p>The grammar for a replacement field is as follows:</p>
+<pre>
+<strong id="grammar-token-sf-replacement_field"><span id="grammar-token-replacement-field"></span>replacement_field</strong> ::=  &quot;{&quot; [<a class="reference internal" href="#grammar-token-sf-arg_id"><code class="xref docutils literal notranslate"><span class="pre">arg_id</span></code></a>] [&quot;:&quot; (<a class="reference internal" href="#grammar-token-sf-format_spec"><code class="xref docutils literal notranslate"><span class="pre">format_spec</span></code></a> | <a class="reference internal" href="#grammar-token-sf-chrono_format_spec"><code class="xref docutils literal notranslate"><span class="pre">chrono_format_spec</span></code></a>)] &quot;}&quot;
+<strong id="grammar-token-sf-arg_id"><span id="grammar-token-arg-id"></span>arg_id           </strong> ::=  <a class="reference internal" href="#grammar-token-sf-integer"><code class="xref docutils literal notranslate"><span class="pre">integer</span></code></a> | <a class="reference internal" href="#grammar-token-sf-identifier"><code class="xref docutils literal notranslate"><span class="pre">identifier</span></code></a>
+<strong id="grammar-token-sf-integer"><span id="grammar-token-integer"></span>integer          </strong> ::=  <a class="reference internal" href="#grammar-token-sf-digit"><code class="xref docutils literal notranslate"><span class="pre">digit</span></code></a>+
+<strong id="grammar-token-sf-digit"><span id="grammar-token-digit"></span>digit            </strong> ::=  &quot;0&quot;...&quot;9&quot;
+<strong id="grammar-token-sf-identifier"><span id="grammar-token-identifier"></span>identifier       </strong> ::=  <a class="reference internal" href="#grammar-token-sf-id_start"><code class="xref docutils literal notranslate"><span class="pre">id_start</span></code></a> <a class="reference internal" href="#grammar-token-sf-id_continue"><code class="xref docutils literal notranslate"><span class="pre">id_continue</span></code></a>*
+<strong id="grammar-token-sf-id_start"><span id="grammar-token-id-start"></span>id_start         </strong> ::=  &quot;a&quot;...&quot;z&quot; | &quot;A&quot;...&quot;Z&quot; | &quot;_&quot;
+<strong id="grammar-token-sf-id_continue"><span id="grammar-token-id-continue"></span>id_continue      </strong> ::=  <a class="reference internal" href="#grammar-token-sf-id_start"><code class="xref docutils literal notranslate"><span class="pre">id_start</span></code></a> | <a class="reference internal" href="#grammar-token-sf-digit"><code class="xref docutils literal notranslate"><span class="pre">digit</span></code></a>
+</pre>
+<p>In less formal terms, the replacement field can start with an <em>arg_id</em>
+that specifies the argument whose value is to be formatted and inserted into
+the output instead of the replacement field.
+The <em>arg_id</em> is optionally followed by a <em>format_spec</em>, which is preceded by a
+colon <code class="docutils literal notranslate"><span class="pre">':'</span></code>.  These specify a non-default format for the replacement value.</p>
+<p>See also the <a class="reference internal" href="#formatspec"><span class="std std-ref">Format Specification Mini-Language</span></a> section.</p>
+<p>If the numerical arg_ids in a format string are 0, 1, 2, … in sequence,
+they can all be omitted (not just some) and the numbers 0, 1, 2, … will be
+automatically inserted in that order.</p>
+<p>Named arguments can be referred to by their names or indices.</p>
+<p>Some simple format string examples:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="s">&quot;First, thou shalt count to {0}&quot;</span><span class="w"> </span><span class="c1">// References the first argument</span>
+<span class="s">&quot;Bring me a {}&quot;</span><span class="w">                  </span><span class="c1">// Implicitly references the first argument</span>
+<span class="s">&quot;From {} to {}&quot;</span><span class="w">                  </span><span class="c1">// Same as &quot;From {0} to {1}&quot;</span>
+</pre></div>
+</div>
+<p>The <em>format_spec</em> field contains a specification of how the value should be
+presented, including such details as field width, alignment, padding, decimal
+precision and so on.  Each value type can define its own “formatting
+mini-language” or interpretation of the <em>format_spec</em>.</p>
+<p>Most built-in types support a common formatting mini-language, which is
+described in the next section.</p>
+<p>A <em>format_spec</em> field can also include nested replacement fields in certain
+positions within it. These nested replacement fields can contain only an
+argument id; format specifications are not allowed. This allows the formatting
+of a value to be dynamically specified.</p>
+<p>See the <a class="reference internal" href="#formatexamples"><span class="std std-ref">Format Examples</span></a> section for some examples.</p>
+<section id="format-specification-mini-language">
+<span id="formatspec"></span><h2>Format Specification Mini-Language<a class="headerlink" href="#format-specification-mini-language" title="Permalink to this headline">¶</a></h2>
+<p>“Format specifications” are used within replacement fields contained within a
+format string to define how individual values are presented (see
+<a class="reference internal" href="#syntax"><span class="std std-ref">Format String Syntax</span></a>).  Each formattable type may define how the format
+specification is to be interpreted.</p>
+<p>Most built-in types implement the following options for format specifications,
+although some of the formatting options are only supported by the numeric types.</p>
+<p>The general form of a <em>standard format specifier</em> is:</p>
+<pre>
+<strong id="grammar-token-sf-format_spec"><span id="grammar-token-format-spec"></span>format_spec</strong> ::=  [[<a class="reference internal" href="#grammar-token-sf-fill"><code class="xref docutils literal notranslate"><span class="pre">fill</span></code></a>]<a class="reference internal" href="#grammar-token-sf-align"><code class="xref docutils literal notranslate"><span class="pre">align</span></code></a>][<a class="reference internal" href="#grammar-token-sf-sign"><code class="xref docutils literal notranslate"><span class="pre">sign</span></code></a>][&quot;#&quot;][&quot;0&quot;][<a class="reference internal" href="#grammar-token-sf-width"><code class="xref docutils literal notranslate"><span class="pre">width</span></code></a>][&quot;.&quot; <a class="reference internal" href="#grammar-token-sf-precision"><code class="xref docutils literal notranslate"><span class="pre">precision</span></code></a>][&quot;L&quot;][<a class="reference internal" href="#grammar-token-sf-type"><code class="xref docutils literal notranslate"><span class="pre">type</span></code></a>]
+<strong id="grammar-token-sf-fill"><span id="grammar-token-fill"></span>fill       </strong> ::=  &lt;a character other than '{' or '}'&gt;
+<strong id="grammar-token-sf-align"><span id="grammar-token-align"></span>align      </strong> ::=  &quot;&lt;&quot; | &quot;&gt;&quot; | &quot;^&quot;
+<strong id="grammar-token-sf-sign"><span id="grammar-token-sign"></span>sign       </strong> ::=  &quot;+&quot; | &quot;-&quot; | &quot; &quot;
+<strong id="grammar-token-sf-width"><span id="grammar-token-width"></span>width      </strong> ::=  <a class="reference internal" href="#grammar-token-sf-integer"><code class="xref docutils literal notranslate"><span class="pre">integer</span></code></a> | &quot;{&quot; [<a class="reference internal" href="#grammar-token-sf-arg_id"><code class="xref docutils literal notranslate"><span class="pre">arg_id</span></code></a>] &quot;}&quot;
+<strong id="grammar-token-sf-precision"><span id="grammar-token-precision"></span>precision  </strong> ::=  <a class="reference internal" href="#grammar-token-sf-integer"><code class="xref docutils literal notranslate"><span class="pre">integer</span></code></a> | &quot;{&quot; [<a class="reference internal" href="#grammar-token-sf-arg_id"><code class="xref docutils literal notranslate"><span class="pre">arg_id</span></code></a>] &quot;}&quot;
+<strong id="grammar-token-sf-type"><span id="grammar-token-type"></span>type       </strong> ::=  &quot;a&quot; | &quot;A&quot; | &quot;b&quot; | &quot;B&quot; | &quot;c&quot; | &quot;d&quot; | &quot;e&quot; | &quot;E&quot; | &quot;f&quot; | &quot;F&quot; | &quot;g&quot; | &quot;G&quot; |
+                 &quot;o&quot; | &quot;p&quot; | &quot;s&quot; | &quot;x&quot; | &quot;X&quot;
+</pre>
+<p>The <em>fill</em> character can be any Unicode code point other than <code class="docutils literal notranslate"><span class="pre">'{'</span></code> or
+<code class="docutils literal notranslate"><span class="pre">'}'</span></code>. The presence of a fill character is signaled by the character following
+it, which must be one of the alignment options. If the second character of
+<em>format_spec</em> is not a valid alignment option, then it is assumed that both the
+fill character and the alignment option are absent.</p>
+<p>The meaning of the various alignment options is as follows:</p>
+<table class="docutils align-default">
+<colgroup>
+<col style="width: 13%" />
+<col style="width: 87%" />
+</colgroup>
+<thead>
+<tr class="row-odd"><th class="head"><p>Option</p></th>
+<th class="head"><p>Meaning</p></th>
+</tr>
+</thead>
+<tbody>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'&lt;'</span></code></p></td>
+<td><p>Forces the field to be left-aligned within the available
+space (this is the default for most objects).</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'&gt;'</span></code></p></td>
+<td><p>Forces the field to be right-aligned within the
+available space (this is the default for numbers).</p></td>
+</tr>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'^'</span></code></p></td>
+<td><p>Forces the field to be centered within the available
+space.</p></td>
+</tr>
+</tbody>
+</table>
+<p>Note that unless a minimum field width is defined, the field width will always
+be the same size as the data to fill it, so that the alignment option has no
+meaning in this case.</p>
+<p>The <em>sign</em> option is only valid for number types, and can be one of the
+following:</p>
+<table class="docutils align-default">
+<colgroup>
+<col style="width: 13%" />
+<col style="width: 87%" />
+</colgroup>
+<thead>
+<tr class="row-odd"><th class="head"><p>Option</p></th>
+<th class="head"><p>Meaning</p></th>
+</tr>
+</thead>
+<tbody>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'+'</span></code></p></td>
+<td><p>indicates that a sign should be used for both
+nonnegative as well as negative numbers.</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'-'</span></code></p></td>
+<td><p>indicates that a sign should be used only for negative
+numbers (this is the default behavior).</p></td>
+</tr>
+<tr class="row-even"><td><p>space</p></td>
+<td><p>indicates that a leading space should be used on
+nonnegative numbers, and a minus sign on negative numbers.</p></td>
+</tr>
+</tbody>
+</table>
+<p>The <code class="docutils literal notranslate"><span class="pre">'#'</span></code> option causes the “alternate form” to be used for the
+conversion.  The alternate form is defined differently for different
+types.  This option is only valid for integer and floating-point types.
+For integers, when binary, octal, or hexadecimal output is used, this
+option adds the prefix respective <code class="docutils literal notranslate"><span class="pre">&quot;0b&quot;</span></code> (<code class="docutils literal notranslate"><span class="pre">&quot;0B&quot;</span></code>), <code class="docutils literal notranslate"><span class="pre">&quot;0&quot;</span></code>, or
+<code class="docutils literal notranslate"><span class="pre">&quot;0x&quot;</span></code> (<code class="docutils literal notranslate"><span class="pre">&quot;0X&quot;</span></code>) to the output value.  Whether the prefix is
+lower-case or upper-case is determined by the case of the type
+specifier, for example, the prefix <code class="docutils literal notranslate"><span class="pre">&quot;0x&quot;</span></code> is used for the type <code class="docutils literal notranslate"><span class="pre">'x'</span></code>
+and <code class="docutils literal notranslate"><span class="pre">&quot;0X&quot;</span></code> is used for <code class="docutils literal notranslate"><span class="pre">'X'</span></code>.  For floating-point numbers the
+alternate form causes the result of the conversion to always contain a
+decimal-point character, even if no digits follow it. Normally, a
+decimal-point character appears in the result of these conversions
+only if a digit follows it. In addition, for <code class="docutils literal notranslate"><span class="pre">'g'</span></code> and <code class="docutils literal notranslate"><span class="pre">'G'</span></code>
+conversions, trailing zeros are not removed from the result.</p>
+<p><em>width</em> is a decimal integer defining the minimum field width.  If not
+specified, then the field width will be determined by the content.</p>
+<p>Preceding the <em>width</em> field by a zero (<code class="docutils literal notranslate"><span class="pre">'0'</span></code>) character enables sign-aware
+zero-padding for numeric types. It forces the padding to be placed after the
+sign or base (if any) but before the digits. This is used for printing fields in
+the form ‘+000000120’. This option is only valid for numeric types and it has no
+effect on formatting of infinity and NaN.</p>
+<p>The <em>precision</em> is a decimal number indicating how many digits should be
+displayed after the decimal point for a floating-point value formatted with
+<code class="docutils literal notranslate"><span class="pre">'f'</span></code> and <code class="docutils literal notranslate"><span class="pre">'F'</span></code>, or before and after the decimal point for a floating-point
+value formatted with <code class="docutils literal notranslate"><span class="pre">'g'</span></code> or <code class="docutils literal notranslate"><span class="pre">'G'</span></code>.  For non-number types the field
+indicates the maximum field size - in other words, how many characters will be
+used from the field content. The <em>precision</em> is not allowed for integer,
+character, Boolean, and pointer values. Note that a C string must be
+null-terminated even if precision is specified.</p>
+<p>The <code class="docutils literal notranslate"><span class="pre">'L'</span></code> option uses the current locale setting to insert the appropriate
+number separator characters. This option is only valid for numeric types.</p>
+<p>Finally, the <em>type</em> determines how the data should be presented.</p>
+<p>The available string presentation types are:</p>
+<table class="docutils align-default">
+<colgroup>
+<col style="width: 13%" />
+<col style="width: 87%" />
+</colgroup>
+<thead>
+<tr class="row-odd"><th class="head"><p>Type</p></th>
+<th class="head"><p>Meaning</p></th>
+</tr>
+</thead>
+<tbody>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'s'</span></code></p></td>
+<td><p>String format. This is the default type for strings and
+may be omitted.</p></td>
+</tr>
+<tr class="row-odd"><td><p>none</p></td>
+<td><p>The same as <code class="docutils literal notranslate"><span class="pre">'s'</span></code>.</p></td>
+</tr>
+</tbody>
+</table>
+<p>The available character presentation types are:</p>
+<table class="docutils align-default">
+<colgroup>
+<col style="width: 13%" />
+<col style="width: 87%" />
+</colgroup>
+<thead>
+<tr class="row-odd"><th class="head"><p>Type</p></th>
+<th class="head"><p>Meaning</p></th>
+</tr>
+</thead>
+<tbody>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'c'</span></code></p></td>
+<td><p>Character format. This is the default type for
+characters and may be omitted.</p></td>
+</tr>
+<tr class="row-odd"><td><p>none</p></td>
+<td><p>The same as <code class="docutils literal notranslate"><span class="pre">'c'</span></code>.</p></td>
+</tr>
+</tbody>
+</table>
+<p>The available integer presentation types are:</p>
+<table class="docutils align-default">
+<colgroup>
+<col style="width: 13%" />
+<col style="width: 87%" />
+</colgroup>
+<thead>
+<tr class="row-odd"><th class="head"><p>Type</p></th>
+<th class="head"><p>Meaning</p></th>
+</tr>
+</thead>
+<tbody>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'b'</span></code></p></td>
+<td><p>Binary format. Outputs the number in base 2. Using the
+<code class="docutils literal notranslate"><span class="pre">'#'</span></code> option with this type adds the prefix <code class="docutils literal notranslate"><span class="pre">&quot;0b&quot;</span></code>
+to the output value.</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'B'</span></code></p></td>
+<td><p>Binary format. Outputs the number in base 2. Using the
+<code class="docutils literal notranslate"><span class="pre">'#'</span></code> option with this type adds the prefix <code class="docutils literal notranslate"><span class="pre">&quot;0B&quot;</span></code>
+to the output value.</p></td>
+</tr>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'c'</span></code></p></td>
+<td><p>Character format. Outputs the number as a character.</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'d'</span></code></p></td>
+<td><p>Decimal integer. Outputs the number in base 10.</p></td>
+</tr>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'o'</span></code></p></td>
+<td><p>Octal format. Outputs the number in base 8.</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'x'</span></code></p></td>
+<td><p>Hex format. Outputs the number in base 16, using
+lower-case letters for the digits above 9. Using the
+<code class="docutils literal notranslate"><span class="pre">'#'</span></code> option with this type adds the prefix <code class="docutils literal notranslate"><span class="pre">&quot;0x&quot;</span></code>
+to the output value.</p></td>
+</tr>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'X'</span></code></p></td>
+<td><p>Hex format. Outputs the number in base 16, using
+upper-case letters for the digits above 9. Using the
+<code class="docutils literal notranslate"><span class="pre">'#'</span></code> option with this type adds the prefix <code class="docutils literal notranslate"><span class="pre">&quot;0X&quot;</span></code>
+to the output value.</p></td>
+</tr>
+<tr class="row-odd"><td><p>none</p></td>
+<td><p>The same as <code class="docutils literal notranslate"><span class="pre">'d'</span></code>.</p></td>
+</tr>
+</tbody>
+</table>
+<p>Integer presentation types can also be used with character and Boolean values.
+Boolean values are formatted using textual representation, either <code class="docutils literal notranslate"><span class="pre">true</span></code> or
+<code class="docutils literal notranslate"><span class="pre">false</span></code>, if the presentation type is not specified.</p>
+<p>The available presentation types for floating-point values are:</p>
+<table class="docutils align-default">
+<colgroup>
+<col style="width: 13%" />
+<col style="width: 87%" />
+</colgroup>
+<thead>
+<tr class="row-odd"><th class="head"><p>Type</p></th>
+<th class="head"><p>Meaning</p></th>
+</tr>
+</thead>
+<tbody>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'a'</span></code></p></td>
+<td><p>Hexadecimal floating point format. Prints the number in
+base 16 with prefix <code class="docutils literal notranslate"><span class="pre">&quot;0x&quot;</span></code> and lower-case letters for
+digits above 9. Uses <code class="docutils literal notranslate"><span class="pre">'p'</span></code> to indicate the exponent.</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'A'</span></code></p></td>
+<td><p>Same as <code class="docutils literal notranslate"><span class="pre">'a'</span></code> except it uses upper-case letters for
+the prefix, digits above 9 and to indicate the exponent.</p></td>
+</tr>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'e'</span></code></p></td>
+<td><p>Exponent notation. Prints the number in scientific
+notation using the letter ‘e’ to indicate the exponent.</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'E'</span></code></p></td>
+<td><p>Exponent notation. Same as <code class="docutils literal notranslate"><span class="pre">'e'</span></code> except it uses an
+upper-case <code class="docutils literal notranslate"><span class="pre">'E'</span></code> as the separator character.</p></td>
+</tr>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'f'</span></code></p></td>
+<td><p>Fixed point. Displays the number as a fixed-point
+number.</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'F'</span></code></p></td>
+<td><p>Fixed point. Same as <code class="docutils literal notranslate"><span class="pre">'f'</span></code>, but converts <code class="docutils literal notranslate"><span class="pre">nan</span></code> to
+<code class="docutils literal notranslate"><span class="pre">NAN</span></code> and <code class="docutils literal notranslate"><span class="pre">inf</span></code> to <code class="docutils literal notranslate"><span class="pre">INF</span></code>.</p></td>
+</tr>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'g'</span></code></p></td>
+<td><p>General format.  For a given precision <code class="docutils literal notranslate"><span class="pre">p</span> <span class="pre">&gt;=</span> <span class="pre">1</span></code>,
+this rounds the number to <code class="docutils literal notranslate"><span class="pre">p</span></code> significant digits and
+then formats the result in either fixed-point format
+or in scientific notation, depending on its magnitude.</p>
+<p>A precision of <code class="docutils literal notranslate"><span class="pre">0</span></code> is treated as equivalent to a
+precision of <code class="docutils literal notranslate"><span class="pre">1</span></code>.</p>
+</td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'G'</span></code></p></td>
+<td><p>General format. Same as <code class="docutils literal notranslate"><span class="pre">'g'</span></code> except switches to
+<code class="docutils literal notranslate"><span class="pre">'E'</span></code> if the number gets too large. The
+representations of infinity and NaN are uppercased, too.</p></td>
+</tr>
+<tr class="row-even"><td><p>none</p></td>
+<td><p>Similar to <code class="docutils literal notranslate"><span class="pre">'g'</span></code>, except that the default precision is
+as high as needed to represent the particular value.</p></td>
+</tr>
+</tbody>
+</table>
+<p>The available presentation types for pointers are:</p>
+<table class="docutils align-default">
+<colgroup>
+<col style="width: 13%" />
+<col style="width: 87%" />
+</colgroup>
+<thead>
+<tr class="row-odd"><th class="head"><p>Type</p></th>
+<th class="head"><p>Meaning</p></th>
+</tr>
+</thead>
+<tbody>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'p'</span></code></p></td>
+<td><p>Pointer format. This is the default type for
+pointers and may be omitted.</p></td>
+</tr>
+<tr class="row-odd"><td><p>none</p></td>
+<td><p>The same as <code class="docutils literal notranslate"><span class="pre">'p'</span></code>.</p></td>
+</tr>
+</tbody>
+</table>
+</section>
+<section id="chrono-format-specifications">
+<span id="chrono-specs"></span><h2>Chrono Format Specifications<a class="headerlink" href="#chrono-format-specifications" title="Permalink to this headline">¶</a></h2>
+<p>Format specifications for chrono types and <code class="docutils literal notranslate"><span class="pre">std::tm</span></code> have the following
+syntax:</p>
+<pre>
+<strong id="grammar-token-sf-chrono_format_spec"><span id="grammar-token-chrono-format-spec"></span>chrono_format_spec</strong> ::=  [[<a class="reference internal" href="#grammar-token-sf-fill"><code class="xref docutils literal notranslate"><span class="pre">fill</span></code></a>]<a class="reference internal" href="#grammar-token-sf-align"><code class="xref docutils literal notranslate"><span class="pre">align</span></code></a>][<a class="reference internal" href="#grammar-token-sf-width"><code class="xref docutils literal notranslate"><span class="pre">width</span></code></a>][&quot;.&quot; <a class="reference internal" href="#grammar-token-sf-precision"><code class="xref docutils literal notranslate"><span class="pre">precision</span></code></a>][<a class="reference internal" href="#grammar-token-sf-chrono_specs"><code class="xref docutils literal notranslate"><span class="pre">chrono_specs</span></code></a>]
+<strong id="grammar-token-sf-chrono_specs"><span id="grammar-token-chrono-specs"></span>chrono_specs      </strong> ::=  [<a class="reference internal" href="#grammar-token-sf-chrono_specs"><code class="xref docutils literal notranslate"><span class="pre">chrono_specs</span></code></a>] <a class="reference internal" href="#grammar-token-sf-conversion_spec"><code class="xref docutils literal notranslate"><span class="pre">conversion_spec</span></code></a> | <a class="reference internal" href="#grammar-token-sf-chrono_specs"><code class="xref docutils literal notranslate"><span class="pre">chrono_specs</span></code></a> <a class="reference internal" href="#grammar-token-sf-literal_char"><code class="xref docutils literal notranslate"><span class="pre">literal_char</span></code></a>
+<strong id="grammar-token-sf-conversion_spec"><span id="grammar-token-conversion-spec"></span>conversion_spec   </strong> ::=  &quot;%&quot; [<a class="reference internal" href="#grammar-token-sf-modifier"><code class="xref docutils literal notranslate"><span class="pre">modifier</span></code></a>] <a class="reference internal" href="#grammar-token-sf-chrono_type"><code class="xref docutils literal notranslate"><span class="pre">chrono_type</span></code></a>
+<strong id="grammar-token-sf-literal_char"><span id="grammar-token-literal-char"></span>literal_char      </strong> ::=  &lt;a character other than '{', '}' or '%'&gt;
+<strong id="grammar-token-sf-modifier"><span id="grammar-token-modifier"></span>modifier          </strong> ::=  &quot;E&quot; | &quot;O&quot;
+<strong id="grammar-token-sf-chrono_type"><span id="grammar-token-chrono-type"></span>chrono_type       </strong> ::=  &quot;a&quot; | &quot;A&quot; | &quot;b&quot; | &quot;B&quot; | &quot;c&quot; | &quot;C&quot; | &quot;d&quot; | &quot;D&quot; | &quot;e&quot; | &quot;F&quot; |
+                        &quot;g&quot; | &quot;G&quot; | &quot;h&quot; | &quot;H&quot; | &quot;I&quot; | &quot;j&quot; | &quot;m&quot; | &quot;M&quot; | &quot;n&quot; | &quot;p&quot; |
+                        &quot;q&quot; | &quot;Q&quot; | &quot;r&quot; | &quot;R&quot; | &quot;S&quot; | &quot;t&quot; | &quot;T&quot; | &quot;u&quot; | &quot;U&quot; | &quot;V&quot; |
+                        &quot;w&quot; | &quot;W&quot; | &quot;x&quot; | &quot;X&quot; | &quot;y&quot; | &quot;Y&quot; | &quot;z&quot; | &quot;Z&quot; | &quot;%&quot;
+</pre>
+<p>Literal chars are copied unchanged to the output. Precision is valid only for
+<code class="docutils literal notranslate"><span class="pre">std::chrono::duration</span></code> types with a floating-point representation type.</p>
+<p>The available presentation types (<em>chrono_type</em>) for chrono durations and time
+points are:</p>
+<table class="docutils align-default">
+<colgroup>
+<col style="width: 12%" />
+<col style="width: 88%" />
+</colgroup>
+<thead>
+<tr class="row-odd"><th class="head"><p>Type</p></th>
+<th class="head"><p>Meaning</p></th>
+</tr>
+</thead>
+<tbody>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'H'</span></code></p></td>
+<td><p>The hour (24-hour clock) as a decimal number. If the result is a
+single digit, it is prefixed with 0. The modified command <code class="docutils literal notranslate"><span class="pre">%OH</span></code>
+produces the locale’s alternative representation.</p></td>
+</tr>
+<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'M'</span></code></p></td>
+<td><p>The minute as a decimal number. If the result is a single digit,
+it is prefixed with 0. The modified command <code class="docutils literal notranslate"><span class="pre">%OM</span></code> produces the
+locale’s alternative representation.</p></td>
+</tr>
+<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'S'</span></code></p></td>
+<td><p>Seconds as a decimal number. If the number of seconds is less than
+10, the result is prefixed with 0. If the precision of the input
+cannot be exactly represented with seconds, then the format is a
+decimal floating-point number with a fixed format and a precision
+matching that of the precision of the input (or to a microseconds
+precision if the conversion to floating-point decimal seconds
+cannot be made within 18 fractional digits). The character for the
+decimal point is localized according to the locale. The modified
+command <code class="docutils literal notranslate"><span class="pre">%OS</span></code> produces the locale’s alternative representation.</p></td>
+</tr>
+</tbody>
+</table>
+<p>Specifiers that have a calendaric component such as <code class="docutils literal notranslate"><span class="pre">'d'</span></code> (the day of month)
+are valid only for <code class="docutils literal notranslate"><span class="pre">std::tm</span></code> and not durations or time points.</p>
+</section>
+<section id="range-format-specifications">
+<h2>Range Format Specifications<a class="headerlink" href="#range-format-specifications" title="Permalink to this headline">¶</a></h2>
+<p>Format specifications for range types have the following syntax:</p>
+<pre>
+<strong id="grammar-token-sf-range_format_spec"><span id="grammar-token-range-format-spec"></span>range_format_spec</strong> ::=  [&quot;:&quot; [<code class="xref docutils literal notranslate"><span class="pre">underlying_spec</span></code>]]
+</pre>
+<p>The <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">underlying_spec</span></code> is parsed based on the formatter of the range’s
+reference type.</p>
+<p>By default, a range of characters or strings is printed escaped and quoted. But
+if any <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">underlying_spec</span></code> is provided (even if it is empty), then the characters
+or strings are printed according to the provided specification.</p>
+<p>Examples:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{}&quot;</span><span class="p">,</span><span class="w"> </span><span class="n">std</span><span class="o">::</span><span class="n">vector</span><span class="p">{</span><span class="mi">10</span><span class="p">,</span><span class="w"> </span><span class="mi">20</span><span class="p">,</span><span class="w"> </span><span class="mi">30</span><span class="p">});</span><span class="w"></span>
+<span class="c1">// Result: [10, 20, 30]</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{::#x}&quot;</span><span class="p">,</span><span class="w"> </span><span class="n">std</span><span class="o">::</span><span class="n">vector</span><span class="p">{</span><span class="mi">10</span><span class="p">,</span><span class="w"> </span><span class="mi">20</span><span class="p">,</span><span class="w"> </span><span class="mi">30</span><span class="p">});</span><span class="w"></span>
+<span class="c1">// Result: [0xa, 0x14, 0x13]</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{}&quot;</span><span class="p">,</span><span class="w"> </span><span class="n">vector</span><span class="p">{</span><span class="sc">&#39;h&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;e&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;l&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;l&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;o&#39;</span><span class="p">});</span><span class="w"></span>
+<span class="c1">// Result: [&#39;h&#39;, &#39;e&#39;, &#39;l&#39;, &#39;l&#39;, &#39;o&#39;]</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{::}&quot;</span><span class="p">,</span><span class="w"> </span><span class="n">vector</span><span class="p">{</span><span class="sc">&#39;h&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;e&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;l&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;l&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;o&#39;</span><span class="p">});</span><span class="w"></span>
+<span class="c1">// Result: [h, e, l, l, o]</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{::d}&quot;</span><span class="p">,</span><span class="w"> </span><span class="n">vector</span><span class="p">{</span><span class="sc">&#39;h&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;e&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;l&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;l&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;o&#39;</span><span class="p">});</span><span class="w"></span>
+<span class="c1">// Result: [104, 101, 108, 108, 111]</span>
+</pre></div>
+</div>
+</section>
+<section id="format-examples">
+<span id="formatexamples"></span><h2>Format Examples<a class="headerlink" href="#format-examples" title="Permalink to this headline">¶</a></h2>
+<p>This section contains examples of the format syntax and comparison with
+the printf formatting.</p>
+<p>In most of the cases the syntax is similar to the printf formatting, with the
+addition of the <code class="docutils literal notranslate"><span class="pre">{}</span></code> and with <code class="docutils literal notranslate"><span class="pre">:</span></code> used instead of <code class="docutils literal notranslate"><span class="pre">%</span></code>.
+For example, <code class="docutils literal notranslate"><span class="pre">&quot;%03.2f&quot;</span></code> can be translated to <code class="docutils literal notranslate"><span class="pre">&quot;{:03.2f}&quot;</span></code>.</p>
+<p>The new format syntax also supports new and different options, shown in the
+following examples.</p>
+<p>Accessing arguments by position:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{0}, {1}, {2}&quot;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;a&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;b&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;c&#39;</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;a, b, c&quot;</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{}, {}, {}&quot;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;a&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;b&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;c&#39;</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;a, b, c&quot;</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{2}, {1}, {0}&quot;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;a&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;b&#39;</span><span class="p">,</span><span class="w"> </span><span class="sc">&#39;c&#39;</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;c, b, a&quot;</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{0}{1}{0}&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;abra&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;cad&quot;</span><span class="p">);</span><span class="w">  </span><span class="c1">// arguments&#39; indices can be repeated</span>
+<span class="c1">// Result: &quot;abracadabra&quot;</span>
+</pre></div>
+</div>
+<p>Aligning the text and specifying a width:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:&lt;30}&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;left aligned&quot;</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;left aligned                  &quot;</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:&gt;30}&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;right aligned&quot;</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;                 right aligned&quot;</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:^30}&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;centered&quot;</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;           centered           &quot;</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:*^30}&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;centered&quot;</span><span class="p">);</span><span class="w">  </span><span class="c1">// use &#39;*&#39; as a fill char</span>
+<span class="c1">// Result: &quot;***********centered***********&quot;</span>
+</pre></div>
+</div>
+<p>Dynamic width:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:&lt;{}}&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;left aligned&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">30</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;left aligned                  &quot;</span>
+</pre></div>
+</div>
+<p>Dynamic precision:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:.{}f}&quot;</span><span class="p">,</span><span class="w"> </span><span class="mf">3.14</span><span class="p">,</span><span class="w"> </span><span class="mi">1</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;3.1&quot;</span>
+</pre></div>
+</div>
+<p>Replacing <code class="docutils literal notranslate"><span class="pre">%+f</span></code>, <code class="docutils literal notranslate"><span class="pre">%-f</span></code>, and <code class="docutils literal notranslate"><span class="pre">%</span> <span class="pre">f</span></code> and specifying a sign:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:+f}; {:+f}&quot;</span><span class="p">,</span><span class="w"> </span><span class="mf">3.14</span><span class="p">,</span><span class="w"> </span><span class="mf">-3.14</span><span class="p">);</span><span class="w">  </span><span class="c1">// show it always</span>
+<span class="c1">// Result: &quot;+3.140000; -3.140000&quot;</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{: f}; {: f}&quot;</span><span class="p">,</span><span class="w"> </span><span class="mf">3.14</span><span class="p">,</span><span class="w"> </span><span class="mf">-3.14</span><span class="p">);</span><span class="w">  </span><span class="c1">// show a space for positive numbers</span>
+<span class="c1">// Result: &quot; 3.140000; -3.140000&quot;</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:-f}; {:-f}&quot;</span><span class="p">,</span><span class="w"> </span><span class="mf">3.14</span><span class="p">,</span><span class="w"> </span><span class="mf">-3.14</span><span class="p">);</span><span class="w">  </span><span class="c1">// show only the minus -- same as &#39;{:f}; {:f}&#39;</span>
+<span class="c1">// Result: &quot;3.140000; -3.140000&quot;</span>
+</pre></div>
+</div>
+<p>Replacing <code class="docutils literal notranslate"><span class="pre">%x</span></code> and <code class="docutils literal notranslate"><span class="pre">%o</span></code> and converting the value to different bases:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;int: {0:d};  hex: {0:x};  oct: {0:o}; bin: {0:b}&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;int: 42;  hex: 2a;  oct: 52; bin: 101010&quot;</span>
+<span class="c1">// with 0x or 0 or 0b as prefix:</span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;int: {0:d};  hex: {0:#x};  oct: {0:#o};  bin: {0:#b}&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;int: 42;  hex: 0x2a;  oct: 052;  bin: 0b101010&quot;</span>
+</pre></div>
+</div>
+<p>Padded hex byte with prefix and always prints both hex characters:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">&quot;{:#04x}&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">0</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Result: &quot;0x00&quot;</span>
+</pre></div>
+</div>
+<p>Box drawing using Unicode fill:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="w"></span>
+<span class="w">  </span><span class="s">&quot;┌{0:─^{2}}┐</span><span class="se">\n</span><span class="s">&quot;</span><span class="w"></span>
+<span class="w">  </span><span class="s">&quot;│{1: ^{2}}│</span><span class="se">\n</span><span class="s">&quot;</span><span class="w"></span>
+<span class="w">  </span><span class="s">&quot;└{0:─^{2}}┘</span><span class="se">\n</span><span class="s">&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;&quot;</span><span class="p">,</span><span class="w"> </span><span class="s">&quot;Hello, world!&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">20</span><span class="p">);</span><span class="w"></span>
+</pre></div>
+</div>
+<p>prints:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span>┌────────────────────┐
+│   Hello, world!    │
+└────────────────────┘
+</pre></div>
+</div>
+<p>Using type-specific formatting:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="cp">#include</span><span class="w"> </span><span class="cpf">&lt;fmt/chrono.h&gt;</span><span class="cp"></span>
+
+<span class="k">auto</span><span class="w"> </span><span class="n">t</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">tm</span><span class="p">();</span><span class="w"></span>
+<span class="n">t</span><span class="p">.</span><span class="n">tm_year</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">2010</span><span class="w"> </span><span class="o">-</span><span class="w"> </span><span class="mi">1900</span><span class="p">;</span><span class="w"></span>
+<span class="n">t</span><span class="p">.</span><span class="n">tm_mon</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">7</span><span class="p">;</span><span class="w"></span>
+<span class="n">t</span><span class="p">.</span><span class="n">tm_mday</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">4</span><span class="p">;</span><span class="w"></span>
+<span class="n">t</span><span class="p">.</span><span class="n">tm_hour</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">12</span><span class="p">;</span><span class="w"></span>
+<span class="n">t</span><span class="p">.</span><span class="n">tm_min</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">15</span><span class="p">;</span><span class="w"></span>
+<span class="n">t</span><span class="p">.</span><span class="n">tm_sec</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">58</span><span class="p">;</span><span class="w"></span>
+<span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">&quot;{:%Y-%m-%d %H:%M:%S}&quot;</span><span class="p">,</span><span class="w"> </span><span class="n">t</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// Prints: 2010-08-04 12:15:58</span>
+</pre></div>
+</div>
+<p>Using the comma as a thousands separator:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="cp">#include</span><span class="w"> </span><span class="cpf">&lt;fmt/format.h&gt;</span><span class="cp"></span>
+
+<span class="k">auto</span><span class="w"> </span><span class="n">s</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="n">std</span><span class="o">::</span><span class="n">locale</span><span class="p">(</span><span class="s">&quot;en_US.UTF-8&quot;</span><span class="p">),</span><span class="w"> </span><span class="s">&quot;{:L}&quot;</span><span class="p">,</span><span class="w"> </span><span class="mi">1234567890</span><span class="p">);</span><span class="w"></span>
+<span class="c1">// s == &quot;1,234,567,890&quot;</span>
+</pre></div>
+</div>
+</section>
+</section>
+
+
+    </div>
+  </div>
+</div>
+
+
+
+    <div class="footer" role="contentinfo">
+        &copy; Copyright 2012-present, Victor Zverovich.
+      Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
+    </div>
+
+<script src="_static/bootstrap.min.js"></script>
+
+  </body>
+</html>

externals/fmt/doc/html/usage.html

@@ -0,0 +1,335 @@
+<!DOCTYPE html>
+
+
+<html lang="en">
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="X-UA-Compatible" content="IE=edge">
+    <meta name="viewport" content="width=device-width, initial-scale=1">
+    
+    <meta name="generator" content="Docutils 0.17.1: http://docutils.sourceforge.net/" />
+
+    <title>Usage &mdash; fmt 9.1.0 documentation</title>
+    
+    <link rel="stylesheet" href="_static/basic.css" type="text/css" />
+    <link rel="stylesheet" href="_static/pygments.css" type="text/css" />
+    <link rel="stylesheet" href="_static/breathe.css" type="text/css" />
+    
+    <script type="text/javascript">
+      var DOCUMENTATION_OPTIONS = {
+        URL_ROOT:    './',
+        VERSION:     '9.1.0',
+        COLLAPSE_INDEX: false,
+        FILE_SUFFIX: '.html',
+        LINK_SUFFIX: '.html',
+        SOURCELINK_SUFFIX: '.txt',
+        HAS_SOURCE:  true,
+        SOURCELINK_SUFFIX:  '.txt'
+      };
+    </script>
+    <script src="_static/jquery.js"></script>
+    <script src="_static/underscore.js"></script>
+    <script src="_static/doctools.js"></script>
+    <script src="_static/language_data.js"></script>
+    <link rel="index" title="Index" href="genindex.html" />
+    <link rel="search" title="Search" href="search.html" />
+<meta name="description" content="Small, safe and fast formatting library">
+<meta name="keywords" content="C++, formatting, printf, string, library">
+<meta name="author" content="Victor Zverovich">
+<link rel="stylesheet" href="_static/fmt.css">
+
+<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
+<script>
+  window.dataLayer = window.dataLayer || [];
+  function gtag(){dataLayer.push(arguments);}
+  gtag('js', new Date());
+
+  gtag('config', 'UA-20116650-4');
+</script>
+
+  </head>
+  <body role="document">
+<nav class="navbar navbar-inverse">
+  <div class="tb-container">
+    <div class="row">
+      <div class="navbar-content">
+        
+        <div class="navbar-header">
+          <button type="button" class="navbar-toggle collapsed"
+                  data-toggle="collapse" data-target=".navbar-collapse">
+            <span class="sr-only">Toggle navigation</span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+            <span class="icon-bar"></span>
+          </button>
+          <a class="navbar-brand" href="index.html">{fmt}</a>
+        </div>
+
+        
+        <div class="collapse navbar-collapse">
+          <ul class="nav navbar-nav">
+            <li class="dropdown">
+              <a href="#" class="dropdown-toggle" data-toggle="dropdown"
+                 role="button" aria-expanded="false">9.1.0
+                <span class="caret"></span></a>
+              <ul class="dropdown-menu" role="menu">
+                
+                <li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
+                
+                <li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
+                
+                <li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
+                
+              </ul>
+            </li>
+            
+              
+              <li><a href="contents.html">Contents</a></li>
+              
+            
+              
+              <li class="active"><a href="usage.html">Usage
+                <span class="sr-only">(current)</span></a></li>
+              
+            
+              
+              <li><a href="api.html">API</a></li>
+              
+            
+              
+              <li><a href="syntax.html">Syntax</a></li>
+              
+            
+          </ul>
+          
+            
+<form class="navbar-form navbar-right" role="search" action="search.html"
+      method="get">
+  <div class="form-group">
+    <input type="text" name="q" class="form-control"
+           placeholder="Search" >
+  </div>
+  <input type="hidden" name="check_keywords" value="yes" />
+  <input type="hidden" name="area" value="default" />
+  
+</form>
+          
+        </div> 
+      </div> 
+    </div> 
+  </div> 
+</nav>
+
+
+
+<div class="tb-container">
+  <div class="row">
+    
+
+    <div class="content">
+      
+  <section id="usage">
+<h1>Usage<a class="headerlink" href="#usage" title="Permalink to this headline">¶</a></h1>
+<p>To use the {fmt} library, add <code class="file docutils literal notranslate"><span class="pre">fmt/core.h</span></code>, <code class="file docutils literal notranslate"><span class="pre">fmt/format.h</span></code>,
+<code class="file docutils literal notranslate"><span class="pre">fmt/format-inl.h</span></code>, <code class="file docutils literal notranslate"><span class="pre">src/format.cc</span></code> and optionally other headers
+from a <a class="reference external" href="https://github.com/fmtlib/fmt/releases/latest">release archive</a> or
+the <a class="reference external" href="https://github.com/fmtlib/fmt">Git repository</a> to your project.
+Alternatively, you can <a class="reference internal" href="#building"><span class="std std-ref">build the library with CMake</span></a>.</p>
+<section id="building-the-library">
+<span id="building"></span><h2>Building the Library<a class="headerlink" href="#building-the-library" title="Permalink to this headline">¶</a></h2>
+<p>The included <a class="reference external" href="https://github.com/fmtlib/fmt/blob/master/CMakeLists.txt">CMake build script</a> can be used to build the fmt
+library on a wide range of platforms. CMake is freely available for
+download from <a class="reference external" href="https://www.cmake.org/download/">https://www.cmake.org/download/</a>.</p>
+<p>CMake works by generating native makefiles or project files that can
+be used in the compiler environment of your choice. The typical
+workflow starts with:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span>mkdir build          # Create a directory to hold the build output.
+cd build
+cmake ..  # Generate native build scripts.
+</pre></div>
+</div>
+<p>where <code class="file docutils literal notranslate"><em><span class="pre">&lt;path/to/fmt&gt;</span></em></code> is a path to the <code class="docutils literal notranslate"><span class="pre">fmt</span></code> repository.</p>
+<p>If you are on a *nix system, you should now see a Makefile in the
+current directory. Now you can build the library by running <strong class="command">make</strong>.</p>
+<p>Once the library has been built you can invoke <strong class="command">make test</strong> to run
+the tests.</p>
+<p>You can control generation of the make <code class="docutils literal notranslate"><span class="pre">test</span></code> target with the <code class="docutils literal notranslate"><span class="pre">FMT_TEST</span></code>
+CMake option. This can be useful if you include fmt as a subdirectory in
+your project but don’t want to add fmt’s tests to your <code class="docutils literal notranslate"><span class="pre">test</span></code> target.</p>
+<p>If you use Windows and have Visual Studio installed, a <code class="file docutils literal notranslate"><span class="pre">FMT.sln</span></code>
+file and several <code class="file docutils literal notranslate"><span class="pre">.vcproj</span></code> files will be created. You can then build them
+using Visual Studio or msbuild.</p>
+<p>On Mac OS X with Xcode installed, an <code class="file docutils literal notranslate"><span class="pre">.xcodeproj</span></code> file will be generated.</p>
+<p>To build a <a class="reference external" href="https://en.wikipedia.org/wiki/Library_%28computing%29#Shared_libraries">shared library</a> set the <code class="docutils literal notranslate"><span class="pre">BUILD_SHARED_LIBS</span></code> CMake variable to
+<code class="docutils literal notranslate"><span class="pre">TRUE</span></code>:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">cmake</span><span class="w"> </span><span class="o">-</span><span class="n">DBUILD_SHARED_LIBS</span><span class="o">=</span><span class="n">TRUE</span><span class="w"> </span><span class="p">...</span><span class="w"></span>
+</pre></div>
+</div>
+<p>To build a <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">static</span> <span class="pre">library</span></code> with position independent code (required if the main
+consumer of the fmt library is a shared library i.e. a Python extension) set the
+<code class="docutils literal notranslate"><span class="pre">CMAKE_POSITION_INDEPENDENT_CODE</span></code> CMake variable to <code class="docutils literal notranslate"><span class="pre">TRUE</span></code>:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">cmake</span><span class="w"> </span><span class="o">-</span><span class="n">DCMAKE_POSITION_INDEPENDENT_CODE</span><span class="o">=</span><span class="n">TRUE</span><span class="w"> </span><span class="p">...</span><span class="w"></span>
+</pre></div>
+</div>
+</section>
+<section id="installing-the-library">
+<h2>Installing the Library<a class="headerlink" href="#installing-the-library" title="Permalink to this headline">¶</a></h2>
+<p>After building the library you can install it on a Unix-like system by running
+<strong class="command">sudo make install</strong>.</p>
+</section>
+<section id="usage-with-cmake">
+<h2>Usage with CMake<a class="headerlink" href="#usage-with-cmake" title="Permalink to this headline">¶</a></h2>
+<p>You can add the <code class="docutils literal notranslate"><span class="pre">fmt</span></code> library directory into your project and include it in
+your <code class="docutils literal notranslate"><span class="pre">CMakeLists.txt</span></code> file:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">add_subdirectory</span><span class="p">(</span><span class="n">fmt</span><span class="p">)</span><span class="w"></span>
+</pre></div>
+</div>
+<p>or</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">add_subdirectory</span><span class="p">(</span><span class="n">fmt</span><span class="w"> </span><span class="n">EXCLUDE_FROM_ALL</span><span class="p">)</span><span class="w"></span>
+</pre></div>
+</div>
+<p>to exclude it from <code class="docutils literal notranslate"><span class="pre">make</span></code>, <code class="docutils literal notranslate"><span class="pre">make</span> <span class="pre">all</span></code>, or <code class="docutils literal notranslate"><span class="pre">cmake</span> <span class="pre">--build</span> <span class="pre">.</span></code>.</p>
+<p>You can detect and use an installed version of {fmt} as follows:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">find_package</span><span class="p">(</span><span class="n">fmt</span><span class="p">)</span><span class="w"></span>
+<span class="n">target_link_libraries</span><span class="p">(</span><span class="o">&lt;</span><span class="n">your</span><span class="o">-</span><span class="n">target</span><span class="o">&gt;</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">fmt</span><span class="p">)</span><span class="w"></span>
+</pre></div>
+</div>
+<p>Setting up your target to use a header-only version of <code class="docutils literal notranslate"><span class="pre">fmt</span></code> is equally easy:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">target_link_libraries</span><span class="p">(</span><span class="o">&lt;</span><span class="n">your</span><span class="o">-</span><span class="n">target</span><span class="o">&gt;</span><span class="w"> </span><span class="n">PRIVATE</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">fmt</span><span class="o">-</span><span class="n">header</span><span class="o">-</span><span class="n">only</span><span class="p">)</span><span class="w"></span>
+</pre></div>
+</div>
+</section>
+<section id="usage-with-build2">
+<h2>Usage with build2<a class="headerlink" href="#usage-with-build2" title="Permalink to this headline">¶</a></h2>
+<p>You can use <a class="reference external" href="https://build2.org">build2</a>, a dependency manager and a
+build-system combined, to use <code class="docutils literal notranslate"><span class="pre">fmt</span></code>.</p>
+<p>Currently this package is available in these package repositories:</p>
+<ul class="simple">
+<li><p><strong>https://cppget.org/fmt/</strong> for released and published versions.</p></li>
+<li><p><a class="reference external" href="https://github.com/build2-packaging/fmt.git">The git repository with the sources of the build2 package of fmt</a>
+for unreleased or custom revisions of <code class="docutils literal notranslate"><span class="pre">fmt</span></code>.</p></li>
+</ul>
+<p><strong>Usage:</strong></p>
+<ul class="simple">
+<li><p><code class="docutils literal notranslate"><span class="pre">build2</span></code> package name: <code class="docutils literal notranslate"><span class="pre">fmt</span></code></p></li>
+<li><p>Library target name : <code class="docutils literal notranslate"><span class="pre">lib{fmt}</span></code></p></li>
+</ul>
+<p>For example, to make your <code class="docutils literal notranslate"><span class="pre">build2</span></code> project depend on <code class="docutils literal notranslate"><span class="pre">fmt</span></code>:</p>
+<ul>
+<li><p>Add one of the repositories to your configurations, or in your
+<code class="docutils literal notranslate"><span class="pre">repositories.manifest</span></code>, if not already there:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="o">:</span><span class="w"></span>
+<span class="nl">role</span><span class="p">:</span><span class="w"> </span><span class="n">prerequisite</span><span class="w"></span>
+<span class="nl">location</span><span class="p">:</span><span class="w"> </span><span class="n">https</span><span class="o">:</span><span class="c1">//pkg.cppget.org/1/stable</span>
+</pre></div>
+</div>
+</li>
+<li><p>Add this package as a dependency to your <code class="docutils literal notranslate"><span class="pre">./manifest</span></code> file
+(example for <code class="docutils literal notranslate"><span class="pre">v7.0.x</span></code>):</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="nl">depends</span><span class="p">:</span><span class="w"> </span><span class="n">fmt</span><span class="w"> </span><span class="o">~</span><span class="mf">7.0.0</span><span class="w"></span>
+</pre></div>
+</div>
+</li>
+<li><p>Import the target and use it as a prerequisite to your own target
+using <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">fmt</span></code> in the appropriate <code class="docutils literal notranslate"><span class="pre">buildfile</span></code>:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="k">import</span><span class="w"> </span><span class="n">fmt</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">fmt</span><span class="o">%</span><span class="n">lib</span><span class="p">{</span><span class="n">fmt</span><span class="p">}</span><span class="w"></span>
+<span class="n">lib</span><span class="p">{</span><span class="n">mylib</span><span class="p">}</span><span class="w"> </span><span class="o">:</span><span class="w"> </span><span class="n">cxx</span><span class="p">{</span><span class="o">**</span><span class="p">}</span><span class="w"> </span><span class="p">...</span><span class="w"> </span><span class="n">$fmt</span><span class="w"></span>
+</pre></div>
+</div>
+</li>
+</ul>
+<p>Then build your project as usual with <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">b</span></code> or <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">bdep</span> <span class="pre">update</span></code>.</p>
+<p>For <code class="docutils literal notranslate"><span class="pre">build2</span></code> newcomers or to get more details and use cases, you can read the
+<code class="docutils literal notranslate"><span class="pre">build2</span></code>
+<a class="reference external" href="https://build2.org/build2-toolchain/doc/build2-toolchain-intro.xhtml">toolchain introduction</a>.</p>
+</section>
+<section id="building-the-documentation">
+<h2>Building the Documentation<a class="headerlink" href="#building-the-documentation" title="Permalink to this headline">¶</a></h2>
+<p>To build the documentation you need the following software installed on your
+system:</p>
+<ul>
+<li><p><a class="reference external" href="https://www.python.org/">Python</a> with pip and virtualenv</p></li>
+<li><p><a class="reference external" href="http://www.stack.nl/~dimitri/doxygen/">Doxygen</a></p></li>
+<li><p><a class="reference external" href="http://lesscss.org/">Less</a> with <code class="docutils literal notranslate"><span class="pre">less-plugin-clean-css</span></code>.
+Ubuntu doesn’t package the <code class="docutils literal notranslate"><span class="pre">clean-css</span></code> plugin so you should use <code class="docutils literal notranslate"><span class="pre">npm</span></code>
+instead of <code class="docutils literal notranslate"><span class="pre">apt</span></code> to install both <code class="docutils literal notranslate"><span class="pre">less</span></code> and the plugin:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">sudo</span><span class="w"> </span><span class="n">npm</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="o">-</span><span class="n">g</span><span class="w"> </span><span class="n">less</span><span class="w"> </span><span class="n">less</span><span class="o">-</span><span class="n">plugin</span><span class="o">-</span><span class="n">clean</span><span class="o">-</span><span class="n">css</span><span class="p">.</span><span class="w"></span>
+</pre></div>
+</div>
+</li>
+</ul>
+<p>First generate makefiles or project files using CMake as described in
+the previous section. Then compile the <code class="docutils literal notranslate"><span class="pre">doc</span></code> target/project, for example:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">make</span><span class="w"> </span><span class="n">doc</span><span class="w"></span>
+</pre></div>
+</div>
+<p>This will generate the HTML documentation in <code class="docutils literal notranslate"><span class="pre">doc/html</span></code>.</p>
+</section>
+<section id="conda">
+<h2>Conda<a class="headerlink" href="#conda" title="Permalink to this headline">¶</a></h2>
+<p>fmt can be installed on Linux, macOS and Windows with
+<a class="reference external" href="https://docs.conda.io/en/latest/">Conda</a>, using its
+<a class="reference external" href="https://conda-forge.org">conda-forge</a>
+<a class="reference external" href="https://github.com/conda-forge/fmt-feedstock">package</a>, as follows:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">conda</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="o">-</span><span class="n">c</span><span class="w"> </span><span class="n">conda</span><span class="o">-</span><span class="n">forge</span><span class="w"> </span><span class="n">fmt</span><span class="w"></span>
+</pre></div>
+</div>
+</section>
+<section id="vcpkg">
+<h2>Vcpkg<a class="headerlink" href="#vcpkg" title="Permalink to this headline">¶</a></h2>
+<p>You can download and install fmt using the <a class="reference external" href="https://github.com/Microsoft/vcpkg">vcpkg</a> dependency manager:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">git</span><span class="w"> </span><span class="n">clone</span><span class="w"> </span><span class="n">https</span><span class="o">:</span><span class="c1">//github.com/Microsoft/vcpkg.git</span>
+<span class="n">cd</span><span class="w"> </span><span class="n">vcpkg</span><span class="w"></span>
+<span class="p">.</span><span class="o">/</span><span class="n">bootstrap</span><span class="o">-</span><span class="n">vcpkg</span><span class="p">.</span><span class="n">sh</span><span class="w"></span>
+<span class="p">.</span><span class="o">/</span><span class="n">vcpkg</span><span class="w"> </span><span class="n">integrate</span><span class="w"> </span><span class="n">install</span><span class="w"></span>
+<span class="p">.</span><span class="o">/</span><span class="n">vcpkg</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="n">fmt</span><span class="w"></span>
+</pre></div>
+</div>
+<p>The fmt port in vcpkg is kept up to date by Microsoft team members and community
+contributors. If the version is out of date, please <a class="reference external" href="https://github.com/Microsoft/vcpkg">create an issue or pull
+request</a> on the vcpkg repository.</p>
+</section>
+<section id="lhelper">
+<h2>LHelper<a class="headerlink" href="#lhelper" title="Permalink to this headline">¶</a></h2>
+<p>You can download and install fmt using
+<a class="reference external" href="https://github.com/franko/lhelper">lhelper</a> dependency manager:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">lhelper</span><span class="w"> </span><span class="n">activate</span><span class="w"> </span><span class="o">&lt;</span><span class="n">some</span><span class="o">-</span><span class="n">environment</span><span class="o">&gt;</span><span class="w"></span>
+<span class="n">lhelper</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="n">fmt</span><span class="w"></span>
+</pre></div>
+</div>
+<p>All the recipes for lhelper are kept in the
+<a class="reference external" href="https://github.com/franko/lhelper-recipes">lhelper’s recipe</a> repository.</p>
+</section>
+<section id="android-ndk">
+<h2>Android NDK<a class="headerlink" href="#android-ndk" title="Permalink to this headline">¶</a></h2>
+<p>fmt provides <a class="reference external" href="https://github.com/fmtlib/fmt/blob/master/support/Android.mk">Android.mk file</a> that can be used to build the library
+with <a class="reference external" href="https://developer.android.com/tools/sdk/ndk/index.html">Android NDK</a>.
+For an example of using fmt with Android NDK, see the
+<a class="reference external" href="https://github.com/fmtlib/android-ndk-example">android-ndk-example</a>
+repository.</p>
+</section>
+<section id="homebrew">
+<h2>Homebrew<a class="headerlink" href="#homebrew" title="Permalink to this headline">¶</a></h2>
+<p>fmt can be installed on OS X using <a class="reference external" href="https://brew.sh/">Homebrew</a>:</p>
+<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">brew</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="n">fmt</span><span class="w"></span>
+</pre></div>
+</div>
+</section>
+</section>
+
+
+    </div>
+  </div>
+</div>
+
+
+
+    <div class="footer" role="contentinfo">
+        &copy; Copyright 2012-present, Victor Zverovich.
+      Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
+    </div>
+
+<script src="_static/bootstrap.min.js"></script>
+
+  </body>
+</html>

externals/fmt/doc/index.rst

@@ -22,25 +22,27 @@ Format API
 ----------
 
 The format API is similar in spirit to the C ``printf`` family of function but
-is safer, simpler and serveral times `faster
-<http://zverovich.net/2013/09/07/integer-to-string-conversion-in-cplusplus.html>`_
+is safer, simpler and several times `faster
+<https://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html>`_
 than common standard library implementations.
 The `format string syntax <syntax.html>`_ is similar to the one used by
-`str.format <http://docs.python.org/3/library/stdtypes.html#str.format>`_ in
+`str.format <https://docs.python.org/3/library/stdtypes.html#str.format>`_ in
 Python:
 
 .. code:: c++
 
-  fmt::format("The answer is {}.", 42);
+  std::string s = fmt::format("The answer is {}.", 42);
   
 The ``fmt::format`` function returns a string "The answer is 42.". You can use
 ``fmt::memory_buffer`` to avoid constructing ``std::string``:
 
 .. code:: c++
 
-  fmt::memory_buffer out;
-  format_to(out, "For a moment, {} happened.", "nothing");
-  out.data(); // returns a pointer to the formatted data
+  auto out = fmt::memory_buffer();
+  fmt::format_to(std::back_inserter(out),
+            "For a moment, {} happened.", "nothing");
+  auto data = out.data(); // pointer to the formatted data
+  auto size = out.size(); // size of the formatted data
 
 The ``fmt::print`` function performs formatting and writes the result to a stream:
 
@@ -48,21 +50,19 @@ The ``fmt::print`` function performs formatting and writes the result to a strea
 
   fmt::print(stderr, "System error code = {}\n", errno);
 
-The file argument can be omitted in which case the function prints to
-``stdout``:
+If you omit the file argument the function will print to ``stdout``:
 
 .. code:: c++
 
   fmt::print("Don't {}\n", "panic");
 
-The Format API also supports positional arguments useful for localization:
+The format API also supports positional arguments useful for localization:
 
 .. code:: c++
 
   fmt::print("I'd rather be {1} than {0}.", "right", "happy");
 
-Named arguments can be created with ``fmt::arg``. This makes it easier to track 
-what goes where when multiple arguments are being formatted:
+You can pass named arguments with ``fmt::arg``:
 
 .. code:: c++
 
@@ -91,16 +91,17 @@ time. For example, the code
 
   fmt::format("The answer is {:d}", "forty-two");
 
-throws a ``format_error`` exception with description "unknown format code 'd' for
-string", because the argument ``"forty-two"`` is a string while the format code
-``d`` only applies to integers, while
+throws the ``format_error`` exception because the argument ``"forty-two"`` is a
+string while the format code ``d`` only applies to integers.
+
+The code
 
 .. code:: c++
 
   format(FMT_STRING("The answer is {:d}"), "forty-two");
 
-reports a compile-time error for the same reason on compilers that support
-relaxed ``constexpr``. See `here <api.html#c.fmt>`_ for details.
+reports a compile-time error on compilers that support relaxed ``constexpr``.
+See `here <api.html#compile-time-format-string-checks>`_ for details.
 
 The following code
 
@@ -109,21 +110,15 @@ The following code
   fmt::format("Cyrillic letter {}", L'\x42e');
   
 produces a compile-time error because wide character ``L'\x42e'`` cannot be
-formatted into a narrow string. You can use a wide format string instead:
-
-.. code:: c++
-
-  fmt::format(L"Cyrillic letter {}", L'\x42e');
-
-For comparison, writing a wide character to ``std::ostream`` results in
-its numeric value being written to the stream (i.e. 1070 instead of letter 'ю'
-which is represented by ``L'\x42e'`` if we use Unicode) which is rarely what is
-needed.
+formatted into a narrow string. For comparison, writing a wide character to
+``std::ostream`` results in its numeric value being written to the stream
+(i.e. 1070 instead of letter 'ю' which is represented by ``L'\x42e'`` if we
+use Unicode) which is rarely desirable.
 
 Compact Binary Code
 -------------------
 
-The library is designed to produce compact per-call compiled code. For example
+The library produces compact per-call compiled code. For example
 (`godbolt <https://godbolt.org/g/TZU4KF>`_),
 
 .. code:: c++
@@ -144,8 +139,8 @@ compiles to just
      mov rcx, rsp
      mov edi, offset .L.str
      mov esi, 17
-     mov edx, 2
-     call fmt::v5::vprint(fmt::v5::basic_string_view<char>, fmt::v5::format_args)
+     mov edx, 1
+     call fmt::v7::vprint(fmt::v7::basic_string_view<char>, fmt::v7::format_args)
      xor eax, eax
      add rsp, 24
      ret
@@ -167,20 +162,19 @@ The library is highly portable and relies only on a small set of C++11 features:
 * deleted functions
 * alias templates
 
-These are available since GCC 4.8, Clang 3.0 and MSVC 19.0 (2015). For older
-compilers use {fmt} `version 4.x
-<https://github.com/fmtlib/fmt/releases/tag/4.1.0>`_ which continues to be
-maintained and only requires C++98.
+These are available in GCC 4.8, Clang 3.4, MSVC 19.0 (2015) and more recent
+compiler version. For older compilers use {fmt} `version 4.x
+<https://github.com/fmtlib/fmt/releases/tag/4.1.0>`_ which is maintained and
+only requires C++98.
 
-The output of all formatting functions is consistent across platforms. In
-particular, formatting a floating-point infinity always gives ``inf`` while the
-output of ``printf`` is platform-dependent. For example,
+The output of all formatting functions is consistent across platforms.
+For example,
 
 .. code::
 
   fmt::print("{}", std::numeric_limits<double>::infinity());
 
-always prints ``inf``.
+always prints ``inf`` while the output of ``printf`` is platform-dependent.
 
 .. _ease-of-use:
 
@@ -192,11 +186,13 @@ just three header files and no external dependencies.
 A permissive MIT `license <https://github.com/fmtlib/fmt#license>`_ allows
 using the library both in open-source and commercial projects.
 
+`Learn more... <contents.html>`_
+
 .. raw:: html
 
   <a class="btn btn-success" href="https://github.com/fmtlib/fmt">GitHub Repository</a>
 
   <div class="section footer">
-    <iframe src="http://ghbtns.com/github-btn.html?user=fmtlib&amp;repo=fmt&amp;type=watch&amp;count=true"
+    <iframe src="https://ghbtns.com/github-btn.html?user=fmtlib&amp;repo=fmt&amp;type=watch&amp;count=true"
             class="github-btn" width="100" height="20"></iframe>
   </div>

externals/fmt/doc/syntax.rst

@@ -16,7 +16,7 @@ literal text, it can be escaped by doubling: ``{{`` and ``}}``.
 The grammar for a replacement field is as follows:
 
 .. productionlist:: sf
-   replacement_field: "{" [`arg_id`] [":" `format_spec`] "}"
+   replacement_field: "{" [`arg_id`] [":" (`format_spec` | `chrono_format_spec`)] "}"
    arg_id: `integer` | `identifier`
    integer: `digit`+
    digit: "0"..."9"
@@ -27,8 +27,8 @@ The grammar for a replacement field is as follows:
 In less formal terms, the replacement field can start with an *arg_id*
 that specifies the argument whose value is to be formatted and inserted into
 the output instead of the replacement field.
-The *arg_id* is optionally followed by a *format_spec*, which is preceded
-by a colon ``':'``.  These specify a non-default format for the replacement value.
+The *arg_id* is optionally followed by a *format_spec*, which is preceded by a
+colon ``':'``.  These specify a non-default format for the replacement value.
 
 See also the :ref:`formatspec` section.
 
@@ -75,14 +75,14 @@ although some of the formatting options are only supported by the numeric types.
 The general form of a *standard format specifier* is:
 
 .. productionlist:: sf
-   format_spec: [[`fill`]`align`][`sign`]["#"]["0"][`width`]["." `precision`][`type`]
+   format_spec: [[`fill`]`align`][`sign`]["#"]["0"][`width`]["." `precision`]["L"][`type`]
    fill: <a character other than '{' or '}'>
    align: "<" | ">" | "^"
    sign: "+" | "-" | " "
-   width: `integer` | "{" `arg_id` "}"
-   precision: `integer` | "{" `arg_id` "}"
-   type: `int_type` | "a" | "A" | "c" | "e" | "E" | "f" | "F" | "g" | "G" | "L" | "p" | "s"
-   int_type: "b" | "B" | "d" | "o" | "x" | "X"
+   width: `integer` | "{" [`arg_id`] "}"
+   precision: `integer` | "{" [`arg_id`] "}"
+   type: "a" | "A" | "b" | "B" | "c" | "d" | "e" | "E" | "f" | "F" | "g" | "G" |
+       : "o" | "p" | "s" | "x" | "X"
 
 The *fill* character can be any Unicode code point other than ``'{'`` or
 ``'}'``. The presence of a fill character is signaled by the character following
@@ -112,18 +112,18 @@ meaning in this case.
 The *sign* option is only valid for number types, and can be one of the
 following:
 
-+---------+----------------------------------------------------------+
-| Option  | Meaning                                                  |
-+=========+==========================================================+
-| ``'+'`` | indicates that a sign should be used for both            |
-|         | positive as well as negative numbers.                    |
-+---------+----------------------------------------------------------+
-| ``'-'`` | indicates that a sign should be used only for negative   |
-|         | numbers (this is the default behavior).                  |
-+---------+----------------------------------------------------------+
-| space   | indicates that a leading space should be used on         |
-|         | positive numbers, and a minus sign on negative numbers.  |
-+---------+----------------------------------------------------------+
++---------+------------------------------------------------------------+
+| Option  | Meaning                                                    |
++=========+============================================================+
+| ``'+'`` | indicates that a sign should be used for both              |
+|         | nonnegative as well as negative numbers.                   |
++---------+------------------------------------------------------------+
+| ``'-'`` | indicates that a sign should be used only for negative     |
+|         | numbers (this is the default behavior).                    |
++---------+------------------------------------------------------------+
+| space   | indicates that a leading space should be used on           |
+|         | nonnegative numbers, and a minus sign on negative numbers. |
++---------+------------------------------------------------------------+
 
 The ``'#'`` option causes the "alternate form" to be used for the
 conversion.  The alternate form is defined differently for different
@@ -161,7 +161,11 @@ displayed after the decimal point for a floating-point value formatted with
 value formatted with ``'g'`` or ``'G'``.  For non-number types the field
 indicates the maximum field size - in other words, how many characters will be
 used from the field content. The *precision* is not allowed for integer,
-character, Boolean, and pointer values.
+character, Boolean, and pointer values. Note that a C string must be
+null-terminated even if precision is specified.
+
+The ``'L'`` option uses the current locale setting to insert the appropriate
+number separator characters. This option is only valid for numeric types.
 
 Finally, the *type* determines how the data should be presented.
 
@@ -200,6 +204,8 @@ The available integer presentation types are:
 |         | ``'#'`` option with this type adds the prefix ``"0B"``   |
 |         | to the output value.                                     |
 +---------+----------------------------------------------------------+
+| ``'c'`` | Character format. Outputs the number as a character.     |
++---------+----------------------------------------------------------+
 | ``'d'`` | Decimal integer. Outputs the number in base 10.          |
 +---------+----------------------------------------------------------+
 | ``'o'`` | Octal format. Outputs the number in base 8.              |
@@ -214,10 +220,6 @@ The available integer presentation types are:
 |         | ``'#'`` option with this type adds the prefix ``"0X"``   |
 |         | to the output value.                                     |
 +---------+----------------------------------------------------------+
-| ``'L'`` | Locale-specific format. This is the same as ``'d'``,     |
-|         | except that it uses the current locale setting to insert |
-|         | the appropriate number separator characters.             |
-+---------+----------------------------------------------------------+
 | none    | The same as ``'d'``.                                     |
 +---------+----------------------------------------------------------+
 
@@ -261,14 +263,8 @@ The available presentation types for floating-point values are:
 |         | ``'E'`` if the number gets too large. The                |
 |         | representations of infinity and NaN are uppercased, too. |
 +---------+----------------------------------------------------------+
-| ``'L'`` | Locale-specific format. This is the same as ``'g'``,     |
-|         | except that it uses the current locale setting to insert |
-|         | the appropriate number separator characters.             |
-+---------+----------------------------------------------------------+
-| none    | Similar to ``'g'``, except that fixed-point notation,    |
-|         | when used, has at least one digit past the decimal       |
-|         | point. The default precision is as high as needed to     |
-|         | represent the particular value.                          |
+| none    | Similar to ``'g'``, except that the default precision is |
+|         | as high as needed to represent the particular value.     |
 +---------+----------------------------------------------------------+
 
 .. ifconfig:: False
@@ -303,6 +299,86 @@ The available presentation types for pointers are:
 | none    | The same as ``'p'``.                                     |
 +---------+----------------------------------------------------------+
 
+.. _chrono-specs:
+
+Chrono Format Specifications
+============================
+
+Format specifications for chrono types and ``std::tm`` have the following
+syntax:
+
+.. productionlist:: sf
+   chrono_format_spec: [[`fill`]`align`][`width`]["." `precision`][`chrono_specs`]
+   chrono_specs: [`chrono_specs`] `conversion_spec` | `chrono_specs` `literal_char`
+   conversion_spec: "%" [`modifier`] `chrono_type`
+   literal_char: <a character other than '{', '}' or '%'>
+   modifier: "E" | "O"
+   chrono_type: "a" | "A" | "b" | "B" | "c" | "C" | "d" | "D" | "e" | "F" |
+              : "g" | "G" | "h" | "H" | "I" | "j" | "m" | "M" | "n" | "p" |
+              : "q" | "Q" | "r" | "R" | "S" | "t" | "T" | "u" | "U" | "V" |
+              : "w" | "W" | "x" | "X" | "y" | "Y" | "z" | "Z" | "%"
+
+Literal chars are copied unchanged to the output. Precision is valid only for
+``std::chrono::duration`` types with a floating-point representation type.
+
+The available presentation types (*chrono_type*) for chrono durations and time
+points are:
+
++---------+--------------------------------------------------------------------+
+| Type    | Meaning                                                            |
++=========+====================================================================+
+| ``'H'`` | The hour (24-hour clock) as a decimal number. If the result is a   |
+|         | single digit, it is prefixed with 0. The modified command ``%OH``  |
+|         | produces the locale's alternative representation.                  |
++---------+--------------------------------------------------------------------+
+| ``'M'`` | The minute as a decimal number. If the result is a single digit,   |
+|         | it is prefixed with 0. The modified command ``%OM`` produces the   |
+|         | locale's alternative representation.                               |
++---------+--------------------------------------------------------------------+
+| ``'S'`` | Seconds as a decimal number. If the number of seconds is less than |
+|         | 10, the result is prefixed with 0. If the precision of the input   |
+|         | cannot be exactly represented with seconds, then the format is a   |
+|         | decimal floating-point number with a fixed format and a precision  |
+|         | matching that of the precision of the input (or to a microseconds  |
+|         | precision if the conversion to floating-point decimal seconds      |
+|         | cannot be made within 18 fractional digits). The character for the |
+|         | decimal point is localized according to the locale. The modified   |
+|         | command ``%OS`` produces the locale's alternative representation.  |
++---------+--------------------------------------------------------------------+
+
+Specifiers that have a calendaric component such as ``'d'`` (the day of month)
+are valid only for ``std::tm`` and not durations or time points.
+
+.. range-specs:
+
+Range Format Specifications
+===========================
+
+Format specifications for range types have the following syntax:
+
+.. productionlist:: sf
+   range_format_spec: [":" [`underlying_spec`]]
+
+The `underlying_spec` is parsed based on the formatter of the range's
+reference type.
+
+By default, a range of characters or strings is printed escaped and quoted. But
+if any `underlying_spec` is provided (even if it is empty), then the characters
+or strings are printed according to the provided specification.
+
+Examples::
+
+  fmt::format("{}", std::vector{10, 20, 30});
+  // Result: [10, 20, 30]
+  fmt::format("{::#x}", std::vector{10, 20, 30});
+  // Result: [0xa, 0x14, 0x13]
+  fmt::format("{}", vector{'h', 'e', 'l', 'l', 'o'});
+  // Result: ['h', 'e', 'l', 'l', 'o']
+  fmt::format("{::}", vector{'h', 'e', 'l', 'l', 'o'});
+  // Result: [h, e, l, l, o]
+  fmt::format("{::d}", vector{'h', 'e', 'l', 'l', 'o'});
+  // Result: [104, 101, 108, 108, 111]
+
 .. _formatexamples:
 
 Format Examples
@@ -391,7 +467,7 @@ Using type-specific formatting::
 
    auto t = tm();
    t.tm_year = 2010 - 1900;
-   t.tm_mon = 6;
+   t.tm_mon = 7;
    t.tm_mday = 4;
    t.tm_hour = 12;
    t.tm_min = 15;
@@ -401,7 +477,7 @@ Using type-specific formatting::
 
 Using the comma as a thousands separator::
 
-   #include <fmt/locale.h>
+   #include <fmt/format.h>
 
    auto s = fmt::format(std::locale("en_US.UTF-8"), "{:L}", 1234567890);
    // s == "1,234,567,890"

externals/fmt/doc/usage.rst

@@ -15,7 +15,7 @@ Building the Library
 
 The included `CMake build script`__ can be used to build the fmt
 library on a wide range of platforms. CMake is freely available for
-download from http://www.cmake.org/download/.
+download from https://www.cmake.org/download/.
 
 __ https://github.com/fmtlib/fmt/blob/master/CMakeLists.txt
 
@@ -50,7 +50,15 @@ To build a `shared library`__ set the ``BUILD_SHARED_LIBS`` CMake variable to
 
   cmake -DBUILD_SHARED_LIBS=TRUE ...
 
-__ http://en.wikipedia.org/wiki/Library_%28computing%29#Shared_libraries
+__ https://en.wikipedia.org/wiki/Library_%28computing%29#Shared_libraries
+
+
+To build a `static library` with position independent code (required if the main
+consumer of the fmt library is a shared library i.e. a Python extension) set the
+``CMAKE_POSITION_INDEPENDENT_CODE`` CMake variable to ``TRUE``::
+
+  cmake -DCMAKE_POSITION_INDEPENDENT_CODE=TRUE ...
+
 
 Installing the Library
 ======================
@@ -83,6 +91,49 @@ Setting up your target to use a header-only version of ``fmt`` is equally easy::
 
    target_link_libraries(<your-target> PRIVATE fmt::fmt-header-only)
 
+Usage with build2
+=================
+
+You can use `build2 <https://build2.org>`_, a dependency manager and a
+build-system combined, to use ``fmt``.
+
+Currently this package is available in these package repositories:
+
+- **https://cppget.org/fmt/** for released and published versions.
+- `The git repository with the sources of the build2 package of fmt <https://github.com/build2-packaging/fmt.git>`_
+  for unreleased or custom revisions of ``fmt``.
+
+**Usage:**
+
+- ``build2`` package name: ``fmt``
+- Library target name : ``lib{fmt}``
+
+For example, to make your ``build2`` project depend on ``fmt``:
+
+- Add one of the repositories to your configurations, or in your
+  ``repositories.manifest``, if not already there::
+
+    :
+    role: prerequisite
+    location: https://pkg.cppget.org/1/stable
+
+- Add this package as a dependency to your ``./manifest`` file
+  (example for ``v7.0.x``)::
+
+    depends: fmt ~7.0.0
+
+- Import the target and use it as a prerequisite to your own target
+  using `fmt` in the appropriate ``buildfile``::
+
+    import fmt = fmt%lib{fmt}
+    lib{mylib} : cxx{**} ... $fmt
+
+Then build your project as usual with `b` or `bdep update`.
+
+For ``build2`` newcomers or to get more details and use cases, you can read the
+``build2``
+`toolchain introduction <https://build2.org/build2-toolchain/doc/build2-toolchain-intro.xhtml>`_.
+
 Building the Documentation
 ==========================
 
@@ -130,6 +181,18 @@ The fmt port in vcpkg is kept up to date by Microsoft team members and community
 contributors. If the version is out of date, please `create an issue or pull
 request <https://github.com/Microsoft/vcpkg>`__ on the vcpkg repository.
 
+LHelper
+=======
+
+You can download and install fmt using
+`lhelper <https://github.com/franko/lhelper>`__ dependency manager::
+
+  lhelper activate <some-environment>
+  lhelper install fmt
+
+All the recipes for lhelper are kept in the
+`lhelper's recipe <https://github.com/franko/lhelper-recipes>`__ repository.
+
 Android NDK
 ===========
 
@@ -139,11 +202,11 @@ For an example of using fmt with Android NDK, see the
 `android-ndk-example <https://github.com/fmtlib/android-ndk-example>`_
 repository.
 
-__ https://github.com/fmtlib/fmt/blob/master/Android.mk
+__ https://github.com/fmtlib/fmt/blob/master/support/Android.mk
 
 Homebrew
 ========
 
-fmt can be installed on OS X using `Homebrew <http://brew.sh/>`_::
+fmt can be installed on OS X using `Homebrew <https://brew.sh/>`_::
 
   brew install fmt

externals/fmt/include/fmt/args.h

@@ -0,0 +1,234 @@
+// Formatting library for C++ - dynamic format arguments
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_ARGS_H_
+#define FMT_ARGS_H_
+
+#include <functional>  // std::reference_wrapper
+#include <memory>      // std::unique_ptr
+#include <vector>
+
+#include "core.h"
+
+FMT_BEGIN_NAMESPACE
+
+namespace detail {
+
+template <typename T> struct is_reference_wrapper : std::false_type {};
+template <typename T>
+struct is_reference_wrapper<std::reference_wrapper<T>> : std::true_type {};
+
+template <typename T> const T& unwrap(const T& v) { return v; }
+template <typename T> const T& unwrap(const std::reference_wrapper<T>& v) {
+  return static_cast<const T&>(v);
+}
+
+class dynamic_arg_list {
+  // Workaround for clang's -Wweak-vtables. Unlike for regular classes, for
+  // templates it doesn't complain about inability to deduce single translation
+  // unit for placing vtable. So storage_node_base is made a fake template.
+  template <typename = void> struct node {
+    virtual ~node() = default;
+    std::unique_ptr<node<>> next;
+  };
+
+  template <typename T> struct typed_node : node<> {
+    T value;
+
+    template <typename Arg>
+    FMT_CONSTEXPR typed_node(const Arg& arg) : value(arg) {}
+
+    template <typename Char>
+    FMT_CONSTEXPR typed_node(const basic_string_view<Char>& arg)
+        : value(arg.data(), arg.size()) {}
+  };
+
+  std::unique_ptr<node<>> head_;
+
+ public:
+  template <typename T, typename Arg> const T& push(const Arg& arg) {
+    auto new_node = std::unique_ptr<typed_node<T>>(new typed_node<T>(arg));
+    auto& value = new_node->value;
+    new_node->next = std::move(head_);
+    head_ = std::move(new_node);
+    return value;
+  }
+};
+}  // namespace detail
+
+/**
+  \rst
+  A dynamic version of `fmt::format_arg_store`.
+  It's equipped with a storage to potentially temporary objects which lifetimes
+  could be shorter than the format arguments object.
+
+  It can be implicitly converted into `~fmt::basic_format_args` for passing
+  into type-erased formatting functions such as `~fmt::vformat`.
+  \endrst
+ */
+template <typename Context>
+class dynamic_format_arg_store
+#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409
+    // Workaround a GCC template argument substitution bug.
+    : public basic_format_args<Context>
+#endif
+{
+ private:
+  using char_type = typename Context::char_type;
+
+  template <typename T> struct need_copy {
+    static constexpr detail::type mapped_type =
+        detail::mapped_type_constant<T, Context>::value;
+
+    enum {
+      value = !(detail::is_reference_wrapper<T>::value ||
+                std::is_same<T, basic_string_view<char_type>>::value ||
+                std::is_same<T, detail::std_string_view<char_type>>::value ||
+                (mapped_type != detail::type::cstring_type &&
+                 mapped_type != detail::type::string_type &&
+                 mapped_type != detail::type::custom_type))
+    };
+  };
+
+  template <typename T>
+  using stored_type = conditional_t<
+      std::is_convertible<T, std::basic_string<char_type>>::value &&
+          !detail::is_reference_wrapper<T>::value,
+      std::basic_string<char_type>, T>;
+
+  // Storage of basic_format_arg must be contiguous.
+  std::vector<basic_format_arg<Context>> data_;
+  std::vector<detail::named_arg_info<char_type>> named_info_;
+
+  // Storage of arguments not fitting into basic_format_arg must grow
+  // without relocation because items in data_ refer to it.
+  detail::dynamic_arg_list dynamic_args_;
+
+  friend class basic_format_args<Context>;
+
+  unsigned long long get_types() const {
+    return detail::is_unpacked_bit | data_.size() |
+           (named_info_.empty()
+                ? 0ULL
+                : static_cast<unsigned long long>(detail::has_named_args_bit));
+  }
+
+  const basic_format_arg<Context>* data() const {
+    return named_info_.empty() ? data_.data() : data_.data() + 1;
+  }
+
+  template <typename T> void emplace_arg(const T& arg) {
+    data_.emplace_back(detail::make_arg<Context>(arg));
+  }
+
+  template <typename T>
+  void emplace_arg(const detail::named_arg<char_type, T>& arg) {
+    if (named_info_.empty()) {
+      constexpr const detail::named_arg_info<char_type>* zero_ptr{nullptr};
+      data_.insert(data_.begin(), {zero_ptr, 0});
+    }
+    data_.emplace_back(detail::make_arg<Context>(detail::unwrap(arg.value)));
+    auto pop_one = [](std::vector<basic_format_arg<Context>>* data) {
+      data->pop_back();
+    };
+    std::unique_ptr<std::vector<basic_format_arg<Context>>, decltype(pop_one)>
+        guard{&data_, pop_one};
+    named_info_.push_back({arg.name, static_cast<int>(data_.size() - 2u)});
+    data_[0].value_.named_args = {named_info_.data(), named_info_.size()};
+    guard.release();
+  }
+
+ public:
+  constexpr dynamic_format_arg_store() = default;
+
+  /**
+    \rst
+    Adds an argument into the dynamic store for later passing to a formatting
+    function.
+
+    Note that custom types and string types (but not string views) are copied
+    into the store dynamically allocating memory if necessary.
+
+    **Example**::
+
+      fmt::dynamic_format_arg_store<fmt::format_context> store;
+      store.push_back(42);
+      store.push_back("abc");
+      store.push_back(1.5f);
+      std::string result = fmt::vformat("{} and {} and {}", store);
+    \endrst
+  */
+  template <typename T> void push_back(const T& arg) {
+    if (detail::const_check(need_copy<T>::value))
+      emplace_arg(dynamic_args_.push<stored_type<T>>(arg));
+    else
+      emplace_arg(detail::unwrap(arg));
+  }
+
+  /**
+    \rst
+    Adds a reference to the argument into the dynamic store for later passing to
+    a formatting function.
+
+    **Example**::
+
+      fmt::dynamic_format_arg_store<fmt::format_context> store;
+      char band[] = "Rolling Stones";
+      store.push_back(std::cref(band));
+      band[9] = 'c'; // Changing str affects the output.
+      std::string result = fmt::vformat("{}", store);
+      // result == "Rolling Scones"
+    \endrst
+  */
+  template <typename T> void push_back(std::reference_wrapper<T> arg) {
+    static_assert(
+        need_copy<T>::value,
+        "objects of built-in types and string views are always copied");
+    emplace_arg(arg.get());
+  }
+
+  /**
+    Adds named argument into the dynamic store for later passing to a formatting
+    function. ``std::reference_wrapper`` is supported to avoid copying of the
+    argument. The name is always copied into the store.
+  */
+  template <typename T>
+  void push_back(const detail::named_arg<char_type, T>& arg) {
+    const char_type* arg_name =
+        dynamic_args_.push<std::basic_string<char_type>>(arg.name).c_str();
+    if (detail::const_check(need_copy<T>::value)) {
+      emplace_arg(
+          fmt::arg(arg_name, dynamic_args_.push<stored_type<T>>(arg.value)));
+    } else {
+      emplace_arg(fmt::arg(arg_name, arg.value));
+    }
+  }
+
+  /** Erase all elements from the store */
+  void clear() {
+    data_.clear();
+    named_info_.clear();
+    dynamic_args_ = detail::dynamic_arg_list();
+  }
+
+  /**
+    \rst
+    Reserves space to store at least *new_cap* arguments including
+    *new_cap_named* named arguments.
+    \endrst
+  */
+  void reserve(size_t new_cap, size_t new_cap_named) {
+    FMT_ASSERT(new_cap >= new_cap_named,
+               "Set of arguments includes set of named arguments");
+    data_.reserve(new_cap);
+    named_info_.reserve(new_cap_named);
+  }
+};
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_ARGS_H_

externals/fmt/include/fmt/color.h

@@ -11,6 +11,7 @@
 #include "format.h"
 
 FMT_BEGIN_NAMESPACE
+FMT_MODULE_EXPORT_BEGIN
 
 enum class color : uint32_t {
   alice_blue = 0xF0F8FF,               // rgb(240,248,255)
@@ -177,9 +178,13 @@ enum class terminal_color : uint8_t {
 
 enum class emphasis : uint8_t {
   bold = 1,
-  italic = 1 << 1,
-  underline = 1 << 2,
-  strikethrough = 1 << 3
+  faint = 1 << 1,
+  italic = 1 << 2,
+  underline = 1 << 3,
+  blink = 1 << 4,
+  reverse = 1 << 5,
+  conceal = 1 << 6,
+  strikethrough = 1 << 7,
 };
 
 // rgb is a struct for red, green and blue colors.
@@ -198,21 +203,20 @@ struct rgb {
   uint8_t b;
 };
 
-namespace internal {
+FMT_BEGIN_DETAIL_NAMESPACE
 
 // color is a struct of either a rgb color or a terminal color.
 struct color_type {
-  FMT_CONSTEXPR color_type() FMT_NOEXCEPT : is_rgb(), value{} {}
-  FMT_CONSTEXPR color_type(color rgb_color) FMT_NOEXCEPT : is_rgb(true),
-                                                           value{} {
+  FMT_CONSTEXPR color_type() noexcept : is_rgb(), value{} {}
+  FMT_CONSTEXPR color_type(color rgb_color) noexcept : is_rgb(true), value{} {
     value.rgb_color = static_cast<uint32_t>(rgb_color);
   }
-  FMT_CONSTEXPR color_type(rgb rgb_color) FMT_NOEXCEPT : is_rgb(true), value{} {
+  FMT_CONSTEXPR color_type(rgb rgb_color) noexcept : is_rgb(true), value{} {
     value.rgb_color = (static_cast<uint32_t>(rgb_color.r) << 16) |
                       (static_cast<uint32_t>(rgb_color.g) << 8) | rgb_color.b;
   }
-  FMT_CONSTEXPR color_type(terminal_color term_color) FMT_NOEXCEPT : is_rgb(),
-                                                                     value{} {
+  FMT_CONSTEXPR color_type(terminal_color term_color) noexcept
+      : is_rgb(), value{} {
     value.term_color = static_cast<uint8_t>(term_color);
   }
   bool is_rgb;
@@ -221,15 +225,14 @@ struct color_type {
     uint32_t rgb_color;
   } value;
 };
-}  // namespace internal
 
-// Experimental text formatting support.
+FMT_END_DETAIL_NAMESPACE
+
+/** A text style consisting of foreground and background colors and emphasis. */
 class text_style {
  public:
-  FMT_CONSTEXPR text_style(emphasis em = emphasis()) FMT_NOEXCEPT
-      : set_foreground_color(),
-        set_background_color(),
-        ems(em) {}
+  FMT_CONSTEXPR text_style(emphasis em = emphasis()) noexcept
+      : set_foreground_color(), set_background_color(), ems(em) {}
 
   FMT_CONSTEXPR text_style& operator|=(const text_style& rhs) {
     if (!set_foreground_color) {
@@ -260,63 +263,32 @@ class text_style {
     return lhs |= rhs;
   }
 
-  FMT_CONSTEXPR text_style& operator&=(const text_style& rhs) {
-    if (!set_foreground_color) {
-      set_foreground_color = rhs.set_foreground_color;
-      foreground_color = rhs.foreground_color;
-    } else if (rhs.set_foreground_color) {
-      if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
-        FMT_THROW(format_error("can't AND a terminal color"));
-      foreground_color.value.rgb_color &= rhs.foreground_color.value.rgb_color;
-    }
-
-    if (!set_background_color) {
-      set_background_color = rhs.set_background_color;
-      background_color = rhs.background_color;
-    } else if (rhs.set_background_color) {
-      if (!background_color.is_rgb || !rhs.background_color.is_rgb)
-        FMT_THROW(format_error("can't AND a terminal color"));
-      background_color.value.rgb_color &= rhs.background_color.value.rgb_color;
-    }
-
-    ems = static_cast<emphasis>(static_cast<uint8_t>(ems) &
-                                static_cast<uint8_t>(rhs.ems));
-    return *this;
-  }
-
-  friend FMT_CONSTEXPR text_style operator&(text_style lhs,
-                                            const text_style& rhs) {
-    return lhs &= rhs;
-  }
-
-  FMT_CONSTEXPR bool has_foreground() const FMT_NOEXCEPT {
+  FMT_CONSTEXPR bool has_foreground() const noexcept {
     return set_foreground_color;
   }
-  FMT_CONSTEXPR bool has_background() const FMT_NOEXCEPT {
+  FMT_CONSTEXPR bool has_background() const noexcept {
     return set_background_color;
   }
-  FMT_CONSTEXPR bool has_emphasis() const FMT_NOEXCEPT {
+  FMT_CONSTEXPR bool has_emphasis() const noexcept {
     return static_cast<uint8_t>(ems) != 0;
   }
-  FMT_CONSTEXPR internal::color_type get_foreground() const FMT_NOEXCEPT {
+  FMT_CONSTEXPR detail::color_type get_foreground() const noexcept {
     FMT_ASSERT(has_foreground(), "no foreground specified for this style");
     return foreground_color;
   }
-  FMT_CONSTEXPR internal::color_type get_background() const FMT_NOEXCEPT {
+  FMT_CONSTEXPR detail::color_type get_background() const noexcept {
     FMT_ASSERT(has_background(), "no background specified for this style");
     return background_color;
   }
-  FMT_CONSTEXPR emphasis get_emphasis() const FMT_NOEXCEPT {
+  FMT_CONSTEXPR emphasis get_emphasis() const noexcept {
     FMT_ASSERT(has_emphasis(), "no emphasis specified for this style");
     return ems;
   }
 
  private:
   FMT_CONSTEXPR text_style(bool is_foreground,
-                           internal::color_type text_color) FMT_NOEXCEPT
-      : set_foreground_color(),
-        set_background_color(),
-        ems() {
+                           detail::color_type text_color) noexcept
+      : set_foreground_color(), set_background_color(), ems() {
     if (is_foreground) {
       foreground_color = text_color;
       set_foreground_color = true;
@@ -326,45 +298,46 @@ class text_style {
     }
   }
 
-  friend FMT_CONSTEXPR_DECL text_style fg(internal::color_type foreground)
-      FMT_NOEXCEPT;
-  friend FMT_CONSTEXPR_DECL text_style bg(internal::color_type background)
-      FMT_NOEXCEPT;
+  friend FMT_CONSTEXPR text_style fg(detail::color_type foreground) noexcept;
 
-  internal::color_type foreground_color;
-  internal::color_type background_color;
+  friend FMT_CONSTEXPR text_style bg(detail::color_type background) noexcept;
+
+  detail::color_type foreground_color;
+  detail::color_type background_color;
   bool set_foreground_color;
   bool set_background_color;
   emphasis ems;
 };
 
-FMT_CONSTEXPR text_style fg(internal::color_type foreground) FMT_NOEXCEPT {
-  return text_style(/*is_foreground=*/true, foreground);
+/** Creates a text style from the foreground (text) color. */
+FMT_CONSTEXPR inline text_style fg(detail::color_type foreground) noexcept {
+  return text_style(true, foreground);
 }
 
-FMT_CONSTEXPR text_style bg(internal::color_type background) FMT_NOEXCEPT {
-  return text_style(/*is_foreground=*/false, background);
+/** Creates a text style from the background color. */
+FMT_CONSTEXPR inline text_style bg(detail::color_type background) noexcept {
+  return text_style(false, background);
 }
 
-FMT_CONSTEXPR text_style operator|(emphasis lhs, emphasis rhs) FMT_NOEXCEPT {
+FMT_CONSTEXPR inline text_style operator|(emphasis lhs, emphasis rhs) noexcept {
   return text_style(lhs) | rhs;
 }
 
-namespace internal {
+FMT_BEGIN_DETAIL_NAMESPACE
 
 template <typename Char> struct ansi_color_escape {
-  FMT_CONSTEXPR ansi_color_escape(internal::color_type text_color,
-                                  const char* esc) FMT_NOEXCEPT {
+  FMT_CONSTEXPR ansi_color_escape(detail::color_type text_color,
+                                  const char* esc) noexcept {
     // If we have a terminal color, we need to output another escape code
     // sequence.
     if (!text_color.is_rgb) {
-      bool is_background = esc == internal::data::background_color;
+      bool is_background = esc == string_view("\x1b[48;2;");
       uint32_t value = text_color.value.term_color;
       // Background ASCII codes are the same as the foreground ones but with
       // 10 more.
       if (is_background) value += 10u;
 
-      std::size_t index = 0;
+      size_t index = 0;
       buffer[index++] = static_cast<Char>('\x1b');
       buffer[index++] = static_cast<Char>('[');
 
@@ -389,17 +362,19 @@ template <typename Char> struct ansi_color_escape {
     to_esc(color.b, buffer + 15, 'm');
     buffer[19] = static_cast<Char>(0);
   }
-  FMT_CONSTEXPR ansi_color_escape(emphasis em) FMT_NOEXCEPT {
-    uint8_t em_codes[4] = {};
-    uint8_t em_bits = static_cast<uint8_t>(em);
-    if (em_bits & static_cast<uint8_t>(emphasis::bold)) em_codes[0] = 1;
-    if (em_bits & static_cast<uint8_t>(emphasis::italic)) em_codes[1] = 3;
-    if (em_bits & static_cast<uint8_t>(emphasis::underline)) em_codes[2] = 4;
-    if (em_bits & static_cast<uint8_t>(emphasis::strikethrough))
-      em_codes[3] = 9;
+  FMT_CONSTEXPR ansi_color_escape(emphasis em) noexcept {
+    uint8_t em_codes[num_emphases] = {};
+    if (has_emphasis(em, emphasis::bold)) em_codes[0] = 1;
+    if (has_emphasis(em, emphasis::faint)) em_codes[1] = 2;
+    if (has_emphasis(em, emphasis::italic)) em_codes[2] = 3;
+    if (has_emphasis(em, emphasis::underline)) em_codes[3] = 4;
+    if (has_emphasis(em, emphasis::blink)) em_codes[4] = 5;
+    if (has_emphasis(em, emphasis::reverse)) em_codes[5] = 7;
+    if (has_emphasis(em, emphasis::conceal)) em_codes[6] = 8;
+    if (has_emphasis(em, emphasis::strikethrough)) em_codes[7] = 9;
 
-    std::size_t index = 0;
-    for (int i = 0; i < 4; ++i) {
+    size_t index = 0;
+    for (size_t i = 0; i < num_emphases; ++i) {
       if (!em_codes[i]) continue;
       buffer[index++] = static_cast<Char>('\x1b');
       buffer[index++] = static_cast<Char>('[');
@@ -408,129 +383,147 @@ template <typename Char> struct ansi_color_escape {
     }
     buffer[index++] = static_cast<Char>(0);
   }
-  FMT_CONSTEXPR operator const Char*() const FMT_NOEXCEPT { return buffer; }
+  FMT_CONSTEXPR operator const Char*() const noexcept { return buffer; }
 
-  FMT_CONSTEXPR const Char* begin() const FMT_NOEXCEPT { return buffer; }
-  FMT_CONSTEXPR const Char* end() const FMT_NOEXCEPT {
+  FMT_CONSTEXPR const Char* begin() const noexcept { return buffer; }
+  FMT_CONSTEXPR_CHAR_TRAITS const Char* end() const noexcept {
     return buffer + std::char_traits<Char>::length(buffer);
   }
 
  private:
-  Char buffer[7u + 3u * 4u + 1u];
+  static constexpr size_t num_emphases = 8;
+  Char buffer[7u + 3u * num_emphases + 1u];
 
   static FMT_CONSTEXPR void to_esc(uint8_t c, Char* out,
-                                   char delimiter) FMT_NOEXCEPT {
+                                   char delimiter) noexcept {
     out[0] = static_cast<Char>('0' + c / 100);
     out[1] = static_cast<Char>('0' + c / 10 % 10);
     out[2] = static_cast<Char>('0' + c % 10);
     out[3] = static_cast<Char>(delimiter);
   }
+  static FMT_CONSTEXPR bool has_emphasis(emphasis em, emphasis mask) noexcept {
+    return static_cast<uint8_t>(em) & static_cast<uint8_t>(mask);
+  }
 };
 
 template <typename Char>
 FMT_CONSTEXPR ansi_color_escape<Char> make_foreground_color(
-    internal::color_type foreground) FMT_NOEXCEPT {
-  return ansi_color_escape<Char>(foreground, internal::data::foreground_color);
+    detail::color_type foreground) noexcept {
+  return ansi_color_escape<Char>(foreground, "\x1b[38;2;");
 }
 
 template <typename Char>
 FMT_CONSTEXPR ansi_color_escape<Char> make_background_color(
-    internal::color_type background) FMT_NOEXCEPT {
-  return ansi_color_escape<Char>(background, internal::data::background_color);
+    detail::color_type background) noexcept {
+  return ansi_color_escape<Char>(background, "\x1b[48;2;");
 }
 
 template <typename Char>
-FMT_CONSTEXPR ansi_color_escape<Char> make_emphasis(emphasis em) FMT_NOEXCEPT {
+FMT_CONSTEXPR ansi_color_escape<Char> make_emphasis(emphasis em) noexcept {
   return ansi_color_escape<Char>(em);
 }
 
-template <typename Char>
-inline void fputs(const Char* chars, FILE* stream) FMT_NOEXCEPT {
-  std::fputs(chars, stream);
+template <typename Char> inline void fputs(const Char* chars, FILE* stream) {
+  int result = std::fputs(chars, stream);
+  if (result < 0)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
 }
 
-template <>
-inline void fputs<wchar_t>(const wchar_t* chars, FILE* stream) FMT_NOEXCEPT {
-  std::fputws(chars, stream);
+template <> inline void fputs<wchar_t>(const wchar_t* chars, FILE* stream) {
+  int result = std::fputws(chars, stream);
+  if (result < 0)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
 }
 
-template <typename Char> inline void reset_color(FILE* stream) FMT_NOEXCEPT {
-  fputs(internal::data::reset_color, stream);
+template <typename Char> inline void reset_color(FILE* stream) {
+  fputs("\x1b[0m", stream);
 }
 
-template <> inline void reset_color<wchar_t>(FILE* stream) FMT_NOEXCEPT {
-  fputs(internal::data::wreset_color, stream);
+template <> inline void reset_color<wchar_t>(FILE* stream) {
+  fputs(L"\x1b[0m", stream);
 }
 
+template <typename Char> inline void reset_color(buffer<Char>& buffer) {
+  auto reset_color = string_view("\x1b[0m");
+  buffer.append(reset_color.begin(), reset_color.end());
+}
+
+template <typename T> struct styled_arg {
+  const T& value;
+  text_style style;
+};
+
 template <typename Char>
-inline void reset_color(basic_memory_buffer<Char>& buffer) FMT_NOEXCEPT {
-  const char* begin = data::reset_color;
-  const char* end = begin + sizeof(data::reset_color) - 1;
-  buffer.append(begin, end);
-}
-
-template <typename Char>
-void vformat_to(basic_memory_buffer<Char>& buf, const text_style& ts,
+void vformat_to(buffer<Char>& buf, const text_style& ts,
                 basic_string_view<Char> format_str,
-                basic_format_args<buffer_context<Char>> args) {
+                basic_format_args<buffer_context<type_identity_t<Char>>> args) {
   bool has_style = false;
   if (ts.has_emphasis()) {
     has_style = true;
-    auto emphasis = internal::make_emphasis<Char>(ts.get_emphasis());
+    auto emphasis = detail::make_emphasis<Char>(ts.get_emphasis());
     buf.append(emphasis.begin(), emphasis.end());
   }
   if (ts.has_foreground()) {
     has_style = true;
-    auto foreground =
-        internal::make_foreground_color<Char>(ts.get_foreground());
+    auto foreground = detail::make_foreground_color<Char>(ts.get_foreground());
     buf.append(foreground.begin(), foreground.end());
   }
   if (ts.has_background()) {
     has_style = true;
-    auto background =
-        internal::make_background_color<Char>(ts.get_background());
+    auto background = detail::make_background_color<Char>(ts.get_background());
     buf.append(background.begin(), background.end());
   }
-  internal::vformat_to(buf, format_str, args);
-  if (has_style) internal::reset_color<Char>(buf);
+  detail::vformat_to(buf, format_str, args, {});
+  if (has_style) detail::reset_color<Char>(buf);
 }
-}  // namespace internal
+
+FMT_END_DETAIL_NAMESPACE
 
 template <typename S, typename Char = char_t<S>>
 void vprint(std::FILE* f, const text_style& ts, const S& format,
-            basic_format_args<buffer_context<Char>> args) {
+            basic_format_args<buffer_context<type_identity_t<Char>>> args) {
   basic_memory_buffer<Char> buf;
-  internal::vformat_to(buf, ts, to_string_view(format), args);
-  buf.push_back(Char(0));
-  internal::fputs(buf.data(), f);
+  detail::vformat_to(buf, ts, detail::to_string_view(format), args);
+  if (detail::is_utf8()) {
+    detail::print(f, basic_string_view<Char>(buf.begin(), buf.size()));
+  } else {
+    buf.push_back(Char(0));
+    detail::fputs(buf.data(), f);
+  }
 }
 
 /**
+  \rst
   Formats a string and prints it to the specified file stream using ANSI
   escape sequences to specify text formatting.
-  Example:
+
+  **Example**::
+
     fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
                "Elapsed time: {0:.2f} seconds", 1.23);
+  \endrst
  */
 template <typename S, typename... Args,
-          FMT_ENABLE_IF(internal::is_string<S>::value)>
+          FMT_ENABLE_IF(detail::is_string<S>::value)>
 void print(std::FILE* f, const text_style& ts, const S& format_str,
            const Args&... args) {
-  internal::check_format_string<Args...>(format_str);
-  using context = buffer_context<char_t<S>>;
-  format_arg_store<context, Args...> as{args...};
-  vprint(f, ts, format_str, basic_format_args<context>(as));
+  vprint(f, ts, format_str,
+         fmt::make_format_args<buffer_context<char_t<S>>>(args...));
 }
 
 /**
+  \rst
   Formats a string and prints it to stdout using ANSI escape sequences to
   specify text formatting.
-  Example:
+
+  **Example**::
+
     fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
                "Elapsed time: {0:.2f} seconds", 1.23);
+  \endrst
  */
 template <typename S, typename... Args,
-          FMT_ENABLE_IF(internal::is_string<S>::value)>
+          FMT_ENABLE_IF(detail::is_string<S>::value)>
 void print(const text_style& ts, const S& format_str, const Args&... args) {
   return print(stdout, ts, format_str, args...);
 }
@@ -540,7 +533,7 @@ inline std::basic_string<Char> vformat(
     const text_style& ts, const S& format_str,
     basic_format_args<buffer_context<type_identity_t<Char>>> args) {
   basic_memory_buffer<Char> buf;
-  internal::vformat_to(buf, ts, to_string_view(format_str), args);
+  detail::vformat_to(buf, ts, detail::to_string_view(format_str), args);
   return fmt::to_string(buf);
 }
 
@@ -559,10 +552,100 @@ inline std::basic_string<Char> vformat(
 template <typename S, typename... Args, typename Char = char_t<S>>
 inline std::basic_string<Char> format(const text_style& ts, const S& format_str,
                                       const Args&... args) {
-  return vformat(ts, to_string_view(format_str),
-                 internal::make_args_checked<Args...>(format_str, args...));
+  return fmt::vformat(ts, detail::to_string_view(format_str),
+                      fmt::make_format_args<buffer_context<Char>>(args...));
 }
 
+/**
+  Formats a string with the given text_style and writes the output to ``out``.
+ */
+template <typename OutputIt, typename Char,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value)>
+OutputIt vformat_to(
+    OutputIt out, const text_style& ts, basic_string_view<Char> format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  auto&& buf = detail::get_buffer<Char>(out);
+  detail::vformat_to(buf, ts, format_str, args);
+  return detail::get_iterator(buf);
+}
+
+/**
+  \rst
+  Formats arguments with the given text_style, writes the result to the output
+  iterator ``out`` and returns the iterator past the end of the output range.
+
+  **Example**::
+
+    std::vector<char> out;
+    fmt::format_to(std::back_inserter(out),
+                   fmt::emphasis::bold | fg(fmt::color::red), "{}", 42);
+  \endrst
+*/
+template <typename OutputIt, typename S, typename... Args,
+          bool enable = detail::is_output_iterator<OutputIt, char_t<S>>::value&&
+              detail::is_string<S>::value>
+inline auto format_to(OutputIt out, const text_style& ts, const S& format_str,
+                      Args&&... args) ->
+    typename std::enable_if<enable, OutputIt>::type {
+  return vformat_to(out, ts, detail::to_string_view(format_str),
+                    fmt::make_format_args<buffer_context<char_t<S>>>(args...));
+}
+
+template <typename T, typename Char>
+struct formatter<detail::styled_arg<T>, Char> : formatter<T, Char> {
+  template <typename FormatContext>
+  auto format(const detail::styled_arg<T>& arg, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    const auto& ts = arg.style;
+    const auto& value = arg.value;
+    auto out = ctx.out();
+
+    bool has_style = false;
+    if (ts.has_emphasis()) {
+      has_style = true;
+      auto emphasis = detail::make_emphasis<Char>(ts.get_emphasis());
+      out = std::copy(emphasis.begin(), emphasis.end(), out);
+    }
+    if (ts.has_foreground()) {
+      has_style = true;
+      auto foreground =
+          detail::make_foreground_color<Char>(ts.get_foreground());
+      out = std::copy(foreground.begin(), foreground.end(), out);
+    }
+    if (ts.has_background()) {
+      has_style = true;
+      auto background =
+          detail::make_background_color<Char>(ts.get_background());
+      out = std::copy(background.begin(), background.end(), out);
+    }
+    out = formatter<T, Char>::format(value, ctx);
+    if (has_style) {
+      auto reset_color = string_view("\x1b[0m");
+      out = std::copy(reset_color.begin(), reset_color.end(), out);
+    }
+    return out;
+  }
+};
+
+/**
+  \rst
+  Returns an argument that will be formatted using ANSI escape sequences,
+  to be used in a formatting function.
+
+  **Example**::
+
+    fmt::print("Elapsed time: {0:.2f} seconds",
+               fmt::styled(1.23, fmt::fg(fmt::color::green) |
+                                 fmt::bg(fmt::color::blue)));
+  \endrst
+ */
+template <typename T>
+FMT_CONSTEXPR auto styled(const T& value, text_style ts)
+    -> detail::styled_arg<remove_cvref_t<T>> {
+  return detail::styled_arg<remove_cvref_t<T>>{value, ts};
+}
+
+FMT_MODULE_EXPORT_END
 FMT_END_NAMESPACE
 
 #endif  // FMT_COLOR_H_

externals/fmt/include/fmt/compile.h

@@ -8,344 +8,162 @@
 #ifndef FMT_COMPILE_H_
 #define FMT_COMPILE_H_
 
-#include <vector>
-
 #include "format.h"
 
 FMT_BEGIN_NAMESPACE
-namespace internal {
+namespace detail {
 
-// Part of a compiled format string. It can be either literal text or a
-// replacement field.
-template <typename Char> struct format_part {
-  enum class kind { arg_index, arg_name, text, replacement };
-
-  struct replacement {
-    arg_ref<Char> arg_id;
-    dynamic_format_specs<Char> specs;
-  };
-
-  kind part_kind;
-  union value {
-    int arg_index;
-    basic_string_view<Char> str;
-    replacement repl;
-
-    FMT_CONSTEXPR value(int index = 0) : arg_index(index) {}
-    FMT_CONSTEXPR value(basic_string_view<Char> s) : str(s) {}
-    FMT_CONSTEXPR value(replacement r) : repl(r) {}
-  } val;
-  // Position past the end of the argument id.
-  const Char* arg_id_end = nullptr;
-
-  FMT_CONSTEXPR format_part(kind k = kind::arg_index, value v = {})
-      : part_kind(k), val(v) {}
-
-  static FMT_CONSTEXPR format_part make_arg_index(int index) {
-    return format_part(kind::arg_index, index);
-  }
-  static FMT_CONSTEXPR format_part make_arg_name(basic_string_view<Char> name) {
-    return format_part(kind::arg_name, name);
-  }
-  static FMT_CONSTEXPR format_part make_text(basic_string_view<Char> text) {
-    return format_part(kind::text, text);
-  }
-  static FMT_CONSTEXPR format_part make_replacement(replacement repl) {
-    return format_part(kind::replacement, repl);
-  }
-};
-
-template <typename Char> struct part_counter {
-  unsigned num_parts = 0;
-
-  FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
-    if (begin != end) ++num_parts;
-  }
-
-  FMT_CONSTEXPR void on_arg_id() { ++num_parts; }
-  FMT_CONSTEXPR void on_arg_id(int) { ++num_parts; }
-  FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) { ++num_parts; }
-
-  FMT_CONSTEXPR void on_replacement_field(const Char*) {}
-
-  FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
-                                            const Char* end) {
-    // Find the matching brace.
-    unsigned brace_counter = 0;
-    for (; begin != end; ++begin) {
-      if (*begin == '{') {
-        ++brace_counter;
-      } else if (*begin == '}') {
-        if (brace_counter == 0u) break;
-        --brace_counter;
-      }
-    }
-    return begin;
-  }
-
-  FMT_CONSTEXPR void on_error(const char*) {}
-};
-
-// Counts the number of parts in a format string.
-template <typename Char>
-FMT_CONSTEXPR unsigned count_parts(basic_string_view<Char> format_str) {
-  part_counter<Char> counter;
-  parse_format_string<true>(format_str, counter);
-  return counter.num_parts;
+template <typename Char, typename InputIt>
+FMT_CONSTEXPR inline counting_iterator copy_str(InputIt begin, InputIt end,
+                                                counting_iterator it) {
+  return it + (end - begin);
 }
 
-template <typename Char, typename PartHandler>
-class format_string_compiler : public error_handler {
- private:
-  using part = format_part<Char>;
+template <typename OutputIt> class truncating_iterator_base {
+ protected:
+  OutputIt out_;
+  size_t limit_;
+  size_t count_ = 0;
 
-  PartHandler handler_;
-  part part_;
-  basic_string_view<Char> format_str_;
-  basic_format_parse_context<Char> parse_context_;
+  truncating_iterator_base() : out_(), limit_(0) {}
+
+  truncating_iterator_base(OutputIt out, size_t limit)
+      : out_(out), limit_(limit) {}
 
  public:
-  FMT_CONSTEXPR format_string_compiler(basic_string_view<Char> format_str,
-                                       PartHandler handler)
-      : handler_(handler),
-        format_str_(format_str),
-        parse_context_(format_str) {}
+  using iterator_category = std::output_iterator_tag;
+  using value_type = typename std::iterator_traits<OutputIt>::value_type;
+  using difference_type = std::ptrdiff_t;
+  using pointer = void;
+  using reference = void;
+  FMT_UNCHECKED_ITERATOR(truncating_iterator_base);
 
-  FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
-    if (begin != end)
-      handler_(part::make_text({begin, to_unsigned(end - begin)}));
+  OutputIt base() const { return out_; }
+  size_t count() const { return count_; }
+};
+
+// An output iterator that truncates the output and counts the number of objects
+// written to it.
+template <typename OutputIt,
+          typename Enable = typename std::is_void<
+              typename std::iterator_traits<OutputIt>::value_type>::type>
+class truncating_iterator;
+
+template <typename OutputIt>
+class truncating_iterator<OutputIt, std::false_type>
+    : public truncating_iterator_base<OutputIt> {
+  mutable typename truncating_iterator_base<OutputIt>::value_type blackhole_;
+
+ public:
+  using value_type = typename truncating_iterator_base<OutputIt>::value_type;
+
+  truncating_iterator() = default;
+
+  truncating_iterator(OutputIt out, size_t limit)
+      : truncating_iterator_base<OutputIt>(out, limit) {}
+
+  truncating_iterator& operator++() {
+    if (this->count_++ < this->limit_) ++this->out_;
+    return *this;
   }
 
-  FMT_CONSTEXPR void on_arg_id() {
-    part_ = part::make_arg_index(parse_context_.next_arg_id());
-  }
-
-  FMT_CONSTEXPR void on_arg_id(int id) {
-    parse_context_.check_arg_id(id);
-    part_ = part::make_arg_index(id);
-  }
-
-  FMT_CONSTEXPR void on_arg_id(basic_string_view<Char> id) {
-    part_ = part::make_arg_name(id);
-  }
-
-  FMT_CONSTEXPR void on_replacement_field(const Char* ptr) {
-    part_.arg_id_end = ptr;
-    handler_(part_);
-  }
-
-  FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
-                                            const Char* end) {
-    auto repl = typename part::replacement();
-    dynamic_specs_handler<basic_format_parse_context<Char>> handler(
-        repl.specs, parse_context_);
-    auto it = parse_format_specs(begin, end, handler);
-    if (*it != '}') on_error("missing '}' in format string");
-    repl.arg_id = part_.part_kind == part::kind::arg_index
-                      ? arg_ref<Char>(part_.val.arg_index)
-                      : arg_ref<Char>(part_.val.str);
-    auto part = part::make_replacement(repl);
-    part.arg_id_end = begin;
-    handler_(part);
+  truncating_iterator operator++(int) {
+    auto it = *this;
+    ++*this;
     return it;
   }
+
+  value_type& operator*() const {
+    return this->count_ < this->limit_ ? *this->out_ : blackhole_;
+  }
 };
 
-// Compiles a format string and invokes handler(part) for each parsed part.
-template <bool IS_CONSTEXPR, typename Char, typename PartHandler>
-FMT_CONSTEXPR void compile_format_string(basic_string_view<Char> format_str,
-                                         PartHandler handler) {
-  parse_format_string<IS_CONSTEXPR>(
-      format_str,
-      format_string_compiler<Char, PartHandler>(format_str, handler));
-}
+template <typename OutputIt>
+class truncating_iterator<OutputIt, std::true_type>
+    : public truncating_iterator_base<OutputIt> {
+ public:
+  truncating_iterator() = default;
 
-template <typename Range, typename Context, typename Id>
-void format_arg(
-    basic_format_parse_context<typename Range::value_type>& parse_ctx,
-    Context& ctx, Id arg_id) {
-  ctx.advance_to(
-      visit_format_arg(arg_formatter<Range>(ctx, &parse_ctx), ctx.arg(arg_id)));
-}
+  truncating_iterator(OutputIt out, size_t limit)
+      : truncating_iterator_base<OutputIt>(out, limit) {}
 
-// vformat_to is defined in a subnamespace to prevent ADL.
-namespace cf {
-template <typename Context, typename Range, typename CompiledFormat>
-auto vformat_to(Range out, CompiledFormat& cf, basic_format_args<Context> args)
-    -> typename Context::iterator {
-  using char_type = typename Context::char_type;
-  basic_format_parse_context<char_type> parse_ctx(
-      to_string_view(cf.format_str_));
-  Context ctx(out.begin(), args);
-
-  const auto& parts = cf.parts();
-  for (auto part_it = std::begin(parts); part_it != std::end(parts);
-       ++part_it) {
-    const auto& part = *part_it;
-    const auto& value = part.val;
-
-    using format_part_t = format_part<char_type>;
-    switch (part.part_kind) {
-    case format_part_t::kind::text: {
-      const auto text = value.str;
-      auto output = ctx.out();
-      auto&& it = reserve(output, text.size());
-      it = std::copy_n(text.begin(), text.size(), it);
-      ctx.advance_to(output);
-      break;
-    }
-
-    case format_part_t::kind::arg_index:
-      advance_to(parse_ctx, part.arg_id_end);
-      internal::format_arg<Range>(parse_ctx, ctx, value.arg_index);
-      break;
-
-    case format_part_t::kind::arg_name:
-      advance_to(parse_ctx, part.arg_id_end);
-      internal::format_arg<Range>(parse_ctx, ctx, value.str);
-      break;
-
-    case format_part_t::kind::replacement: {
-      const auto& arg_id_value = value.repl.arg_id.val;
-      const auto arg = value.repl.arg_id.kind == arg_id_kind::index
-                           ? ctx.arg(arg_id_value.index)
-                           : ctx.arg(arg_id_value.name);
-
-      auto specs = value.repl.specs;
-
-      handle_dynamic_spec<width_checker>(specs.width, specs.width_ref, ctx);
-      handle_dynamic_spec<precision_checker>(specs.precision,
-                                             specs.precision_ref, ctx);
-
-      error_handler h;
-      numeric_specs_checker<error_handler> checker(h, arg.type());
-      if (specs.align == align::numeric) checker.require_numeric_argument();
-      if (specs.sign != sign::none) checker.check_sign();
-      if (specs.alt) checker.require_numeric_argument();
-      if (specs.precision >= 0) checker.check_precision();
-
-      advance_to(parse_ctx, part.arg_id_end);
-      ctx.advance_to(
-          visit_format_arg(arg_formatter<Range>(ctx, nullptr, &specs), arg));
-      break;
-    }
-    }
-  }
-  return ctx.out();
-}
-}  // namespace cf
-
-struct basic_compiled_format {};
-
-template <typename S, typename = void>
-struct compiled_format_base : basic_compiled_format {
-  using char_type = char_t<S>;
-  using parts_container = std::vector<internal::format_part<char_type>>;
-
-  parts_container compiled_parts;
-
-  explicit compiled_format_base(basic_string_view<char_type> format_str) {
-    compile_format_string<false>(format_str,
-                                 [this](const format_part<char_type>& part) {
-                                   compiled_parts.push_back(part);
-                                 });
+  template <typename T> truncating_iterator& operator=(T val) {
+    if (this->count_++ < this->limit_) *this->out_++ = val;
+    return *this;
   }
 
-  const parts_container& parts() const { return compiled_parts; }
+  truncating_iterator& operator++() { return *this; }
+  truncating_iterator& operator++(int) { return *this; }
+  truncating_iterator& operator*() { return *this; }
 };
 
-template <typename Char, unsigned N> struct format_part_array {
-  format_part<Char> data[N] = {};
-  FMT_CONSTEXPR format_part_array() = default;
-};
-
-template <typename Char, unsigned N>
-FMT_CONSTEXPR format_part_array<Char, N> compile_to_parts(
-    basic_string_view<Char> format_str) {
-  format_part_array<Char, N> parts;
-  unsigned counter = 0;
-  // This is not a lambda for compatibility with older compilers.
-  struct {
-    format_part<Char>* parts;
-    unsigned* counter;
-    FMT_CONSTEXPR void operator()(const format_part<Char>& part) {
-      parts[(*counter)++] = part;
-    }
-  } collector{parts.data, &counter};
-  compile_format_string<true>(format_str, collector);
-  if (counter < N) {
-    parts.data[counter] =
-        format_part<Char>::make_text(basic_string_view<Char>());
-  }
-  return parts;
-}
-
-template <typename T> constexpr const T& constexpr_max(const T& a, const T& b) {
-  return (a < b) ? b : a;
-}
+// A compile-time string which is compiled into fast formatting code.
+class compiled_string {};
 
 template <typename S>
-struct compiled_format_base<S, enable_if_t<is_compile_string<S>::value>>
-    : basic_compiled_format {
-  using char_type = char_t<S>;
+struct is_compiled_string : std::is_base_of<compiled_string, S> {};
 
-  FMT_CONSTEXPR explicit compiled_format_base(basic_string_view<char_type>) {}
+/**
+  \rst
+  Converts a string literal *s* into a format string that will be parsed at
+  compile time and converted into efficient formatting code. Requires C++17
+  ``constexpr if`` compiler support.
 
-// Workaround for old compilers. Format string compilation will not be
-// performed there anyway.
-#if FMT_USE_CONSTEXPR
-  static FMT_CONSTEXPR_DECL const unsigned num_format_parts =
-      constexpr_max(count_parts(to_string_view(S())), 1u);
+  **Example**::
+
+    // Converts 42 into std::string using the most efficient method and no
+    // runtime format string processing.
+    std::string s = fmt::format(FMT_COMPILE("{}"), 42);
+  \endrst
+ */
+#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
+#  define FMT_COMPILE(s) \
+    FMT_STRING_IMPL(s, fmt::detail::compiled_string, explicit)
 #else
-  static const unsigned num_format_parts = 1;
+#  define FMT_COMPILE(s) FMT_STRING(s)
 #endif
 
-  using parts_container = format_part<char_type>[num_format_parts];
-
-  const parts_container& parts() const {
-    static FMT_CONSTEXPR_DECL const auto compiled_parts =
-        compile_to_parts<char_type, num_format_parts>(
-            internal::to_string_view(S()));
-    return compiled_parts.data;
+#if FMT_USE_NONTYPE_TEMPLATE_ARGS
+template <typename Char, size_t N,
+          fmt::detail_exported::fixed_string<Char, N> Str>
+struct udl_compiled_string : compiled_string {
+  using char_type = Char;
+  explicit constexpr operator basic_string_view<char_type>() const {
+    return {Str.data, N - 1};
   }
 };
+#endif
 
-template <typename S, typename... Args>
-class compiled_format : private compiled_format_base<S> {
- public:
-  using typename compiled_format_base<S>::char_type;
+template <typename T, typename... Tail>
+const T& first(const T& value, const Tail&...) {
+  return value;
+}
 
- private:
-  basic_string_view<char_type> format_str_;
-
-  template <typename Context, typename Range, typename CompiledFormat>
-  friend auto cf::vformat_to(Range out, CompiledFormat& cf,
-                             basic_format_args<Context> args) ->
-      typename Context::iterator;
-
- public:
-  compiled_format() = delete;
-  explicit constexpr compiled_format(basic_string_view<char_type> format_str)
-      : compiled_format_base<S>(format_str), format_str_(format_str) {}
-};
-
-#ifdef __cpp_if_constexpr
+#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
 template <typename... Args> struct type_list {};
 
 // Returns a reference to the argument at index N from [first, rest...].
 template <int N, typename T, typename... Args>
-constexpr const auto& get(const T& first, const Args&... rest) {
+constexpr const auto& get([[maybe_unused]] const T& first,
+                          [[maybe_unused]] const Args&... rest) {
   static_assert(N < 1 + sizeof...(Args), "index is out of bounds");
   if constexpr (N == 0)
     return first;
   else
-    return get<N - 1>(rest...);
+    return detail::get<N - 1>(rest...);
+}
+
+template <typename Char, typename... Args>
+constexpr int get_arg_index_by_name(basic_string_view<Char> name,
+                                    type_list<Args...>) {
+  return get_arg_index_by_name<Args...>(name);
 }
 
 template <int N, typename> struct get_type_impl;
 
 template <int N, typename... Args> struct get_type_impl<N, type_list<Args...>> {
-  using type = remove_cvref_t<decltype(get<N>(std::declval<Args>()...))>;
+  using type =
+      remove_cvref_t<decltype(detail::get<N>(std::declval<Args>()...))>;
 };
 
 template <int N, typename T>
@@ -358,9 +176,8 @@ template <typename Char> struct text {
   using char_type = Char;
 
   template <typename OutputIt, typename... Args>
-  OutputIt format(OutputIt out, const Args&...) const {
-    // TODO: reserve
-    return copy_str<Char>(data.begin(), data.end(), out);
+  constexpr OutputIt format(OutputIt out, const Args&...) const {
+    return write<Char>(out, data);
   }
 };
 
@@ -373,55 +190,100 @@ constexpr text<Char> make_text(basic_string_view<Char> s, size_t pos,
   return {{&s[pos], size}};
 }
 
-template <typename Char, typename OutputIt, typename T,
-          std::enable_if_t<std::is_integral_v<T>, int> = 0>
-OutputIt format_default(OutputIt out, T value) {
-  // TODO: reserve
-  format_int fi(value);
-  return std::copy(fi.data(), fi.data() + fi.size(), out);
+template <typename Char> struct code_unit {
+  Char value;
+  using char_type = Char;
+
+  template <typename OutputIt, typename... Args>
+  constexpr OutputIt format(OutputIt out, const Args&...) const {
+    return write<Char>(out, value);
+  }
+};
+
+// This ensures that the argument type is convertible to `const T&`.
+template <typename T, int N, typename... Args>
+constexpr const T& get_arg_checked(const Args&... args) {
+  const auto& arg = detail::get<N>(args...);
+  if constexpr (detail::is_named_arg<remove_cvref_t<decltype(arg)>>()) {
+    return arg.value;
+  } else {
+    return arg;
+  }
 }
 
-template <typename Char, typename OutputIt>
-OutputIt format_default(OutputIt out, double value) {
-  writer w(out);
-  w.write(value);
-  return w.out();
-}
-
-template <typename Char, typename OutputIt>
-OutputIt format_default(OutputIt out, Char value) {
-  *out++ = value;
-  return out;
-}
-
-template <typename Char, typename OutputIt>
-OutputIt format_default(OutputIt out, const Char* value) {
-  auto length = std::char_traits<Char>::length(value);
-  return copy_str<Char>(value, value + length, out);
-}
+template <typename Char>
+struct is_compiled_format<code_unit<Char>> : std::true_type {};
 
 // A replacement field that refers to argument N.
 template <typename Char, typename T, int N> struct field {
   using char_type = Char;
 
   template <typename OutputIt, typename... Args>
-  OutputIt format(OutputIt out, const Args&... args) const {
-    // This ensures that the argument type is convertile to `const T&`.
-    const T& arg = get<N>(args...);
-    return format_default<Char>(out, arg);
+  constexpr OutputIt format(OutputIt out, const Args&... args) const {
+    return write<Char>(out, get_arg_checked<T, N>(args...));
   }
 };
 
 template <typename Char, typename T, int N>
 struct is_compiled_format<field<Char, T, N>> : std::true_type {};
 
+// A replacement field that refers to argument with name.
+template <typename Char> struct runtime_named_field {
+  using char_type = Char;
+  basic_string_view<Char> name;
+
+  template <typename OutputIt, typename T>
+  constexpr static bool try_format_argument(
+      OutputIt& out,
+      // [[maybe_unused]] due to unused-but-set-parameter warning in GCC 7,8,9
+      [[maybe_unused]] basic_string_view<Char> arg_name, const T& arg) {
+    if constexpr (is_named_arg<typename std::remove_cv<T>::type>::value) {
+      if (arg_name == arg.name) {
+        out = write<Char>(out, arg.value);
+        return true;
+      }
+    }
+    return false;
+  }
+
+  template <typename OutputIt, typename... Args>
+  constexpr OutputIt format(OutputIt out, const Args&... args) const {
+    bool found = (try_format_argument(out, name, args) || ...);
+    if (!found) {
+      FMT_THROW(format_error("argument with specified name is not found"));
+    }
+    return out;
+  }
+};
+
+template <typename Char>
+struct is_compiled_format<runtime_named_field<Char>> : std::true_type {};
+
+// A replacement field that refers to argument N and has format specifiers.
+template <typename Char, typename T, int N> struct spec_field {
+  using char_type = Char;
+  formatter<T, Char> fmt;
+
+  template <typename OutputIt, typename... Args>
+  constexpr FMT_INLINE OutputIt format(OutputIt out,
+                                       const Args&... args) const {
+    const auto& vargs =
+        fmt::make_format_args<basic_format_context<OutputIt, Char>>(args...);
+    basic_format_context<OutputIt, Char> ctx(out, vargs);
+    return fmt.format(get_arg_checked<T, N>(args...), ctx);
+  }
+};
+
+template <typename Char, typename T, int N>
+struct is_compiled_format<spec_field<Char, T, N>> : std::true_type {};
+
 template <typename L, typename R> struct concat {
   L lhs;
   R rhs;
   using char_type = typename L::char_type;
 
   template <typename OutputIt, typename... Args>
-  OutputIt format(OutputIt out, const Args&... args) const {
+  constexpr OutputIt format(OutputIt out, const Args&... args) const {
     out = lhs.format(out, args...);
     return rhs.format(out, args...);
   }
@@ -450,7 +312,8 @@ constexpr auto compile_format_string(S format_str);
 
 template <typename Args, size_t POS, int ID, typename T, typename S>
 constexpr auto parse_tail(T head, S format_str) {
-  if constexpr (POS != to_string_view(format_str).size()) {
+  if constexpr (POS !=
+                basic_string_view<typename S::char_type>(format_str).size()) {
     constexpr auto tail = compile_format_string<Args, POS, ID>(format_str);
     if constexpr (std::is_same<remove_cvref_t<decltype(tail)>,
                                unknown_format>())
@@ -462,134 +325,287 @@ constexpr auto parse_tail(T head, S format_str) {
   }
 }
 
+template <typename T, typename Char> struct parse_specs_result {
+  formatter<T, Char> fmt;
+  size_t end;
+  int next_arg_id;
+};
+
+constexpr int manual_indexing_id = -1;
+
+template <typename T, typename Char>
+constexpr parse_specs_result<T, Char> parse_specs(basic_string_view<Char> str,
+                                                  size_t pos, int next_arg_id) {
+  str.remove_prefix(pos);
+  auto ctx = compile_parse_context<Char>(str, max_value<int>(), nullptr, {},
+                                         next_arg_id);
+  auto f = formatter<T, Char>();
+  auto end = f.parse(ctx);
+  return {f, pos + fmt::detail::to_unsigned(end - str.data()),
+          next_arg_id == 0 ? manual_indexing_id : ctx.next_arg_id()};
+}
+
+template <typename Char> struct arg_id_handler {
+  arg_ref<Char> arg_id;
+
+  constexpr int operator()() {
+    FMT_ASSERT(false, "handler cannot be used with automatic indexing");
+    return 0;
+  }
+  constexpr int operator()(int id) {
+    arg_id = arg_ref<Char>(id);
+    return 0;
+  }
+  constexpr int operator()(basic_string_view<Char> id) {
+    arg_id = arg_ref<Char>(id);
+    return 0;
+  }
+
+  constexpr void on_error(const char* message) {
+    FMT_THROW(format_error(message));
+  }
+};
+
+template <typename Char> struct parse_arg_id_result {
+  arg_ref<Char> arg_id;
+  const Char* arg_id_end;
+};
+
+template <int ID, typename Char>
+constexpr auto parse_arg_id(const Char* begin, const Char* end) {
+  auto handler = arg_id_handler<Char>{arg_ref<Char>{}};
+  auto arg_id_end = parse_arg_id(begin, end, handler);
+  return parse_arg_id_result<Char>{handler.arg_id, arg_id_end};
+}
+
+template <typename T, typename Enable = void> struct field_type {
+  using type = remove_cvref_t<T>;
+};
+
+template <typename T>
+struct field_type<T, enable_if_t<detail::is_named_arg<T>::value>> {
+  using type = remove_cvref_t<decltype(T::value)>;
+};
+
+template <typename T, typename Args, size_t END_POS, int ARG_INDEX, int NEXT_ID,
+          typename S>
+constexpr auto parse_replacement_field_then_tail(S format_str) {
+  using char_type = typename S::char_type;
+  constexpr auto str = basic_string_view<char_type>(format_str);
+  constexpr char_type c = END_POS != str.size() ? str[END_POS] : char_type();
+  if constexpr (c == '}') {
+    return parse_tail<Args, END_POS + 1, NEXT_ID>(
+        field<char_type, typename field_type<T>::type, ARG_INDEX>(),
+        format_str);
+  } else if constexpr (c != ':') {
+    FMT_THROW(format_error("expected ':'"));
+  } else {
+    constexpr auto result = parse_specs<typename field_type<T>::type>(
+        str, END_POS + 1, NEXT_ID == manual_indexing_id ? 0 : NEXT_ID);
+    if constexpr (result.end >= str.size() || str[result.end] != '}') {
+      FMT_THROW(format_error("expected '}'"));
+      return 0;
+    } else {
+      return parse_tail<Args, result.end + 1, result.next_arg_id>(
+          spec_field<char_type, typename field_type<T>::type, ARG_INDEX>{
+              result.fmt},
+          format_str);
+    }
+  }
+}
+
 // Compiles a non-empty format string and returns the compiled representation
 // or unknown_format() on unrecognized input.
 template <typename Args, size_t POS, int ID, typename S>
 constexpr auto compile_format_string(S format_str) {
   using char_type = typename S::char_type;
-  constexpr basic_string_view<char_type> str = format_str;
+  constexpr auto str = basic_string_view<char_type>(format_str);
   if constexpr (str[POS] == '{') {
-    if (POS + 1 == str.size())
-      throw format_error("unmatched '{' in format string");
+    if constexpr (POS + 1 == str.size())
+      FMT_THROW(format_error("unmatched '{' in format string"));
     if constexpr (str[POS + 1] == '{') {
       return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
-    } else if constexpr (str[POS + 1] == '}') {
-      using type = get_type<ID, Args>;
-      if constexpr (std::is_same<type, int>::value) {
-        return parse_tail<Args, POS + 2, ID + 1>(field<char_type, type, ID>(),
-                                                 format_str);
-      } else {
-        return unknown_format();
-      }
+    } else if constexpr (str[POS + 1] == '}' || str[POS + 1] == ':') {
+      static_assert(ID != manual_indexing_id,
+                    "cannot switch from manual to automatic argument indexing");
+      constexpr auto next_id =
+          ID != manual_indexing_id ? ID + 1 : manual_indexing_id;
+      return parse_replacement_field_then_tail<get_type<ID, Args>, Args,
+                                               POS + 1, ID, next_id>(
+          format_str);
     } else {
-      return unknown_format();
+      constexpr auto arg_id_result =
+          parse_arg_id<ID>(str.data() + POS + 1, str.data() + str.size());
+      constexpr auto arg_id_end_pos = arg_id_result.arg_id_end - str.data();
+      constexpr char_type c =
+          arg_id_end_pos != str.size() ? str[arg_id_end_pos] : char_type();
+      static_assert(c == '}' || c == ':', "missing '}' in format string");
+      if constexpr (arg_id_result.arg_id.kind == arg_id_kind::index) {
+        static_assert(
+            ID == manual_indexing_id || ID == 0,
+            "cannot switch from automatic to manual argument indexing");
+        constexpr auto arg_index = arg_id_result.arg_id.val.index;
+        return parse_replacement_field_then_tail<get_type<arg_index, Args>,
+                                                 Args, arg_id_end_pos,
+                                                 arg_index, manual_indexing_id>(
+            format_str);
+      } else if constexpr (arg_id_result.arg_id.kind == arg_id_kind::name) {
+        constexpr auto arg_index =
+            get_arg_index_by_name(arg_id_result.arg_id.val.name, Args{});
+        if constexpr (arg_index != invalid_arg_index) {
+          constexpr auto next_id =
+              ID != manual_indexing_id ? ID + 1 : manual_indexing_id;
+          return parse_replacement_field_then_tail<
+              decltype(get_type<arg_index, Args>::value), Args, arg_id_end_pos,
+              arg_index, next_id>(format_str);
+        } else {
+          if constexpr (c == '}') {
+            return parse_tail<Args, arg_id_end_pos + 1, ID>(
+                runtime_named_field<char_type>{arg_id_result.arg_id.val.name},
+                format_str);
+          } else if constexpr (c == ':') {
+            return unknown_format();  // no type info for specs parsing
+          }
+        }
+      }
     }
   } else if constexpr (str[POS] == '}') {
-    if (POS + 1 == str.size())
-      throw format_error("unmatched '}' in format string");
+    if constexpr (POS + 1 == str.size())
+      FMT_THROW(format_error("unmatched '}' in format string"));
     return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
   } else {
     constexpr auto end = parse_text(str, POS + 1);
-    return parse_tail<Args, end, ID>(make_text(str, POS, end - POS),
-                                     format_str);
-  }
-}
-#endif  // __cpp_if_constexpr
-}  // namespace internal
-
-#if FMT_USE_CONSTEXPR
-#  ifdef __cpp_if_constexpr
-template <typename... Args, typename S,
-          FMT_ENABLE_IF(is_compile_string<S>::value)>
-constexpr auto compile(S format_str) {
-  constexpr basic_string_view<typename S::char_type> str = format_str;
-  if constexpr (str.size() == 0) {
-    return internal::make_text(str, 0, 0);
-  } else {
-    constexpr auto result =
-        internal::compile_format_string<internal::type_list<Args...>, 0, 0>(
-            format_str);
-    if constexpr (std::is_same<remove_cvref_t<decltype(result)>,
-                               internal::unknown_format>()) {
-      return internal::compiled_format<S, Args...>(to_string_view(format_str));
+    if constexpr (end - POS > 1) {
+      return parse_tail<Args, end, ID>(make_text(str, POS, end - POS),
+                                       format_str);
     } else {
-      return result;
+      return parse_tail<Args, end, ID>(code_unit<char_type>{str[POS]},
+                                       format_str);
     }
   }
 }
 
+template <typename... Args, typename S,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+constexpr auto compile(S format_str) {
+  constexpr auto str = basic_string_view<typename S::char_type>(format_str);
+  if constexpr (str.size() == 0) {
+    return detail::make_text(str, 0, 0);
+  } else {
+    constexpr auto result =
+        detail::compile_format_string<detail::type_list<Args...>, 0, 0>(
+            format_str);
+    return result;
+  }
+}
+#endif  // defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
+}  // namespace detail
+
+FMT_MODULE_EXPORT_BEGIN
+
+#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
+
 template <typename CompiledFormat, typename... Args,
           typename Char = typename CompiledFormat::char_type,
-          FMT_ENABLE_IF(internal::is_compiled_format<CompiledFormat>::value)>
-std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
-  basic_memory_buffer<Char> buffer;
-  cf.format(std::back_inserter(buffer), args...);
-  return to_string(buffer);
+          FMT_ENABLE_IF(detail::is_compiled_format<CompiledFormat>::value)>
+FMT_INLINE std::basic_string<Char> format(const CompiledFormat& cf,
+                                          const Args&... args) {
+  auto s = std::basic_string<Char>();
+  cf.format(std::back_inserter(s), args...);
+  return s;
 }
 
 template <typename OutputIt, typename CompiledFormat, typename... Args,
-          FMT_ENABLE_IF(internal::is_compiled_format<CompiledFormat>::value)>
-OutputIt format_to(OutputIt out, const CompiledFormat& cf,
-                   const Args&... args) {
+          FMT_ENABLE_IF(detail::is_compiled_format<CompiledFormat>::value)>
+constexpr FMT_INLINE OutputIt format_to(OutputIt out, const CompiledFormat& cf,
+                                        const Args&... args) {
   return cf.format(out, args...);
 }
-#  else
-template <typename... Args, typename S,
-          FMT_ENABLE_IF(is_compile_string<S>::value)>
-constexpr auto compile(S format_str) -> internal::compiled_format<S, Args...> {
-  return internal::compiled_format<S, Args...>(to_string_view(format_str));
-}
-#  endif  // __cpp_if_constexpr
-#endif    // FMT_USE_CONSTEXPR
 
-// Compiles the format string which must be a string literal.
-template <typename... Args, typename Char, size_t N>
-auto compile(const Char (&format_str)[N])
-    -> internal::compiled_format<const Char*, Args...> {
-  return internal::compiled_format<const Char*, Args...>(
-      basic_string_view<Char>(format_str, N - 1));
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+FMT_INLINE std::basic_string<typename S::char_type> format(const S&,
+                                                           Args&&... args) {
+  if constexpr (std::is_same<typename S::char_type, char>::value) {
+    constexpr auto str = basic_string_view<typename S::char_type>(S());
+    if constexpr (str.size() == 2 && str[0] == '{' && str[1] == '}') {
+      const auto& first = detail::first(args...);
+      if constexpr (detail::is_named_arg<
+                        remove_cvref_t<decltype(first)>>::value) {
+        return fmt::to_string(first.value);
+      } else {
+        return fmt::to_string(first);
+      }
+    }
+  }
+  constexpr auto compiled = detail::compile<Args...>(S());
+  if constexpr (std::is_same<remove_cvref_t<decltype(compiled)>,
+                             detail::unknown_format>()) {
+    return fmt::format(
+        static_cast<basic_string_view<typename S::char_type>>(S()),
+        std::forward<Args>(args)...);
+  } else {
+    return fmt::format(compiled, std::forward<Args>(args)...);
+  }
 }
 
-template <typename CompiledFormat, typename... Args,
-          typename Char = typename CompiledFormat::char_type,
-          FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
-                                        CompiledFormat>::value)>
-std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
-  basic_memory_buffer<Char> buffer;
-  using range = buffer_range<Char>;
-  using context = buffer_context<Char>;
-  internal::cf::vformat_to<context>(range(buffer), cf,
-                                    make_format_args<context>(args...));
-  return to_string(buffer);
+template <typename OutputIt, typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+FMT_CONSTEXPR OutputIt format_to(OutputIt out, const S&, Args&&... args) {
+  constexpr auto compiled = detail::compile<Args...>(S());
+  if constexpr (std::is_same<remove_cvref_t<decltype(compiled)>,
+                             detail::unknown_format>()) {
+    return fmt::format_to(
+        out, static_cast<basic_string_view<typename S::char_type>>(S()),
+        std::forward<Args>(args)...);
+  } else {
+    return fmt::format_to(out, compiled, std::forward<Args>(args)...);
+  }
 }
+#endif
 
-template <typename OutputIt, typename CompiledFormat, typename... Args,
-          FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
-                                        CompiledFormat>::value)>
-OutputIt format_to(OutputIt out, const CompiledFormat& cf,
-                   const Args&... args) {
-  using char_type = typename CompiledFormat::char_type;
-  using range = internal::output_range<OutputIt, char_type>;
-  using context = format_context_t<OutputIt, char_type>;
-  return internal::cf::vformat_to<context>(range(out), cf,
-                                           make_format_args<context>(args...));
-}
-
-template <typename OutputIt, typename CompiledFormat, typename... Args,
-          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)>
+template <typename OutputIt, typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
 format_to_n_result<OutputIt> format_to_n(OutputIt out, size_t n,
-                                         const CompiledFormat& cf,
-                                         const Args&... args) {
-  auto it =
-      format_to(internal::truncating_iterator<OutputIt>(out, n), cf, args...);
+                                         const S& format_str, Args&&... args) {
+  auto it = fmt::format_to(detail::truncating_iterator<OutputIt>(out, n),
+                           format_str, std::forward<Args>(args)...);
   return {it.base(), it.count()};
 }
 
-template <typename CompiledFormat, typename... Args>
-std::size_t formatted_size(const CompiledFormat& cf, const Args&... args) {
-  return format_to(internal::counting_iterator(), cf, args...).count();
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+FMT_CONSTEXPR20 size_t formatted_size(const S& format_str,
+                                      const Args&... args) {
+  return fmt::format_to(detail::counting_iterator(), format_str, args...)
+      .count();
 }
 
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+void print(std::FILE* f, const S& format_str, const Args&... args) {
+  memory_buffer buffer;
+  fmt::format_to(std::back_inserter(buffer), format_str, args...);
+  detail::print(f, {buffer.data(), buffer.size()});
+}
+
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+void print(const S& format_str, const Args&... args) {
+  print(stdout, format_str, args...);
+}
+
+#if FMT_USE_NONTYPE_TEMPLATE_ARGS
+inline namespace literals {
+template <detail_exported::fixed_string Str> constexpr auto operator""_cf() {
+  using char_t = remove_cvref_t<decltype(Str.data[0])>;
+  return detail::udl_compiled_string<char_t, sizeof(Str.data) / sizeof(char_t),
+                                     Str>();
+}
+}  // namespace literals
+#endif
+
+FMT_MODULE_EXPORT_END
 FMT_END_NAMESPACE
 
 #endif  // FMT_COMPILE_H_

externals/fmt/include/fmt/locale.h

@@ -1,78 +0,0 @@
-// Formatting library for C++ - std::locale support
-//
-// Copyright (c) 2012 - present, Victor Zverovich
-// All rights reserved.
-//
-// For the license information refer to format.h.
-
-#ifndef FMT_LOCALE_H_
-#define FMT_LOCALE_H_
-
-#include <locale>
-
-#include "format.h"
-
-FMT_BEGIN_NAMESPACE
-
-namespace internal {
-template <typename Char>
-typename buffer_context<Char>::iterator vformat_to(
-    const std::locale& loc, buffer<Char>& buf,
-    basic_string_view<Char> format_str,
-    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
-  using range = buffer_range<Char>;
-  return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str), args,
-                                          internal::locale_ref(loc));
-}
-
-template <typename Char>
-std::basic_string<Char> vformat(
-    const std::locale& loc, basic_string_view<Char> format_str,
-    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
-  basic_memory_buffer<Char> buffer;
-  internal::vformat_to(loc, buffer, format_str, args);
-  return fmt::to_string(buffer);
-}
-}  // namespace internal
-
-template <typename S, typename Char = char_t<S>>
-inline std::basic_string<Char> vformat(
-    const std::locale& loc, const S& format_str,
-    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
-  return internal::vformat(loc, to_string_view(format_str), args);
-}
-
-template <typename S, typename... Args, typename Char = char_t<S>>
-inline std::basic_string<Char> format(const std::locale& loc,
-                                      const S& format_str, Args&&... args) {
-  return internal::vformat(
-      loc, to_string_view(format_str),
-      internal::make_args_checked<Args...>(format_str, args...));
-}
-
-template <typename S, typename OutputIt, typename... Args,
-          typename Char = enable_if_t<
-              internal::is_output_iterator<OutputIt>::value, char_t<S>>>
-inline OutputIt vformat_to(
-    OutputIt out, const std::locale& loc, const S& format_str,
-    format_args_t<type_identity_t<OutputIt>, Char> args) {
-  using range = internal::output_range<OutputIt, Char>;
-  return vformat_to<arg_formatter<range>>(
-      range(out), to_string_view(format_str), args, internal::locale_ref(loc));
-}
-
-template <typename OutputIt, typename S, typename... Args,
-          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value&&
-                            internal::is_string<S>::value)>
-inline OutputIt format_to(OutputIt out, const std::locale& loc,
-                          const S& format_str, Args&&... args) {
-  internal::check_format_string<Args...>(format_str);
-  using context = format_context_t<OutputIt, char_t<S>>;
-  format_arg_store<context, Args...> as{args...};
-  return vformat_to(out, loc, to_string_view(format_str),
-                    basic_format_args<context>(as));
-}
-
-FMT_END_NAMESPACE
-
-#endif  // FMT_LOCALE_H_

externals/fmt/include/fmt/os.h

@@ -8,16 +8,10 @@
 #ifndef FMT_OS_H_
 #define FMT_OS_H_
 
-#if defined(__MINGW32__) || defined(__CYGWIN__)
-// Workaround MinGW bug https://sourceforge.net/p/mingw/bugs/2024/.
-#  undef __STRICT_ANSI__
-#endif
-
 #include <cerrno>
-#include <clocale>  // for locale_t
 #include <cstddef>
 #include <cstdio>
-#include <cstdlib>  // for strtod_l
+#include <system_error>  // std::system_error
 
 #if defined __APPLE__ || defined(__FreeBSD__)
 #  include <xlocale.h>  // for LC_NUMERIC_MASK on OS X
@@ -25,16 +19,20 @@
 
 #include "format.h"
 
+#ifndef FMT_USE_FCNTL
 // UWP doesn't provide _pipe.
-#if FMT_HAS_INCLUDE("winapifamily.h")
-#  include <winapifamily.h>
-#endif
-#if FMT_HAS_INCLUDE("fcntl.h") && \
-    (!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
-#  include <fcntl.h>  // for O_RDONLY
-#  define FMT_USE_FCNTL 1
-#else
-#  define FMT_USE_FCNTL 0
+#  if FMT_HAS_INCLUDE("winapifamily.h")
+#    include <winapifamily.h>
+#  endif
+#  if (FMT_HAS_INCLUDE(<fcntl.h>) || defined(__APPLE__) || \
+       defined(__linux__)) &&                              \
+      (!defined(WINAPI_FAMILY) ||                          \
+       (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
+#    include <fcntl.h>  // for O_RDONLY
+#    define FMT_USE_FCNTL 1
+#  else
+#    define FMT_USE_FCNTL 0
+#  endif
 #endif
 
 #ifndef FMT_POSIX
@@ -50,7 +48,7 @@
 #ifdef FMT_SYSTEM
 #  define FMT_POSIX_CALL(call) FMT_SYSTEM(call)
 #else
-#  define FMT_SYSTEM(call) call
+#  define FMT_SYSTEM(call) ::call
 #  ifdef _WIN32
 // Fix warnings about deprecated symbols.
 #    define FMT_POSIX_CALL(call) ::_##call
@@ -73,6 +71,7 @@
 #define FMT_RETRY(result, expression) FMT_RETRY_VAL(result, expression, -1)
 
 FMT_BEGIN_NAMESPACE
+FMT_MODULE_EXPORT_BEGIN
 
 /**
   \rst
@@ -121,19 +120,28 @@ template <typename Char> class basic_cstring_view {
 using cstring_view = basic_cstring_view<char>;
 using wcstring_view = basic_cstring_view<wchar_t>;
 
-// An error code.
-class error_code {
- private:
-  int value_;
+template <typename Char> struct formatter<std::error_code, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
 
- public:
-  explicit error_code(int value = 0) FMT_NOEXCEPT : value_(value) {}
-
-  int get() const FMT_NOEXCEPT { return value_; }
+  template <typename FormatContext>
+  FMT_CONSTEXPR auto format(const std::error_code& ec, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    out = detail::write_bytes(out, ec.category().name(),
+                              basic_format_specs<Char>());
+    out = detail::write<Char>(out, Char(':'));
+    out = detail::write<Char>(out, ec.value());
+    return out;
+  }
 };
 
 #ifdef _WIN32
-namespace internal {
+FMT_API const std::error_category& system_category() noexcept;
+
+FMT_BEGIN_DETAIL_NAMESPACE
 // A converter from UTF-16 to UTF-8.
 // It is only provided for Windows since other systems support UTF-8 natively.
 class utf16_to_utf8 {
@@ -142,7 +150,7 @@ class utf16_to_utf8 {
 
  public:
   utf16_to_utf8() {}
-  FMT_API explicit utf16_to_utf8(wstring_view s);
+  FMT_API explicit utf16_to_utf8(basic_string_view<wchar_t> s);
   operator string_view() const { return string_view(&buffer_[0], size()); }
   size_t size() const { return buffer_.size() - 1; }
   const char* c_str() const { return &buffer_[0]; }
@@ -151,59 +159,67 @@ class utf16_to_utf8 {
   // Performs conversion returning a system error code instead of
   // throwing exception on conversion error. This method may still throw
   // in case of memory allocation error.
-  FMT_API int convert(wstring_view s);
+  FMT_API int convert(basic_string_view<wchar_t> s);
 };
 
 FMT_API void format_windows_error(buffer<char>& out, int error_code,
-                                  string_view message) FMT_NOEXCEPT;
-}  // namespace internal
+                                  const char* message) noexcept;
+FMT_END_DETAIL_NAMESPACE
 
-/** A Windows error. */
-class windows_error : public system_error {
- private:
-  FMT_API void init(int error_code, string_view format_str, format_args args);
+FMT_API std::system_error vwindows_error(int error_code, string_view format_str,
+                                         format_args args);
 
- public:
-  /**
-   \rst
-   Constructs a :class:`fmt::windows_error` object with the description
-   of the form
+/**
+ \rst
+ Constructs a :class:`std::system_error` object with the description
+ of the form
 
-   .. parsed-literal::
-     *<message>*: *<system-message>*
+ .. parsed-literal::
+   *<message>*: *<system-message>*
 
-   where *<message>* is the formatted message and *<system-message>* is the
-   system message corresponding to the error code.
-   *error_code* is a Windows error code as given by ``GetLastError``.
-   If *error_code* is not a valid error code such as -1, the system message
-   will look like "error -1".
+ where *<message>* is the formatted message and *<system-message>* is the
+ system message corresponding to the error code.
+ *error_code* is a Windows error code as given by ``GetLastError``.
+ If *error_code* is not a valid error code such as -1, the system message
+ will look like "error -1".
 
-   **Example**::
+ **Example**::
 
-     // This throws a windows_error with the description
-     //   cannot open file 'madeup': The system cannot find the file specified.
-     // or similar (system message may vary).
-     const char *filename = "madeup";
-     LPOFSTRUCT of = LPOFSTRUCT();
-     HFILE file = OpenFile(filename, &of, OF_READ);
-     if (file == HFILE_ERROR) {
-       throw fmt::windows_error(GetLastError(),
-                                "cannot open file '{}'", filename);
-     }
-   \endrst
-  */
-  template <typename... Args>
-  windows_error(int error_code, string_view message, const Args&... args) {
-    init(error_code, message, make_format_args(args...));
-  }
-};
+   // This throws a system_error with the description
+   //   cannot open file 'madeup': The system cannot find the file specified.
+   // or similar (system message may vary).
+   const char *filename = "madeup";
+   LPOFSTRUCT of = LPOFSTRUCT();
+   HFILE file = OpenFile(filename, &of, OF_READ);
+   if (file == HFILE_ERROR) {
+     throw fmt::windows_error(GetLastError(),
+                              "cannot open file '{}'", filename);
+   }
+ \endrst
+*/
+template <typename... Args>
+std::system_error windows_error(int error_code, string_view message,
+                                const Args&... args) {
+  return vwindows_error(error_code, message, fmt::make_format_args(args...));
+}
 
 // Reports a Windows error without throwing an exception.
 // Can be used to report errors from destructors.
-FMT_API void report_windows_error(int error_code,
-                                  string_view message) FMT_NOEXCEPT;
+FMT_API void report_windows_error(int error_code, const char* message) noexcept;
+#else
+inline const std::error_category& system_category() noexcept {
+  return std::system_category();
+}
 #endif  // _WIN32
 
+// std::system is not available on some platforms such as iOS (#2248).
+#ifdef __OSX__
+template <typename S, typename... Args, typename Char = char_t<S>>
+void say(const S& format_str, Args&&... args) {
+  std::system(format("say \"{}\"", format(format_str, args...)).c_str());
+}
+#endif
+
 // A buffered file.
 class buffered_file {
  private:
@@ -218,13 +234,13 @@ class buffered_file {
   void operator=(const buffered_file&) = delete;
 
   // Constructs a buffered_file object which doesn't represent any file.
-  buffered_file() FMT_NOEXCEPT : file_(nullptr) {}
+  buffered_file() noexcept : file_(nullptr) {}
 
   // Destroys the object closing the file it represents if any.
-  FMT_API ~buffered_file() FMT_NOEXCEPT;
+  FMT_API ~buffered_file() noexcept;
 
  public:
-  buffered_file(buffered_file&& other) FMT_NOEXCEPT : file_(other.file_) {
+  buffered_file(buffered_file&& other) noexcept : file_(other.file_) {
     other.file_ = nullptr;
   }
 
@@ -242,11 +258,9 @@ class buffered_file {
   FMT_API void close();
 
   // Returns the pointer to a FILE object representing this file.
-  FILE* get() const FMT_NOEXCEPT { return file_; }
+  FILE* get() const noexcept { return file_; }
 
-  // We place parentheses around fileno to workaround a bug in some versions
-  // of MinGW that define fileno as a macro.
-  FMT_API int(fileno)() const;
+  FMT_API int descriptor() const;
 
   void vprint(string_view format_str, format_args args) {
     fmt::vprint(file_, format_str, args);
@@ -254,18 +268,18 @@ class buffered_file {
 
   template <typename... Args>
   inline void print(string_view format_str, const Args&... args) {
-    vprint(format_str, make_format_args(args...));
+    vprint(format_str, fmt::make_format_args(args...));
   }
 };
 
 #if FMT_USE_FCNTL
 // A file. Closed file is represented by a file object with descriptor -1.
-// Methods that are not declared with FMT_NOEXCEPT may throw
+// Methods that are not declared with noexcept may throw
 // fmt::system_error in case of failure. Note that some errors such as
 // closing the file multiple times will cause a crash on Windows rather
 // than an exception. You can get standard behavior by overriding the
 // invalid parameter handler with _set_invalid_parameter_handler.
-class file {
+class FMT_API file {
  private:
   int fd_;  // File descriptor.
 
@@ -277,22 +291,26 @@ class file {
   enum {
     RDONLY = FMT_POSIX(O_RDONLY),  // Open for reading only.
     WRONLY = FMT_POSIX(O_WRONLY),  // Open for writing only.
-    RDWR = FMT_POSIX(O_RDWR)       // Open for reading and writing.
+    RDWR = FMT_POSIX(O_RDWR),      // Open for reading and writing.
+    CREATE = FMT_POSIX(O_CREAT),   // Create if the file doesn't exist.
+    APPEND = FMT_POSIX(O_APPEND),  // Open in append mode.
+    TRUNC = FMT_POSIX(O_TRUNC)     // Truncate the content of the file.
   };
 
   // Constructs a file object which doesn't represent any file.
-  file() FMT_NOEXCEPT : fd_(-1) {}
+  file() noexcept : fd_(-1) {}
 
   // Opens a file and constructs a file object representing this file.
-  FMT_API file(cstring_view path, int oflag);
+  file(cstring_view path, int oflag);
 
  public:
   file(const file&) = delete;
   void operator=(const file&) = delete;
 
-  file(file&& other) FMT_NOEXCEPT : fd_(other.fd_) { other.fd_ = -1; }
+  file(file&& other) noexcept : fd_(other.fd_) { other.fd_ = -1; }
 
-  file& operator=(file&& other) FMT_NOEXCEPT {
+  // Move assignment is not noexcept because close may throw.
+  file& operator=(file&& other) {
     close();
     fd_ = other.fd_;
     other.fd_ = -1;
@@ -300,93 +318,161 @@ class file {
   }
 
   // Destroys the object closing the file it represents if any.
-  FMT_API ~file() FMT_NOEXCEPT;
+  ~file() noexcept;
 
   // Returns the file descriptor.
-  int descriptor() const FMT_NOEXCEPT { return fd_; }
+  int descriptor() const noexcept { return fd_; }
 
   // Closes the file.
-  FMT_API void close();
+  void close();
 
   // Returns the file size. The size has signed type for consistency with
   // stat::st_size.
-  FMT_API long long size() const;
+  long long size() const;
 
   // Attempts to read count bytes from the file into the specified buffer.
-  FMT_API std::size_t read(void* buffer, std::size_t count);
+  size_t read(void* buffer, size_t count);
 
   // Attempts to write count bytes from the specified buffer to the file.
-  FMT_API std::size_t write(const void* buffer, std::size_t count);
+  size_t write(const void* buffer, size_t count);
 
   // Duplicates a file descriptor with the dup function and returns
   // the duplicate as a file object.
-  FMT_API static file dup(int fd);
+  static file dup(int fd);
 
   // Makes fd be the copy of this file descriptor, closing fd first if
   // necessary.
-  FMT_API void dup2(int fd);
+  void dup2(int fd);
 
   // Makes fd be the copy of this file descriptor, closing fd first if
   // necessary.
-  FMT_API void dup2(int fd, error_code& ec) FMT_NOEXCEPT;
+  void dup2(int fd, std::error_code& ec) noexcept;
 
   // Creates a pipe setting up read_end and write_end file objects for reading
   // and writing respectively.
-  FMT_API static void pipe(file& read_end, file& write_end);
+  static void pipe(file& read_end, file& write_end);
 
   // Creates a buffered_file object associated with this file and detaches
   // this file object from the file.
-  FMT_API buffered_file fdopen(const char* mode);
+  buffered_file fdopen(const char* mode);
 };
 
 // Returns the memory page size.
 long getpagesize();
-#endif  // FMT_USE_FCNTL
 
-#ifdef FMT_LOCALE
-// A "C" numeric locale.
-class locale {
- private:
-#  ifdef _WIN32
-  using locale_t = _locale_t;
+FMT_BEGIN_DETAIL_NAMESPACE
 
-  static void freelocale(locale_t loc) { _free_locale(loc); }
-
-  static double strtod_l(const char* nptr, char** endptr, _locale_t loc) {
-    return _strtod_l(nptr, endptr, loc);
-  }
-#  endif
-
-  locale_t locale_;
-
- public:
-  using type = locale_t;
-  locale(const locale&) = delete;
-  void operator=(const locale&) = delete;
-
-  locale() {
-#  ifndef _WIN32
-    locale_ = FMT_SYSTEM(newlocale(LC_NUMERIC_MASK, "C", nullptr));
-#  else
-    locale_ = _create_locale(LC_NUMERIC, "C");
-#  endif
-    if (!locale_) FMT_THROW(system_error(errno, "cannot create locale"));
-  }
-  ~locale() { freelocale(locale_); }
-
-  type get() const { return locale_; }
-
-  // Converts string to floating-point number and advances str past the end
-  // of the parsed input.
-  double strtod(const char*& str) const {
-    char* end = nullptr;
-    double result = strtod_l(str, &end, locale_);
-    str = end;
-    return result;
+struct buffer_size {
+  buffer_size() = default;
+  size_t value = 0;
+  buffer_size operator=(size_t val) const {
+    auto bs = buffer_size();
+    bs.value = val;
+    return bs;
   }
 };
-using Locale FMT_DEPRECATED_ALIAS = locale;
-#endif  // FMT_LOCALE
+
+struct ostream_params {
+  int oflag = file::WRONLY | file::CREATE | file::TRUNC;
+  size_t buffer_size = BUFSIZ > 32768 ? BUFSIZ : 32768;
+
+  ostream_params() {}
+
+  template <typename... T>
+  ostream_params(T... params, int new_oflag) : ostream_params(params...) {
+    oflag = new_oflag;
+  }
+
+  template <typename... T>
+  ostream_params(T... params, detail::buffer_size bs)
+      : ostream_params(params...) {
+    this->buffer_size = bs.value;
+  }
+
+// Intel has a bug that results in failure to deduce a constructor
+// for empty parameter packs.
+#  if defined(__INTEL_COMPILER) && __INTEL_COMPILER < 2000
+  ostream_params(int new_oflag) : oflag(new_oflag) {}
+  ostream_params(detail::buffer_size bs) : buffer_size(bs.value) {}
+#  endif
+};
+
+FMT_END_DETAIL_NAMESPACE
+
+// Added {} below to work around default constructor error known to
+// occur in Xcode versions 7.2.1 and 8.2.1.
+constexpr detail::buffer_size buffer_size{};
+
+/** A fast output stream which is not thread-safe. */
+class FMT_API ostream final : private detail::buffer<char> {
+ private:
+  file file_;
+
+  void grow(size_t) override;
+
+  ostream(cstring_view path, const detail::ostream_params& params)
+      : file_(path, params.oflag) {
+    set(new char[params.buffer_size], params.buffer_size);
+  }
+
+ public:
+  ostream(ostream&& other)
+      : detail::buffer<char>(other.data(), other.size(), other.capacity()),
+        file_(std::move(other.file_)) {
+    other.clear();
+    other.set(nullptr, 0);
+  }
+  ~ostream() {
+    flush();
+    delete[] data();
+  }
+
+  void flush() {
+    if (size() == 0) return;
+    file_.write(data(), size());
+    clear();
+  }
+
+  template <typename... T>
+  friend ostream output_file(cstring_view path, T... params);
+
+  void close() {
+    flush();
+    file_.close();
+  }
+
+  /**
+    Formats ``args`` according to specifications in ``fmt`` and writes the
+    output to the file.
+   */
+  template <typename... T> void print(format_string<T...> fmt, T&&... args) {
+    vformat_to(detail::buffer_appender<char>(*this), fmt,
+               fmt::make_format_args(args...));
+  }
+};
+
+/**
+  \rst
+  Opens a file for writing. Supported parameters passed in *params*:
+
+  * ``<integer>``: Flags passed to `open
+    <https://pubs.opengroup.org/onlinepubs/007904875/functions/open.html>`_
+    (``file::WRONLY | file::CREATE | file::TRUNC`` by default)
+  * ``buffer_size=<integer>``: Output buffer size
+
+  **Example**::
+
+    auto out = fmt::output_file("guide.txt");
+    out.print("Don't {}", "Panic");
+  \endrst
+ */
+template <typename... T>
+inline ostream output_file(cstring_view path, T... params) {
+  return {path, detail::ostream_params(params...)};
+}
+#endif  // FMT_USE_FCNTL
+
+FMT_MODULE_EXPORT_END
 FMT_END_NAMESPACE
 
 #endif  // FMT_OS_H_

externals/fmt/include/fmt/ostream.h

@@ -8,74 +8,106 @@
 #ifndef FMT_OSTREAM_H_
 #define FMT_OSTREAM_H_
 
+#include <fstream>
 #include <ostream>
+#if defined(_WIN32) && defined(__GLIBCXX__)
+#  include <ext/stdio_filebuf.h>
+#  include <ext/stdio_sync_filebuf.h>
+#elif defined(_WIN32) && defined(_LIBCPP_VERSION)
+#  include <__std_stream>
+#endif
+
 #include "format.h"
 
 FMT_BEGIN_NAMESPACE
-namespace internal {
 
-template <class Char> class formatbuf : public std::basic_streambuf<Char> {
- private:
-  using int_type = typename std::basic_streambuf<Char>::int_type;
-  using traits_type = typename std::basic_streambuf<Char>::traits_type;
+template <typename OutputIt, typename Char> class basic_printf_context;
 
-  buffer<Char>& buffer_;
+namespace detail {
 
- public:
-  formatbuf(buffer<Char>& buf) : buffer_(buf) {}
-
- protected:
-  // The put-area is actually always empty. This makes the implementation
-  // simpler and has the advantage that the streambuf and the buffer are always
-  // in sync and sputc never writes into uninitialized memory. The obvious
-  // disadvantage is that each call to sputc always results in a (virtual) call
-  // to overflow. There is no disadvantage here for sputn since this always
-  // results in a call to xsputn.
-
-  int_type overflow(int_type ch = traits_type::eof()) FMT_OVERRIDE {
-    if (!traits_type::eq_int_type(ch, traits_type::eof()))
-      buffer_.push_back(static_cast<Char>(ch));
-    return ch;
-  }
-
-  std::streamsize xsputn(const Char* s, std::streamsize count) FMT_OVERRIDE {
-    buffer_.append(s, s + count);
-    return count;
-  }
-};
-
-template <typename Char> struct test_stream : std::basic_ostream<Char> {
- private:
-  // Hide all operator<< from std::basic_ostream<Char>.
-  void_t<> operator<<(null<>);
-  void_t<> operator<<(const Char*);
-
-  template <typename T, FMT_ENABLE_IF(std::is_convertible<T, int>::value &&
-                                      !std::is_enum<T>::value)>
-  void_t<> operator<<(T);
-};
-
-// Checks if T has a user-defined operator<< (e.g. not a member of
-// std::ostream).
-template <typename T, typename Char> class is_streamable {
+// Checks if T has a user-defined operator<<.
+template <typename T, typename Char, typename Enable = void>
+class is_streamable {
  private:
   template <typename U>
-  static bool_constant<!std::is_same<decltype(std::declval<test_stream<Char>&>()
-                                              << std::declval<U>()),
-                                     void_t<>>::value>
-  test(int);
+  static auto test(int)
+      -> bool_constant<sizeof(std::declval<std::basic_ostream<Char>&>()
+                              << std::declval<U>()) != 0>;
 
-  template <typename> static std::false_type test(...);
+  template <typename> static auto test(...) -> std::false_type;
 
   using result = decltype(test<T>(0));
 
  public:
+  is_streamable() = default;
+
   static const bool value = result::value;
 };
 
+// Formatting of built-in types and arrays is intentionally disabled because
+// it's handled by standard (non-ostream) formatters.
+template <typename T, typename Char>
+struct is_streamable<
+    T, Char,
+    enable_if_t<
+        std::is_arithmetic<T>::value || std::is_array<T>::value ||
+        std::is_pointer<T>::value || std::is_same<T, char8_type>::value ||
+        std::is_convertible<T, fmt::basic_string_view<Char>>::value ||
+        std::is_same<T, std_string_view<Char>>::value ||
+        (std::is_convertible<T, int>::value && !std::is_enum<T>::value)>>
+    : std::false_type {};
+
+// Generate a unique explicit instantion in every translation unit using a tag
+// type in an anonymous namespace.
+namespace {
+struct file_access_tag {};
+}  // namespace
+template <class Tag, class BufType, FILE* BufType::*FileMemberPtr>
+class file_access {
+  friend auto get_file(BufType& obj) -> FILE* { return obj.*FileMemberPtr; }
+};
+
+#if FMT_MSC_VERSION
+template class file_access<file_access_tag, std::filebuf,
+                           &std::filebuf::_Myfile>;
+auto get_file(std::filebuf&) -> FILE*;
+#elif defined(_WIN32) && defined(_LIBCPP_VERSION)
+template class file_access<file_access_tag, std::__stdoutbuf<char>,
+                           &std::__stdoutbuf<char>::__file_>;
+auto get_file(std::__stdoutbuf<char>&) -> FILE*;
+#endif
+
+inline bool write_ostream_unicode(std::ostream& os, fmt::string_view data) {
+#if FMT_MSC_VERSION
+  if (auto* buf = dynamic_cast<std::filebuf*>(os.rdbuf()))
+    if (FILE* f = get_file(*buf)) return write_console(f, data);
+#elif defined(_WIN32) && defined(__GLIBCXX__)
+  auto* rdbuf = os.rdbuf();
+  FILE* c_file;
+  if (auto* fbuf = dynamic_cast<__gnu_cxx::stdio_sync_filebuf<char>*>(rdbuf))
+    c_file = fbuf->file();
+  else if (auto* fbuf = dynamic_cast<__gnu_cxx::stdio_filebuf<char>*>(rdbuf))
+    c_file = fbuf->file();
+  else
+    return false;
+  if (c_file) return write_console(c_file, data);
+#elif defined(_WIN32) && defined(_LIBCPP_VERSION)
+  if (auto* buf = dynamic_cast<std::__stdoutbuf<char>*>(os.rdbuf()))
+    if (FILE* f = get_file(*buf)) return write_console(f, data);
+#else
+  ignore_unused(os, data);
+#endif
+  return false;
+}
+inline bool write_ostream_unicode(std::wostream&,
+                                  fmt::basic_string_view<wchar_t>) {
+  return false;
+}
+
 // Write the content of buf to os.
+// It is a separate function rather than a part of vprint to simplify testing.
 template <typename Char>
-void write(std::basic_ostream<Char>& os, buffer<Char>& buf) {
+void write_buffer(std::basic_ostream<Char>& os, buffer<Char>& buf) {
   const Char* buf_data = buf.data();
   using unsigned_streamsize = std::make_unsigned<std::streamsize>::type;
   unsigned_streamsize size = buf.size();
@@ -91,36 +123,87 @@ void write(std::basic_ostream<Char>& os, buffer<Char>& buf) {
 template <typename Char, typename T>
 void format_value(buffer<Char>& buf, const T& value,
                   locale_ref loc = locale_ref()) {
-  formatbuf<Char> format_buf(buf);
-  std::basic_ostream<Char> output(&format_buf);
-  #if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
+  auto&& format_buf = formatbuf<std::basic_streambuf<Char>>(buf);
+  auto&& output = std::basic_ostream<Char>(&format_buf);
+#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
   if (loc) output.imbue(loc.get<std::locale>());
-  #endif
-  output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
+#endif
   output << value;
-  buf.resize(buf.size());
+  output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
 }
 
+template <typename T> struct streamed_view { const T& value; };
+
+}  // namespace detail
+
+// Formats an object of type T that has an overloaded ostream operator<<.
+template <typename Char>
+struct basic_ostream_formatter : formatter<basic_string_view<Char>, Char> {
+  void set_debug_format() = delete;
+
+  template <typename T, typename OutputIt>
+  auto format(const T& value, basic_format_context<OutputIt, Char>& ctx) const
+      -> OutputIt {
+    auto buffer = basic_memory_buffer<Char>();
+    format_value(buffer, value, ctx.locale());
+    return formatter<basic_string_view<Char>, Char>::format(
+        {buffer.data(), buffer.size()}, ctx);
+  }
+};
+
+using ostream_formatter = basic_ostream_formatter<char>;
+
+template <typename T, typename Char>
+struct formatter<detail::streamed_view<T>, Char>
+    : basic_ostream_formatter<Char> {
+  template <typename OutputIt>
+  auto format(detail::streamed_view<T> view,
+              basic_format_context<OutputIt, Char>& ctx) const -> OutputIt {
+    return basic_ostream_formatter<Char>::format(view.value, ctx);
+  }
+};
+
+/**
+  \rst
+  Returns a view that formats `value` via an ostream ``operator<<``.
+
+  **Example**::
+
+    fmt::print("Current thread id: {}\n",
+               fmt::streamed(std::this_thread::get_id()));
+  \endrst
+ */
+template <typename T>
+auto streamed(const T& value) -> detail::streamed_view<T> {
+  return {value};
+}
+
+namespace detail {
+
 // Formats an object of type T that has an overloaded ostream operator<<.
 template <typename T, typename Char>
 struct fallback_formatter<T, Char, enable_if_t<is_streamable<T, Char>::value>>
-    : formatter<basic_string_view<Char>, Char> {
-  template <typename Context>
-  auto format(const T& value, Context& ctx) -> decltype(ctx.out()) {
-    basic_memory_buffer<Char> buffer;
-    format_value(buffer, value, ctx.locale());
-    basic_string_view<Char> str(buffer.data(), buffer.size());
-    return formatter<basic_string_view<Char>, Char>::format(str, ctx);
-  }
+    : basic_ostream_formatter<Char> {
+  using basic_ostream_formatter<Char>::format;
 };
-}  // namespace internal
 
-template <typename Char>
-void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str,
+inline void vprint_directly(std::ostream& os, string_view format_str,
+                            format_args args) {
+  auto buffer = memory_buffer();
+  detail::vformat_to(buffer, format_str, args);
+  detail::write_buffer(os, buffer);
+}
+
+}  // namespace detail
+
+FMT_MODULE_EXPORT template <typename Char>
+void vprint(std::basic_ostream<Char>& os,
+            basic_string_view<type_identity_t<Char>> format_str,
             basic_format_args<buffer_context<type_identity_t<Char>>> args) {
-  basic_memory_buffer<Char> buffer;
-  internal::vformat_to(buffer, format_str, args);
-  internal::write(os, buffer);
+  auto buffer = basic_memory_buffer<Char>();
+  detail::vformat_to(buffer, format_str, args);
+  if (detail::write_ostream_unicode(os, {buffer.data(), buffer.size()})) return;
+  detail::write_buffer(os, buffer);
 }
 
 /**
@@ -132,12 +215,23 @@ void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str,
     fmt::print(cerr, "Don't {}!", "panic");
   \endrst
  */
-template <typename S, typename... Args,
-          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
-void print(std::basic_ostream<Char>& os, const S& format_str, Args&&... args) {
-  vprint(os, to_string_view(format_str),
-         internal::make_args_checked<Args...>(format_str, args...));
+FMT_MODULE_EXPORT template <typename... T>
+void print(std::ostream& os, format_string<T...> fmt, T&&... args) {
+  const auto& vargs = fmt::make_format_args(args...);
+  if (detail::is_utf8())
+    vprint(os, fmt, vargs);
+  else
+    detail::vprint_directly(os, fmt, vargs);
 }
+
+FMT_MODULE_EXPORT
+template <typename... Args>
+void print(std::wostream& os,
+           basic_format_string<wchar_t, type_identity_t<Args>...> fmt,
+           Args&&... args) {
+  vprint(os, fmt, fmt::make_format_args<buffer_context<wchar_t>>(args...));
+}
+
 FMT_END_NAMESPACE
 
 #endif  // FMT_OSTREAM_H_

externals/fmt/include/fmt/posix.h

@@ -1,2 +0,0 @@
-#include "os.h"
-#warning "fmt/posix.h is deprecated; use fmt/os.h instead"

externals/fmt/include/fmt/printf.h

@@ -11,10 +11,52 @@
 #include <algorithm>  // std::max
 #include <limits>     // std::numeric_limits
 
-#include "ostream.h"
+#include "format.h"
 
 FMT_BEGIN_NAMESPACE
-namespace internal {
+FMT_MODULE_EXPORT_BEGIN
+
+template <typename T> struct printf_formatter { printf_formatter() = delete; };
+
+template <typename Char>
+class basic_printf_parse_context : public basic_format_parse_context<Char> {
+  using basic_format_parse_context<Char>::basic_format_parse_context;
+};
+
+template <typename OutputIt, typename Char> class basic_printf_context {
+ private:
+  OutputIt out_;
+  basic_format_args<basic_printf_context> args_;
+
+ public:
+  using char_type = Char;
+  using format_arg = basic_format_arg<basic_printf_context>;
+  using parse_context_type = basic_printf_parse_context<Char>;
+  template <typename T> using formatter_type = printf_formatter<T>;
+
+  /**
+    \rst
+    Constructs a ``printf_context`` object. References to the arguments are
+    stored in the context object so make sure they have appropriate lifetimes.
+    \endrst
+   */
+  basic_printf_context(OutputIt out,
+                       basic_format_args<basic_printf_context> args)
+      : out_(out), args_(args) {}
+
+  OutputIt out() { return out_; }
+  void advance_to(OutputIt it) { out_ = it; }
+
+  detail::locale_ref locale() { return {}; }
+
+  format_arg arg(int id) const { return args_.get(id); }
+
+  FMT_CONSTEXPR void on_error(const char* message) {
+    detail::error_handler().on_error(message);
+  }
+};
+
+FMT_BEGIN_DETAIL_NAMESPACE
 
 // Checks if a value fits in int - used to avoid warnings about comparing
 // signed and unsigned integers.
@@ -90,11 +132,11 @@ template <typename T, typename Context> class arg_converter {
     if (const_check(sizeof(target_type) <= sizeof(int))) {
       // Extra casts are used to silence warnings.
       if (is_signed) {
-        arg_ = internal::make_arg<Context>(
+        arg_ = detail::make_arg<Context>(
             static_cast<int>(static_cast<target_type>(value)));
       } else {
         using unsigned_type = typename make_unsigned_or_bool<target_type>::type;
-        arg_ = internal::make_arg<Context>(
+        arg_ = detail::make_arg<Context>(
             static_cast<unsigned>(static_cast<unsigned_type>(value)));
       }
     } else {
@@ -102,9 +144,9 @@ template <typename T, typename Context> class arg_converter {
         // glibc's printf doesn't sign extend arguments of smaller types:
         //   std::printf("%lld", -42);  // prints "4294967254"
         // but we don't have to do the same because it's a UB.
-        arg_ = internal::make_arg<Context>(static_cast<long long>(value));
+        arg_ = detail::make_arg<Context>(static_cast<long long>(value));
       } else {
-        arg_ = internal::make_arg<Context>(
+        arg_ = detail::make_arg<Context>(
             static_cast<typename make_unsigned_or_bool<U>::type>(value));
       }
     }
@@ -133,7 +175,7 @@ template <typename Context> class char_converter {
 
   template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
   void operator()(T value) {
-    arg_ = internal::make_arg<Context>(
+    arg_ = detail::make_arg<Context>(
         static_cast<typename Context::char_type>(value));
   }
 
@@ -141,6 +183,13 @@ template <typename Context> class char_converter {
   void operator()(T) {}  // No conversion needed for non-integral types.
 };
 
+// An argument visitor that return a pointer to a C string if argument is a
+// string or null otherwise.
+template <typename Char> struct get_cstring {
+  template <typename T> const Char* operator()(T) { return nullptr; }
+  const Char* operator()(const Char* s) { return s; }
+};
+
 // Checks if an argument is a valid printf width specifier and sets
 // left alignment if it is negative.
 template <typename Char> class printf_width_handler {
@@ -155,7 +204,7 @@ template <typename Char> class printf_width_handler {
   template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
   unsigned operator()(T value) {
     auto width = static_cast<uint32_or_64_or_128_t<T>>(value);
-    if (internal::is_negative(value)) {
+    if (detail::is_negative(value)) {
       specs_.align = align::left;
       width = 0 - width;
     }
@@ -171,212 +220,88 @@ template <typename Char> class printf_width_handler {
   }
 };
 
-template <typename Char, typename Context>
-void printf(buffer<Char>& buf, basic_string_view<Char> format,
-            basic_format_args<Context> args) {
-  Context(std::back_inserter(buf), format, args).format();
-}
-
-template <typename OutputIt, typename Char, typename Context>
-internal::truncating_iterator<OutputIt> printf(
-    internal::truncating_iterator<OutputIt> it, basic_string_view<Char> format,
-    basic_format_args<Context> args) {
-  return Context(it, format, args).format();
-}
-}  // namespace internal
-
-using internal::printf;  // For printing into memory_buffer.
-
-template <typename Range> class printf_arg_formatter;
-
-template <typename OutputIt, typename Char> class basic_printf_context;
-
-/**
-  \rst
-  The ``printf`` argument formatter.
-  \endrst
- */
-template <typename Range>
-class printf_arg_formatter : public internal::arg_formatter_base<Range> {
- public:
-  using iterator = typename Range::iterator;
-
+// The ``printf`` argument formatter.
+template <typename OutputIt, typename Char>
+class printf_arg_formatter : public arg_formatter<Char> {
  private:
-  using char_type = typename Range::value_type;
-  using base = internal::arg_formatter_base<Range>;
-  using context_type = basic_printf_context<iterator, char_type>;
+  using base = arg_formatter<Char>;
+  using context_type = basic_printf_context<OutputIt, Char>;
+  using format_specs = basic_format_specs<Char>;
 
   context_type& context_;
 
-  void write_null_pointer(char) {
-    this->specs()->type = 0;
-    this->write("(nil)");
-  }
-
-  void write_null_pointer(wchar_t) {
-    this->specs()->type = 0;
-    this->write(L"(nil)");
+  OutputIt write_null_pointer(bool is_string = false) {
+    auto s = this->specs;
+    s.type = presentation_type::none;
+    return write_bytes(this->out, is_string ? "(null)" : "(nil)", s);
   }
 
  public:
-  using format_specs = typename base::format_specs;
+  printf_arg_formatter(OutputIt iter, format_specs& s, context_type& ctx)
+      : base{iter, s, locale_ref()}, context_(ctx) {}
 
-  /**
-    \rst
-    Constructs an argument formatter object.
-    *buffer* is a reference to the output buffer and *specs* contains format
-    specifier information for standard argument types.
-    \endrst
-   */
-  printf_arg_formatter(iterator iter, format_specs& specs, context_type& ctx)
-      : base(Range(iter), &specs, internal::locale_ref()), context_(ctx) {}
+  OutputIt operator()(monostate value) { return base::operator()(value); }
 
-  template <typename T, FMT_ENABLE_IF(fmt::internal::is_integral<T>::value)>
-  iterator operator()(T value) {
-    // MSVC2013 fails to compile separate overloads for bool and char_type so
-    // use std::is_same instead.
-    if (std::is_same<T, bool>::value) {
-      format_specs& fmt_specs = *this->specs();
-      if (fmt_specs.type != 's') return base::operator()(value ? 1 : 0);
-      fmt_specs.type = 0;
-      this->write(value != 0);
-    } else if (std::is_same<T, char_type>::value) {
-      format_specs& fmt_specs = *this->specs();
-      if (fmt_specs.type && fmt_specs.type != 'c')
+  template <typename T, FMT_ENABLE_IF(detail::is_integral<T>::value)>
+  OutputIt operator()(T value) {
+    // MSVC2013 fails to compile separate overloads for bool and Char so use
+    // std::is_same instead.
+    if (std::is_same<T, Char>::value) {
+      format_specs fmt_specs = this->specs;
+      if (fmt_specs.type != presentation_type::none &&
+          fmt_specs.type != presentation_type::chr) {
         return (*this)(static_cast<int>(value));
+      }
       fmt_specs.sign = sign::none;
       fmt_specs.alt = false;
-      fmt_specs.align = align::right;
-      return base::operator()(value);
-    } else {
-      return base::operator()(value);
+      fmt_specs.fill[0] = ' ';  // Ignore '0' flag for char types.
+      // align::numeric needs to be overwritten here since the '0' flag is
+      // ignored for non-numeric types
+      if (fmt_specs.align == align::none || fmt_specs.align == align::numeric)
+        fmt_specs.align = align::right;
+      return write<Char>(this->out, static_cast<Char>(value), fmt_specs);
     }
-    return this->out();
+    return base::operator()(value);
   }
 
   template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
-  iterator operator()(T value) {
+  OutputIt operator()(T value) {
     return base::operator()(value);
   }
 
   /** Formats a null-terminated C string. */
-  iterator operator()(const char* value) {
-    if (value)
-      base::operator()(value);
-    else if (this->specs()->type == 'p')
-      write_null_pointer(char_type());
-    else
-      this->write("(null)");
-    return this->out();
+  OutputIt operator()(const char* value) {
+    if (value) return base::operator()(value);
+    return write_null_pointer(this->specs.type != presentation_type::pointer);
   }
 
   /** Formats a null-terminated wide C string. */
-  iterator operator()(const wchar_t* value) {
-    if (value)
-      base::operator()(value);
-    else if (this->specs()->type == 'p')
-      write_null_pointer(char_type());
-    else
-      this->write(L"(null)");
-    return this->out();
+  OutputIt operator()(const wchar_t* value) {
+    if (value) return base::operator()(value);
+    return write_null_pointer(this->specs.type != presentation_type::pointer);
   }
 
-  iterator operator()(basic_string_view<char_type> value) {
+  OutputIt operator()(basic_string_view<Char> value) {
     return base::operator()(value);
   }
 
-  iterator operator()(monostate value) { return base::operator()(value); }
-
   /** Formats a pointer. */
-  iterator operator()(const void* value) {
-    if (value) return base::operator()(value);
-    this->specs()->type = 0;
-    write_null_pointer(char_type());
-    return this->out();
+  OutputIt operator()(const void* value) {
+    return value ? base::operator()(value) : write_null_pointer();
   }
 
   /** Formats an argument of a custom (user-defined) type. */
-  iterator operator()(typename basic_format_arg<context_type>::handle handle) {
-    handle.format(context_.parse_context(), context_);
-    return this->out();
+  OutputIt operator()(typename basic_format_arg<context_type>::handle handle) {
+    auto parse_ctx =
+        basic_printf_parse_context<Char>(basic_string_view<Char>());
+    handle.format(parse_ctx, context_);
+    return this->out;
   }
 };
 
-template <typename T> struct printf_formatter {
-  printf_formatter() = delete;
-
-  template <typename ParseContext>
-  auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
-    return ctx.begin();
-  }
-
-  template <typename FormatContext>
-  auto format(const T& value, FormatContext& ctx) -> decltype(ctx.out()) {
-    internal::format_value(internal::get_container(ctx.out()), value);
-    return ctx.out();
-  }
-};
-
-/** This template formats data and writes the output to a writer. */
-template <typename OutputIt, typename Char> class basic_printf_context {
- public:
-  /** The character type for the output. */
-  using char_type = Char;
-  using iterator = OutputIt;
-  using format_arg = basic_format_arg<basic_printf_context>;
-  template <typename T> using formatter_type = printf_formatter<T>;
-
- private:
-  using format_specs = basic_format_specs<char_type>;
-
-  OutputIt out_;
-  basic_format_args<basic_printf_context> args_;
-  basic_format_parse_context<Char> parse_ctx_;
-
-  static void parse_flags(format_specs& specs, const Char*& it,
-                          const Char* end);
-
-  // Returns the argument with specified index or, if arg_index is -1, the next
-  // argument.
-  format_arg get_arg(int arg_index = -1);
-
-  // Parses argument index, flags and width and returns the argument index.
-  int parse_header(const Char*& it, const Char* end, format_specs& specs);
-
- public:
-  /**
-   \rst
-   Constructs a ``printf_context`` object. References to the arguments and
-   the writer are stored in the context object so make sure they have
-   appropriate lifetimes.
-   \endrst
-   */
-  basic_printf_context(OutputIt out, basic_string_view<char_type> format_str,
-                       basic_format_args<basic_printf_context> args)
-      : out_(out), args_(args), parse_ctx_(format_str) {}
-
-  OutputIt out() { return out_; }
-  void advance_to(OutputIt it) { out_ = it; }
-
-  internal::locale_ref locale() { return {}; }
-
-  format_arg arg(int id) const { return args_.get(id); }
-
-  basic_format_parse_context<Char>& parse_context() { return parse_ctx_; }
-
-  FMT_CONSTEXPR void on_error(const char* message) {
-    parse_ctx_.on_error(message);
-  }
-
-  /** Formats stored arguments and writes the output to the range. */
-  template <typename ArgFormatter = printf_arg_formatter<buffer_range<Char>>>
-  OutputIt format();
-};
-
-template <typename OutputIt, typename Char>
-void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
-                                                       const Char*& it,
-                                                       const Char* end) {
+template <typename Char>
+void parse_flags(basic_format_specs<Char>& specs, const Char*& it,
+                 const Char* end) {
   for (; it != end; ++it) {
     switch (*it) {
     case '-':
@@ -389,7 +314,9 @@ void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
       specs.fill[0] = '0';
       break;
     case ' ':
-      specs.sign = sign::space;
+      if (specs.sign != sign::plus) {
+        specs.sign = sign::space;
+      }
       break;
     case '#':
       specs.alt = true;
@@ -400,35 +327,24 @@ void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
   }
 }
 
-template <typename OutputIt, typename Char>
-typename basic_printf_context<OutputIt, Char>::format_arg
-basic_printf_context<OutputIt, Char>::get_arg(int arg_index) {
-  if (arg_index < 0)
-    arg_index = parse_ctx_.next_arg_id();
-  else
-    parse_ctx_.check_arg_id(--arg_index);
-  return internal::get_arg(*this, arg_index);
-}
-
-template <typename OutputIt, typename Char>
-int basic_printf_context<OutputIt, Char>::parse_header(const Char*& it,
-                                                       const Char* end,
-                                                       format_specs& specs) {
+template <typename Char, typename GetArg>
+int parse_header(const Char*& it, const Char* end,
+                 basic_format_specs<Char>& specs, GetArg get_arg) {
   int arg_index = -1;
-  char_type c = *it;
+  Char c = *it;
   if (c >= '0' && c <= '9') {
     // Parse an argument index (if followed by '$') or a width possibly
     // preceded with '0' flag(s).
-    internal::error_handler eh;
-    int value = parse_nonnegative_int(it, end, eh);
+    int value = parse_nonnegative_int(it, end, -1);
     if (it != end && *it == '$') {  // value is an argument index
       ++it;
-      arg_index = value;
+      arg_index = value != -1 ? value : max_value<int>();
     } else {
       if (c == '0') specs.fill[0] = '0';
       if (value != 0) {
         // Nonzero value means that we parsed width and don't need to
         // parse it or flags again, so return now.
+        if (value == -1) FMT_THROW(format_error("number is too big"));
         specs.width = value;
         return arg_index;
       }
@@ -438,71 +354,104 @@ int basic_printf_context<OutputIt, Char>::parse_header(const Char*& it,
   // Parse width.
   if (it != end) {
     if (*it >= '0' && *it <= '9') {
-      internal::error_handler eh;
-      specs.width = parse_nonnegative_int(it, end, eh);
+      specs.width = parse_nonnegative_int(it, end, -1);
+      if (specs.width == -1) FMT_THROW(format_error("number is too big"));
     } else if (*it == '*') {
       ++it;
       specs.width = static_cast<int>(visit_format_arg(
-          internal::printf_width_handler<char_type>(specs), get_arg()));
+          detail::printf_width_handler<Char>(specs), get_arg(-1)));
     }
   }
   return arg_index;
 }
 
-template <typename OutputIt, typename Char>
-template <typename ArgFormatter>
-OutputIt basic_printf_context<OutputIt, Char>::format() {
-  auto out = this->out();
-  const Char* start = parse_ctx_.begin();
-  const Char* end = parse_ctx_.end();
+template <typename Char, typename Context>
+void vprintf(buffer<Char>& buf, basic_string_view<Char> format,
+             basic_format_args<Context> args) {
+  using OutputIt = buffer_appender<Char>;
+  auto out = OutputIt(buf);
+  auto context = basic_printf_context<OutputIt, Char>(out, args);
+  auto parse_ctx = basic_printf_parse_context<Char>(format);
+
+  // Returns the argument with specified index or, if arg_index is -1, the next
+  // argument.
+  auto get_arg = [&](int arg_index) {
+    if (arg_index < 0)
+      arg_index = parse_ctx.next_arg_id();
+    else
+      parse_ctx.check_arg_id(--arg_index);
+    return detail::get_arg(context, arg_index);
+  };
+
+  const Char* start = parse_ctx.begin();
+  const Char* end = parse_ctx.end();
   auto it = start;
   while (it != end) {
-    char_type c = *it++;
-    if (c != '%') continue;
+    if (!detail::find<false, Char>(it, end, '%', it)) {
+      it = end;  // detail::find leaves it == nullptr if it doesn't find '%'
+      break;
+    }
+    Char c = *it++;
     if (it != end && *it == c) {
-      out = std::copy(start, it, out);
+      out = detail::write(
+          out, basic_string_view<Char>(start, detail::to_unsigned(it - start)));
       start = ++it;
       continue;
     }
-    out = std::copy(start, it - 1, out);
+    out = detail::write(out, basic_string_view<Char>(
+                                 start, detail::to_unsigned(it - 1 - start)));
 
-    format_specs specs;
+    basic_format_specs<Char> specs;
     specs.align = align::right;
 
     // Parse argument index, flags and width.
-    int arg_index = parse_header(it, end, specs);
-    if (arg_index == 0) on_error("argument index out of range");
+    int arg_index = parse_header(it, end, specs, get_arg);
+    if (arg_index == 0) parse_ctx.on_error("argument not found");
 
     // Parse precision.
     if (it != end && *it == '.') {
       ++it;
       c = it != end ? *it : 0;
       if ('0' <= c && c <= '9') {
-        internal::error_handler eh;
-        specs.precision = parse_nonnegative_int(it, end, eh);
+        specs.precision = parse_nonnegative_int(it, end, 0);
       } else if (c == '*') {
         ++it;
         specs.precision = static_cast<int>(
-            visit_format_arg(internal::printf_precision_handler(), get_arg()));
+            visit_format_arg(detail::printf_precision_handler(), get_arg(-1)));
       } else {
         specs.precision = 0;
       }
     }
 
-    format_arg arg = get_arg(arg_index);
-    if (specs.alt && visit_format_arg(internal::is_zero_int(), arg))
+    auto arg = get_arg(arg_index);
+    // For d, i, o, u, x, and X conversion specifiers, if a precision is
+    // specified, the '0' flag is ignored
+    if (specs.precision >= 0 && arg.is_integral())
+      specs.fill[0] =
+          ' ';  // Ignore '0' flag for non-numeric types or if '-' present.
+    if (specs.precision >= 0 && arg.type() == detail::type::cstring_type) {
+      auto str = visit_format_arg(detail::get_cstring<Char>(), arg);
+      auto str_end = str + specs.precision;
+      auto nul = std::find(str, str_end, Char());
+      arg = detail::make_arg<basic_printf_context<OutputIt, Char>>(
+          basic_string_view<Char>(
+              str, detail::to_unsigned(nul != str_end ? nul - str
+                                                      : specs.precision)));
+    }
+    if (specs.alt && visit_format_arg(detail::is_zero_int(), arg))
       specs.alt = false;
     if (specs.fill[0] == '0') {
-      if (arg.is_arithmetic())
+      if (arg.is_arithmetic() && specs.align != align::left)
         specs.align = align::numeric;
       else
-        specs.fill[0] = ' ';  // Ignore '0' flag for non-numeric types.
+        specs.fill[0] = ' ';  // Ignore '0' flag for non-numeric types or if '-'
+                              // flag is also present.
     }
 
     // Parse length and convert the argument to the required type.
     c = it != end ? *it++ : 0;
-    char_type t = it != end ? *it : 0;
-    using internal::convert_arg;
+    Char t = it != end ? *it : 0;
+    using detail::convert_arg;
     switch (c) {
     case 'h':
       if (t == 'h') {
@@ -526,7 +475,7 @@ OutputIt basic_printf_context<OutputIt, Char>::format() {
       convert_arg<intmax_t>(arg, t);
       break;
     case 'z':
-      convert_arg<std::size_t>(arg, t);
+      convert_arg<size_t>(arg, t);
       break;
     case 't':
       convert_arg<std::ptrdiff_t>(arg, t);
@@ -542,33 +491,38 @@ OutputIt basic_printf_context<OutputIt, Char>::format() {
 
     // Parse type.
     if (it == end) FMT_THROW(format_error("invalid format string"));
-    specs.type = static_cast<char>(*it++);
+    char type = static_cast<char>(*it++);
     if (arg.is_integral()) {
       // Normalize type.
-      switch (specs.type) {
+      switch (type) {
       case 'i':
       case 'u':
-        specs.type = 'd';
+        type = 'd';
         break;
       case 'c':
-        visit_format_arg(internal::char_converter<basic_printf_context>(arg),
-                         arg);
+        visit_format_arg(
+            detail::char_converter<basic_printf_context<OutputIt, Char>>(arg),
+            arg);
         break;
       }
     }
+    specs.type = parse_presentation_type(type);
+    if (specs.type == presentation_type::none)
+      parse_ctx.on_error("invalid type specifier");
 
     start = it;
 
     // Format argument.
-    visit_format_arg(ArgFormatter(out, specs, *this), arg);
+    out = visit_format_arg(
+        detail::printf_arg_formatter<OutputIt, Char>(out, specs, context), arg);
   }
-  return std::copy(start, it, out);
+  detail::write(out, basic_string_view<Char>(start, to_unsigned(it - start)));
 }
+FMT_END_DETAIL_NAMESPACE
 
 template <typename Char>
 using basic_printf_context_t =
-    basic_printf_context<std::back_insert_iterator<internal::buffer<Char>>,
-                         Char>;
+    basic_printf_context<detail::buffer_appender<Char>, Char>;
 
 using printf_context = basic_printf_context_t<char>;
 using wprintf_context = basic_printf_context_t<wchar_t>;
@@ -582,9 +536,9 @@ using wprintf_args = basic_format_args<wprintf_context>;
   arguments and can be implicitly converted to `~fmt::printf_args`.
   \endrst
  */
-template <typename... Args>
-inline format_arg_store<printf_context, Args...> make_printf_args(
-    const Args&... args) {
+template <typename... T>
+inline auto make_printf_args(const T&... args)
+    -> format_arg_store<printf_context, T...> {
   return {args...};
 }
 
@@ -594,18 +548,19 @@ inline format_arg_store<printf_context, Args...> make_printf_args(
   arguments and can be implicitly converted to `~fmt::wprintf_args`.
   \endrst
  */
-template <typename... Args>
-inline format_arg_store<wprintf_context, Args...> make_wprintf_args(
-    const Args&... args) {
+template <typename... T>
+inline auto make_wprintf_args(const T&... args)
+    -> format_arg_store<wprintf_context, T...> {
   return {args...};
 }
 
 template <typename S, typename Char = char_t<S>>
-inline std::basic_string<Char> vsprintf(
-    const S& format,
-    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+inline auto vsprintf(
+    const S& fmt,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args)
+    -> std::basic_string<Char> {
   basic_memory_buffer<Char> buffer;
-  printf(buffer, to_string_view(format), args);
+  vprintf(buffer, detail::to_string_view(fmt), args);
   return to_string(buffer);
 }
 
@@ -618,20 +573,22 @@ inline std::basic_string<Char> vsprintf(
     std::string message = fmt::sprintf("The answer is %d", 42);
   \endrst
 */
-template <typename S, typename... Args,
-          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
-inline std::basic_string<Char> sprintf(const S& format, const Args&... args) {
+template <typename S, typename... T,
+          typename Char = enable_if_t<detail::is_string<S>::value, char_t<S>>>
+inline auto sprintf(const S& fmt, const T&... args) -> std::basic_string<Char> {
   using context = basic_printf_context_t<Char>;
-  return vsprintf(to_string_view(format), make_format_args<context>(args...));
+  return vsprintf(detail::to_string_view(fmt),
+                  fmt::make_format_args<context>(args...));
 }
 
 template <typename S, typename Char = char_t<S>>
-inline int vfprintf(
-    std::FILE* f, const S& format,
-    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+inline auto vfprintf(
+    std::FILE* f, const S& fmt,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args)
+    -> int {
   basic_memory_buffer<Char> buffer;
-  printf(buffer, to_string_view(format), args);
-  std::size_t size = buffer.size();
+  vprintf(buffer, detail::to_string_view(fmt), args);
+  size_t size = buffer.size();
   return std::fwrite(buffer.data(), sizeof(Char), size, f) < size
              ? -1
              : static_cast<int>(size);
@@ -646,19 +603,19 @@ inline int vfprintf(
     fmt::fprintf(stderr, "Don't %s!", "panic");
   \endrst
  */
-template <typename S, typename... Args,
-          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
-inline int fprintf(std::FILE* f, const S& format, const Args&... args) {
+template <typename S, typename... T, typename Char = char_t<S>>
+inline auto fprintf(std::FILE* f, const S& fmt, const T&... args) -> int {
   using context = basic_printf_context_t<Char>;
-  return vfprintf(f, to_string_view(format),
-                  make_format_args<context>(args...));
+  return vfprintf(f, detail::to_string_view(fmt),
+                  fmt::make_format_args<context>(args...));
 }
 
 template <typename S, typename Char = char_t<S>>
-inline int vprintf(
-    const S& format,
-    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
-  return vfprintf(stdout, to_string_view(format), args);
+inline auto vprintf(
+    const S& fmt,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args)
+    -> int {
+  return vfprintf(stdout, detail::to_string_view(fmt), args);
 }
 
 /**
@@ -670,52 +627,14 @@ inline int vprintf(
     fmt::printf("Elapsed time: %.2f seconds", 1.23);
   \endrst
  */
-template <typename S, typename... Args,
-          FMT_ENABLE_IF(internal::is_string<S>::value)>
-inline int printf(const S& format_str, const Args&... args) {
-  using context = basic_printf_context_t<char_t<S>>;
-  return vprintf(to_string_view(format_str),
-                 make_format_args<context>(args...));
+template <typename S, typename... T, FMT_ENABLE_IF(detail::is_string<S>::value)>
+inline auto printf(const S& fmt, const T&... args) -> int {
+  return vprintf(
+      detail::to_string_view(fmt),
+      fmt::make_format_args<basic_printf_context_t<char_t<S>>>(args...));
 }
 
-template <typename S, typename Char = char_t<S>>
-inline int vfprintf(
-    std::basic_ostream<Char>& os, const S& format,
-    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
-  basic_memory_buffer<Char> buffer;
-  printf(buffer, to_string_view(format), args);
-  internal::write(os, buffer);
-  return static_cast<int>(buffer.size());
-}
-
-/** Formats arguments and writes the output to the range. */
-template <typename ArgFormatter, typename Char,
-          typename Context =
-              basic_printf_context<typename ArgFormatter::iterator, Char>>
-typename ArgFormatter::iterator vprintf(
-    internal::buffer<Char>& out, basic_string_view<Char> format_str,
-    basic_format_args<type_identity_t<Context>> args) {
-  typename ArgFormatter::iterator iter(out);
-  Context(iter, format_str, args).template format<ArgFormatter>();
-  return iter;
-}
-
-/**
-  \rst
-  Prints formatted data to the stream *os*.
-
-  **Example**::
-
-    fmt::fprintf(cerr, "Don't %s!", "panic");
-  \endrst
- */
-template <typename S, typename... Args, typename Char = char_t<S>>
-inline int fprintf(std::basic_ostream<Char>& os, const S& format_str,
-                   const Args&... args) {
-  using context = basic_printf_context_t<Char>;
-  return vfprintf(os, to_string_view(format_str),
-                  make_format_args<context>(args...));
-}
+FMT_MODULE_EXPORT_END
 FMT_END_NAMESPACE
 
 #endif  // FMT_PRINTF_H_

externals/fmt/include/fmt/ranges.h

@@ -13,48 +13,14 @@
 #define FMT_RANGES_H_
 
 #include <initializer_list>
+#include <tuple>
 #include <type_traits>
 
 #include "format.h"
 
-// output only up to N items from the range.
-#ifndef FMT_RANGE_OUTPUT_LENGTH_LIMIT
-#  define FMT_RANGE_OUTPUT_LENGTH_LIMIT 256
-#endif
-
 FMT_BEGIN_NAMESPACE
 
-template <typename Char> struct formatting_base {
-  template <typename ParseContext>
-  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
-    return ctx.begin();
-  }
-};
-
-template <typename Char, typename Enable = void>
-struct formatting_range : formatting_base<Char> {
-  static FMT_CONSTEXPR_DECL const std::size_t range_length_limit =
-      FMT_RANGE_OUTPUT_LENGTH_LIMIT;  // output only up to N items from the
-                                      // range.
-  Char prefix;
-  Char delimiter;
-  Char postfix;
-  formatting_range() : prefix('{'), delimiter(','), postfix('}') {}
-  static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
-  static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
-};
-
-template <typename Char, typename Enable = void>
-struct formatting_tuple : formatting_base<Char> {
-  Char prefix;
-  Char delimiter;
-  Char postfix;
-  formatting_tuple() : prefix('('), delimiter(','), postfix(')') {}
-  static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
-  static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
-};
-
-namespace internal {
+namespace detail {
 
 template <typename RangeT, typename OutputIterator>
 OutputIterator copy(const RangeT& range, OutputIterator out) {
@@ -75,73 +41,194 @@ OutputIterator copy(char ch, OutputIterator out) {
   return out;
 }
 
-/// Return true value if T has std::string interface, like std::string_view.
-template <typename T> class is_like_std_string {
+template <typename OutputIterator>
+OutputIterator copy(wchar_t ch, OutputIterator out) {
+  *out++ = ch;
+  return out;
+}
+
+// Returns true if T has a std::string-like interface, like std::string_view.
+template <typename T> class is_std_string_like {
   template <typename U>
   static auto check(U* p)
       -> decltype((void)p->find('a'), p->length(), (void)p->data(), int());
   template <typename> static void check(...);
 
  public:
-  static FMT_CONSTEXPR_DECL const bool value =
-      is_string<T>::value || !std::is_void<decltype(check<T>(nullptr))>::value;
+  static constexpr const bool value =
+      is_string<T>::value ||
+      std::is_convertible<T, std_string_view<char>>::value ||
+      !std::is_void<decltype(check<T>(nullptr))>::value;
 };
 
 template <typename Char>
-struct is_like_std_string<fmt::basic_string_view<Char>> : std::true_type {};
+struct is_std_string_like<fmt::basic_string_view<Char>> : std::true_type {};
+
+template <typename T> class is_map {
+  template <typename U> static auto check(U*) -> typename U::mapped_type;
+  template <typename> static void check(...);
+
+ public:
+#ifdef FMT_FORMAT_MAP_AS_LIST
+  static constexpr const bool value = false;
+#else
+  static constexpr const bool value =
+      !std::is_void<decltype(check<T>(nullptr))>::value;
+#endif
+};
+
+template <typename T> class is_set {
+  template <typename U> static auto check(U*) -> typename U::key_type;
+  template <typename> static void check(...);
+
+ public:
+#ifdef FMT_FORMAT_SET_AS_LIST
+  static constexpr const bool value = false;
+#else
+  static constexpr const bool value =
+      !std::is_void<decltype(check<T>(nullptr))>::value && !is_map<T>::value;
+#endif
+};
 
 template <typename... Ts> struct conditional_helper {};
 
 template <typename T, typename _ = void> struct is_range_ : std::false_type {};
 
-#if !FMT_MSC_VER || FMT_MSC_VER > 1800
+#if !FMT_MSC_VERSION || FMT_MSC_VERSION > 1800
+
+#  define FMT_DECLTYPE_RETURN(val)  \
+    ->decltype(val) { return val; } \
+    static_assert(                  \
+        true, "")  // This makes it so that a semicolon is required after the
+                   // macro, which helps clang-format handle the formatting.
+
+// C array overload
+template <typename T, std::size_t N>
+auto range_begin(const T (&arr)[N]) -> const T* {
+  return arr;
+}
+template <typename T, std::size_t N>
+auto range_end(const T (&arr)[N]) -> const T* {
+  return arr + N;
+}
+
+template <typename T, typename Enable = void>
+struct has_member_fn_begin_end_t : std::false_type {};
+
 template <typename T>
-struct is_range_<
-    T, conditional_t<false,
-                     conditional_helper<decltype(std::declval<T>().begin()),
-                                        decltype(std::declval<T>().end())>,
-                     void>> : std::true_type {};
+struct has_member_fn_begin_end_t<T, void_t<decltype(std::declval<T>().begin()),
+                                           decltype(std::declval<T>().end())>>
+    : std::true_type {};
+
+// Member function overload
+template <typename T>
+auto range_begin(T&& rng) FMT_DECLTYPE_RETURN(static_cast<T&&>(rng).begin());
+template <typename T>
+auto range_end(T&& rng) FMT_DECLTYPE_RETURN(static_cast<T&&>(rng).end());
+
+// ADL overload. Only participates in overload resolution if member functions
+// are not found.
+template <typename T>
+auto range_begin(T&& rng)
+    -> enable_if_t<!has_member_fn_begin_end_t<T&&>::value,
+                   decltype(begin(static_cast<T&&>(rng)))> {
+  return begin(static_cast<T&&>(rng));
+}
+template <typename T>
+auto range_end(T&& rng) -> enable_if_t<!has_member_fn_begin_end_t<T&&>::value,
+                                       decltype(end(static_cast<T&&>(rng)))> {
+  return end(static_cast<T&&>(rng));
+}
+
+template <typename T, typename Enable = void>
+struct has_const_begin_end : std::false_type {};
+template <typename T, typename Enable = void>
+struct has_mutable_begin_end : std::false_type {};
+
+template <typename T>
+struct has_const_begin_end<
+    T,
+    void_t<
+        decltype(detail::range_begin(std::declval<const remove_cvref_t<T>&>())),
+        decltype(detail::range_end(std::declval<const remove_cvref_t<T>&>()))>>
+    : std::true_type {};
+
+template <typename T>
+struct has_mutable_begin_end<
+    T, void_t<decltype(detail::range_begin(std::declval<T>())),
+              decltype(detail::range_end(std::declval<T>())),
+              enable_if_t<std::is_copy_constructible<T>::value>>>
+    : std::true_type {};
+
+template <typename T>
+struct is_range_<T, void>
+    : std::integral_constant<bool, (has_const_begin_end<T>::value ||
+                                    has_mutable_begin_end<T>::value)> {};
+#  undef FMT_DECLTYPE_RETURN
 #endif
 
-/// tuple_size and tuple_element check.
+// tuple_size and tuple_element check.
 template <typename T> class is_tuple_like_ {
   template <typename U>
   static auto check(U* p) -> decltype(std::tuple_size<U>::value, int());
   template <typename> static void check(...);
 
  public:
-  static FMT_CONSTEXPR_DECL const bool value =
+  static constexpr const bool value =
       !std::is_void<decltype(check<T>(nullptr))>::value;
 };
 
 // Check for integer_sequence
-#if defined(__cpp_lib_integer_sequence) || FMT_MSC_VER >= 1900
+#if defined(__cpp_lib_integer_sequence) || FMT_MSC_VERSION >= 1900
 template <typename T, T... N>
 using integer_sequence = std::integer_sequence<T, N...>;
-template <std::size_t... N> using index_sequence = std::index_sequence<N...>;
-template <std::size_t N>
-using make_index_sequence = std::make_index_sequence<N>;
+template <size_t... N> using index_sequence = std::index_sequence<N...>;
+template <size_t N> using make_index_sequence = std::make_index_sequence<N>;
 #else
 template <typename T, T... N> struct integer_sequence {
   using value_type = T;
 
-  static FMT_CONSTEXPR std::size_t size() { return sizeof...(N); }
+  static FMT_CONSTEXPR size_t size() { return sizeof...(N); }
 };
 
-template <std::size_t... N>
-using index_sequence = integer_sequence<std::size_t, N...>;
+template <size_t... N> using index_sequence = integer_sequence<size_t, N...>;
 
-template <typename T, std::size_t N, T... Ns>
+template <typename T, size_t N, T... Ns>
 struct make_integer_sequence : make_integer_sequence<T, N - 1, N - 1, Ns...> {};
 template <typename T, T... Ns>
 struct make_integer_sequence<T, 0, Ns...> : integer_sequence<T, Ns...> {};
 
-template <std::size_t N>
-using make_index_sequence = make_integer_sequence<std::size_t, N>;
+template <size_t N>
+using make_index_sequence = make_integer_sequence<size_t, N>;
 #endif
 
+template <typename T>
+using tuple_index_sequence = make_index_sequence<std::tuple_size<T>::value>;
+
+template <typename T, typename C, bool = is_tuple_like_<T>::value>
+class is_tuple_formattable_ {
+ public:
+  static constexpr const bool value = false;
+};
+template <typename T, typename C> class is_tuple_formattable_<T, C, true> {
+  template <std::size_t... I>
+  static std::true_type check2(index_sequence<I...>,
+                               integer_sequence<bool, (I == I)...>);
+  static std::false_type check2(...);
+  template <std::size_t... I>
+  static decltype(check2(
+      index_sequence<I...>{},
+      integer_sequence<
+          bool, (is_formattable<typename std::tuple_element<I, T>::type,
+                                C>::value)...>{})) check(index_sequence<I...>);
+
+ public:
+  static constexpr const bool value =
+      decltype(check(tuple_index_sequence<T>{}))::value;
+};
+
 template <class Tuple, class F, size_t... Is>
-void for_each(index_sequence<Is...>, Tuple&& tup, F&& f) FMT_NOEXCEPT {
+void for_each(index_sequence<Is...>, Tuple&& tup, F&& f) noexcept {
   using std::get;
   // using free function get<I>(T) now.
   const int _[] = {0, ((void)f(get<Is>(tup)), 0)...};
@@ -159,183 +246,435 @@ template <class Tuple, class F> void for_each(Tuple&& tup, F&& f) {
   for_each(indexes, std::forward<Tuple>(tup), std::forward<F>(f));
 }
 
-template <typename Arg, FMT_ENABLE_IF(!is_like_std_string<
-                                      typename std::decay<Arg>::type>::value)>
-FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
-  return add_space ? " {}" : "{}";
+#if FMT_MSC_VERSION && FMT_MSC_VERSION < 1920
+// Older MSVC doesn't get the reference type correctly for arrays.
+template <typename R> struct range_reference_type_impl {
+  using type = decltype(*detail::range_begin(std::declval<R&>()));
+};
+
+template <typename T, std::size_t N> struct range_reference_type_impl<T[N]> {
+  using type = T&;
+};
+
+template <typename T>
+using range_reference_type = typename range_reference_type_impl<T>::type;
+#else
+template <typename Range>
+using range_reference_type =
+    decltype(*detail::range_begin(std::declval<Range&>()));
+#endif
+
+// We don't use the Range's value_type for anything, but we do need the Range's
+// reference type, with cv-ref stripped.
+template <typename Range>
+using uncvref_type = remove_cvref_t<range_reference_type<Range>>;
+
+template <typename Range>
+using uncvref_first_type =
+    remove_cvref_t<decltype(std::declval<range_reference_type<Range>>().first)>;
+
+template <typename Range>
+using uncvref_second_type = remove_cvref_t<
+    decltype(std::declval<range_reference_type<Range>>().second)>;
+
+template <typename OutputIt> OutputIt write_delimiter(OutputIt out) {
+  *out++ = ',';
+  *out++ = ' ';
+  return out;
 }
 
-template <typename Arg, FMT_ENABLE_IF(is_like_std_string<
-                                      typename std::decay<Arg>::type>::value)>
-FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
-  return add_space ? " \"{}\"" : "\"{}\"";
+template <typename Char, typename OutputIt>
+auto write_range_entry(OutputIt out, basic_string_view<Char> str) -> OutputIt {
+  return write_escaped_string(out, str);
 }
 
-FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char*) {
-  return add_space ? " \"{}\"" : "\"{}\"";
-}
-FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t*) {
-  return add_space ? L" \"{}\"" : L"\"{}\"";
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(std::is_convertible<T, std_string_view<char>>::value)>
+inline auto write_range_entry(OutputIt out, const T& str) -> OutputIt {
+  auto sv = std_string_view<Char>(str);
+  return write_range_entry<Char>(out, basic_string_view<Char>(sv));
 }
 
-FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char) {
-  return add_space ? " '{}'" : "'{}'";
-}
-FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t) {
-  return add_space ? L" '{}'" : L"'{}'";
+template <typename Char, typename OutputIt, typename Arg,
+          FMT_ENABLE_IF(std::is_same<Arg, Char>::value)>
+OutputIt write_range_entry(OutputIt out, const Arg v) {
+  return write_escaped_char(out, v);
 }
 
-}  // namespace internal
+template <
+    typename Char, typename OutputIt, typename Arg,
+    FMT_ENABLE_IF(!is_std_string_like<typename std::decay<Arg>::type>::value &&
+                  !std::is_same<Arg, Char>::value)>
+OutputIt write_range_entry(OutputIt out, const Arg& v) {
+  return write<Char>(out, v);
+}
+
+}  // namespace detail
 
 template <typename T> struct is_tuple_like {
-  static FMT_CONSTEXPR_DECL const bool value =
-      internal::is_tuple_like_<T>::value && !internal::is_range_<T>::value;
+  static constexpr const bool value =
+      detail::is_tuple_like_<T>::value && !detail::is_range_<T>::value;
+};
+
+template <typename T, typename C> struct is_tuple_formattable {
+  static constexpr const bool value =
+      detail::is_tuple_formattable_<T, C>::value;
 };
 
 template <typename TupleT, typename Char>
-struct formatter<TupleT, Char, enable_if_t<fmt::is_tuple_like<TupleT>::value>> {
+struct formatter<TupleT, Char,
+                 enable_if_t<fmt::is_tuple_like<TupleT>::value &&
+                             fmt::is_tuple_formattable<TupleT, Char>::value>> {
  private:
-  // C++11 generic lambda for format()
+  basic_string_view<Char> separator_ = detail::string_literal<Char, ',', ' '>{};
+  basic_string_view<Char> opening_bracket_ =
+      detail::string_literal<Char, '('>{};
+  basic_string_view<Char> closing_bracket_ =
+      detail::string_literal<Char, ')'>{};
+
+  // C++11 generic lambda for format().
   template <typename FormatContext> struct format_each {
     template <typename T> void operator()(const T& v) {
-      if (i > 0) {
-        if (formatting.add_prepostfix_space) {
-          *out++ = ' ';
-        }
-        out = internal::copy(formatting.delimiter, out);
-      }
-      out = format_to(out,
-                      internal::format_str_quoted(
-                          (formatting.add_delimiter_spaces && i > 0), v),
-                      v);
+      if (i > 0) out = detail::copy_str<Char>(separator, out);
+      out = detail::write_range_entry<Char>(out, v);
       ++i;
     }
-
-    formatting_tuple<Char>& formatting;
-    std::size_t& i;
-    typename std::add_lvalue_reference<decltype(
-        std::declval<FormatContext>().out())>::type out;
+    int i;
+    typename FormatContext::iterator& out;
+    basic_string_view<Char> separator;
   };
 
  public:
-  formatting_tuple<Char> formatting;
+  FMT_CONSTEXPR formatter() {}
 
-  template <typename ParseContext>
-  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
-    return formatting.parse(ctx);
+  FMT_CONSTEXPR void set_separator(basic_string_view<Char> sep) {
+    separator_ = sep;
   }
 
-  template <typename FormatContext = format_context>
-  auto format(const TupleT& values, FormatContext& ctx) -> decltype(ctx.out()) {
-    auto out = ctx.out();
-    std::size_t i = 0;
-    internal::copy(formatting.prefix, out);
-
-    internal::for_each(values, format_each<FormatContext>{formatting, i, out});
-    if (formatting.add_prepostfix_space) {
-      *out++ = ' ';
-    }
-    internal::copy(formatting.postfix, out);
-
-    return ctx.out();
-  }
-};
-
-template <typename T, typename Char> struct is_range {
-  static FMT_CONSTEXPR_DECL const bool value =
-      internal::is_range_<T>::value &&
-      !internal::is_like_std_string<T>::value &&
-      !std::is_convertible<T, std::basic_string<Char>>::value &&
-      !std::is_constructible<internal::std_string_view<Char>, T>::value;
-};
-
-template <typename RangeT, typename Char>
-struct formatter<RangeT, Char,
-                 enable_if_t<fmt::is_range<RangeT, Char>::value>> {
-  formatting_range<Char> formatting;
-
-  template <typename ParseContext>
-  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
-    return formatting.parse(ctx);
+  FMT_CONSTEXPR void set_brackets(basic_string_view<Char> open,
+                                  basic_string_view<Char> close) {
+    opening_bracket_ = open;
+    closing_bracket_ = close;
   }
 
-  template <typename FormatContext>
-  typename FormatContext::iterator format(const RangeT& values,
-                                          FormatContext& ctx) {
-    auto out = internal::copy(formatting.prefix, ctx.out());
-    std::size_t i = 0;
-    for (auto it = values.begin(), end = values.end(); it != end; ++it) {
-      if (i > 0) {
-        if (formatting.add_prepostfix_space) *out++ = ' ';
-        out = internal::copy(formatting.delimiter, out);
-      }
-      out = format_to(out,
-                      internal::format_str_quoted(
-                          (formatting.add_delimiter_spaces && i > 0), *it),
-                      *it);
-      if (++i > formatting.range_length_limit) {
-        out = format_to(out, " ... <other elements>");
-        break;
-      }
-    }
-    if (formatting.add_prepostfix_space) *out++ = ' ';
-    return internal::copy(formatting.postfix, out);
-  }
-};
-
-template <typename Char, typename... T> struct tuple_arg_join : internal::view {
-  const std::tuple<T...>& tuple;
-  basic_string_view<Char> sep;
-
-  tuple_arg_join(const std::tuple<T...>& t, basic_string_view<Char> s)
-      : tuple{t}, sep{s} {}
-};
-
-template <typename Char, typename... T>
-struct formatter<tuple_arg_join<Char, T...>, Char> {
   template <typename ParseContext>
   FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
     return ctx.begin();
   }
 
+  template <typename FormatContext = format_context>
+  auto format(const TupleT& values, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    out = detail::copy_str<Char>(opening_bracket_, out);
+    detail::for_each(values, format_each<FormatContext>{0, out, separator_});
+    out = detail::copy_str<Char>(closing_bracket_, out);
+    return out;
+  }
+};
+
+template <typename T, typename Char> struct is_range {
+  static constexpr const bool value =
+      detail::is_range_<T>::value && !detail::is_std_string_like<T>::value &&
+      !std::is_convertible<T, std::basic_string<Char>>::value &&
+      !std::is_convertible<T, detail::std_string_view<Char>>::value;
+};
+
+namespace detail {
+template <typename Context> struct range_mapper {
+  using mapper = arg_mapper<Context>;
+
+  template <typename T,
+            FMT_ENABLE_IF(has_formatter<remove_cvref_t<T>, Context>::value)>
+  static auto map(T&& value) -> T&& {
+    return static_cast<T&&>(value);
+  }
+  template <typename T,
+            FMT_ENABLE_IF(!has_formatter<remove_cvref_t<T>, Context>::value)>
+  static auto map(T&& value)
+      -> decltype(mapper().map(static_cast<T&&>(value))) {
+    return mapper().map(static_cast<T&&>(value));
+  }
+};
+
+template <typename Char, typename Element>
+using range_formatter_type = conditional_t<
+    is_formattable<Element, Char>::value,
+    formatter<remove_cvref_t<decltype(range_mapper<buffer_context<Char>>{}.map(
+                  std::declval<Element>()))>,
+              Char>,
+    fallback_formatter<Element, Char>>;
+
+template <typename R>
+using maybe_const_range =
+    conditional_t<has_const_begin_end<R>::value, const R, R>;
+
+// Workaround a bug in MSVC 2015 and earlier.
+#if !FMT_MSC_VERSION || FMT_MSC_VERSION >= 1910
+template <typename R, typename Char>
+struct is_formattable_delayed
+    : disjunction<
+          is_formattable<uncvref_type<maybe_const_range<R>>, Char>,
+          has_fallback_formatter<uncvref_type<maybe_const_range<R>>, Char>> {};
+#endif
+
+}  // namespace detail
+
+template <typename T, typename Char, typename Enable = void>
+struct range_formatter;
+
+template <typename T, typename Char>
+struct range_formatter<
+    T, Char,
+    enable_if_t<conjunction<
+        std::is_same<T, remove_cvref_t<T>>,
+        disjunction<is_formattable<T, Char>,
+                    detail::has_fallback_formatter<T, Char>>>::value>> {
+ private:
+  detail::range_formatter_type<Char, T> underlying_;
+  bool custom_specs_ = false;
+  basic_string_view<Char> separator_ = detail::string_literal<Char, ',', ' '>{};
+  basic_string_view<Char> opening_bracket_ =
+      detail::string_literal<Char, '['>{};
+  basic_string_view<Char> closing_bracket_ =
+      detail::string_literal<Char, ']'>{};
+
+  template <class U>
+  FMT_CONSTEXPR static auto maybe_set_debug_format(U& u, int)
+      -> decltype(u.set_debug_format()) {
+    u.set_debug_format();
+  }
+
+  template <class U>
+  FMT_CONSTEXPR static void maybe_set_debug_format(U&, ...) {}
+
+  FMT_CONSTEXPR void maybe_set_debug_format() {
+    maybe_set_debug_format(underlying_, 0);
+  }
+
+ public:
+  FMT_CONSTEXPR range_formatter() {}
+
+  FMT_CONSTEXPR auto underlying() -> detail::range_formatter_type<Char, T>& {
+    return underlying_;
+  }
+
+  FMT_CONSTEXPR void set_separator(basic_string_view<Char> sep) {
+    separator_ = sep;
+  }
+
+  FMT_CONSTEXPR void set_brackets(basic_string_view<Char> open,
+                                  basic_string_view<Char> close) {
+    opening_bracket_ = open;
+    closing_bracket_ = close;
+  }
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    auto it = ctx.begin();
+    auto end = ctx.end();
+    if (it == end || *it == '}') {
+      maybe_set_debug_format();
+      return it;
+    }
+
+    if (*it == 'n') {
+      set_brackets({}, {});
+      ++it;
+    }
+
+    if (*it == '}') {
+      maybe_set_debug_format();
+      return it;
+    }
+
+    if (*it != ':')
+      FMT_THROW(format_error("no other top-level range formatters supported"));
+
+    custom_specs_ = true;
+    ++it;
+    ctx.advance_to(it);
+    return underlying_.parse(ctx);
+  }
+
+  template <typename R, class FormatContext>
+  auto format(R&& range, FormatContext& ctx) const -> decltype(ctx.out()) {
+    detail::range_mapper<buffer_context<Char>> mapper;
+    auto out = ctx.out();
+    out = detail::copy_str<Char>(opening_bracket_, out);
+    int i = 0;
+    auto it = detail::range_begin(range);
+    auto end = detail::range_end(range);
+    for (; it != end; ++it) {
+      if (i > 0) out = detail::copy_str<Char>(separator_, out);
+      ;
+      ctx.advance_to(out);
+      out = underlying_.format(mapper.map(*it), ctx);
+      ++i;
+    }
+    out = detail::copy_str<Char>(closing_bracket_, out);
+    return out;
+  }
+};
+
+enum class range_format { disabled, map, set, sequence, string, debug_string };
+
+namespace detail {
+template <typename T> struct range_format_kind_ {
+  static constexpr auto value = std::is_same<range_reference_type<T>, T>::value
+                                    ? range_format::disabled
+                                : is_map<T>::value ? range_format::map
+                                : is_set<T>::value ? range_format::set
+                                                   : range_format::sequence;
+};
+
+template <range_format K, typename R, typename Char, typename Enable = void>
+struct range_default_formatter;
+
+template <range_format K>
+using range_format_constant = std::integral_constant<range_format, K>;
+
+template <range_format K, typename R, typename Char>
+struct range_default_formatter<
+    K, R, Char,
+    enable_if_t<(K == range_format::sequence || K == range_format::map ||
+                 K == range_format::set)>> {
+  using range_type = detail::maybe_const_range<R>;
+  range_formatter<detail::uncvref_type<range_type>, Char> underlying_;
+
+  FMT_CONSTEXPR range_default_formatter() { init(range_format_constant<K>()); }
+
+  FMT_CONSTEXPR void init(range_format_constant<range_format::set>) {
+    underlying_.set_brackets(detail::string_literal<Char, '{'>{},
+                             detail::string_literal<Char, '}'>{});
+  }
+
+  FMT_CONSTEXPR void init(range_format_constant<range_format::map>) {
+    underlying_.set_brackets(detail::string_literal<Char, '{'>{},
+                             detail::string_literal<Char, '}'>{});
+    underlying_.underlying().set_brackets({}, {});
+    underlying_.underlying().set_separator(
+        detail::string_literal<Char, ':', ' '>{});
+  }
+
+  FMT_CONSTEXPR void init(range_format_constant<range_format::sequence>) {}
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return underlying_.parse(ctx);
+  }
+
   template <typename FormatContext>
-  typename FormatContext::iterator format(
-      const tuple_arg_join<Char, T...>& value, FormatContext& ctx) {
-    return format(value, ctx, internal::make_index_sequence<sizeof...(T)>{});
+  auto format(range_type& range, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return underlying_.format(range, ctx);
+  }
+};
+}  // namespace detail
+
+template <typename T, typename Char, typename Enable = void>
+struct range_format_kind
+    : conditional_t<
+          is_range<T, Char>::value, detail::range_format_kind_<T>,
+          std::integral_constant<range_format, range_format::disabled>> {};
+
+template <typename R, typename Char>
+struct formatter<
+    R, Char,
+    enable_if_t<conjunction<bool_constant<range_format_kind<R, Char>::value !=
+                                          range_format::disabled>
+// Workaround a bug in MSVC 2015 and earlier.
+#if !FMT_MSC_VERSION || FMT_MSC_VERSION >= 1910
+                            ,
+                            detail::is_formattable_delayed<R, Char>
+#endif
+                            >::value>>
+    : detail::range_default_formatter<range_format_kind<R, Char>::value, R,
+                                      Char> {
+};
+
+template <typename Char, typename... T> struct tuple_join_view : detail::view {
+  const std::tuple<T...>& tuple;
+  basic_string_view<Char> sep;
+
+  tuple_join_view(const std::tuple<T...>& t, basic_string_view<Char> s)
+      : tuple(t), sep{s} {}
+};
+
+template <typename Char, typename... T>
+using tuple_arg_join = tuple_join_view<Char, T...>;
+
+// Define FMT_TUPLE_JOIN_SPECIFIERS to enable experimental format specifiers
+// support in tuple_join. It is disabled by default because of issues with
+// the dynamic width and precision.
+#ifndef FMT_TUPLE_JOIN_SPECIFIERS
+#  define FMT_TUPLE_JOIN_SPECIFIERS 0
+#endif
+
+template <typename Char, typename... T>
+struct formatter<tuple_join_view<Char, T...>, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return do_parse(ctx, std::integral_constant<size_t, sizeof...(T)>());
+  }
+
+  template <typename FormatContext>
+  auto format(const tuple_join_view<Char, T...>& value,
+              FormatContext& ctx) const -> typename FormatContext::iterator {
+    return do_format(value, ctx,
+                     std::integral_constant<size_t, sizeof...(T)>());
   }
 
  private:
-  template <typename FormatContext, size_t... N>
-  typename FormatContext::iterator format(
-      const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
-      internal::index_sequence<N...>) {
-    return format_args(value, ctx, std::get<N>(value.tuple)...);
+  std::tuple<formatter<typename std::decay<T>::type, Char>...> formatters_;
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto do_parse(ParseContext& ctx,
+                              std::integral_constant<size_t, 0>)
+      -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename ParseContext, size_t N>
+  FMT_CONSTEXPR auto do_parse(ParseContext& ctx,
+                              std::integral_constant<size_t, N>)
+      -> decltype(ctx.begin()) {
+    auto end = ctx.begin();
+#if FMT_TUPLE_JOIN_SPECIFIERS
+    end = std::get<sizeof...(T) - N>(formatters_).parse(ctx);
+    if (N > 1) {
+      auto end1 = do_parse(ctx, std::integral_constant<size_t, N - 1>());
+      if (end != end1)
+        FMT_THROW(format_error("incompatible format specs for tuple elements"));
+    }
+#endif
+    return end;
   }
 
   template <typename FormatContext>
-  typename FormatContext::iterator format_args(
-      const tuple_arg_join<Char, T...>&, FormatContext& ctx) {
-    // NOTE: for compilers that support C++17, this empty function instantiation
-    // can be replaced with a constexpr branch in the variadic overload.
+  auto do_format(const tuple_join_view<Char, T...>&, FormatContext& ctx,
+                 std::integral_constant<size_t, 0>) const ->
+      typename FormatContext::iterator {
     return ctx.out();
   }
 
-  template <typename FormatContext, typename Arg, typename... Args>
-  typename FormatContext::iterator format_args(
-      const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
-      const Arg& arg, const Args&... args) {
-    using base = formatter<typename std::decay<Arg>::type, Char>;
-    auto out = ctx.out();
-    out = base{}.format(arg, ctx);
-    if (sizeof...(Args) > 0) {
+  template <typename FormatContext, size_t N>
+  auto do_format(const tuple_join_view<Char, T...>& value, FormatContext& ctx,
+                 std::integral_constant<size_t, N>) const ->
+      typename FormatContext::iterator {
+    auto out = std::get<sizeof...(T) - N>(formatters_)
+                   .format(std::get<sizeof...(T) - N>(value.tuple), ctx);
+    if (N > 1) {
       out = std::copy(value.sep.begin(), value.sep.end(), out);
       ctx.advance_to(out);
-      return format_args(value, ctx, args...);
+      return do_format(value, ctx, std::integral_constant<size_t, N - 1>());
     }
     return out;
   }
 };
 
+FMT_MODULE_EXPORT_BEGIN
+
 /**
   \rst
   Returns an object that formats `tuple` with elements separated by `sep`.
@@ -348,14 +687,15 @@ struct formatter<tuple_arg_join<Char, T...>, Char> {
   \endrst
  */
 template <typename... T>
-FMT_CONSTEXPR tuple_arg_join<char, T...> join(const std::tuple<T...>& tuple,
-                                              string_view sep) {
+FMT_CONSTEXPR auto join(const std::tuple<T...>& tuple, string_view sep)
+    -> tuple_join_view<char, T...> {
   return {tuple, sep};
 }
 
 template <typename... T>
-FMT_CONSTEXPR tuple_arg_join<wchar_t, T...> join(const std::tuple<T...>& tuple,
-                                                 wstring_view sep) {
+FMT_CONSTEXPR auto join(const std::tuple<T...>& tuple,
+                        basic_string_view<wchar_t> sep)
+    -> tuple_join_view<wchar_t, T...> {
   return {tuple, sep};
 }
 
@@ -371,17 +711,12 @@ FMT_CONSTEXPR tuple_arg_join<wchar_t, T...> join(const std::tuple<T...>& tuple,
   \endrst
  */
 template <typename T>
-arg_join<internal::iterator_t<const std::initializer_list<T>>, char> join(
-    std::initializer_list<T> list, string_view sep) {
-  return join(std::begin(list), std::end(list), sep);
-}
-
-template <typename T>
-arg_join<internal::iterator_t<const std::initializer_list<T>>, wchar_t> join(
-    std::initializer_list<T> list, wstring_view sep) {
+auto join(std::initializer_list<T> list, string_view sep)
+    -> join_view<const T*, const T*> {
   return join(std::begin(list), std::end(list), sep);
 }
 
+FMT_MODULE_EXPORT_END
 FMT_END_NAMESPACE
 
 #endif  // FMT_RANGES_H_

externals/fmt/include/fmt/std.h

@@ -0,0 +1,171 @@
+// Formatting library for C++ - formatters for standard library types
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_STD_H_
+#define FMT_STD_H_
+
+#include <thread>
+#include <type_traits>
+#include <utility>
+
+#include "ostream.h"
+
+#if FMT_HAS_INCLUDE(<version>)
+#  include <version>
+#endif
+// Checking FMT_CPLUSPLUS for warning suppression in MSVC.
+#if FMT_CPLUSPLUS >= 201703L
+#  if FMT_HAS_INCLUDE(<filesystem>)
+#    include <filesystem>
+#  endif
+#  if FMT_HAS_INCLUDE(<variant>)
+#    include <variant>
+#  endif
+#endif
+
+#ifdef __cpp_lib_filesystem
+FMT_BEGIN_NAMESPACE
+
+namespace detail {
+
+template <typename Char>
+void write_escaped_path(basic_memory_buffer<Char>& quoted,
+                        const std::filesystem::path& p) {
+  write_escaped_string<Char>(std::back_inserter(quoted), p.string<Char>());
+}
+#  ifdef _WIN32
+template <>
+inline void write_escaped_path<char>(basic_memory_buffer<char>& quoted,
+                                     const std::filesystem::path& p) {
+  auto s = p.u8string();
+  write_escaped_string<char>(
+      std::back_inserter(quoted),
+      string_view(reinterpret_cast<const char*>(s.c_str()), s.size()));
+}
+#  endif
+template <>
+inline void write_escaped_path<std::filesystem::path::value_type>(
+    basic_memory_buffer<std::filesystem::path::value_type>& quoted,
+    const std::filesystem::path& p) {
+  write_escaped_string<std::filesystem::path::value_type>(
+      std::back_inserter(quoted), p.native());
+}
+
+}  // namespace detail
+
+template <typename Char>
+struct formatter<std::filesystem::path, Char>
+    : formatter<basic_string_view<Char>> {
+  template <typename FormatContext>
+  auto format(const std::filesystem::path& p, FormatContext& ctx) const ->
+      typename FormatContext::iterator {
+    basic_memory_buffer<Char> quoted;
+    detail::write_escaped_path(quoted, p);
+    return formatter<basic_string_view<Char>>::format(
+        basic_string_view<Char>(quoted.data(), quoted.size()), ctx);
+  }
+};
+FMT_END_NAMESPACE
+#endif
+
+FMT_BEGIN_NAMESPACE
+template <typename Char>
+struct formatter<std::thread::id, Char> : basic_ostream_formatter<Char> {};
+FMT_END_NAMESPACE
+
+#ifdef __cpp_lib_variant
+FMT_BEGIN_NAMESPACE
+template <typename Char> struct formatter<std::monostate, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  auto format(const std::monostate&, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    out = detail::write<Char>(out, "monostate");
+    return out;
+  }
+};
+
+namespace detail {
+
+template <typename T>
+using variant_index_sequence =
+    std::make_index_sequence<std::variant_size<T>::value>;
+
+// variant_size and variant_alternative check.
+template <typename T, typename U = void>
+struct is_variant_like_ : std::false_type {};
+template <typename T>
+struct is_variant_like_<T, std::void_t<decltype(std::variant_size<T>::value)>>
+    : std::true_type {};
+
+// formattable element check
+template <typename T, typename C> class is_variant_formattable_ {
+  template <std::size_t... I>
+  static std::conjunction<
+      is_formattable<std::variant_alternative_t<I, T>, C>...>
+      check(std::index_sequence<I...>);
+
+ public:
+  static constexpr const bool value =
+      decltype(check(variant_index_sequence<T>{}))::value;
+};
+
+template <typename Char, typename OutputIt, typename T>
+auto write_variant_alternative(OutputIt out, const T& v) -> OutputIt {
+  if constexpr (is_string<T>::value)
+    return write_escaped_string<Char>(out, detail::to_string_view(v));
+  else if constexpr (std::is_same_v<T, Char>)
+    return write_escaped_char(out, v);
+  else
+    return write<Char>(out, v);
+}
+
+}  // namespace detail
+
+template <typename T> struct is_variant_like {
+  static constexpr const bool value = detail::is_variant_like_<T>::value;
+};
+
+template <typename T, typename C> struct is_variant_formattable {
+  static constexpr const bool value =
+      detail::is_variant_formattable_<T, C>::value;
+};
+
+template <typename Variant, typename Char>
+struct formatter<
+    Variant, Char,
+    std::enable_if_t<std::conjunction_v<
+        is_variant_like<Variant>, is_variant_formattable<Variant, Char>>>> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  auto format(const Variant& value, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+
+    out = detail::write<Char>(out, "variant(");
+    std::visit(
+        [&](const auto& v) {
+          out = detail::write_variant_alternative<Char>(out, v);
+        },
+        value);
+    *out++ = ')';
+    return out;
+  }
+};
+FMT_END_NAMESPACE
+#endif
+
+#endif  // FMT_STD_H_

externals/fmt/include/fmt/xchar.h

@@ -0,0 +1,229 @@
+// Formatting library for C++ - optional wchar_t and exotic character support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_XCHAR_H_
+#define FMT_XCHAR_H_
+
+#include <cwchar>
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+namespace detail {
+template <typename T>
+using is_exotic_char = bool_constant<!std::is_same<T, char>::value>;
+}
+
+FMT_MODULE_EXPORT_BEGIN
+
+using wstring_view = basic_string_view<wchar_t>;
+using wformat_parse_context = basic_format_parse_context<wchar_t>;
+using wformat_context = buffer_context<wchar_t>;
+using wformat_args = basic_format_args<wformat_context>;
+using wmemory_buffer = basic_memory_buffer<wchar_t>;
+
+#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409
+// Workaround broken conversion on older gcc.
+template <typename... Args> using wformat_string = wstring_view;
+inline auto runtime(wstring_view s) -> wstring_view { return s; }
+#else
+template <typename... Args>
+using wformat_string = basic_format_string<wchar_t, type_identity_t<Args>...>;
+inline auto runtime(wstring_view s) -> basic_runtime<wchar_t> { return {{s}}; }
+#endif
+
+template <> struct is_char<wchar_t> : std::true_type {};
+template <> struct is_char<detail::char8_type> : std::true_type {};
+template <> struct is_char<char16_t> : std::true_type {};
+template <> struct is_char<char32_t> : std::true_type {};
+
+template <typename... Args>
+constexpr format_arg_store<wformat_context, Args...> make_wformat_args(
+    const Args&... args) {
+  return {args...};
+}
+
+inline namespace literals {
+#if FMT_USE_USER_DEFINED_LITERALS && !FMT_USE_NONTYPE_TEMPLATE_ARGS
+constexpr detail::udl_arg<wchar_t> operator"" _a(const wchar_t* s, size_t) {
+  return {s};
+}
+#endif
+}  // namespace literals
+
+template <typename It, typename Sentinel>
+auto join(It begin, Sentinel end, wstring_view sep)
+    -> join_view<It, Sentinel, wchar_t> {
+  return {begin, end, sep};
+}
+
+template <typename Range>
+auto join(Range&& range, wstring_view sep)
+    -> join_view<detail::iterator_t<Range>, detail::sentinel_t<Range>,
+                 wchar_t> {
+  return join(std::begin(range), std::end(range), sep);
+}
+
+template <typename T>
+auto join(std::initializer_list<T> list, wstring_view sep)
+    -> join_view<const T*, const T*, wchar_t> {
+  return join(std::begin(list), std::end(list), sep);
+}
+
+template <typename Char, FMT_ENABLE_IF(!std::is_same<Char, char>::value)>
+auto vformat(basic_string_view<Char> format_str,
+             basic_format_args<buffer_context<type_identity_t<Char>>> args)
+    -> std::basic_string<Char> {
+  basic_memory_buffer<Char> buffer;
+  detail::vformat_to(buffer, format_str, args);
+  return to_string(buffer);
+}
+
+template <typename... T>
+auto format(wformat_string<T...> fmt, T&&... args) -> std::wstring {
+  return vformat(fmt::wstring_view(fmt), fmt::make_wformat_args(args...));
+}
+
+// Pass char_t as a default template parameter instead of using
+// std::basic_string<char_t<S>> to reduce the symbol size.
+template <typename S, typename... Args, typename Char = char_t<S>,
+          FMT_ENABLE_IF(!std::is_same<Char, char>::value &&
+                        !std::is_same<Char, wchar_t>::value)>
+auto format(const S& format_str, Args&&... args) -> std::basic_string<Char> {
+  return vformat(detail::to_string_view(format_str),
+                 fmt::make_format_args<buffer_context<Char>>(args...));
+}
+
+template <typename Locale, typename S, typename Char = char_t<S>,
+          FMT_ENABLE_IF(detail::is_locale<Locale>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto vformat(
+    const Locale& loc, const S& format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args)
+    -> std::basic_string<Char> {
+  return detail::vformat(loc, detail::to_string_view(format_str), args);
+}
+
+template <typename Locale, typename S, typename... Args,
+          typename Char = char_t<S>,
+          FMT_ENABLE_IF(detail::is_locale<Locale>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto format(const Locale& loc, const S& format_str, Args&&... args)
+    -> std::basic_string<Char> {
+  return detail::vformat(loc, detail::to_string_view(format_str),
+                         fmt::make_format_args<buffer_context<Char>>(args...));
+}
+
+template <typename OutputIt, typename S, typename Char = char_t<S>,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_exotic_char<Char>::value)>
+auto vformat_to(OutputIt out, const S& format_str,
+                basic_format_args<buffer_context<type_identity_t<Char>>> args)
+    -> OutputIt {
+  auto&& buf = detail::get_buffer<Char>(out);
+  detail::vformat_to(buf, detail::to_string_view(format_str), args);
+  return detail::get_iterator(buf);
+}
+
+template <typename OutputIt, typename S, typename... Args,
+          typename Char = char_t<S>,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto format_to(OutputIt out, const S& fmt, Args&&... args) -> OutputIt {
+  return vformat_to(out, detail::to_string_view(fmt),
+                    fmt::make_format_args<buffer_context<Char>>(args...));
+}
+
+template <typename Locale, typename S, typename OutputIt, typename... Args,
+          typename Char = char_t<S>,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_locale<Locale>::value&&
+                                detail::is_exotic_char<Char>::value)>
+inline auto vformat_to(
+    OutputIt out, const Locale& loc, const S& format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) -> OutputIt {
+  auto&& buf = detail::get_buffer<Char>(out);
+  vformat_to(buf, detail::to_string_view(format_str), args,
+             detail::locale_ref(loc));
+  return detail::get_iterator(buf);
+}
+
+template <
+    typename OutputIt, typename Locale, typename S, typename... Args,
+    typename Char = char_t<S>,
+    bool enable = detail::is_output_iterator<OutputIt, Char>::value&&
+        detail::is_locale<Locale>::value&& detail::is_exotic_char<Char>::value>
+inline auto format_to(OutputIt out, const Locale& loc, const S& format_str,
+                      Args&&... args) ->
+    typename std::enable_if<enable, OutputIt>::type {
+  return vformat_to(out, loc, to_string_view(format_str),
+                    fmt::make_format_args<buffer_context<Char>>(args...));
+}
+
+template <typename OutputIt, typename Char, typename... Args,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto vformat_to_n(
+    OutputIt out, size_t n, basic_string_view<Char> format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args)
+    -> format_to_n_result<OutputIt> {
+  detail::iterator_buffer<OutputIt, Char, detail::fixed_buffer_traits> buf(out,
+                                                                           n);
+  detail::vformat_to(buf, format_str, args);
+  return {buf.out(), buf.count()};
+}
+
+template <typename OutputIt, typename S, typename... Args,
+          typename Char = char_t<S>,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto format_to_n(OutputIt out, size_t n, const S& fmt,
+                        const Args&... args) -> format_to_n_result<OutputIt> {
+  return vformat_to_n(out, n, detail::to_string_view(fmt),
+                      fmt::make_format_args<buffer_context<Char>>(args...));
+}
+
+template <typename S, typename... Args, typename Char = char_t<S>,
+          FMT_ENABLE_IF(detail::is_exotic_char<Char>::value)>
+inline auto formatted_size(const S& fmt, Args&&... args) -> size_t {
+  detail::counting_buffer<Char> buf;
+  detail::vformat_to(buf, detail::to_string_view(fmt),
+                     fmt::make_format_args<buffer_context<Char>>(args...));
+  return buf.count();
+}
+
+inline void vprint(std::FILE* f, wstring_view fmt, wformat_args args) {
+  wmemory_buffer buffer;
+  detail::vformat_to(buffer, fmt, args);
+  buffer.push_back(L'\0');
+  if (std::fputws(buffer.data(), f) == -1)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
+}
+
+inline void vprint(wstring_view fmt, wformat_args args) {
+  vprint(stdout, fmt, args);
+}
+
+template <typename... T>
+void print(std::FILE* f, wformat_string<T...> fmt, T&&... args) {
+  return vprint(f, wstring_view(fmt), fmt::make_wformat_args(args...));
+}
+
+template <typename... T> void print(wformat_string<T...> fmt, T&&... args) {
+  return vprint(wstring_view(fmt), fmt::make_wformat_args(args...));
+}
+
+/**
+  Converts *value* to ``std::wstring`` using the default format for type *T*.
+ */
+template <typename T> inline auto to_wstring(const T& value) -> std::wstring {
+  return format(FMT_STRING(L"{}"), value);
+}
+FMT_MODULE_EXPORT_END
+FMT_END_NAMESPACE
+
+#endif  // FMT_XCHAR_H_

externals/fmt/src/fmt.cc

@@ -0,0 +1,99 @@
+module;
+#ifndef __cpp_modules
+#  error Module not supported.
+#endif
+
+// put all implementation-provided headers into the global module fragment
+// to prevent attachment to this module
+#if !defined(_CRT_SECURE_NO_WARNINGS) && defined(_MSC_VER)
+#  define _CRT_SECURE_NO_WARNINGS
+#endif
+#if !defined(WIN32_LEAN_AND_MEAN) && defined(_WIN32)
+#  define WIN32_LEAN_AND_MEAN
+#endif
+
+#include <algorithm>
+#include <cctype>
+#include <cerrno>
+#include <chrono>
+#include <climits>
+#include <clocale>
+#include <cmath>
+#include <cstdarg>
+#include <cstddef>
+#include <cstdint>
+#include <cstdio>
+#include <cstdlib>
+#include <cstring>
+#include <ctime>
+#include <cwchar>
+#include <exception>
+#include <functional>
+#include <iterator>
+#include <limits>
+#include <locale>
+#include <memory>
+#include <ostream>
+#include <sstream>
+#include <stdexcept>
+#include <string>
+#include <string_view>
+#include <system_error>
+#include <type_traits>
+#include <utility>
+#include <vector>
+
+#if _MSC_VER
+#  include <intrin.h>
+#endif
+#if defined __APPLE__ || defined(__FreeBSD__)
+#  include <xlocale.h>
+#endif
+#if __has_include(<winapifamily.h>)
+#  include <winapifamily.h>
+#endif
+#if (__has_include(<fcntl.h>) || defined(__APPLE__) || \
+     defined(__linux__)) &&                            \
+    (!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
+#  include <fcntl.h>
+#  include <sys/stat.h>
+#  include <sys/types.h>
+#  ifndef _WIN32
+#    include <unistd.h>
+#  else
+#    include <io.h>
+#  endif
+#endif
+#ifdef _WIN32
+#  include <windows.h>
+#endif
+
+export module fmt;
+
+#define FMT_MODULE_EXPORT export
+#define FMT_MODULE_EXPORT_BEGIN export {
+#define FMT_MODULE_EXPORT_END }
+#define FMT_BEGIN_DETAIL_NAMESPACE \
+  }                                \
+  namespace detail {
+#define FMT_END_DETAIL_NAMESPACE \
+  }                              \
+  export {
+// all library-provided declarations and definitions
+// must be in the module purview to be exported
+#include "fmt/args.h"
+#include "fmt/chrono.h"
+#include "fmt/color.h"
+#include "fmt/compile.h"
+#include "fmt/format.h"
+#include "fmt/os.h"
+#include "fmt/printf.h"
+#include "fmt/xchar.h"
+
+// gcc doesn't yet implement private module fragments
+#if !FMT_GCC_VERSION
+module : private;
+#endif
+
+#include "format.cc"
+#include "os.cc"

externals/fmt/src/format.cc

@@ -8,169 +8,40 @@
 #include "fmt/format-inl.h"
 
 FMT_BEGIN_NAMESPACE
-namespace internal {
+namespace detail {
 
-template <typename T>
-int format_float(char* buf, std::size_t size, const char* format, int precision,
-                 T value) {
-#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
-  if (precision > 100000)
-    throw std::runtime_error(
-        "fuzz mode - avoid large allocation inside snprintf");
-#endif
-  // Suppress the warning about nonliteral format string.
-  int (*snprintf_ptr)(char*, size_t, const char*, ...) = FMT_SNPRINTF;
-  return precision < 0 ? snprintf_ptr(buf, size, format, value)
-                       : snprintf_ptr(buf, size, format, precision, value);
-}
-struct sprintf_specs {
-  int precision;
-  char type;
-  bool alt : 1;
-
-  template <typename Char>
-  constexpr sprintf_specs(basic_format_specs<Char> specs)
-      : precision(specs.precision), type(specs.type), alt(specs.alt) {}
-
-  constexpr bool has_precision() const { return precision >= 0; }
-};
-
-// This is deprecated and is kept only to preserve ABI compatibility.
-template <typename Double>
-char* sprintf_format(Double value, internal::buffer<char>& buf,
-                     sprintf_specs specs) {
-  // Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail.
-  FMT_ASSERT(buf.capacity() != 0, "empty buffer");
-
-  // Build format string.
-  enum { max_format_size = 10 };  // longest format: %#-*.*Lg
-  char format[max_format_size];
-  char* format_ptr = format;
-  *format_ptr++ = '%';
-  if (specs.alt || !specs.type) *format_ptr++ = '#';
-  if (specs.precision >= 0) {
-    *format_ptr++ = '.';
-    *format_ptr++ = '*';
-  }
-  if (std::is_same<Double, long double>::value) *format_ptr++ = 'L';
-
-  char type = specs.type;
-
-  if (type == '%')
-    type = 'f';
-  else if (type == 0 || type == 'n')
-    type = 'g';
-#if FMT_MSC_VER
-  if (type == 'F') {
-    // MSVC's printf doesn't support 'F'.
-    type = 'f';
-  }
-#endif
-  *format_ptr++ = type;
-  *format_ptr = '\0';
-
-  // Format using snprintf.
-  char* start = nullptr;
-  char* decimal_point_pos = nullptr;
-  for (;;) {
-    std::size_t buffer_size = buf.capacity();
-    start = &buf[0];
-    int result =
-        format_float(start, buffer_size, format, specs.precision, value);
-    if (result >= 0) {
-      unsigned n = internal::to_unsigned(result);
-      if (n < buf.capacity()) {
-        // Find the decimal point.
-        auto p = buf.data(), end = p + n;
-        if (*p == '+' || *p == '-') ++p;
-        if (specs.type != 'a' && specs.type != 'A') {
-          while (p < end && *p >= '0' && *p <= '9') ++p;
-          if (p < end && *p != 'e' && *p != 'E') {
-            decimal_point_pos = p;
-            if (!specs.type) {
-              // Keep only one trailing zero after the decimal point.
-              ++p;
-              if (*p == '0') ++p;
-              while (p != end && *p >= '1' && *p <= '9') ++p;
-              char* where = p;
-              while (p != end && *p == '0') ++p;
-              if (p == end || *p < '0' || *p > '9') {
-                if (p != end) std::memmove(where, p, to_unsigned(end - p));
-                n -= static_cast<unsigned>(p - where);
-              }
-            }
-          }
-        }
-        buf.resize(n);
-        break;  // The buffer is large enough - continue with formatting.
-      }
-      buf.reserve(n + 1);
-    } else {
-      // If result is negative we ask to increase the capacity by at least 1,
-      // but as std::vector, the buffer grows exponentially.
-      buf.reserve(buf.capacity() + 1);
-    }
-  }
-  return decimal_point_pos;
-}
-}  // namespace internal
-
-template FMT_API char* internal::sprintf_format(double, internal::buffer<char>&,
-                                                sprintf_specs);
-template FMT_API char* internal::sprintf_format(long double,
-                                                internal::buffer<char>&,
-                                                sprintf_specs);
-
-template struct FMT_INSTANTIATION_DEF_API internal::basic_data<void>;
-
-// Workaround a bug in MSVC2013 that prevents instantiation of format_float.
-int (*instantiate_format_float)(double, int, internal::float_specs,
-                                internal::buffer<char>&) =
-    internal::format_float;
+template FMT_API auto dragonbox::to_decimal(float x) noexcept
+    -> dragonbox::decimal_fp<float>;
+template FMT_API auto dragonbox::to_decimal(double x) noexcept
+    -> dragonbox::decimal_fp<double>;
 
 #ifndef FMT_STATIC_THOUSANDS_SEPARATOR
-template FMT_API internal::locale_ref::locale_ref(const std::locale& loc);
-template FMT_API std::locale internal::locale_ref::get<std::locale>() const;
+template FMT_API locale_ref::locale_ref(const std::locale& loc);
+template FMT_API auto locale_ref::get<std::locale>() const -> std::locale;
 #endif
 
 // Explicit instantiations for char.
 
-template FMT_API std::string internal::grouping_impl<char>(locale_ref);
-template FMT_API char internal::thousands_sep_impl(locale_ref);
-template FMT_API char internal::decimal_point_impl(locale_ref);
+template FMT_API auto thousands_sep_impl(locale_ref)
+    -> thousands_sep_result<char>;
+template FMT_API auto decimal_point_impl(locale_ref) -> char;
 
-template FMT_API void internal::buffer<char>::append(const char*, const char*);
+template FMT_API void buffer<char>::append(const char*, const char*);
 
-template FMT_API void internal::arg_map<format_context>::init(
-    const basic_format_args<format_context>& args);
-
-template FMT_API std::string internal::vformat<char>(
-    string_view, basic_format_args<format_context>);
-
-template FMT_API format_context::iterator internal::vformat_to(
-    internal::buffer<char>&, string_view, basic_format_args<format_context>);
-
-template FMT_API int internal::snprintf_float(double, int,
-                                              internal::float_specs,
-                                              internal::buffer<char>&);
-template FMT_API int internal::snprintf_float(long double, int,
-                                              internal::float_specs,
-                                              internal::buffer<char>&);
-template FMT_API int internal::format_float(double, int, internal::float_specs,
-                                            internal::buffer<char>&);
-template FMT_API int internal::format_float(long double, int,
-                                            internal::float_specs,
-                                            internal::buffer<char>&);
+// DEPRECATED!
+// There is no correspondent extern template in format.h because of
+// incompatibility between clang and gcc (#2377).
+template FMT_API void vformat_to(buffer<char>&, string_view,
+                                 basic_format_args<FMT_BUFFER_CONTEXT(char)>,
+                                 locale_ref);
 
 // Explicit instantiations for wchar_t.
 
-template FMT_API std::string internal::grouping_impl<wchar_t>(locale_ref);
-template FMT_API wchar_t internal::thousands_sep_impl(locale_ref);
-template FMT_API wchar_t internal::decimal_point_impl(locale_ref);
+template FMT_API auto thousands_sep_impl(locale_ref)
+    -> thousands_sep_result<wchar_t>;
+template FMT_API auto decimal_point_impl(locale_ref) -> wchar_t;
 
-template FMT_API void internal::buffer<wchar_t>::append(const wchar_t*,
-                                                        const wchar_t*);
+template FMT_API void buffer<wchar_t>::append(const wchar_t*, const wchar_t*);
 
-template FMT_API std::wstring internal::vformat<wchar_t>(
-    wstring_view, basic_format_args<wformat_context>);
+}  // namespace detail
 FMT_END_NAMESPACE

externals/fmt/src/os.cc

@@ -25,21 +25,24 @@
 #      define WIN32_LEAN_AND_MEAN
 #    endif
 #    include <io.h>
-#    include <windows.h>
-
-#    define O_CREAT _O_CREAT
-#    define O_TRUNC _O_TRUNC
 
 #    ifndef S_IRUSR
 #      define S_IRUSR _S_IREAD
 #    endif
-
 #    ifndef S_IWUSR
 #      define S_IWUSR _S_IWRITE
 #    endif
-
-#    ifdef __MINGW32__
-#      define _SH_DENYNO 0x40
+#    ifndef S_IRGRP
+#      define S_IRGRP 0
+#    endif
+#    ifndef S_IWGRP
+#      define S_IWGRP 0
+#    endif
+#    ifndef S_IROTH
+#      define S_IROTH 0
+#    endif
+#    ifndef S_IWOTH
+#      define S_IWOTH 0
 #    endif
 #  endif  // _WIN32
 #endif    // FMT_USE_FCNTL
@@ -48,23 +51,19 @@
 #  include <windows.h>
 #endif
 
-#ifdef fileno
-#  undef fileno
-#endif
-
 namespace {
 #ifdef _WIN32
 // Return type of read and write functions.
-using RWResult = int;
+using rwresult = int;
 
 // On Windows the count argument to read and write is unsigned, so convert
 // it from size_t preventing integer overflow.
 inline unsigned convert_rwcount(std::size_t count) {
   return count <= UINT_MAX ? static_cast<unsigned>(count) : UINT_MAX;
 }
-#else
+#elif FMT_USE_FCNTL
 // Return type of read and write functions.
-using RWResult = ssize_t;
+using rwresult = ssize_t;
 
 inline std::size_t convert_rwcount(std::size_t count) { return count; }
 #endif
@@ -73,14 +72,14 @@ inline std::size_t convert_rwcount(std::size_t count) { return count; }
 FMT_BEGIN_NAMESPACE
 
 #ifdef _WIN32
-internal::utf16_to_utf8::utf16_to_utf8(wstring_view s) {
+detail::utf16_to_utf8::utf16_to_utf8(basic_string_view<wchar_t> s) {
   if (int error_code = convert(s)) {
     FMT_THROW(windows_error(error_code,
                             "cannot convert string from UTF-16 to UTF-8"));
   }
 }
 
-int internal::utf16_to_utf8::convert(wstring_view s) {
+int detail::utf16_to_utf8::convert(basic_string_view<wchar_t> s) {
   if (s.size() > INT_MAX) return ERROR_INVALID_PARAMETER;
   int s_size = static_cast<int>(s.size());
   if (s_size == 0) {
@@ -101,53 +100,90 @@ int internal::utf16_to_utf8::convert(wstring_view s) {
   return 0;
 }
 
-void windows_error::init(int err_code, string_view format_str,
-                         format_args args) {
-  error_code_ = err_code;
-  memory_buffer buffer;
-  internal::format_windows_error(buffer, err_code, vformat(format_str, args));
-  std::runtime_error& base = *this;
-  base = std::runtime_error(to_string(buffer));
+namespace detail {
+
+class system_message {
+  system_message(const system_message&) = delete;
+  void operator=(const system_message&) = delete;
+
+  unsigned long result_;
+  wchar_t* message_;
+
+  static bool is_whitespace(wchar_t c) noexcept {
+    return c == L' ' || c == L'\n' || c == L'\r' || c == L'\t' || c == L'\0';
+  }
+
+ public:
+  explicit system_message(unsigned long error_code)
+      : result_(0), message_(nullptr) {
+    result_ = FormatMessageW(
+        FORMAT_MESSAGE_ALLOCATE_BUFFER | FORMAT_MESSAGE_FROM_SYSTEM |
+            FORMAT_MESSAGE_IGNORE_INSERTS,
+        nullptr, error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT),
+        reinterpret_cast<wchar_t*>(&message_), 0, nullptr);
+    if (result_ != 0) {
+      while (result_ != 0 && is_whitespace(message_[result_ - 1])) {
+        --result_;
+      }
+    }
+  }
+  ~system_message() { LocalFree(message_); }
+  explicit operator bool() const noexcept { return result_ != 0; }
+  operator basic_string_view<wchar_t>() const noexcept {
+    return basic_string_view<wchar_t>(message_, result_);
+  }
+};
+
+class utf8_system_category final : public std::error_category {
+ public:
+  const char* name() const noexcept override { return "system"; }
+  std::string message(int error_code) const override {
+    system_message msg(error_code);
+    if (msg) {
+      utf16_to_utf8 utf8_message;
+      if (utf8_message.convert(msg) == ERROR_SUCCESS) {
+        return utf8_message.str();
+      }
+    }
+    return "unknown error";
+  }
+};
+
+}  // namespace detail
+
+FMT_API const std::error_category& system_category() noexcept {
+  static const detail::utf8_system_category category;
+  return category;
 }
 
-void internal::format_windows_error(internal::buffer<char>& out, int error_code,
-                                    string_view message) FMT_NOEXCEPT {
+std::system_error vwindows_error(int err_code, string_view format_str,
+                                 format_args args) {
+  auto ec = std::error_code(err_code, system_category());
+  return std::system_error(ec, vformat(format_str, args));
+}
+
+void detail::format_windows_error(detail::buffer<char>& out, int error_code,
+                                  const char* message) noexcept {
   FMT_TRY {
-    wmemory_buffer buf;
-    buf.resize(inline_buffer_size);
-    for (;;) {
-      wchar_t* system_message = &buf[0];
-      int result = FormatMessageW(
-          FORMAT_MESSAGE_FROM_SYSTEM | FORMAT_MESSAGE_IGNORE_INSERTS, nullptr,
-          error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT), system_message,
-          static_cast<uint32_t>(buf.size()), nullptr);
-      if (result != 0) {
-        utf16_to_utf8 utf8_message;
-        if (utf8_message.convert(system_message) == ERROR_SUCCESS) {
-          internal::writer w(out);
-          w.write(message);
-          w.write(": ");
-          w.write(utf8_message);
-          return;
-        }
-        break;
+    system_message msg(error_code);
+    if (msg) {
+      utf16_to_utf8 utf8_message;
+      if (utf8_message.convert(msg) == ERROR_SUCCESS) {
+        fmt::format_to(buffer_appender<char>(out), "{}: {}", message, utf8_message);
+        return;
       }
-      if (GetLastError() != ERROR_INSUFFICIENT_BUFFER)
-        break;  // Can't get error message, report error code instead.
-      buf.resize(buf.size() * 2);
     }
   }
   FMT_CATCH(...) {}
   format_error_code(out, error_code, message);
 }
 
-void report_windows_error(int error_code,
-                          fmt::string_view message) FMT_NOEXCEPT {
-  report_error(internal::format_windows_error, error_code, message);
+void report_windows_error(int error_code, const char* message) noexcept {
+  report_error(detail::format_windows_error, error_code, message);
 }
 #endif  // _WIN32
 
-buffered_file::~buffered_file() FMT_NOEXCEPT {
+buffered_file::~buffered_file() noexcept {
   if (file_ && FMT_SYSTEM(fclose(file_)) != 0)
     report_system_error(errno, "cannot close file");
 }
@@ -166,18 +202,19 @@ void buffered_file::close() {
   if (result != 0) FMT_THROW(system_error(errno, "cannot close file"));
 }
 
-// A macro used to prevent expansion of fileno on broken versions of MinGW.
-#define FMT_ARGS
-
-int buffered_file::fileno() const {
-  int fd = FMT_POSIX_CALL(fileno FMT_ARGS(file_));
+int buffered_file::descriptor() const {
+  int fd = FMT_POSIX_CALL(fileno(file_));
   if (fd == -1) FMT_THROW(system_error(errno, "cannot get file descriptor"));
   return fd;
 }
 
 #if FMT_USE_FCNTL
 file::file(cstring_view path, int oflag) {
-  int mode = S_IRUSR | S_IWUSR;
+#  ifdef _WIN32
+  using mode_t = int;
+#  endif
+  constexpr mode_t mode =
+      S_IRUSR | S_IWUSR | S_IRGRP | S_IWGRP | S_IROTH | S_IWOTH;
 #  if defined(_WIN32) && !defined(__MINGW32__)
   fd_ = -1;
   FMT_POSIX_CALL(sopen_s(&fd_, path.c_str(), oflag, _SH_DENYNO, mode));
@@ -188,7 +225,7 @@ file::file(cstring_view path, int oflag) {
     FMT_THROW(system_error(errno, "cannot open file {}", path.c_str()));
 }
 
-file::~file() FMT_NOEXCEPT {
+file::~file() noexcept {
   // Don't retry close in case of EINTR!
   // See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
   if (fd_ != -1 && FMT_POSIX_CALL(close(fd_)) != 0)
@@ -231,17 +268,17 @@ long long file::size() const {
 }
 
 std::size_t file::read(void* buffer, std::size_t count) {
-  RWResult result = 0;
+  rwresult result = 0;
   FMT_RETRY(result, FMT_POSIX_CALL(read(fd_, buffer, convert_rwcount(count))));
   if (result < 0) FMT_THROW(system_error(errno, "cannot read from file"));
-  return internal::to_unsigned(result);
+  return detail::to_unsigned(result);
 }
 
 std::size_t file::write(const void* buffer, std::size_t count) {
-  RWResult result = 0;
+  rwresult result = 0;
   FMT_RETRY(result, FMT_POSIX_CALL(write(fd_, buffer, convert_rwcount(count))));
   if (result < 0) FMT_THROW(system_error(errno, "cannot write to file"));
-  return internal::to_unsigned(result);
+  return detail::to_unsigned(result);
 }
 
 file file::dup(int fd) {
@@ -262,10 +299,10 @@ void file::dup2(int fd) {
   }
 }
 
-void file::dup2(int fd, error_code& ec) FMT_NOEXCEPT {
+void file::dup2(int fd, std::error_code& ec) noexcept {
   int result = 0;
   FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
-  if (result == -1) ec = error_code(errno);
+  if (result == -1) ec = std::error_code(errno, std::generic_category());
 }
 
 void file::pipe(file& read_end, file& write_end) {
@@ -291,8 +328,12 @@ void file::pipe(file& read_end, file& write_end) {
 }
 
 buffered_file file::fdopen(const char* mode) {
-  // Don't retry as fdopen doesn't return EINTR.
+// Don't retry as fdopen doesn't return EINTR.
+#  if defined(__MINGW32__) && defined(_POSIX_)
+  FILE* f = ::fdopen(fd_, mode);
+#  else
   FILE* f = FMT_POSIX_CALL(fdopen(fd_, mode));
+#  endif
   if (!f)
     FMT_THROW(
         system_error(errno, "cannot associate stream with file descriptor"));
@@ -312,5 +353,9 @@ long getpagesize() {
   return size;
 #  endif
 }
+
+FMT_API void ostream::grow(size_t) {
+  if (this->size() == this->capacity()) flush();
+}
 #endif  // FMT_USE_FCNTL
 FMT_END_NAMESPACE

externals/fmt/support/README

@@ -2,5 +2,3 @@ This directory contains build support files such as
 
 * CMake modules
 * Build scripts
-* qmake (static build with dynamic libc only)
-

externals/fmt/support/Vagrantfile

@@ -4,6 +4,7 @@
 # A vagrant config for testing against gcc-4.8.
 Vagrant.configure("2") do |config|
   config.vm.box = "ubuntu/xenial64"
+  config.disksize.size = '15GB'
 
   config.vm.provider "virtualbox" do |vb|
     vb.memory = "4096"

externals/fmt/support/appveyor-build.py

@@ -1,43 +0,0 @@
-#!/usr/bin/env python
-# Build the project on AppVeyor.
-
-import os
-from subprocess import check_call
-
-build = os.environ['BUILD']
-config = os.environ['CONFIGURATION']
-platform = os.environ['PLATFORM']
-path = os.environ['PATH']
-image = os.environ['APPVEYOR_BUILD_WORKER_IMAGE']
-jobid = os.environ['APPVEYOR_JOB_ID']
-cmake_command = ['cmake', '-DFMT_PEDANTIC=ON', '-DCMAKE_BUILD_TYPE=' + config, '..']
-if build == 'mingw':
-    cmake_command.append('-GMinGW Makefiles')
-    build_command = ['mingw32-make', '-j4']
-    test_command = ['mingw32-make', 'test']
-    # Remove the path to Git bin directory from $PATH because it breaks
-    # MinGW config.
-    path = path.replace(r'C:\Program Files (x86)\Git\bin', '')
-    os.environ['PATH'] = r'C:\MinGW\bin;' + path
-else:
-    # Add MSBuild 14.0 to PATH as described in
-    # http://help.appveyor.com/discussions/problems/2229-v140-not-found-on-vs2105rc.
-    os.environ['PATH'] = r'C:\Program Files (x86)\MSBuild\15.0\Bin;' + path
-    if image == 'Visual Studio 2019':
-        generator = 'Visual Studio 16 2019'
-        if platform == 'x64':
-            cmake_command.extend(['-A', 'x64'])
-    else:
-        if image == 'Visual Studio 2015':
-            generator = 'Visual Studio 14 2015'
-        elif image == 'Visual Studio 2017':
-            generator = 'Visual Studio 15 2017'
-        if platform == 'x64':
-            generator += ' Win64'
-    cmake_command.append('-G' + generator)
-    build_command = ['cmake', '--build', '.', '--config', config, '--', '/m:4']
-    test_command = ['ctest', '-C', config]
-
-check_call(cmake_command)
-check_call(build_command)
-check_call(test_command)

externals/fmt/support/appveyor.yml

@@ -1,41 +0,0 @@
-configuration:
-  - Debug
-  - Release
-
-clone_depth: 1
-
-image:
-  - Visual Studio 2015
-  - Visual Studio 2019
-  - Visual Studio 2017
-
-platform:
-  - Win32
-  - x64
-
-environment:
-  CTEST_OUTPUT_ON_FAILURE: 1
-  MSVC_DEFAULT_OPTIONS: ON
-  BUILD: msvc
-
-matrix:
-  exclude:
-    - image: Visual Studio 2015
-      platform: Win32
-    - image: Visual Studio 2019
-      platform: Win32
-
-before_build:
- - mkdir build
- - cd build
-
-build_script:
-  - python ../support/appveyor-build.py
-
-on_failure:
-  - appveyor PushArtifact Testing/Temporary/LastTest.log
-  - appveyor AddTest test
-
-# Uncomment this to debug AppVeyor failures.
-#on_finish:
-#  - ps: $blockRdp = $true; iex ((new-object net.webclient).DownloadString('https://raw.githubusercontent.com/appveyor/ci/master/scripts/enable-rdp.ps1'))

externals/fmt/support/bazel/.bazelrc

@@ -0,0 +1 @@
+build --symlink_prefix=/ # Out of source build

externals/fmt/support/bazel/.bazelversion

@@ -0,0 +1 @@
+5.1.1

externals/fmt/support/bazel/BUILD.bazel

@@ -0,0 +1,28 @@
+cc_library(
+    name = "fmt",
+    srcs = [
+        #"src/fmt.cc", # No C++ module support
+        "src/format.cc",
+        "src/os.cc",
+    ],
+    hdrs = [
+        "include/fmt/args.h",
+        "include/fmt/chrono.h",
+        "include/fmt/color.h",
+        "include/fmt/compile.h",
+        "include/fmt/core.h",
+        "include/fmt/format-inl.h",
+        "include/fmt/format.h",
+        "include/fmt/os.h",
+        "include/fmt/ostream.h",
+        "include/fmt/printf.h",
+        "include/fmt/ranges.h",
+        "include/fmt/std.h",
+        "include/fmt/xchar.h",
+    ],
+    includes = [
+        "include",        
+    ],
+    strip_include_prefix = "include",
+    visibility = ["//visibility:public"],
+)

externals/fmt/support/bazel/README.md

@@ -0,0 +1,73 @@
+# Bazel support
+
+To get [Bazel](https://bazel.build/) working with {fmt} you can copy the files `BUILD.bazel`, `WORKSPACE.bazel`, `.bazelrc`, and `.bazelversion` from this folder (`support/bazel`) to the root folder of this project. This way {fmt} gets bazelized and can be used with Bazel (e.g. doing a `bazel build //...` on {fmt}). 
+
+## Using {fmt} as a dependency
+
+The following minimal example shows how to use {fmt} as a dependency within a Bazel project.
+
+The following file structure is assumed:
+
+```
+example
+├── BUILD.bazel
+├── main.cpp
+└── WORKSPACE.bazel
+```
+
+*main.cpp*:
+
+```c++
+#include "fmt/core.h"
+
+int main() {
+  fmt::print("The answer is {}\n", 42);
+}
+```
+
+The expected output of this example is `The answer is 42`.
+
+*WORKSPACE.bazel*:
+
+```python
+load("@bazel_tools//tools/build_defs/repo:git.bzl", "git_repository")
+
+git_repository(
+    name = "fmt",
+    branch = "master",
+    remote = "https://github.com/fmtlib/fmt",
+    patch_cmds = [
+        "mv support/bazel/.bazelrc .bazelrc",
+        "mv support/bazel/.bazelversion .bazelversion",
+        "mv support/bazel/BUILD.bazel BUILD.bazel",
+        "mv support/bazel/WORKSPACE.bazel WORKSPACE.bazel",
+    ],
+    # Windows-related patch commands are only needed in the case MSYS2 is not installed.
+    # More details about the installation process of MSYS2 on Windows systems can be found here:
+    # https://docs.bazel.build/versions/main/install-windows.html#installing-compilers-and-language-runtimes
+    # Even if MSYS2 is installed the Windows related patch commands can still be used.
+    patch_cmds_win = [
+        "Move-Item -Path support/bazel/.bazelrc -Destination .bazelrc",
+        "Move-Item -Path support/bazel/.bazelversion -Destination .bazelversion",
+        "Move-Item -Path support/bazel/BUILD.bazel -Destination BUILD.bazel",
+        "Move-Item -Path support/bazel/WORKSPACE.bazel -Destination WORKSPACE.bazel",
+    ],
+)
+```
+
+In the *WORKSPACE* file, the {fmt} GitHub repository is fetched. Using the attribute `patch_cmds` the  files `BUILD.bazel`, `WORKSPACE.bazel`, `.bazelrc`, and `.bazelversion` are moved to the root of the {fmt} repository. This way the {fmt} repository is recognized as a bazelized workspace. 
+
+*BUILD.bazel*:
+
+```python
+cc_binary(
+    name = "Demo",
+    srcs = ["main.cpp"],
+    deps = ["@fmt"],
+)
+```
+
+The *BUILD* file defines a binary named `Demo` that has a dependency to {fmt}.
+
+To execute the binary you can run `bazel run //:Demo`.
+

externals/fmt/support/bazel/WORKSPACE.bazel

@@ -0,0 +1 @@
+workspace(name = "fmt")

externals/fmt/support/build-docs.py

@@ -0,0 +1,58 @@
+#!/usr/bin/env python
+# Build the documentation in CI.
+
+from __future__ import print_function
+import errno, os, shutil, subprocess, sys, urllib
+from subprocess import call, check_call, Popen, PIPE, STDOUT
+
+def rmtree_if_exists(dir):
+    try:
+        shutil.rmtree(dir)
+    except OSError as e:
+        if e.errno == errno.ENOENT:
+            pass
+
+# Build the docs.
+fmt_dir = os.path.dirname(os.path.dirname(os.path.realpath(__file__)))
+sys.path.insert(0, os.path.join(fmt_dir, 'doc'))
+import build
+build.create_build_env()
+html_dir = build.build_docs()
+
+repo = 'fmtlib.github.io'
+branch = os.environ['GITHUB_REF']
+is_ci = 'CI' in os.environ
+if is_ci and branch != 'refs/heads/master':
+    print('Branch: ' + branch)
+    exit(0) # Ignore non-master branches
+if is_ci and 'KEY' not in os.environ:
+    # Don't update the repo if building in CI from an account that doesn't have
+    # push access.
+    print('Skipping update of ' + repo)
+    exit(0)
+
+# Clone the fmtlib.github.io repo.
+rmtree_if_exists(repo)
+git_url = 'https://github.com/' if is_ci else 'git@github.com:'
+check_call(['git', 'clone', git_url + 'fmtlib/{}.git'.format(repo)])
+
+# Copy docs to the repo.
+target_dir = os.path.join(repo, 'dev')
+rmtree_if_exists(target_dir)
+shutil.copytree(html_dir, target_dir, ignore=shutil.ignore_patterns('.*'))
+if is_ci:
+    check_call(['git', 'config', '--global', 'user.name', 'fmtbot'])
+    check_call(['git', 'config', '--global', 'user.email', 'viz@fmt.dev'])
+
+# Push docs to GitHub pages.
+check_call(['git', 'add', '--all'], cwd=repo)
+if call(['git', 'diff-index', '--quiet', 'HEAD'], cwd=repo):
+    check_call(['git', 'commit', '-m', 'Update documentation'], cwd=repo)
+    cmd = 'git push'
+    if is_ci:
+        cmd += ' https://$KEY@github.com/fmtlib/fmtlib.github.io.git master'
+    p = Popen(cmd, shell=True, stdout=PIPE, stderr=STDOUT, cwd=repo)
+    # Print the output without the key.
+    print(p.communicate()[0].decode('utf-8').replace(os.environ['KEY'], '$KEY'))
+    if p.returncode != 0:
+        raise subprocess.CalledProcessError(p.returncode, cmd)

externals/fmt/support/build.gradle

@@ -1,3 +1,4 @@
+import java.nio.file.Paths
 
 // General gradle arguments for root project
 buildscript {    
@@ -7,24 +8,25 @@ buildscript {
     }
     dependencies {
         //
-        // https://developer.android.com/studio/releases/gradle-plugin
+        // https://developer.android.com/studio/releases/gradle-plugin#updating-gradle
         //
-        // Notice that 3.3.0 here is the version of [Android Gradle Plugin]
-        // Accroding to URL above you will need Gradle 5.0 or higher
+        // Notice that 4.0.0 here is the version of [Android Gradle Plugin]
+        // Accroding to URL above you will need Gradle 6.1 or higher
         //
-        // If you are using Android Studio, and it is using Gradle's lower 
-        // version, Use the plugin version 3.1.3 ~ 3.2.0 for Gradle 4.4 ~ 4.10
-        classpath 'com.android.tools.build:gradle:3.3.0'
+        classpath "com.android.tools.build:gradle:4.1.1"
     }
 }
 repositories {
     google()
     jcenter()
 }
-    
-// Output: Shared library (.so) for Android 
-apply plugin: 'com.android.library'
 
+// Project's root where CMakeLists.txt exists: rootDir/support/.cxx -> rootDir
+def rootDir = Paths.get(project.buildDir.getParent()).getParent()
+println("rootDir: ${rootDir}")
+
+// Output: Shared library (.so) for Android 
+apply plugin: "com.android.library"
 android {
     compileSdkVersion 25    // Android 7.0
 
@@ -41,13 +43,13 @@ android {
             include  "arm64-v8a", "armeabi-v7a", "x86_64"
         }
     }
+    ndkVersion "21.3.6528147" // ANDROID_NDK_HOME is deprecated. Be explicit
 
     defaultConfig {
         minSdkVersion 21    // Android 5.0+
         targetSdkVersion 25 // Follow Compile SDK
-        versionCode 21      // Follow release count
-        versionName "5.3.0" // Follow Official version
-        testInstrumentationRunner "android.support.test.runner.AndroidJUnitRunner"
+        versionCode 34      // Follow release count
+        versionName "7.1.2" // Follow Official version
         
         externalNativeBuild {
             cmake {
@@ -56,9 +58,9 @@ android {
                 arguments "-DFMT_TEST=false"            // Skip test
                 arguments "-DFMT_DOC=false"             // Skip document
                 cppFlags  "-std=c++17"
+                targets   "fmt"
             }
         }
-        println("Gradle CMake Plugin: ")
         println(externalNativeBuild.cmake.cppFlags)
         println(externalNativeBuild.cmake.arguments)
     }
@@ -69,16 +71,27 @@ android {
     //    neighbor of the top level cmake
     externalNativeBuild {
         cmake {
-            path "../CMakeLists.txt"
+            version "3.10.0+"
+            path "${rootDir}/CMakeLists.txt"
             // buildStagingDirectory "./build"  // Custom path for cmake output
         }
-        //println(cmake.path)
     }
     
     sourceSets{
         // Android Manifest for Gradle
         main {
-            manifest.srcFile 'AndroidManifest.xml'
+            manifest.srcFile "AndroidManifest.xml"
+        }
+    }
+
+    // https://developer.android.com/studio/build/native-dependencies#build_system_configuration
+    buildFeatures {
+        prefab true
+        prefabPublishing true
+    }
+    prefab {
+        fmt {
+            headers "${rootDir}/include"
         }
     }
 }
@@ -88,20 +101,32 @@ assemble.doLast
     // Instead of `ninja install`, Gradle will deploy the files.
     // We are doing this since FMT is dependent to the ANDROID_STL after build
     copy {
-        from 'build/intermediates/cmake'
-        into '../libs'
+        from "build/intermediates/cmake"
+        into "${rootDir}/libs"
     }
     // Copy debug binaries
     copy {
-        from '../libs/debug/obj'
-        into '../libs/debug'
+        from "${rootDir}/libs/debug/obj"
+        into "${rootDir}/libs/debug"
     }
     // Copy Release binaries
     copy {
-        from '../libs/release/obj'
-        into '../libs/release'
+        from "${rootDir}/libs/release/obj"
+        into "${rootDir}/libs/release"
     }
     // Remove empty directory
-    delete '../libs/debug/obj'
-    delete '../libs/release/obj'
+    delete "${rootDir}/libs/debug/obj"
+    delete "${rootDir}/libs/release/obj"
+
+    // Copy AAR files. Notice that the aar is named after the folder of this script.
+    copy {
+        from "build/outputs/aar/support-release.aar"
+        into "${rootDir}/libs"
+        rename "support-release.aar", "fmt-release.aar"
+    }
+    copy {
+        from "build/outputs/aar/support-debug.aar"
+        into "${rootDir}/libs"
+        rename "support-debug.aar", "fmt-debug.aar"
+    }
 }

externals/fmt/support/cmake/JoinPaths.cmake

@@ -0,0 +1,26 @@
+# This module provides function for joining paths
+# known from from most languages
+#
+# Original license:
+# SPDX-License-Identifier: (MIT OR CC0-1.0)
+# Explicit permission given to distribute this module under
+# the terms of the project as described in /LICENSE.rst.
+# Copyright 2020 Jan Tojnar
+# https://github.com/jtojnar/cmake-snips
+#
+# Modelled after Python’s os.path.join
+# https://docs.python.org/3.7/library/os.path.html#os.path.join
+# Windows not supported
+function(join_paths joined_path first_path_segment)
+    set(temp_path "${first_path_segment}")
+    foreach(current_segment IN LISTS ARGN)
+        if(NOT ("${current_segment}" STREQUAL ""))
+            if(IS_ABSOLUTE "${current_segment}")
+                set(temp_path "${current_segment}")
+            else()
+                set(temp_path "${temp_path}/${current_segment}")
+            endif()
+        endif()
+    endforeach()
+    set(${joined_path} "${temp_path}" PARENT_SCOPE)
+endfunction()

externals/fmt/support/cmake/cxx14.cmake

@@ -1,7 +1,11 @@
 # C++14 feature support detection
 
-include(CheckCXXSourceCompiles)
 include(CheckCXXCompilerFlag)
+function (fmt_check_cxx_compiler_flag flag result)
+  if (NOT MSVC)
+    check_cxx_compiler_flag("${flag}" ${result})
+  endif ()
+endfunction ()
 
 if (NOT CMAKE_CXX_STANDARD)
   set(CMAKE_CXX_STANDARD 11)
@@ -9,35 +13,38 @@ endif()
 message(STATUS "CXX_STANDARD: ${CMAKE_CXX_STANDARD}")
 
 if (CMAKE_CXX_STANDARD EQUAL 20)
-  check_cxx_compiler_flag(-std=c++20 has_std_20_flag)
-  check_cxx_compiler_flag(-std=c++2a has_std_2a_flag)
+  fmt_check_cxx_compiler_flag(-std=c++20 has_std_20_flag)
+  fmt_check_cxx_compiler_flag(-std=c++2a has_std_2a_flag)
 
   if (has_std_20_flag)
     set(CXX_STANDARD_FLAG -std=c++20)
   elseif (has_std_2a_flag)
     set(CXX_STANDARD_FLAG -std=c++2a)
   endif ()
+
 elseif (CMAKE_CXX_STANDARD EQUAL 17)
-  check_cxx_compiler_flag(-std=c++17 has_std_17_flag)
-  check_cxx_compiler_flag(-std=c++1z has_std_1z_flag)
+  fmt_check_cxx_compiler_flag(-std=c++17 has_std_17_flag)
+  fmt_check_cxx_compiler_flag(-std=c++1z has_std_1z_flag)
 
   if (has_std_17_flag)
     set(CXX_STANDARD_FLAG -std=c++17)
   elseif (has_std_1z_flag)
     set(CXX_STANDARD_FLAG -std=c++1z)
   endif ()
+
 elseif (CMAKE_CXX_STANDARD EQUAL 14)
-  check_cxx_compiler_flag(-std=c++14 has_std_14_flag)
-  check_cxx_compiler_flag(-std=c++1y has_std_1y_flag)
+  fmt_check_cxx_compiler_flag(-std=c++14 has_std_14_flag)
+  fmt_check_cxx_compiler_flag(-std=c++1y has_std_1y_flag)
 
   if (has_std_14_flag)
     set(CXX_STANDARD_FLAG -std=c++14)
   elseif (has_std_1y_flag)
     set(CXX_STANDARD_FLAG -std=c++1y)
   endif ()
+
 elseif (CMAKE_CXX_STANDARD EQUAL 11)
-  check_cxx_compiler_flag(-std=c++11 has_std_11_flag)
-  check_cxx_compiler_flag(-std=c++0x has_std_0x_flag)
+  fmt_check_cxx_compiler_flag(-std=c++11 has_std_11_flag)
+  fmt_check_cxx_compiler_flag(-std=c++0x has_std_0x_flag)
 
   if (has_std_11_flag)
     set(CXX_STANDARD_FLAG -std=c++11)
@@ -45,26 +52,3 @@ elseif (CMAKE_CXX_STANDARD EQUAL 11)
     set(CXX_STANDARD_FLAG -std=c++0x)
   endif ()
 endif ()
-
-set(CMAKE_REQUIRED_FLAGS ${CXX_STANDARD_FLAG})
-
-# Check if user-defined literals are available
-check_cxx_source_compiles("
-  void operator\"\" _udl(long double);
-  int main() {}"
-  SUPPORTS_USER_DEFINED_LITERALS)
-if (NOT SUPPORTS_USER_DEFINED_LITERALS)
-  set (SUPPORTS_USER_DEFINED_LITERALS OFF)
-endif ()
-
-# Check if <variant> is available
-set(CMAKE_REQUIRED_FLAGS -std=c++1z)
-check_cxx_source_compiles("
-  #include <variant>
-  int main() {}"
-  FMT_HAS_VARIANT)
-if (NOT FMT_HAS_VARIANT)
-  set (FMT_HAS_VARIANT OFF)
-endif ()
-
-set(CMAKE_REQUIRED_FLAGS )

externals/fmt/support/cmake/fmt-config.cmake.in

@@ -1,4 +1,7 @@
 @PACKAGE_INIT@
 
-include(${CMAKE_CURRENT_LIST_DIR}/@targets_export_name@.cmake)
+if (NOT TARGET fmt::fmt)
+  include(${CMAKE_CURRENT_LIST_DIR}/@targets_export_name@.cmake)
+endif ()
+
 check_required_components(fmt)

externals/fmt/support/cmake/fmt.pc.in

@@ -1,7 +1,7 @@
 prefix=@CMAKE_INSTALL_PREFIX@
 exec_prefix=@CMAKE_INSTALL_PREFIX@
-libdir=${exec_prefix}/@CMAKE_INSTALL_LIBDIR@
-includedir=${prefix}/@CMAKE_INSTALL_INCLUDEDIR@
+libdir=@libdir_for_pc_file@
+includedir=@includedir_for_pc_file@
 
 Name: fmt
 Description: A modern formatting library

externals/fmt/support/fmt.pro

@@ -1,27 +0,0 @@
-# Staticlib configuration for qmake builds
-# For some reason qmake 3.1 fails to identify source dependencies and excludes format.cc and printf.cc
-# from compilation so it _MUST_ be called as qmake -nodepend
-# A workaround is implemented below: a custom compiler is defined which does not track dependencies
-
-TEMPLATE = lib
-
-TARGET = fmt
-
-QMAKE_EXT_CPP = .cc
-
-CONFIG = staticlib warn_on c++11
-
-FMT_SOURCES = \
-    ../src/format.cc \
-    ../src/posix.cc
-
-fmt.name = libfmt
-fmt.input = FMT_SOURCES
-fmt.output = ${QMAKE_FILE_BASE}$$QMAKE_EXT_OBJ
-fmt.clean = ${QMAKE_FILE_BASE}$$QMAKE_EXT_OBJ
-fmt.depends = ${QMAKE_FILE_IN}
-# QMAKE_RUN_CXX will not be expanded
-fmt.commands = $$QMAKE_CXX -c $$QMAKE_CXXFLAGS $$QMAKE_CXXFLAGS_WARN_ON $$QMAKE_CXXFLAGS_RELEASE_WITH_DEBUGINFO $$QMAKE_CXXFLAGS_CXX11 ${QMAKE_FILE_IN}
-fmt.variable_out = OBJECTS
-fmt.CONFIG = no_dependencies no_link
-QMAKE_EXTRA_COMPILERS += fmt

externals/fmt/support/manage.py

@@ -1,4 +1,4 @@
-#!/usr/bin/env python
+#!/usr/bin/env python3
 
 """Manage site and releases.
 
@@ -144,14 +144,51 @@ def update_site(env):
                 b.data = re.sub(pattern, r'doxygenfunction:: \1(int)', b.data)
                 b.data = b.data.replace('std::FILE*', 'std::FILE *')
                 b.data = b.data.replace('unsigned int', 'unsigned')
-                b.data = b.data.replace('operator""_', 'operator"" _')
-                b.data = b.data.replace(', size_t', ', std::size_t')
+                #b.data = b.data.replace('operator""_', 'operator"" _')
+                b.data = b.data.replace(
+                    'format_to_n(OutputIt, size_t, string_view, Args&&',
+                    'format_to_n(OutputIt, size_t, const S&, const Args&')
+                b.data = b.data.replace(
+                    'format_to_n(OutputIt, std::size_t, string_view, Args&&',
+                    'format_to_n(OutputIt, std::size_t, const S&, const Args&')
+                if version == ('3.0.2'):
+                    b.data = b.data.replace(
+                        'fprintf(std::ostream&', 'fprintf(std::ostream &')
+                if version == ('5.3.0'):
+                    b.data = b.data.replace(
+                        'format_to(OutputIt, const S&, const Args&...)',
+                        'format_to(OutputIt, const S &, const Args &...)')
+                if version.startswith('5.') or version.startswith('6.'):
+                    b.data = b.data.replace(', size_t', ', std::size_t')
+                if version.startswith('7.'):
+                    b.data = b.data.replace(', std::size_t', ', size_t')
+                    b.data = b.data.replace('join(It, It', 'join(It, Sentinel')
+                if version.startswith('7.1.'):
+                    b.data = b.data.replace(', std::size_t', ', size_t')
+                    b.data = b.data.replace('join(It, It', 'join(It, Sentinel')
+                    b.data = b.data.replace(
+                        'fmt::format_to(OutputIt, const S&, Args&&...)',
+                        'fmt::format_to(OutputIt, const S&, Args&&...) -> ' +
+                        'typename std::enable_if<enable, OutputIt>::type')
                 b.data = b.data.replace('aa long', 'a long')
+                b.data = b.data.replace('serveral', 'several')
+                if version.startswith('6.2.'):
+                    b.data = b.data.replace(
+                        'vformat(const S&, basic_format_args<' +
+                        'buffer_context<Char>>)',
+                        'vformat(const S&, basic_format_args<' +
+                        'buffer_context<type_identity_t<Char>>>)')
         # Fix a broken link in index.rst.
         index = os.path.join(target_doc_dir, 'index.rst')
         with rewrite(index) as b:
             b.data = b.data.replace(
                 'doc/latest/index.html#format-string-syntax', 'syntax.html')
+        # Fix issues in syntax.rst.
+        index = os.path.join(target_doc_dir, 'syntax.rst')
+        with rewrite(index) as b:
+            b.data = b.data.replace(
+                '..productionlist:: sf\n', '.. productionlist:: sf\n ')
+            b.data = b.data.replace('Examples:\n', 'Examples::\n')
         # Build the docs.
         html_dir = os.path.join(env.build_dir, 'html')
         if os.path.exists(html_dir):
@@ -209,7 +246,7 @@ def release(args):
     # Update the version in the changelog.
     title_len = 0
     for line in fileinput.input(changelog_path, inplace=True):
-        if line.decode('utf-8').startswith(version + ' - TBD'):
+        if line.startswith(version + ' - TBD'):
             line = version + ' - ' + datetime.date.today().isoformat()
             title_len = len(line)
             line += '\n'
@@ -239,9 +276,9 @@ def release(args):
 
     # Create a release on GitHub.
     fmt_repo.push('origin', 'release')
-    params = {'access_token': os.getenv('FMT_TOKEN')}
+    auth_headers = {'Authorization': 'token ' + os.getenv('FMT_TOKEN')}
     r = requests.post('https://api.github.com/repos/fmtlib/fmt/releases',
-                      params=params,
+                      headers=auth_headers,
                       data=json.dumps({'tag_name': version,
                                        'target_commitish': 'release',
                                        'body': changes, 'draft': True}))
@@ -252,8 +289,8 @@ def release(args):
     package = 'fmt-{}.zip'.format(version)
     r = requests.post(
         '{}/{}/assets?name={}'.format(uploads_url, id, package),
-        headers={'Content-Type': 'application/zip'},
-        params=params, data=open('build/fmt/' + package, 'rb'))
+        headers={'Content-Type': 'application/zip'} | auth_headers,
+        data=open('build/fmt/' + package, 'rb'))
     if r.status_code != 201:
         raise Exception('Failed to upload an asset ' + str(r))
 

externals/fmt/support/printable.py

@@ -0,0 +1,201 @@
+#!/usr/bin/env python3
+
+# This script is based on
+# https://github.com/rust-lang/rust/blob/master/library/core/src/unicode/printable.py
+# distributed under https://github.com/rust-lang/rust/blob/master/LICENSE-MIT.
+
+# This script uses the following Unicode tables:
+# - UnicodeData.txt
+
+
+from collections import namedtuple
+import csv
+import os
+import subprocess
+
+NUM_CODEPOINTS=0x110000
+
+def to_ranges(iter):
+    current = None
+    for i in iter:
+        if current is None or i != current[1] or i in (0x10000, 0x20000):
+            if current is not None:
+                yield tuple(current)
+            current = [i, i + 1]
+        else:
+            current[1] += 1
+    if current is not None:
+        yield tuple(current)
+
+def get_escaped(codepoints):
+    for c in codepoints:
+        if (c.class_ or "Cn") in "Cc Cf Cs Co Cn Zl Zp Zs".split() and c.value != ord(' '):
+            yield c.value
+
+def get_file(f):
+    try:
+        return open(os.path.basename(f))
+    except FileNotFoundError:
+        subprocess.run(["curl", "-O", f], check=True)
+        return open(os.path.basename(f))
+
+Codepoint = namedtuple('Codepoint', 'value class_')
+
+def get_codepoints(f):
+    r = csv.reader(f, delimiter=";")
+    prev_codepoint = 0
+    class_first = None
+    for row in r:
+        codepoint = int(row[0], 16)
+        name = row[1]
+        class_ = row[2]
+
+        if class_first is not None:
+            if not name.endswith("Last>"):
+                raise ValueError("Missing Last after First")
+
+        for c in range(prev_codepoint + 1, codepoint):
+            yield Codepoint(c, class_first)
+
+        class_first = None
+        if name.endswith("First>"):
+            class_first = class_
+
+        yield Codepoint(codepoint, class_)
+        prev_codepoint = codepoint
+
+    if class_first is not None:
+        raise ValueError("Missing Last after First")
+
+    for c in range(prev_codepoint + 1, NUM_CODEPOINTS):
+        yield Codepoint(c, None)
+
+def compress_singletons(singletons):
+    uppers = [] # (upper, # items in lowers)
+    lowers = []
+
+    for i in singletons:
+        upper = i >> 8
+        lower = i & 0xff
+        if len(uppers) == 0 or uppers[-1][0] != upper:
+            uppers.append((upper, 1))
+        else:
+            upper, count = uppers[-1]
+            uppers[-1] = upper, count + 1
+        lowers.append(lower)
+
+    return uppers, lowers
+
+def compress_normal(normal):
+    # lengths 0x00..0x7f are encoded as 00, 01, ..., 7e, 7f
+    # lengths 0x80..0x7fff are encoded as 80 80, 80 81, ..., ff fe, ff ff
+    compressed = [] # [truelen, (truelenaux), falselen, (falselenaux)]
+
+    prev_start = 0
+    for start, count in normal:
+        truelen = start - prev_start
+        falselen = count
+        prev_start = start + count
+
+        assert truelen < 0x8000 and falselen < 0x8000
+        entry = []
+        if truelen > 0x7f:
+            entry.append(0x80 | (truelen >> 8))
+            entry.append(truelen & 0xff)
+        else:
+            entry.append(truelen & 0x7f)
+        if falselen > 0x7f:
+            entry.append(0x80 | (falselen >> 8))
+            entry.append(falselen & 0xff)
+        else:
+            entry.append(falselen & 0x7f)
+
+        compressed.append(entry)
+
+    return compressed
+
+def print_singletons(uppers, lowers, uppersname, lowersname):
+    print("  static constexpr singleton {}[] = {{".format(uppersname))
+    for u, c in uppers:
+        print("    {{{:#04x}, {}}},".format(u, c))
+    print("  };")
+    print("  static constexpr unsigned char {}[] = {{".format(lowersname))
+    for i in range(0, len(lowers), 8):
+        print("    {}".format(" ".join("{:#04x},".format(l) for l in lowers[i:i+8])))
+    print("  };")
+
+def print_normal(normal, normalname):
+    print("  static constexpr unsigned char {}[] = {{".format(normalname))
+    for v in normal:
+        print("    {}".format(" ".join("{:#04x},".format(i) for i in v)))
+    print("  };")
+
+def main():
+    file = get_file("https://www.unicode.org/Public/UNIDATA/UnicodeData.txt")
+
+    codepoints = get_codepoints(file)
+
+    CUTOFF=0x10000
+    singletons0 = []
+    singletons1 = []
+    normal0 = []
+    normal1 = []
+    extra = []
+
+    for a, b in to_ranges(get_escaped(codepoints)):
+        if a > 2 * CUTOFF:
+            extra.append((a, b - a))
+        elif a == b - 1:
+            if a & CUTOFF:
+                singletons1.append(a & ~CUTOFF)
+            else:
+                singletons0.append(a)
+        elif a == b - 2:
+            if a & CUTOFF:
+                singletons1.append(a & ~CUTOFF)
+                singletons1.append((a + 1) & ~CUTOFF)
+            else:
+                singletons0.append(a)
+                singletons0.append(a + 1)
+        else:
+            if a >= 2 * CUTOFF:
+                extra.append((a, b - a))
+            elif a & CUTOFF:
+                normal1.append((a & ~CUTOFF, b - a))
+            else:
+                normal0.append((a, b - a))
+
+    singletons0u, singletons0l = compress_singletons(singletons0)
+    singletons1u, singletons1l = compress_singletons(singletons1)
+    normal0 = compress_normal(normal0)
+    normal1 = compress_normal(normal1)
+
+    print("""\
+FMT_FUNC auto is_printable(uint32_t cp) -> bool {\
+""")
+    print_singletons(singletons0u, singletons0l, 'singletons0', 'singletons0_lower')
+    print_singletons(singletons1u, singletons1l, 'singletons1', 'singletons1_lower')
+    print_normal(normal0, 'normal0')
+    print_normal(normal1, 'normal1')
+    print("""\
+  auto lower = static_cast<uint16_t>(cp);
+  if (cp < 0x10000) {
+    return is_printable(lower, singletons0,
+                        sizeof(singletons0) / sizeof(*singletons0),
+                        singletons0_lower, normal0, sizeof(normal0));
+  }
+  if (cp < 0x20000) {
+    return is_printable(lower, singletons1,
+                        sizeof(singletons1) / sizeof(*singletons1),
+                        singletons1_lower, normal1, sizeof(normal1));
+  }\
+""")
+    for a, b in extra:
+        print("  if (0x{:x} <= cp && cp < 0x{:x}) return false;".format(a, a + b))
+    print("""\
+  return cp < 0x{:x};
+}}\
+""".format(NUM_CODEPOINTS))
+
+if __name__ == '__main__':
+    main()

externals/fmt/support/rst2md.py

@@ -65,7 +65,7 @@ class Translator(nodes.NodeVisitor):
         self.write('\n\n')
 
     def visit_paragraph(self, node):
-        pass
+        self.write('\n\n')
 
     def depart_paragraph(self, node):
         pass

externals/fmt/support/travis-build.py

@@ -1,119 +0,0 @@
-#!/usr/bin/env python
-# Build the project on Travis CI.
-
-from __future__ import print_function
-import errno, os, shutil, subprocess, sys, urllib
-from subprocess import call, check_call, Popen, PIPE, STDOUT
-
-def rmtree_if_exists(dir):
-    try:
-        shutil.rmtree(dir)
-    except OSError as e:
-        if e.errno == errno.ENOENT:
-            pass
-
-def makedirs_if_not_exist(dir):
-    try:
-        os.makedirs(dir)
-    except OSError as e:
-        if e.errno != errno.EEXIST:
-            raise
-
-def install_dependencies():
-    branch = os.environ['TRAVIS_BRANCH']
-    if branch != 'master':
-        print('Branch: ' + branch)
-        exit(0) # Ignore non-master branches
-    check_call('curl -s https://deb.nodesource.com/gpgkey/nodesource.gpg.key ' +
-               '| sudo apt-key add -', shell=True)
-    check_call('echo "deb https://deb.nodesource.com/node_0.10 precise main" ' +
-               '| sudo tee /etc/apt/sources.list.d/nodesource.list', shell=True)
-    check_call(['sudo', 'apt-get', 'update'])
-    check_call(['sudo', 'apt-get', 'install', 'python-virtualenv', 'nodejs'])
-    check_call(['sudo', 'npm', 'install', '-g', 'less@2.6.1', 'less-plugin-clean-css'])
-    deb_file = 'doxygen_1.8.6-2_amd64.deb'
-    urllib.urlretrieve('http://mirrors.kernel.org/ubuntu/pool/main/d/doxygen/' +
-                       deb_file, deb_file)
-    check_call(['sudo', 'dpkg', '-i', deb_file])
-
-fmt_dir = os.path.dirname(os.path.dirname(os.path.realpath(__file__)))
-
-build = os.environ['BUILD']
-if build == 'Doc':
-    travis = 'TRAVIS' in os.environ
-    if travis:
-        install_dependencies()
-    sys.path.insert(0, os.path.join(fmt_dir, 'doc'))
-    import build
-    build.create_build_env()
-    html_dir = build.build_docs()
-    repo = 'fmtlib.github.io'
-    if travis and 'KEY' not in os.environ:
-        # Don't update the repo if building on Travis from an account that
-        # doesn't have push access.
-        print('Skipping update of ' + repo)
-        exit(0)
-    # Clone the fmtlib.github.io repo.
-    rmtree_if_exists(repo)
-    git_url = 'https://github.com/' if travis else 'git@github.com:'
-    check_call(['git', 'clone', git_url + 'fmtlib/{}.git'.format(repo)])
-    # Copy docs to the repo.
-    target_dir = os.path.join(repo, 'dev')
-    rmtree_if_exists(target_dir)
-    shutil.copytree(html_dir, target_dir, ignore=shutil.ignore_patterns('.*'))
-    if travis:
-        check_call(['git', 'config', '--global', 'user.name', 'amplbot'])
-        check_call(['git', 'config', '--global', 'user.email', 'viz@ampl.com'])
-    # Push docs to GitHub pages.
-    check_call(['git', 'add', '--all'], cwd=repo)
-    if call(['git', 'diff-index', '--quiet', 'HEAD'], cwd=repo):
-        check_call(['git', 'commit', '-m', 'Update documentation'], cwd=repo)
-        cmd = 'git push'
-        if travis:
-            cmd += ' https://$KEY@github.com/fmtlib/fmtlib.github.io.git master'
-        p = Popen(cmd, shell=True, stdout=PIPE, stderr=STDOUT, cwd=repo)
-        # Print the output without the key.
-        print(p.communicate()[0].replace(os.environ['KEY'], '$KEY'))
-        if p.returncode != 0:
-            raise subprocess.CalledProcessError(p.returncode, cmd)
-    exit(0)
-
-standard = os.environ['STANDARD']
-install_dir    = os.path.join(fmt_dir, "_install")
-build_dir      = os.path.join(fmt_dir, "_build")
-test_build_dir = os.path.join(fmt_dir, "_build_test")
-
-# Configure the library.
-makedirs_if_not_exist(build_dir)
-cmake_flags = [
-    '-DCMAKE_INSTALL_PREFIX=' + install_dir, '-DCMAKE_BUILD_TYPE=' + build,
-    '-DCMAKE_CXX_STANDARD=' + standard
-]
-
-# Make sure the fuzzers still compile.
-main_cmake_flags = list(cmake_flags)
-if 'ENABLE_FUZZING' in os.environ:
-    main_cmake_flags += ['-DFMT_FUZZ=ON', '-DFMT_FUZZ_LINKMAIN=On']
-
-check_call(['cmake', '-DFMT_DOC=OFF', '-DFMT_PEDANTIC=ON', '-DFMT_WERROR=ON', fmt_dir] +
-           main_cmake_flags, cwd=build_dir)
-
-# Build the library.
-check_call(['cmake', '--build','.'], cwd=build_dir)
-
-# Test the library.
-env = os.environ.copy()
-env['CTEST_OUTPUT_ON_FAILURE'] = '1'
-if call(['make', 'test'], env=env, cwd=build_dir):
-    with open(os.path.join(build_dir, 'Testing', 'Temporary', 'LastTest.log'), 'r') as f:
-        print(f.read())
-    sys.exit(-1)
-
-# Install the library.
-check_call(['make', 'install'], cwd=build_dir)
-
-# Test installation.
-makedirs_if_not_exist(test_build_dir)
-check_call(['cmake', os.path.join(fmt_dir, "test", "find-package-test")] +
-            cmake_flags, cwd=test_build_dir)
-check_call(['make', '-j4'], cwd=test_build_dir)