Compare commits
144 Commits
master
...
citra_merg
Author | SHA1 | Date | |
---|---|---|---|
|
4606179019 | ||
|
72ceebe331 | ||
|
8949b027e9 | ||
|
9bfa3c407c | ||
|
811b07b78c | ||
|
153e10cad3 | ||
|
9f88f234a1 | ||
|
af0d4a7c18 | ||
|
edb00b680d | ||
|
b0200a0485 | ||
|
71e3553d78 | ||
|
bef990b74e | ||
|
707ae88153 | ||
|
722600e4f2 | ||
|
581f50a903 | ||
|
a0d50b138e | ||
|
2b3be5eee8 | ||
|
94d1f7c01a | ||
|
ad315fd20d | ||
|
8856604383 | ||
|
358cf6f035 | ||
|
883c8fc2ca | ||
|
f9d84871fb | ||
|
232c2588ab | ||
|
9da8190874 | ||
|
6fbe3bd275 | ||
|
b90d1921fa | ||
|
50782502a6 | ||
|
06d3b35549 | ||
|
43bd471949 | ||
|
5613c1a042 | ||
|
38556d1bf2 | ||
|
3113b830c1 | ||
|
54113d4546 | ||
|
cbfbb0ef8b | ||
|
f42cba71bb | ||
|
e5ba462a5d | ||
|
30f5d5d354 | ||
|
36c28648d7 | ||
|
f9c841b66d | ||
|
af010996a5 | ||
|
d472e5ba61 | ||
|
8e1f543bfb | ||
|
ec293f447b | ||
|
0aa938209c | ||
|
1234add918 | ||
|
b4239a6a06 | ||
|
85b607bdaa | ||
|
35e40cb1a9 | ||
|
45b8f69855 | ||
|
9da0572c0d | ||
|
2752b9c4e5 | ||
|
481af9f823 | ||
|
f837fab9dd | ||
|
50bf478e6a | ||
|
16dbb68715 | ||
|
f02ef43aa8 | ||
|
0f3ef9babe | ||
|
f661d13906 | ||
|
b4addd2564 | ||
|
7c7968741e | ||
|
131f9d69bd | ||
|
5d0f1e84e8 | ||
|
6cc068b8b9 | ||
|
dbc7562190 | ||
|
035dd1d2e0 | ||
|
07922b318d | ||
|
6d36c1f4f9 | ||
|
287658878d | ||
|
ccf47ec5cd | ||
|
428477abe1 | ||
|
918be1fe40 | ||
|
90b1e62490 | ||
|
8245465b98 | ||
|
f56f9c2b29 | ||
|
5958810e56 | ||
|
ab27fbc0c6 | ||
|
01682cd735 | ||
|
2c2666b0eb | ||
|
758481f5db | ||
|
c8a910a009 | ||
|
2a378692fa | ||
|
a698e35422 | ||
|
7b6cc4ec70 | ||
|
1a03e361c3 | ||
|
2f9f317c9e | ||
|
374c703335 | ||
|
78619e5620 | ||
|
0398fc9b41 | ||
|
08ada2919d | ||
|
263a7c823a | ||
|
cb7228828e | ||
|
fe63ef0486 | ||
|
5bf010cc62 | ||
|
99728efc1b | ||
|
c45d11e0af | ||
|
157435bd07 | ||
|
7bae3c14ba | ||
|
b491d1aae6 | ||
|
0784f2fe0d | ||
|
b61bb8e313 | ||
|
25532e4999 | ||
|
c1130497b1 | ||
|
c4fb80bf05 | ||
|
83ef2b7070 | ||
|
eacc261010 | ||
|
89bb32bed5 | ||
|
20ab2e2e80 | ||
|
3850598ca2 | ||
|
80a67a8f31 | ||
|
0deeb504b6 | ||
|
0b9008680a | ||
|
71bf3432a0 | ||
|
ea54d71e3b | ||
|
361d221741 | ||
|
85fa3096dd | ||
|
ddf33c425b | ||
|
3119f62f24 | ||
|
454aee658f | ||
|
cc83d2344e | ||
|
4edf81f785 | ||
|
ea221bcc94 | ||
|
598392c9f6 | ||
|
800d1e34e2 | ||
|
2645f51713 | ||
|
8eebc787c9 | ||
|
b240c9a454 | ||
|
26f3e3d352 | ||
|
c6e9c29cab | ||
|
9b3235d10b | ||
|
41ea882353 | ||
|
4e7de5cc57 | ||
|
a0ed585d41 | ||
|
f9da068670 | ||
|
1a2cd53847 | ||
|
5026aba986 | ||
|
c60adeb8e3 | ||
|
459d1478f3 | ||
|
0fb69f4ec0 | ||
|
0e4062e219 | ||
|
901e53eb9b | ||
|
cdf4bf5197 | ||
|
71d1f55eec | ||
|
78653d475e |
90
.github/workflows/ci.yml
vendored
Normal file
90
.github/workflows/ci.yml
vendored
Normal file
@ -0,0 +1,90 @@
|
|||||||
|
name: dynarmic-ci
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches: [ "*" ]
|
||||||
|
tags: [ "*" ]
|
||||||
|
pull_request:
|
||||||
|
branches: [ "*" ]
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
linux-x86_64-gcc:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
gcc-ver: [7, 8]
|
||||||
|
env:
|
||||||
|
GCC_VERSION: ${{ matrix.gcc-ver }}
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
- name: Deps
|
||||||
|
run: ./.travis/build-x86_64-linux/deps.sh
|
||||||
|
- name: Build
|
||||||
|
run: ./.travis/build-x86_64-linux/build.sh
|
||||||
|
linux-aarch64-gcc-8:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
- name: Deps apt-get
|
||||||
|
run: |
|
||||||
|
sudo apt-get update
|
||||||
|
sudo apt-get install \
|
||||||
|
gcc-8-aarch64-linux-gnu \
|
||||||
|
g++-8-aarch64-linux-gnu \
|
||||||
|
ninja-build \
|
||||||
|
qemu-user
|
||||||
|
- name: Deps
|
||||||
|
run: ./.travis/build-aarch64-linux/deps.sh
|
||||||
|
- name: Build
|
||||||
|
run: ./.travis/build-aarch64-linux/build.sh
|
||||||
|
linux:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
image: ["sse3-only-on-x86_64-linux", "test-with-unicorn-on-x86_64-linux"]
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
- name: Deps apt-get
|
||||||
|
run: |
|
||||||
|
sudo apt-get install \
|
||||||
|
gcc-7 \
|
||||||
|
g++-7 \
|
||||||
|
llvm-dev \
|
||||||
|
ninja-build
|
||||||
|
- name: Deps
|
||||||
|
run: ./.travis/${{ matrix.image }}/deps.sh
|
||||||
|
- name: Build
|
||||||
|
run: ./.travis/${{ matrix.image }}/build.sh
|
||||||
|
macos:
|
||||||
|
runs-on: macos-latest
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
arch: ["x86_64", "aarch64"]
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
- name: Deps
|
||||||
|
run: ./.travis/build-${{ matrix.arch }}-macos/deps.sh
|
||||||
|
- name: Build
|
||||||
|
run: ./.travis/build-${{ matrix.arch }}-macos/build.sh
|
||||||
|
windows:
|
||||||
|
runs-on: windows-latest
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
- name: Deps
|
||||||
|
run: ./.travis/build-x86_64-windows/deps.sh
|
||||||
|
shell: bash
|
||||||
|
- name: Set up MSVC
|
||||||
|
uses: ilammy/msvc-dev-cmd@v1
|
||||||
|
- name: Build
|
||||||
|
run: ./.travis/build-x86_64-windows/build.sh
|
||||||
|
shell: bash
|
2
.gitignore
vendored
2
.gitignore
vendored
@ -1,6 +1,6 @@
|
|||||||
# Built files
|
# Built files
|
||||||
build/
|
build/
|
||||||
build-*/
|
|
||||||
docs/Doxygen/
|
docs/Doxygen/
|
||||||
|
.vs/
|
||||||
# Generated files
|
# Generated files
|
||||||
src/backend/x64/mig/
|
src/backend/x64/mig/
|
||||||
|
14
.travis.yml
14
.travis.yml
@ -30,6 +30,20 @@ matrix:
|
|||||||
- ninja-build
|
- ninja-build
|
||||||
install: ./.travis/build-x86_64-linux/deps.sh
|
install: ./.travis/build-x86_64-linux/deps.sh
|
||||||
script: ./.travis/build-x86_64-linux/build.sh
|
script: ./.travis/build-x86_64-linux/build.sh
|
||||||
|
- env: NAME="Linux aarch64 Build"
|
||||||
|
os: linux
|
||||||
|
dist: bionic
|
||||||
|
addons:
|
||||||
|
apt:
|
||||||
|
sources:
|
||||||
|
- ubuntu-toolchain-r-test
|
||||||
|
packages:
|
||||||
|
- gcc-8-aarch64-linux-gnu
|
||||||
|
- g++-8-aarch64-linux-gnu
|
||||||
|
- ninja-build
|
||||||
|
- qemu-user
|
||||||
|
install: ./.travis/build-aarch64-linux/deps.sh
|
||||||
|
script: ./.travis/build-aarch64-linux/build.sh
|
||||||
- env: NAME="macOS Build"
|
- env: NAME="macOS Build"
|
||||||
os: osx
|
os: osx
|
||||||
sudo: false
|
sudo: false
|
||||||
|
13
.travis/build-aarch64-linux/build.sh
Executable file
13
.travis/build-aarch64-linux/build.sh
Executable file
@ -0,0 +1,13 @@
|
|||||||
|
#!/bin/sh
|
||||||
|
|
||||||
|
set -e
|
||||||
|
set -x
|
||||||
|
|
||||||
|
export CC=aarch64-linux-gnu-gcc-8
|
||||||
|
export CXX=aarch64-linux-gnu-g++-8
|
||||||
|
|
||||||
|
mkdir build && cd build
|
||||||
|
cmake .. -DBoost_INCLUDE_DIRS=${PWD}/../externals/ext-boost -DCMAKE_BUILD_TYPE=Release -G Ninja
|
||||||
|
ninja
|
||||||
|
|
||||||
|
qemu-aarch64 -L /usr/aarch64-linux-gnu ./tests/dynarmic_tests -d yes
|
9
.travis/build-aarch64-linux/deps.sh
Executable file
9
.travis/build-aarch64-linux/deps.sh
Executable file
@ -0,0 +1,9 @@
|
|||||||
|
#!/bin/sh
|
||||||
|
|
||||||
|
set -e
|
||||||
|
set -x
|
||||||
|
|
||||||
|
# TODO: This isn't ideal.
|
||||||
|
cd externals
|
||||||
|
git clone https://github.com/MerryMage/ext-boost
|
||||||
|
cd ..
|
11
.travis/build-aarch64-macos/build.sh
Executable file
11
.travis/build-aarch64-macos/build.sh
Executable file
@ -0,0 +1,11 @@
|
|||||||
|
#!/bin/sh
|
||||||
|
|
||||||
|
set -e
|
||||||
|
set -x
|
||||||
|
set -o pipefail
|
||||||
|
|
||||||
|
export MACOSX_DEPLOYMENT_TARGET=11.0
|
||||||
|
|
||||||
|
mkdir build && cd build
|
||||||
|
cmake .. -GXcode -DBoost_INCLUDE_DIRS=${PWD}/../externals/ext-boost -DDYNARMIC_TESTS=0 -DCMAKE_OSX_ARCHITECTURES=arm64
|
||||||
|
xcodebuild -configuration Release
|
9
.travis/build-aarch64-macos/deps.sh
Executable file
9
.travis/build-aarch64-macos/deps.sh
Executable file
@ -0,0 +1,9 @@
|
|||||||
|
#!/bin/sh
|
||||||
|
|
||||||
|
set -e
|
||||||
|
set -x
|
||||||
|
|
||||||
|
# TODO: This isn't ideal.
|
||||||
|
cd externals
|
||||||
|
git clone https://github.com/MerryMage/ext-boost
|
||||||
|
cd ..
|
@ -3,6 +3,12 @@
|
|||||||
set -e
|
set -e
|
||||||
set -x
|
set -x
|
||||||
|
|
||||||
|
sudo apt-get update
|
||||||
|
sudo apt-get install \
|
||||||
|
gcc-${GCC_VERSION} \
|
||||||
|
g++-${GCC_VERSION} \
|
||||||
|
ninja-build
|
||||||
|
|
||||||
# TODO: This isn't ideal.
|
# TODO: This isn't ideal.
|
||||||
cd externals
|
cd externals
|
||||||
git clone https://github.com/MerryMage/ext-boost
|
git clone https://github.com/MerryMage/ext-boost
|
||||||
|
10
.travis/build-x86_64-windows/build.sh
Normal file
10
.travis/build-x86_64-windows/build.sh
Normal file
@ -0,0 +1,10 @@
|
|||||||
|
#!/bin/sh
|
||||||
|
|
||||||
|
set -e
|
||||||
|
set -x
|
||||||
|
|
||||||
|
mkdir build && cd build
|
||||||
|
cmake .. -DBoost_INCLUDE_DIRS=${PWD}/../externals/ext-boost -DCMAKE_BUILD_TYPE=Release -G Ninja
|
||||||
|
ninja
|
||||||
|
|
||||||
|
./tests/dynarmic_tests --durations yes
|
9
.travis/build-x86_64-windows/deps.sh
Normal file
9
.travis/build-x86_64-windows/deps.sh
Normal file
@ -0,0 +1,9 @@
|
|||||||
|
#!/bin/sh
|
||||||
|
|
||||||
|
set -e
|
||||||
|
set -x
|
||||||
|
|
||||||
|
# TODO: This isn't ideal.
|
||||||
|
cd externals
|
||||||
|
git clone https://github.com/MerryMage/ext-boost
|
||||||
|
cd ..
|
@ -8,9 +8,36 @@ if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
|
|||||||
set(MASTER_PROJECT ON)
|
set(MASTER_PROJECT ON)
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
|
# Add the module directory to the list of paths
|
||||||
|
list(APPEND CMAKE_MODULE_PATH "${PROJECT_SOURCE_DIR}/CMakeModules")
|
||||||
|
|
||||||
|
if (CMAKE_CXX_COMPILER_ID STREQUAL "Clang" AND CMAKE_CXX_COMPILER_VERSION VERSION_GREATER 12)
|
||||||
|
string(APPEND CMAKE_CXX_FLAGS " -fbracket-depth=1024")
|
||||||
|
endif()
|
||||||
|
|
||||||
|
# Arch detection
|
||||||
|
include(DetectArchitecture)
|
||||||
|
if (MSVC)
|
||||||
|
detect_architecture("_M_AMD64" x86_64)
|
||||||
|
detect_architecture("_M_ARM64" Aarch64)
|
||||||
|
else()
|
||||||
|
detect_architecture("__x86_64__" x86_64)
|
||||||
|
detect_architecture("__aarch64__" Aarch64)
|
||||||
|
endif()
|
||||||
|
if (NOT DEFINED DYNARMIC_ARCHITECTURE)
|
||||||
|
message(FATAL_ERROR "Unsupported architecture encountered. Ending CMake generation.")
|
||||||
|
endif()
|
||||||
|
message(STATUS "Target architecture: ${DYNARMIC_ARCHITECTURE}")
|
||||||
|
|
||||||
|
set(REQUIRES_NO_EXECUTE_SUPPORT OFF)
|
||||||
|
#Apple Silicon chips require W^X
|
||||||
|
if(APPLE AND ARCHITECTURE_Aarch64)
|
||||||
|
set(REQUIRES_NO_EXECUTE_SUPPORT ON)
|
||||||
|
endif()
|
||||||
|
|
||||||
# Dynarmic project options
|
# Dynarmic project options
|
||||||
option(DYNARMIC_ENABLE_CPU_FEATURE_DETECTION "Turning this off causes dynarmic to assume the host CPU doesn't support anything later than SSE3" ON)
|
option(DYNARMIC_ENABLE_CPU_FEATURE_DETECTION "Turning this off causes dynarmic to assume the host CPU doesn't support anything later than SSE3" ON)
|
||||||
option(DYNARMIC_ENABLE_NO_EXECUTE_SUPPORT "Enables support for systems that require W^X" OFF)
|
option(DYNARMIC_ENABLE_NO_EXECUTE_SUPPORT "Enables support for systems that require W^X" ${REQUIRES_NO_EXECUTE_SUPPORT})
|
||||||
option(DYNARMIC_FATAL_ERRORS "Errors are fatal" OFF)
|
option(DYNARMIC_FATAL_ERRORS "Errors are fatal" OFF)
|
||||||
option(DYNARMIC_TESTS "Build tests" ${MASTER_PROJECT})
|
option(DYNARMIC_TESTS "Build tests" ${MASTER_PROJECT})
|
||||||
option(DYNARMIC_TESTS_USE_UNICORN "Enable fuzzing tests against unicorn" OFF)
|
option(DYNARMIC_TESTS_USE_UNICORN "Enable fuzzing tests against unicorn" OFF)
|
||||||
@ -38,9 +65,6 @@ if ("${CMAKE_SOURCE_DIR}" STREQUAL "${CMAKE_BINARY_DIR}")
|
|||||||
message(SEND_ERROR "In-source builds are not allowed.")
|
message(SEND_ERROR "In-source builds are not allowed.")
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
# Add the module directory to the list of paths
|
|
||||||
list(APPEND CMAKE_MODULE_PATH "${PROJECT_SOURCE_DIR}/CMakeModules")
|
|
||||||
|
|
||||||
# Compiler flags
|
# Compiler flags
|
||||||
if (MSVC)
|
if (MSVC)
|
||||||
set(DYNARMIC_CXX_FLAGS
|
set(DYNARMIC_CXX_FLAGS
|
||||||
@ -99,20 +123,6 @@ else()
|
|||||||
endif()
|
endif()
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
# Arch detection
|
|
||||||
include(DetectArchitecture)
|
|
||||||
if (MSVC)
|
|
||||||
detect_architecture("_M_AMD64" x86_64)
|
|
||||||
detect_architecture("_M_ARM64" Aarch64)
|
|
||||||
else()
|
|
||||||
detect_architecture("__x86_64__" x86_64)
|
|
||||||
detect_architecture("__aarch64__" Aarch64)
|
|
||||||
endif()
|
|
||||||
if (NOT DEFINED ARCHITECTURE)
|
|
||||||
message(FATAL_ERROR "Unsupported architecture encountered. Ending CMake generation.")
|
|
||||||
endif()
|
|
||||||
message(STATUS "Target architecture: ${ARCHITECTURE}")
|
|
||||||
|
|
||||||
# Include Boost
|
# Include Boost
|
||||||
if (NOT TARGET boost)
|
if (NOT TARGET boost)
|
||||||
if (NOT Boost_INCLUDE_DIRS)
|
if (NOT Boost_INCLUDE_DIRS)
|
||||||
|
@ -1,6 +1,6 @@
|
|||||||
include(CheckSymbolExists)
|
include(CheckSymbolExists)
|
||||||
function(detect_architecture symbol arch)
|
function(detect_architecture symbol arch)
|
||||||
if (NOT DEFINED ARCHITECTURE)
|
if (NOT DEFINED DYNARMIC_ARCHITECTURE)
|
||||||
set(CMAKE_REQUIRED_QUIET 1)
|
set(CMAKE_REQUIRED_QUIET 1)
|
||||||
check_symbol_exists("${symbol}" "" ARCHITECTURE_${arch})
|
check_symbol_exists("${symbol}" "" ARCHITECTURE_${arch})
|
||||||
unset(CMAKE_REQUIRED_QUIET)
|
unset(CMAKE_REQUIRED_QUIET)
|
||||||
@ -8,7 +8,7 @@ function(detect_architecture symbol arch)
|
|||||||
# The output variable needs to be unique across invocations otherwise
|
# The output variable needs to be unique across invocations otherwise
|
||||||
# CMake's crazy scope rules will keep it defined
|
# CMake's crazy scope rules will keep it defined
|
||||||
if (ARCHITECTURE_${arch})
|
if (ARCHITECTURE_${arch})
|
||||||
set(ARCHITECTURE "${arch}" PARENT_SCOPE)
|
set(DYNARMIC_ARCHITECTURE "${arch}" PARENT_SCOPE)
|
||||||
set(ARCHITECTURE_${arch} 1 PARENT_SCOPE)
|
set(ARCHITECTURE_${arch} 1 PARENT_SCOPE)
|
||||||
add_definitions(-DARCHITECTURE_${arch}=1)
|
add_definitions(-DARCHITECTURE_${arch}=1)
|
||||||
endif()
|
endif()
|
||||||
|
@ -1,6 +0,0 @@
|
|||||||
<!-- Please read the contribution guidelines before submitting a pull request. -->
|
|
||||||
<!-- By submitting this pull request, you agree that your contributions are licensed under the {fmt} license,
|
|
||||||
and agree to future changes to the licensing. -->
|
|
||||||
<!-- If you're a first-time contributor, please acknowledge it by leaving the statement below. -->
|
|
||||||
|
|
||||||
I agree that my contributions are licensed under the {fmt} license, and agree to future changes to the licensing.
|
|
35
externals/fmt/.gitignore
vendored
35
externals/fmt/.gitignore
vendored
@ -1,35 +0,0 @@
|
|||||||
.vscode/
|
|
||||||
.vs/
|
|
||||||
|
|
||||||
*.iml
|
|
||||||
.idea/
|
|
||||||
.externalNativeBuild/
|
|
||||||
.gradle/
|
|
||||||
gradle/
|
|
||||||
gradlew*
|
|
||||||
local.properties
|
|
||||||
build/
|
|
||||||
|
|
||||||
bin/
|
|
||||||
/_CPack_Packages
|
|
||||||
/CMakeScripts
|
|
||||||
/doc/doxyxml
|
|
||||||
/doc/html
|
|
||||||
virtualenv
|
|
||||||
/Testing
|
|
||||||
/install_manifest.txt
|
|
||||||
*~
|
|
||||||
*.a
|
|
||||||
*.so*
|
|
||||||
*.xcodeproj
|
|
||||||
*.zip
|
|
||||||
cmake_install.cmake
|
|
||||||
CPack*.cmake
|
|
||||||
fmt-*.cmake
|
|
||||||
CTestTestfile.cmake
|
|
||||||
CMakeCache.txt
|
|
||||||
CMakeFiles
|
|
||||||
FMT.build
|
|
||||||
Makefile
|
|
||||||
run-msbuild.bat
|
|
||||||
fmt.pc
|
|
101
externals/fmt/.travis.yml
vendored
101
externals/fmt/.travis.yml
vendored
@ -1,101 +0,0 @@
|
|||||||
language: cpp
|
|
||||||
dist: trusty
|
|
||||||
sudo: false
|
|
||||||
|
|
||||||
os: linux
|
|
||||||
|
|
||||||
git:
|
|
||||||
depth: 1
|
|
||||||
|
|
||||||
env:
|
|
||||||
global:
|
|
||||||
- secure: |-
|
|
||||||
a1eovNn4uol9won7ghr67eD3/59oeESN+G9bWE+ecI1V6yRseG9whniGhIpC/YfMW/Qz5I
|
|
||||||
5sxSmFjaw9bxCISNwUIrL1O5x2AmRYTnFcXk4dFsUvlZg+WeF/aKyBYCNRM8C2ndbBmtAO
|
|
||||||
o1F2EwFbiso0EmtzhAPs19ujiVxkLn4=
|
|
||||||
|
|
||||||
matrix:
|
|
||||||
include:
|
|
||||||
# Documentation
|
|
||||||
- env: BUILD=Doc
|
|
||||||
sudo: required
|
|
||||||
# g++ 6 on Linux with C++14
|
|
||||||
- env: COMPILER=g++-6 BUILD=Debug STANDARD=14
|
|
||||||
compiler: gcc
|
|
||||||
addons:
|
|
||||||
apt:
|
|
||||||
update: true
|
|
||||||
sources:
|
|
||||||
- ubuntu-toolchain-r-test
|
|
||||||
packages:
|
|
||||||
- g++-6
|
|
||||||
- env: COMPILER=g++-6 BUILD=Release STANDARD=14
|
|
||||||
compiler: gcc
|
|
||||||
addons:
|
|
||||||
apt:
|
|
||||||
update: true
|
|
||||||
sources:
|
|
||||||
- ubuntu-toolchain-r-test
|
|
||||||
packages:
|
|
||||||
- g++-6
|
|
||||||
# g++ 8 on Linux with C++17
|
|
||||||
- env: COMPILER=g++-8 BUILD=Debug STANDARD=17
|
|
||||||
compiler: gcc
|
|
||||||
addons:
|
|
||||||
apt:
|
|
||||||
update: true
|
|
||||||
sources:
|
|
||||||
- ubuntu-toolchain-r-test
|
|
||||||
packages:
|
|
||||||
- g++-8
|
|
||||||
- env: COMPILER=g++-8 BUILD=Release STANDARD=17
|
|
||||||
compiler: gcc
|
|
||||||
addons:
|
|
||||||
apt:
|
|
||||||
update: true
|
|
||||||
sources:
|
|
||||||
- ubuntu-toolchain-r-test
|
|
||||||
packages:
|
|
||||||
- g++-8
|
|
||||||
|
|
||||||
# Apple clang on OS X with C++14
|
|
||||||
- env: BUILD=Debug STANDARD=14
|
|
||||||
compiler: clang
|
|
||||||
os: osx
|
|
||||||
- env: BUILD=Release STANDARD=14
|
|
||||||
compiler: clang
|
|
||||||
os: osx
|
|
||||||
# clang 6.0 on Linux with C++14 (builds the fuzzers as well)
|
|
||||||
- env: COMPILER=clang++-6.0 BUILD=Debug STANDARD=14 ENABLE_FUZZING=1
|
|
||||||
compiler: clang
|
|
||||||
addons:
|
|
||||||
apt:
|
|
||||||
update: true
|
|
||||||
packages:
|
|
||||||
- clang-6.0
|
|
||||||
sources:
|
|
||||||
- ubuntu-toolchain-r-test
|
|
||||||
- llvm-toolchain-trusty
|
|
||||||
- llvm-toolchain-trusty-6.0
|
|
||||||
# clang 4.0 on Linux with C++14
|
|
||||||
- env: COMPILER=clang++-4.0 BUILD=Debug STANDARD=11
|
|
||||||
compiler: clang
|
|
||||||
addons:
|
|
||||||
apt:
|
|
||||||
update: true
|
|
||||||
packages:
|
|
||||||
- clang-4.0
|
|
||||||
sources:
|
|
||||||
- ubuntu-toolchain-r-test
|
|
||||||
- llvm-toolchain-trusty
|
|
||||||
- llvm-toolchain-trusty-4.0
|
|
||||||
# g++ 4.8 on Linux with C++11
|
|
||||||
- env: COMPILER=g++-4.8 BUILD=Debug STANDARD=11
|
|
||||||
compiler: gcc
|
|
||||||
|
|
||||||
before_script:
|
|
||||||
- if [[ "${TRAVIS_OS_NAME}" == "linux" ]]; then export CXX=${COMPILER}; fi
|
|
||||||
- if [[ "${BUILD}" != "Doc" ]]; then ${CXX} --version; fi
|
|
||||||
|
|
||||||
script:
|
|
||||||
- support/travis-build.py
|
|
215
externals/fmt/CMakeLists.txt
vendored
215
externals/fmt/CMakeLists.txt
vendored
@ -1,61 +1,106 @@
|
|||||||
cmake_minimum_required(VERSION 3.1.0)
|
cmake_minimum_required(VERSION 3.1...3.18)
|
||||||
|
|
||||||
# Use newer policies if available, up to most recent tested version of CMake.
|
# Fallback for using newer policies on CMake <3.12.
|
||||||
if(${CMAKE_VERSION} VERSION_LESS 3.11)
|
if(${CMAKE_VERSION} VERSION_LESS 3.12)
|
||||||
cmake_policy(VERSION ${CMAKE_MAJOR_VERSION}.${CMAKE_MINOR_VERSION})
|
cmake_policy(VERSION ${CMAKE_MAJOR_VERSION}.${CMAKE_MINOR_VERSION})
|
||||||
else()
|
|
||||||
cmake_policy(VERSION 3.11)
|
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
# Determine if fmt is built as a subproject (using add_subdirectory)
|
# Determine if fmt is built as a subproject (using add_subdirectory)
|
||||||
# or if it is the master project.
|
# or if it is the master project.
|
||||||
set(MASTER_PROJECT OFF)
|
if (NOT DEFINED FMT_MASTER_PROJECT)
|
||||||
if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
|
set(FMT_MASTER_PROJECT OFF)
|
||||||
set(MASTER_PROJECT ON)
|
if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
|
||||||
|
set(FMT_MASTER_PROJECT ON)
|
||||||
message(STATUS "CMake version: ${CMAKE_VERSION}")
|
message(STATUS "CMake version: ${CMAKE_VERSION}")
|
||||||
|
endif ()
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
# Joins arguments and places the results in ${result_var}.
|
# Joins arguments and places the results in ${result_var}.
|
||||||
function(join result_var)
|
function(join result_var)
|
||||||
set(result )
|
set(result "")
|
||||||
foreach (arg ${ARGN})
|
foreach (arg ${ARGN})
|
||||||
set(result "${result}${arg}")
|
set(result "${result}${arg}")
|
||||||
endforeach ()
|
endforeach ()
|
||||||
set(${result_var} "${result}" PARENT_SCOPE)
|
set(${result_var} "${result}" PARENT_SCOPE)
|
||||||
endfunction()
|
endfunction()
|
||||||
|
|
||||||
|
function(enable_module target)
|
||||||
|
if (MSVC)
|
||||||
|
set(BMI ${CMAKE_CURRENT_BINARY_DIR}/${target}.ifc)
|
||||||
|
target_compile_options(${target}
|
||||||
|
PRIVATE /interface /ifcOutput ${BMI}
|
||||||
|
INTERFACE /reference fmt=${BMI})
|
||||||
|
endif ()
|
||||||
|
set_target_properties(${target} PROPERTIES ADDITIONAL_CLEAN_FILES ${BMI})
|
||||||
|
set_source_files_properties(${BMI} PROPERTIES GENERATED ON)
|
||||||
|
endfunction()
|
||||||
|
|
||||||
|
include(CMakeParseArguments)
|
||||||
|
|
||||||
# Sets a cache variable with a docstring joined from multiple arguments:
|
# Sets a cache variable with a docstring joined from multiple arguments:
|
||||||
# set(<variable> <value>... CACHE <type> <docstring>...)
|
# set(<variable> <value>... CACHE <type> <docstring>...)
|
||||||
# This allows splitting a long docstring for readability.
|
# This allows splitting a long docstring for readability.
|
||||||
function(set_verbose)
|
function(set_verbose)
|
||||||
cmake_parse_arguments(SET_VERBOSE "" "" "CACHE" ${ARGN})
|
# cmake_parse_arguments is broken in CMake 3.4 (cannot parse CACHE) so use
|
||||||
list(GET SET_VERBOSE_CACHE 0 type)
|
# list instead.
|
||||||
list(REMOVE_AT SET_VERBOSE_CACHE 0)
|
list(GET ARGN 0 var)
|
||||||
join(doc ${SET_VERBOSE_CACHE})
|
list(REMOVE_AT ARGN 0)
|
||||||
set(${SET_VERBOSE_UNPARSED_ARGUMENTS} CACHE ${type} ${doc})
|
list(GET ARGN 0 val)
|
||||||
|
list(REMOVE_AT ARGN 0)
|
||||||
|
list(REMOVE_AT ARGN 0)
|
||||||
|
list(GET ARGN 0 type)
|
||||||
|
list(REMOVE_AT ARGN 0)
|
||||||
|
join(doc ${ARGN})
|
||||||
|
set(${var} ${val} CACHE ${type} ${doc})
|
||||||
endfunction()
|
endfunction()
|
||||||
|
|
||||||
# Set the default CMAKE_BUILD_TYPE to Release.
|
# Set the default CMAKE_BUILD_TYPE to Release.
|
||||||
# This should be done before the project command since the latter can set
|
# This should be done before the project command since the latter can set
|
||||||
# CMAKE_BUILD_TYPE itself (it does so for nmake).
|
# CMAKE_BUILD_TYPE itself (it does so for nmake).
|
||||||
if (MASTER_PROJECT AND NOT CMAKE_BUILD_TYPE)
|
if (FMT_MASTER_PROJECT AND NOT CMAKE_BUILD_TYPE)
|
||||||
set_verbose(CMAKE_BUILD_TYPE Release CACHE STRING
|
set_verbose(CMAKE_BUILD_TYPE Release CACHE STRING
|
||||||
"Choose the type of build, options are: None(CMAKE_CXX_FLAGS or "
|
"Choose the type of build, options are: None(CMAKE_CXX_FLAGS or "
|
||||||
"CMAKE_C_FLAGS used) Debug Release RelWithDebInfo MinSizeRel.")
|
"CMAKE_C_FLAGS used) Debug Release RelWithDebInfo MinSizeRel.")
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
|
project(FMT CXX)
|
||||||
|
include(GNUInstallDirs)
|
||||||
|
set_verbose(FMT_INC_DIR ${CMAKE_INSTALL_INCLUDEDIR} CACHE STRING
|
||||||
|
"Installation directory for include files, a relative path that "
|
||||||
|
"will be joined with ${CMAKE_INSTALL_PREFIX} or an absolute path.")
|
||||||
|
|
||||||
option(FMT_PEDANTIC "Enable extra warnings and expensive tests." OFF)
|
option(FMT_PEDANTIC "Enable extra warnings and expensive tests." OFF)
|
||||||
option(FMT_WERROR "Halt the compilation with an error on compiler warnings."
|
option(FMT_WERROR "Halt the compilation with an error on compiler warnings."
|
||||||
OFF)
|
OFF)
|
||||||
|
|
||||||
# Options that control generation of various targets.
|
# Options that control generation of various targets.
|
||||||
option(FMT_DOC "Generate the doc target." ${MASTER_PROJECT})
|
option(FMT_DOC "Generate the doc target." ${FMT_MASTER_PROJECT})
|
||||||
option(FMT_INSTALL "Generate the install target." ${MASTER_PROJECT})
|
option(FMT_INSTALL "Generate the install target." ${FMT_MASTER_PROJECT})
|
||||||
option(FMT_TEST "Generate the test target." ${MASTER_PROJECT})
|
option(FMT_TEST "Generate the test target." ${FMT_MASTER_PROJECT})
|
||||||
option(FMT_FUZZ "Generate the fuzz target." OFF)
|
option(FMT_FUZZ "Generate the fuzz target." OFF)
|
||||||
option(FMT_CUDA_TEST "Generate the cuda-test target." OFF)
|
option(FMT_CUDA_TEST "Generate the cuda-test target." OFF)
|
||||||
|
option(FMT_OS "Include core requiring OS (Windows/Posix) " ON)
|
||||||
|
option(FMT_MODULE "Build a module instead of a traditional library." OFF)
|
||||||
|
option(FMT_SYSTEM_HEADERS "Expose headers with marking them as system." OFF)
|
||||||
|
|
||||||
project(FMT CXX)
|
set(FMT_CAN_MODULE OFF)
|
||||||
|
if (CMAKE_CXX_STANDARD GREATER 17 AND
|
||||||
|
# msvc 16.10-pre4
|
||||||
|
MSVC AND CMAKE_CXX_COMPILER_VERSION VERSION_GREATER 19.29.30035)
|
||||||
|
set(FMT_CAN_MODULE OFF)
|
||||||
|
endif ()
|
||||||
|
if (NOT FMT_CAN_MODULE)
|
||||||
|
set(FMT_MODULE OFF)
|
||||||
|
message(STATUS "Module support is disabled.")
|
||||||
|
endif ()
|
||||||
|
if (FMT_TEST AND FMT_MODULE)
|
||||||
|
# The tests require {fmt} to be compiled as traditional library
|
||||||
|
message(STATUS "Testing is incompatible with build mode 'module'.")
|
||||||
|
endif ()
|
||||||
|
set(FMT_SYSTEM_HEADERS_ATTRIBUTE "")
|
||||||
|
if (FMT_SYSTEM_HEADERS)
|
||||||
|
set(FMT_SYSTEM_HEADERS_ATTRIBUTE SYSTEM)
|
||||||
|
endif ()
|
||||||
|
|
||||||
# Get version from core.h
|
# Get version from core.h
|
||||||
file(READ include/fmt/core.h core_h)
|
file(READ include/fmt/core.h core_h)
|
||||||
@ -80,7 +125,7 @@ set(CMAKE_MODULE_PATH ${CMAKE_MODULE_PATH}
|
|||||||
"${CMAKE_CURRENT_SOURCE_DIR}/support/cmake")
|
"${CMAKE_CURRENT_SOURCE_DIR}/support/cmake")
|
||||||
|
|
||||||
include(cxx14)
|
include(cxx14)
|
||||||
include(CheckCXXCompilerFlag)
|
include(JoinPaths)
|
||||||
|
|
||||||
list(FIND CMAKE_CXX_COMPILE_FEATURES "cxx_variadic_templates" index)
|
list(FIND CMAKE_CXX_COMPILE_FEATURES "cxx_variadic_templates" index)
|
||||||
if (${index} GREATER -1)
|
if (${index} GREATER -1)
|
||||||
@ -90,24 +135,36 @@ if (${index} GREATER -1)
|
|||||||
endif ()
|
endif ()
|
||||||
message(STATUS "Required features: ${FMT_REQUIRED_FEATURES}")
|
message(STATUS "Required features: ${FMT_REQUIRED_FEATURES}")
|
||||||
|
|
||||||
|
if (FMT_MASTER_PROJECT AND NOT DEFINED CMAKE_CXX_VISIBILITY_PRESET)
|
||||||
|
set_verbose(CMAKE_CXX_VISIBILITY_PRESET hidden CACHE STRING
|
||||||
|
"Preset for the export of private symbols")
|
||||||
|
set_property(CACHE CMAKE_CXX_VISIBILITY_PRESET PROPERTY STRINGS
|
||||||
|
hidden default)
|
||||||
|
endif ()
|
||||||
|
|
||||||
|
if (FMT_MASTER_PROJECT AND NOT DEFINED CMAKE_VISIBILITY_INLINES_HIDDEN)
|
||||||
|
set_verbose(CMAKE_VISIBILITY_INLINES_HIDDEN ON CACHE BOOL
|
||||||
|
"Whether to add a compile flag to hide symbols of inline functions")
|
||||||
|
endif ()
|
||||||
|
|
||||||
if (CMAKE_CXX_COMPILER_ID MATCHES "GNU")
|
if (CMAKE_CXX_COMPILER_ID MATCHES "GNU")
|
||||||
set(PEDANTIC_COMPILE_FLAGS -pedantic-errors -Wall -Wextra -pedantic
|
set(PEDANTIC_COMPILE_FLAGS -pedantic-errors -Wall -Wextra -pedantic
|
||||||
-Wold-style-cast -Wundef
|
-Wold-style-cast -Wundef
|
||||||
-Wredundant-decls -Wwrite-strings -Wpointer-arith
|
-Wredundant-decls -Wwrite-strings -Wpointer-arith
|
||||||
-Wcast-qual -Wformat=2 -Wmissing-include-dirs
|
-Wcast-qual -Wformat=2 -Wmissing-include-dirs
|
||||||
-Wcast-align -Wnon-virtual-dtor
|
-Wcast-align
|
||||||
-Wctor-dtor-privacy -Wdisabled-optimization
|
-Wctor-dtor-privacy -Wdisabled-optimization
|
||||||
-Winvalid-pch -Woverloaded-virtual
|
-Winvalid-pch -Woverloaded-virtual
|
||||||
-Wconversion -Wswitch-enum
|
-Wconversion -Wundef
|
||||||
-Wno-ctor-dtor-privacy -Wno-format-nonliteral -Wno-shadow)
|
-Wno-ctor-dtor-privacy -Wno-format-nonliteral)
|
||||||
if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 4.6)
|
if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 4.6)
|
||||||
set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wnoexcept
|
set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS}
|
||||||
-Wno-dangling-else -Wno-unused-local-typedefs)
|
-Wno-dangling-else -Wno-unused-local-typedefs)
|
||||||
endif ()
|
endif ()
|
||||||
if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 5.0)
|
if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 5.0)
|
||||||
set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wdouble-promotion
|
set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wdouble-promotion
|
||||||
-Wtrampolines -Wzero-as-null-pointer-constant -Wuseless-cast
|
-Wtrampolines -Wzero-as-null-pointer-constant -Wuseless-cast
|
||||||
-Wvector-operation-performance -Wsized-deallocation)
|
-Wvector-operation-performance -Wsized-deallocation -Wshadow)
|
||||||
endif ()
|
endif ()
|
||||||
if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 6.0)
|
if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 6.0)
|
||||||
set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wshift-overflow=2
|
set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wshift-overflow=2
|
||||||
@ -117,8 +174,9 @@ if (CMAKE_CXX_COMPILER_ID MATCHES "GNU")
|
|||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
if (CMAKE_CXX_COMPILER_ID MATCHES "Clang")
|
if (CMAKE_CXX_COMPILER_ID MATCHES "Clang")
|
||||||
set(PEDANTIC_COMPILE_FLAGS -Wall -Wextra -pedantic -Wconversion
|
set(PEDANTIC_COMPILE_FLAGS -Wall -Wextra -pedantic -Wconversion -Wundef
|
||||||
-Wno-sign-conversion -Wdeprecated -Wweak-vtables)
|
-Wdeprecated -Wweak-vtables -Wshadow
|
||||||
|
-Wno-gnu-zero-variadic-macro-arguments)
|
||||||
check_cxx_compiler_flag(-Wzero-as-null-pointer-constant HAS_NULLPTR_WARNING)
|
check_cxx_compiler_flag(-Wzero-as-null-pointer-constant HAS_NULLPTR_WARNING)
|
||||||
if (HAS_NULLPTR_WARNING)
|
if (HAS_NULLPTR_WARNING)
|
||||||
set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS}
|
set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS}
|
||||||
@ -132,7 +190,7 @@ if (MSVC)
|
|||||||
set(WERROR_FLAG /WX)
|
set(WERROR_FLAG /WX)
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
if (MASTER_PROJECT AND CMAKE_GENERATOR MATCHES "Visual Studio")
|
if (FMT_MASTER_PROJECT AND CMAKE_GENERATOR MATCHES "Visual Studio")
|
||||||
# If Microsoft SDK is installed create script run-msbuild.bat that
|
# If Microsoft SDK is installed create script run-msbuild.bat that
|
||||||
# calls SetEnv.cmd to set up build environment and runs msbuild.
|
# calls SetEnv.cmd to set up build environment and runs msbuild.
|
||||||
# It is useful when building Visual Studio projects with the SDK
|
# It is useful when building Visual Studio projects with the SDK
|
||||||
@ -150,18 +208,6 @@ if (MASTER_PROJECT AND CMAKE_GENERATOR MATCHES "Visual Studio")
|
|||||||
${CMAKE_MAKE_PROGRAM} -p:FrameworkPathOverride=\"${netfxpath}\" %*")
|
${CMAKE_MAKE_PROGRAM} -p:FrameworkPathOverride=\"${netfxpath}\" %*")
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
set(strtod_l_headers stdlib.h)
|
|
||||||
if (APPLE)
|
|
||||||
set(strtod_l_headers ${strtod_l_headers} xlocale.h)
|
|
||||||
endif ()
|
|
||||||
|
|
||||||
include(CheckSymbolExists)
|
|
||||||
if (WIN32)
|
|
||||||
check_symbol_exists(_strtod_l "${strtod_l_headers}" HAVE_STRTOD_L)
|
|
||||||
else ()
|
|
||||||
check_symbol_exists(strtod_l "${strtod_l_headers}" HAVE_STRTOD_L)
|
|
||||||
endif ()
|
|
||||||
|
|
||||||
function(add_headers VAR)
|
function(add_headers VAR)
|
||||||
set(headers ${${VAR}})
|
set(headers ${${VAR}})
|
||||||
foreach (header ${ARGN})
|
foreach (header ${ARGN})
|
||||||
@ -171,34 +217,41 @@ function(add_headers VAR)
|
|||||||
endfunction()
|
endfunction()
|
||||||
|
|
||||||
# Define the fmt library, its includes and the needed defines.
|
# Define the fmt library, its includes and the needed defines.
|
||||||
add_headers(FMT_HEADERS chrono.h color.h compile.h core.h format.h format-inl.h
|
add_headers(FMT_HEADERS args.h chrono.h color.h compile.h core.h format.h
|
||||||
locale.h os.h ostream.h posix.h printf.h ranges.h)
|
format-inl.h os.h ostream.h printf.h ranges.h std.h
|
||||||
set(FMT_SOURCES src/format.cc src/os.cc)
|
xchar.h)
|
||||||
|
if (FMT_MODULE)
|
||||||
|
set(FMT_SOURCES src/fmt.cc)
|
||||||
|
elseif (FMT_OS)
|
||||||
|
set(FMT_SOURCES src/format.cc src/os.cc)
|
||||||
|
else()
|
||||||
|
set(FMT_SOURCES src/format.cc)
|
||||||
|
endif ()
|
||||||
|
|
||||||
add_library(fmt ${FMT_SOURCES} ${FMT_HEADERS} README.rst ChangeLog.rst)
|
add_library(fmt ${FMT_SOURCES} ${FMT_HEADERS} README.rst ChangeLog.rst)
|
||||||
add_library(fmt::fmt ALIAS fmt)
|
add_library(fmt::fmt ALIAS fmt)
|
||||||
|
|
||||||
if (HAVE_STRTOD_L)
|
|
||||||
target_compile_definitions(fmt PUBLIC FMT_LOCALE)
|
|
||||||
endif ()
|
|
||||||
|
|
||||||
if (FMT_WERROR)
|
if (FMT_WERROR)
|
||||||
target_compile_options(fmt PRIVATE ${WERROR_FLAG})
|
target_compile_options(fmt PRIVATE ${WERROR_FLAG})
|
||||||
endif ()
|
endif ()
|
||||||
if (FMT_PEDANTIC)
|
if (FMT_PEDANTIC)
|
||||||
target_compile_options(fmt PRIVATE ${PEDANTIC_COMPILE_FLAGS})
|
target_compile_options(fmt PRIVATE ${PEDANTIC_COMPILE_FLAGS})
|
||||||
endif ()
|
endif ()
|
||||||
|
if (FMT_MODULE)
|
||||||
|
enable_module(fmt)
|
||||||
|
endif ()
|
||||||
|
|
||||||
target_compile_features(fmt INTERFACE ${FMT_REQUIRED_FEATURES})
|
target_compile_features(fmt INTERFACE ${FMT_REQUIRED_FEATURES})
|
||||||
|
|
||||||
target_include_directories(fmt PUBLIC
|
target_include_directories(fmt ${FMT_SYSTEM_HEADERS_ATTRIBUTE} PUBLIC
|
||||||
$<BUILD_INTERFACE:${PROJECT_SOURCE_DIR}/include>
|
$<BUILD_INTERFACE:${PROJECT_SOURCE_DIR}/include>
|
||||||
$<INSTALL_INTERFACE:include>)
|
$<INSTALL_INTERFACE:${FMT_INC_DIR}>)
|
||||||
|
|
||||||
set(FMT_DEBUG_POSTFIX d CACHE STRING "Debug library postfix.")
|
set(FMT_DEBUG_POSTFIX d CACHE STRING "Debug library postfix.")
|
||||||
|
|
||||||
set_target_properties(fmt PROPERTIES
|
set_target_properties(fmt PROPERTIES
|
||||||
VERSION ${FMT_VERSION} SOVERSION ${CPACK_PACKAGE_VERSION_MAJOR}
|
VERSION ${FMT_VERSION} SOVERSION ${CPACK_PACKAGE_VERSION_MAJOR}
|
||||||
|
PUBLIC_HEADER "${FMT_HEADERS}"
|
||||||
DEBUG_POSTFIX "${FMT_DEBUG_POSTFIX}")
|
DEBUG_POSTFIX "${FMT_DEBUG_POSTFIX}")
|
||||||
|
|
||||||
# Set FMT_LIB_NAME for pkg-config fmt.pc. We cannot use the OUTPUT_NAME target
|
# Set FMT_LIB_NAME for pkg-config fmt.pc. We cannot use the OUTPUT_NAME target
|
||||||
@ -209,11 +262,6 @@ if (CMAKE_BUILD_TYPE STREQUAL "Debug")
|
|||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
if (BUILD_SHARED_LIBS)
|
if (BUILD_SHARED_LIBS)
|
||||||
if (UNIX AND NOT APPLE AND NOT ${CMAKE_SYSTEM_NAME} MATCHES "SunOS")
|
|
||||||
# Fix rpmlint warning:
|
|
||||||
# unused-direct-shlib-dependency /usr/lib/libformat.so.1.1.0 /lib/libm.so.6.
|
|
||||||
target_link_libraries(fmt -Wl,--as-needed)
|
|
||||||
endif ()
|
|
||||||
target_compile_definitions(fmt PRIVATE FMT_EXPORT INTERFACE FMT_SHARED)
|
target_compile_definitions(fmt PRIVATE FMT_EXPORT INTERFACE FMT_SHARED)
|
||||||
endif ()
|
endif ()
|
||||||
if (FMT_SAFE_DURATION_CAST)
|
if (FMT_SAFE_DURATION_CAST)
|
||||||
@ -226,44 +274,40 @@ add_library(fmt::fmt-header-only ALIAS fmt-header-only)
|
|||||||
target_compile_definitions(fmt-header-only INTERFACE FMT_HEADER_ONLY=1)
|
target_compile_definitions(fmt-header-only INTERFACE FMT_HEADER_ONLY=1)
|
||||||
target_compile_features(fmt-header-only INTERFACE ${FMT_REQUIRED_FEATURES})
|
target_compile_features(fmt-header-only INTERFACE ${FMT_REQUIRED_FEATURES})
|
||||||
|
|
||||||
target_include_directories(fmt-header-only INTERFACE
|
target_include_directories(fmt-header-only ${FMT_SYSTEM_HEADERS_ATTRIBUTE} INTERFACE
|
||||||
$<BUILD_INTERFACE:${PROJECT_SOURCE_DIR}/include>
|
$<BUILD_INTERFACE:${PROJECT_SOURCE_DIR}/include>
|
||||||
$<INSTALL_INTERFACE:include>)
|
$<INSTALL_INTERFACE:${FMT_INC_DIR}>)
|
||||||
|
|
||||||
# Install targets.
|
# Install targets.
|
||||||
if (FMT_INSTALL)
|
if (FMT_INSTALL)
|
||||||
include(GNUInstallDirs)
|
|
||||||
include(CMakePackageConfigHelpers)
|
include(CMakePackageConfigHelpers)
|
||||||
set_verbose(FMT_CMAKE_DIR ${CMAKE_INSTALL_LIBDIR}/cmake/fmt CACHE STRING
|
set_verbose(FMT_CMAKE_DIR ${CMAKE_INSTALL_LIBDIR}/cmake/fmt CACHE STRING
|
||||||
"Installation directory for cmake files, relative to "
|
"Installation directory for cmake files, a relative path that "
|
||||||
"${CMAKE_INSTALL_PREFIX}.")
|
"will be joined with ${CMAKE_INSTALL_PREFIX} or an absolute "
|
||||||
|
"path.")
|
||||||
set(version_config ${PROJECT_BINARY_DIR}/fmt-config-version.cmake)
|
set(version_config ${PROJECT_BINARY_DIR}/fmt-config-version.cmake)
|
||||||
set(project_config ${PROJECT_BINARY_DIR}/fmt-config.cmake)
|
set(project_config ${PROJECT_BINARY_DIR}/fmt-config.cmake)
|
||||||
set(pkgconfig ${PROJECT_BINARY_DIR}/fmt.pc)
|
set(pkgconfig ${PROJECT_BINARY_DIR}/fmt.pc)
|
||||||
set(targets_export_name fmt-targets)
|
set(targets_export_name fmt-targets)
|
||||||
|
|
||||||
set (INSTALL_TARGETS fmt)
|
|
||||||
if (TARGET fmt-header-only)
|
|
||||||
set(INSTALL_TARGETS ${INSTALL_TARGETS} fmt-header-only)
|
|
||||||
endif ()
|
|
||||||
|
|
||||||
set_verbose(FMT_LIB_DIR ${CMAKE_INSTALL_LIBDIR} CACHE STRING
|
set_verbose(FMT_LIB_DIR ${CMAKE_INSTALL_LIBDIR} CACHE STRING
|
||||||
"Installation directory for libraries, relative to "
|
"Installation directory for libraries, a relative path that "
|
||||||
"${CMAKE_INSTALL_PREFIX}.")
|
"will be joined to ${CMAKE_INSTALL_PREFIX} or an absolute path.")
|
||||||
|
|
||||||
set_verbose(FMT_INC_DIR ${CMAKE_INSTALL_INCLUDEDIR}/fmt CACHE STRING
|
|
||||||
"Installation directory for include files, relative to "
|
|
||||||
"${CMAKE_INSTALL_PREFIX}.")
|
|
||||||
|
|
||||||
set_verbose(FMT_PKGCONFIG_DIR ${CMAKE_INSTALL_LIBDIR}/pkgconfig CACHE PATH
|
set_verbose(FMT_PKGCONFIG_DIR ${CMAKE_INSTALL_LIBDIR}/pkgconfig CACHE PATH
|
||||||
"Installation directory for pkgconfig (.pc) files, relative to "
|
"Installation directory for pkgconfig (.pc) files, a relative "
|
||||||
"${CMAKE_INSTALL_PREFIX}.")
|
"path that will be joined with ${CMAKE_INSTALL_PREFIX} or an "
|
||||||
|
"absolute path.")
|
||||||
|
|
||||||
# Generate the version, config and target files into the build directory.
|
# Generate the version, config and target files into the build directory.
|
||||||
write_basic_package_version_file(
|
write_basic_package_version_file(
|
||||||
${version_config}
|
${version_config}
|
||||||
VERSION ${FMT_VERSION}
|
VERSION ${FMT_VERSION}
|
||||||
COMPATIBILITY AnyNewerVersion)
|
COMPATIBILITY AnyNewerVersion)
|
||||||
|
|
||||||
|
join_paths(libdir_for_pc_file "\${exec_prefix}" "${FMT_LIB_DIR}")
|
||||||
|
join_paths(includedir_for_pc_file "\${prefix}" "${FMT_INC_DIR}")
|
||||||
|
|
||||||
configure_file(
|
configure_file(
|
||||||
"${PROJECT_SOURCE_DIR}/support/cmake/fmt.pc.in"
|
"${PROJECT_SOURCE_DIR}/support/cmake/fmt.pc.in"
|
||||||
"${pkgconfig}"
|
"${pkgconfig}"
|
||||||
@ -272,6 +316,17 @@ if (FMT_INSTALL)
|
|||||||
${PROJECT_SOURCE_DIR}/support/cmake/fmt-config.cmake.in
|
${PROJECT_SOURCE_DIR}/support/cmake/fmt-config.cmake.in
|
||||||
${project_config}
|
${project_config}
|
||||||
INSTALL_DESTINATION ${FMT_CMAKE_DIR})
|
INSTALL_DESTINATION ${FMT_CMAKE_DIR})
|
||||||
|
|
||||||
|
set(INSTALL_TARGETS fmt fmt-header-only)
|
||||||
|
|
||||||
|
# Install the library and headers.
|
||||||
|
install(TARGETS ${INSTALL_TARGETS} EXPORT ${targets_export_name}
|
||||||
|
LIBRARY DESTINATION ${FMT_LIB_DIR}
|
||||||
|
ARCHIVE DESTINATION ${FMT_LIB_DIR}
|
||||||
|
PUBLIC_HEADER DESTINATION "${FMT_INC_DIR}/fmt"
|
||||||
|
FRAMEWORK DESTINATION "."
|
||||||
|
RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR})
|
||||||
|
|
||||||
# Use a namespace because CMake provides better diagnostics for namespaced
|
# Use a namespace because CMake provides better diagnostics for namespaced
|
||||||
# imported targets.
|
# imported targets.
|
||||||
export(TARGETS ${INSTALL_TARGETS} NAMESPACE fmt::
|
export(TARGETS ${INSTALL_TARGETS} NAMESPACE fmt::
|
||||||
@ -284,15 +339,8 @@ if (FMT_INSTALL)
|
|||||||
install(EXPORT ${targets_export_name} DESTINATION ${FMT_CMAKE_DIR}
|
install(EXPORT ${targets_export_name} DESTINATION ${FMT_CMAKE_DIR}
|
||||||
NAMESPACE fmt::)
|
NAMESPACE fmt::)
|
||||||
|
|
||||||
# Install the library and headers.
|
|
||||||
install(TARGETS ${INSTALL_TARGETS} EXPORT ${targets_export_name}
|
|
||||||
LIBRARY DESTINATION ${FMT_LIB_DIR}
|
|
||||||
ARCHIVE DESTINATION ${FMT_LIB_DIR}
|
|
||||||
RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR})
|
|
||||||
|
|
||||||
install(FILES $<TARGET_PDB_FILE:${INSTALL_TARGETS}>
|
install(FILES $<TARGET_PDB_FILE:${INSTALL_TARGETS}>
|
||||||
DESTINATION ${FMT_LIB_DIR} OPTIONAL)
|
DESTINATION ${FMT_LIB_DIR} OPTIONAL)
|
||||||
install(FILES ${FMT_HEADERS} DESTINATION ${FMT_INC_DIR})
|
|
||||||
install(FILES "${pkgconfig}" DESTINATION "${FMT_PKGCONFIG_DIR}")
|
install(FILES "${pkgconfig}" DESTINATION "${FMT_PKGCONFIG_DIR}")
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
@ -308,10 +356,17 @@ endif ()
|
|||||||
# Control fuzzing independent of the unit tests.
|
# Control fuzzing independent of the unit tests.
|
||||||
if (FMT_FUZZ)
|
if (FMT_FUZZ)
|
||||||
add_subdirectory(test/fuzzing)
|
add_subdirectory(test/fuzzing)
|
||||||
|
|
||||||
|
# The FMT_FUZZ macro is used to prevent resource exhaustion in fuzzing
|
||||||
|
# mode and make fuzzing practically possible. It is similar to
|
||||||
|
# FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION but uses a different name to
|
||||||
|
# avoid interfering with fuzzing of projects that use {fmt}.
|
||||||
|
# See also https://llvm.org/docs/LibFuzzer.html#fuzzer-friendly-build-mode.
|
||||||
|
target_compile_definitions(fmt PUBLIC FMT_FUZZ)
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
set(gitignore ${PROJECT_SOURCE_DIR}/.gitignore)
|
set(gitignore ${PROJECT_SOURCE_DIR}/.gitignore)
|
||||||
if (MASTER_PROJECT AND EXISTS ${gitignore})
|
if (FMT_MASTER_PROJECT AND EXISTS ${gitignore})
|
||||||
# Get the list of ignored files from .gitignore.
|
# Get the list of ignored files from .gitignore.
|
||||||
file (STRINGS ${gitignore} lines)
|
file (STRINGS ${gitignore} lines)
|
||||||
list(REMOVE_ITEM lines /doc/html)
|
list(REMOVE_ITEM lines /doc/html)
|
||||||
|
3
externals/fmt/CONTRIBUTING.md
vendored
3
externals/fmt/CONTRIBUTING.md
vendored
@ -14,4 +14,7 @@ exceptions:
|
|||||||
* snake_case should be used instead of UpperCamelCase for function and type
|
* snake_case should be used instead of UpperCamelCase for function and type
|
||||||
names
|
names
|
||||||
|
|
||||||
|
All documentation must adhere to the [Google Developer Documentation Style
|
||||||
|
Guide](https://developers.google.com/style).
|
||||||
|
|
||||||
Thanks for contributing!
|
Thanks for contributing!
|
||||||
|
2385
externals/fmt/ChangeLog.rst
vendored
2385
externals/fmt/ChangeLog.rst
vendored
File diff suppressed because it is too large
Load Diff
474
externals/fmt/README.rst
vendored
474
externals/fmt/README.rst
vendored
@ -1,159 +1,186 @@
|
|||||||
{fmt}
|
.. image:: https://user-images.githubusercontent.com/
|
||||||
=====
|
576385/156254208-f5b743a9-88cf-439d-b0c0-923d53e8d551.png
|
||||||
|
:width: 25%
|
||||||
|
:alt: {fmt}
|
||||||
|
|
||||||
.. image:: https://travis-ci.org/fmtlib/fmt.png?branch=master
|
.. image:: https://github.com/fmtlib/fmt/workflows/linux/badge.svg
|
||||||
:target: https://travis-ci.org/fmtlib/fmt
|
:target: https://github.com/fmtlib/fmt/actions?query=workflow%3Alinux
|
||||||
|
|
||||||
.. image:: https://ci.appveyor.com/api/projects/status/ehjkiefde6gucy1v
|
.. image:: https://github.com/fmtlib/fmt/workflows/macos/badge.svg
|
||||||
:target: https://ci.appveyor.com/project/vitaut/fmt
|
:target: https://github.com/fmtlib/fmt/actions?query=workflow%3Amacos
|
||||||
|
|
||||||
.. image:: https://oss-fuzz-build-logs.storage.googleapis.com/badges/libfmt.svg
|
.. image:: https://github.com/fmtlib/fmt/workflows/windows/badge.svg
|
||||||
:alt: fmt is continuously fuzzed att oss-fuzz
|
:target: https://github.com/fmtlib/fmt/actions?query=workflow%3Awindows
|
||||||
:target: https://bugs.chromium.org/p/oss-fuzz/issues/list?colspec=ID%20Type%20Component%20Status%20Proj%20Reported%20Owner%20Summary&q=proj%3Dlibfmt&can=1
|
|
||||||
|
.. image:: https://oss-fuzz-build-logs.storage.googleapis.com/badges/fmt.svg
|
||||||
|
:alt: fmt is continuously fuzzed at oss-fuzz
|
||||||
|
:target: https://bugs.chromium.org/p/oss-fuzz/issues/list?\
|
||||||
|
colspec=ID%20Type%20Component%20Status%20Proj%20Reported%20Owner%20\
|
||||||
|
Summary&q=proj%3Dfmt&can=1
|
||||||
|
|
||||||
.. image:: https://img.shields.io/badge/stackoverflow-fmt-blue.svg
|
.. image:: https://img.shields.io/badge/stackoverflow-fmt-blue.svg
|
||||||
:alt: Ask questions at StackOverflow with the tag fmt
|
:alt: Ask questions at StackOverflow with the tag fmt
|
||||||
:target: https://stackoverflow.com/questions/tagged/fmt
|
:target: https://stackoverflow.com/questions/tagged/fmt
|
||||||
|
|
||||||
**{fmt}** is an open-source formatting library for C++.
|
**{fmt}** is an open-source formatting library providing a fast and safe
|
||||||
It can be used as a safe and fast alternative to (s)printf and iostreams.
|
alternative to C stdio and C++ iostreams.
|
||||||
|
|
||||||
`Documentation <https://fmt.dev/latest/>`__
|
If you like this project, please consider donating to one of the funds that
|
||||||
|
help victims of the war in Ukraine: https://www.stopputin.net/.
|
||||||
|
|
||||||
Q&A: ask questions on `StackOverflow with the tag fmt <https://stackoverflow.com/questions/tagged/fmt>`_.
|
`Documentation <https://fmt.dev>`__
|
||||||
|
|
||||||
|
`Cheat Sheets <https://hackingcpp.com/cpp/libs/fmt.html>`__
|
||||||
|
|
||||||
|
Q&A: ask questions on `StackOverflow with the tag fmt
|
||||||
|
<https://stackoverflow.com/questions/tagged/fmt>`_.
|
||||||
|
|
||||||
|
Try {fmt} in `Compiler Explorer <https://godbolt.org/z/Eq5763>`_.
|
||||||
|
|
||||||
Features
|
Features
|
||||||
--------
|
--------
|
||||||
|
|
||||||
* Replacement-based `format API <https://fmt.dev/dev/api.html>`_ with
|
* Simple `format API <https://fmt.dev/latest/api.html>`_ with positional arguments
|
||||||
positional arguments for localization.
|
for localization
|
||||||
* `Format string syntax <https://fmt.dev/dev/syntax.html>`_ similar to the one
|
* Implementation of `C++20 std::format
|
||||||
of `str.format <https://docs.python.org/3/library/stdtypes.html#str.format>`_
|
<https://en.cppreference.com/w/cpp/utility/format>`__
|
||||||
in Python.
|
* `Format string syntax <https://fmt.dev/latest/syntax.html>`_ similar to Python's
|
||||||
|
`format <https://docs.python.org/3/library/stdtypes.html#str.format>`_
|
||||||
|
* Fast IEEE 754 floating-point formatter with correct rounding, shortness and
|
||||||
|
round-trip guarantees
|
||||||
* Safe `printf implementation
|
* Safe `printf implementation
|
||||||
<https://fmt.dev/latest/api.html#printf-formatting>`_ including
|
<https://fmt.dev/latest/api.html#printf-formatting>`_ including the POSIX
|
||||||
the POSIX extension for positional arguments.
|
extension for positional arguments
|
||||||
* Implementation of `C++20 std::format <https://en.cppreference.com/w/cpp/utility/format>`__.
|
* Extensibility: `support for user-defined types
|
||||||
* Support for user-defined types.
|
<https://fmt.dev/latest/api.html#formatting-user-defined-types>`_
|
||||||
* High performance: faster than common standard library implementations of
|
* High performance: faster than common standard library implementations of
|
||||||
`printf <https://en.cppreference.com/w/cpp/io/c/fprintf>`_ and
|
``(s)printf``, iostreams, ``to_string`` and ``to_chars``, see `Speed tests`_
|
||||||
iostreams. See `Speed tests`_ and `Fast integer to string conversion in C++
|
and `Converting a hundred million integers to strings per second
|
||||||
<http://zverovich.net/2013/09/07/integer-to-string-conversion-in-cplusplus.html>`_.
|
<http://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html>`_
|
||||||
* Small code size both in terms of source code (the minimum configuration
|
* Small code size both in terms of source code with the minimum configuration
|
||||||
consists of just three header files, ``core.h``, ``format.h`` and
|
consisting of just three files, ``core.h``, ``format.h`` and ``format-inl.h``,
|
||||||
``format-inl.h``) and compiled code. See `Compile time and code bloat`_.
|
and compiled code; see `Compile time and code bloat`_
|
||||||
* Reliability: the library has an extensive set of `unit tests
|
* Reliability: the library has an extensive set of `tests
|
||||||
<https://github.com/fmtlib/fmt/tree/master/test>`_ and is continuously fuzzed.
|
<https://github.com/fmtlib/fmt/tree/master/test>`_ and is `continuously fuzzed
|
||||||
|
<https://bugs.chromium.org/p/oss-fuzz/issues/list?colspec=ID%20Type%20
|
||||||
|
Component%20Status%20Proj%20Reported%20Owner%20Summary&q=proj%3Dfmt&can=1>`_
|
||||||
* Safety: the library is fully type safe, errors in format strings can be
|
* Safety: the library is fully type safe, errors in format strings can be
|
||||||
reported at compile time, automatic memory management prevents buffer overflow
|
reported at compile time, automatic memory management prevents buffer overflow
|
||||||
errors.
|
errors
|
||||||
* Ease of use: small self-contained code base, no external dependencies,
|
* Ease of use: small self-contained code base, no external dependencies,
|
||||||
permissive MIT `license
|
permissive MIT `license
|
||||||
<https://github.com/fmtlib/fmt/blob/master/LICENSE.rst>`_
|
<https://github.com/fmtlib/fmt/blob/master/LICENSE.rst>`_
|
||||||
* `Portability <https://fmt.dev/latest/index.html#portability>`_ with
|
* `Portability <https://fmt.dev/latest/index.html#portability>`_ with
|
||||||
consistent output across platforms and support for older compilers.
|
consistent output across platforms and support for older compilers
|
||||||
* Clean warning-free codebase even on high warning levels
|
* Clean warning-free codebase even on high warning levels such as
|
||||||
(``-Wall -Wextra -pedantic``).
|
``-Wall -Wextra -pedantic``
|
||||||
* Support for wide strings.
|
* Locale-independence by default
|
||||||
* Optional header-only configuration enabled with the ``FMT_HEADER_ONLY`` macro.
|
* Optional header-only configuration enabled with the ``FMT_HEADER_ONLY`` macro
|
||||||
|
|
||||||
See the `documentation <https://fmt.dev/latest/>`_ for more details.
|
See the `documentation <https://fmt.dev>`_ for more details.
|
||||||
|
|
||||||
Examples
|
Examples
|
||||||
--------
|
--------
|
||||||
|
|
||||||
Print ``Hello, world!`` to ``stdout``:
|
**Print to stdout** (`run <https://godbolt.org/z/Tevcjh>`_)
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
fmt::print("Hello, {}!", "world"); // Python-like format string syntax
|
#include <fmt/core.h>
|
||||||
fmt::printf("Hello, %s!", "world"); // printf format string syntax
|
|
||||||
|
|
||||||
Format a string and use positional arguments:
|
int main() {
|
||||||
|
fmt::print("Hello, world!\n");
|
||||||
|
}
|
||||||
|
|
||||||
|
**Format a string** (`run <https://godbolt.org/z/oK8h33>`_)
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
std::string s = fmt::format("The answer is {}.", 42);
|
||||||
|
// s == "The answer is 42."
|
||||||
|
|
||||||
|
**Format a string using positional arguments** (`run <https://godbolt.org/z/Yn7Txe>`_)
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
std::string s = fmt::format("I'd rather be {1} than {0}.", "right", "happy");
|
std::string s = fmt::format("I'd rather be {1} than {0}.", "right", "happy");
|
||||||
// s == "I'd rather be happy than right."
|
// s == "I'd rather be happy than right."
|
||||||
|
|
||||||
Check a format string at compile time:
|
**Print chrono durations** (`run <https://godbolt.org/z/K8s4Mc>`_)
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
// test.cc
|
#include <fmt/chrono.h>
|
||||||
#include <fmt/format.h>
|
|
||||||
std::string s = format(FMT_STRING("{2}"), 42);
|
|
||||||
|
|
||||||
.. code::
|
int main() {
|
||||||
|
using namespace std::literals::chrono_literals;
|
||||||
$ c++ -Iinclude -std=c++14 test.cc
|
fmt::print("Default format: {} {}\n", 42s, 100ms);
|
||||||
...
|
fmt::print("strftime-like format: {:%H:%M:%S}\n", 3h + 15min + 30s);
|
||||||
test.cc:4:17: note: in instantiation of function template specialization 'fmt::v5::format<S, int>' requested here
|
|
||||||
std::string s = format(FMT_STRING("{2}"), 42);
|
|
||||||
^
|
|
||||||
include/fmt/core.h:778:19: note: non-constexpr function 'on_error' cannot be used in a constant expression
|
|
||||||
ErrorHandler::on_error(message);
|
|
||||||
^
|
|
||||||
include/fmt/format.h:2226:16: note: in call to '&checker.context_->on_error(&"argument index out of range"[0])'
|
|
||||||
context_.on_error("argument index out of range");
|
|
||||||
^
|
|
||||||
|
|
||||||
Use {fmt} as a safe portable replacement for ``itoa``
|
|
||||||
(`godbolt <https://godbolt.org/g/NXmpU4>`_):
|
|
||||||
|
|
||||||
.. code:: c++
|
|
||||||
|
|
||||||
fmt::memory_buffer buf;
|
|
||||||
format_to(buf, "{}", 42); // replaces itoa(42, buffer, 10)
|
|
||||||
format_to(buf, "{:x}", 42); // replaces itoa(42, buffer, 16)
|
|
||||||
// access the string with to_string(buf) or buf.data()
|
|
||||||
|
|
||||||
Format objects of user-defined types via a simple `extension API
|
|
||||||
<https://fmt.dev/latest/api.html#formatting-user-defined-types>`_:
|
|
||||||
|
|
||||||
.. code:: c++
|
|
||||||
|
|
||||||
#include "fmt/format.h"
|
|
||||||
|
|
||||||
struct date {
|
|
||||||
int year, month, day;
|
|
||||||
};
|
|
||||||
|
|
||||||
template <>
|
|
||||||
struct fmt::formatter<date> {
|
|
||||||
constexpr auto parse(format_parse_context& ctx) { return ctx.begin(); }
|
|
||||||
|
|
||||||
template <typename FormatContext>
|
|
||||||
auto format(const date& d, FormatContext& ctx) {
|
|
||||||
return format_to(ctx.out(), "{}-{}-{}", d.year, d.month, d.day);
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
std::string s = fmt::format("The date is {}", date{2012, 12, 9});
|
|
||||||
// s == "The date is 2012-12-9"
|
|
||||||
|
|
||||||
Create your own functions similar to `format
|
|
||||||
<https://fmt.dev/latest/api.html#format>`_ and
|
|
||||||
`print <https://fmt.dev/latest/api.html#print>`_
|
|
||||||
which take arbitrary arguments (`godbolt <https://godbolt.org/g/MHjHVf>`_):
|
|
||||||
|
|
||||||
.. code:: c++
|
|
||||||
|
|
||||||
// Prints formatted error message.
|
|
||||||
void vreport_error(const char* format, fmt::format_args args) {
|
|
||||||
fmt::print("Error: ");
|
|
||||||
fmt::vprint(format, args);
|
|
||||||
}
|
|
||||||
template <typename... Args>
|
|
||||||
void report_error(const char* format, const Args & ... args) {
|
|
||||||
vreport_error(format, fmt::make_format_args(args...));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
report_error("file not found: {}", path);
|
Output::
|
||||||
|
|
||||||
Note that ``vreport_error`` is not parameterized on argument types which can
|
Default format: 42s 100ms
|
||||||
improve compile times and reduce code size compared to a fully parameterized
|
strftime-like format: 03:15:30
|
||||||
version.
|
|
||||||
|
**Print a container** (`run <https://godbolt.org/z/MxM1YqjE7>`_)
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
#include <vector>
|
||||||
|
#include <fmt/ranges.h>
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
std::vector<int> v = {1, 2, 3};
|
||||||
|
fmt::print("{}\n", v);
|
||||||
|
}
|
||||||
|
|
||||||
|
Output::
|
||||||
|
|
||||||
|
[1, 2, 3]
|
||||||
|
|
||||||
|
**Check a format string at compile time**
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
std::string s = fmt::format("{:d}", "I am not a number");
|
||||||
|
|
||||||
|
This gives a compile-time error in C++20 because ``d`` is an invalid format
|
||||||
|
specifier for a string.
|
||||||
|
|
||||||
|
**Write a file from a single thread**
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
#include <fmt/os.h>
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
auto out = fmt::output_file("guide.txt");
|
||||||
|
out.print("Don't {}", "Panic");
|
||||||
|
}
|
||||||
|
|
||||||
|
This can be `5 to 9 times faster than fprintf
|
||||||
|
<http://www.zverovich.net/2020/08/04/optimal-file-buffer-size.html>`_.
|
||||||
|
|
||||||
|
**Print with colors and text styles**
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
#include <fmt/color.h>
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
fmt::print(fg(fmt::color::crimson) | fmt::emphasis::bold,
|
||||||
|
"Hello, {}!\n", "world");
|
||||||
|
fmt::print(fg(fmt::color::floral_white) | bg(fmt::color::slate_gray) |
|
||||||
|
fmt::emphasis::underline, "Hello, {}!\n", "мир");
|
||||||
|
fmt::print(fg(fmt::color::steel_blue) | fmt::emphasis::italic,
|
||||||
|
"Hello, {}!\n", "世界");
|
||||||
|
}
|
||||||
|
|
||||||
|
Output on a modern terminal:
|
||||||
|
|
||||||
|
.. image:: https://user-images.githubusercontent.com/
|
||||||
|
576385/88485597-d312f600-cf2b-11ea-9cbe-61f535a86e28.png
|
||||||
|
|
||||||
Benchmarks
|
Benchmarks
|
||||||
----------
|
----------
|
||||||
@ -174,18 +201,20 @@ Folly Format folly::format 2.23
|
|||||||
{fmt} is the fastest of the benchmarked methods, ~35% faster than ``printf``.
|
{fmt} is the fastest of the benchmarked methods, ~35% faster than ``printf``.
|
||||||
|
|
||||||
The above results were generated by building ``tinyformat_test.cpp`` on macOS
|
The above results were generated by building ``tinyformat_test.cpp`` on macOS
|
||||||
10.14.6 with ``clang++ -O3 -DSPEED_TEST -DHAVE_FORMAT``, and taking the best of
|
10.14.6 with ``clang++ -O3 -DNDEBUG -DSPEED_TEST -DHAVE_FORMAT``, and taking the
|
||||||
three runs. In the test, the format string ``"%0.10f:%04d:%+g:%s:%p:%c:%%\n"``
|
best of three runs. In the test, the format string ``"%0.10f:%04d:%+g:%s:%p:%c:%%\n"``
|
||||||
or equivalent is filled 2,000,000 times with output sent to ``/dev/null``; for
|
or equivalent is filled 2,000,000 times with output sent to ``/dev/null``; for
|
||||||
further details refer to the `source
|
further details refer to the `source
|
||||||
<https://github.com/fmtlib/format-benchmark/blob/master/tinyformat_test.cpp>`_.
|
<https://github.com/fmtlib/format-benchmark/blob/master/src/tinyformat-test.cc>`_.
|
||||||
|
|
||||||
{fmt} is 10x faster than ``std::ostringstream`` and ``sprintf`` on floating-point
|
{fmt} is up to 20-30x faster than ``std::ostringstream`` and ``sprintf`` on
|
||||||
formatting (`dtoa-benchmark <https://github.com/fmtlib/dtoa-benchmark>`_)
|
floating-point formatting (`dtoa-benchmark <https://github.com/fmtlib/dtoa-benchmark>`_)
|
||||||
and as fast as `double-conversion <https://github.com/google/double-conversion>`_:
|
and faster than `double-conversion <https://github.com/google/double-conversion>`_ and
|
||||||
|
`ryu <https://github.com/ulfjack/ryu>`_:
|
||||||
|
|
||||||
.. image:: https://user-images.githubusercontent.com/576385/69767160-cdaca400-112f-11ea-9fc5-347c9f83caad.png
|
.. image:: https://user-images.githubusercontent.com/576385/
|
||||||
:target: https://fmt.dev/unknown_mac64_clang10.0.html
|
95684665-11719600-0ba8-11eb-8e5b-972ff4e49428.png
|
||||||
|
:target: https://fmt.dev/unknown_mac64_clang12.0.html
|
||||||
|
|
||||||
Compile time and code bloat
|
Compile time and code bloat
|
||||||
~~~~~~~~~~~~~~~~~~~~~~~~~~~
|
~~~~~~~~~~~~~~~~~~~~~~~~~~~
|
||||||
@ -261,39 +290,45 @@ or the bloat test::
|
|||||||
|
|
||||||
$ make bloat-test
|
$ make bloat-test
|
||||||
|
|
||||||
|
Migrating code
|
||||||
|
--------------
|
||||||
|
|
||||||
|
`clang-tidy-fmt <https://github.com/mikecrowe/clang-tidy-fmt>`_ provides clang
|
||||||
|
tidy checks for converting occurrences of ``printf`` and ``fprintf`` to
|
||||||
|
``fmt::print``.
|
||||||
|
|
||||||
Projects using this library
|
Projects using this library
|
||||||
---------------------------
|
---------------------------
|
||||||
|
|
||||||
* `0 A.D. <https://play0ad.com/>`_: A free, open-source, cross-platform real-time
|
* `0 A.D. <https://play0ad.com/>`_: a free, open-source, cross-platform
|
||||||
strategy game
|
real-time strategy game
|
||||||
|
|
||||||
|
* `2GIS <https://2gis.ru/>`_: free business listings with a city map
|
||||||
|
|
||||||
* `AMPL/MP <https://github.com/ampl/mp>`_:
|
* `AMPL/MP <https://github.com/ampl/mp>`_:
|
||||||
An open-source library for mathematical programming
|
an open-source library for mathematical programming
|
||||||
|
|
||||||
* `AvioBook <https://www.aviobook.aero/en>`_: A comprehensive aircraft
|
* `Aseprite <https://github.com/aseprite/aseprite>`_:
|
||||||
|
animated sprite editor & pixel art tool
|
||||||
|
|
||||||
|
* `AvioBook <https://www.aviobook.aero/en>`_: a comprehensive aircraft
|
||||||
operations suite
|
operations suite
|
||||||
|
|
||||||
* `Celestia <https://celestia.space/>`_: Real-time 3D visualization of space
|
* `Blizzard Battle.net <https://battle.net/>`_: an online gaming platform
|
||||||
|
|
||||||
* `Ceph <https://ceph.com/>`_: A scalable distributed storage system
|
* `Celestia <https://celestia.space/>`_: real-time 3D visualization of space
|
||||||
|
|
||||||
* `ccache <https://ccache.dev/>`_: A compiler cache
|
* `Ceph <https://ceph.com/>`_: a scalable distributed storage system
|
||||||
|
|
||||||
* `CUAUV <http://cuauv.org/>`_: Cornell University's autonomous underwater
|
* `ccache <https://ccache.dev/>`_: a compiler cache
|
||||||
|
|
||||||
|
* `ClickHouse <https://github.com/ClickHouse/ClickHouse>`_: analytical database
|
||||||
|
management system
|
||||||
|
|
||||||
|
* `CUAUV <https://cuauv.org/>`_: Cornell University's autonomous underwater
|
||||||
vehicle
|
vehicle
|
||||||
|
|
||||||
* `HarpyWar/pvpgn <https://github.com/pvpgn/pvpgn-server>`_:
|
* `Drake <https://drake.mit.edu/>`_: a planning, control, and analysis toolbox
|
||||||
Player vs Player Gaming Network with tweaks
|
|
||||||
|
|
||||||
* `KBEngine <https://kbengine.org/>`_: An open-source MMOG server engine
|
|
||||||
|
|
||||||
* `Keypirinha <https://keypirinha.com/>`_: A semantic launcher for Windows
|
|
||||||
|
|
||||||
* `Kodi <https://kodi.tv/>`_ (formerly xbmc): Home theater software
|
|
||||||
|
|
||||||
* `Lifeline <https://github.com/peter-clark/lifeline>`_: A 2D game
|
|
||||||
|
|
||||||
* `Drake <https://drake.mit.edu/>`_: A planning, control, and analysis toolbox
|
|
||||||
for nonlinear dynamical systems (MIT)
|
for nonlinear dynamical systems (MIT)
|
||||||
|
|
||||||
* `Envoy <https://lyft.github.io/envoy/>`_: C++ L7 proxy and communication bus
|
* `Envoy <https://lyft.github.io/envoy/>`_: C++ L7 proxy and communication bus
|
||||||
@ -301,49 +336,86 @@ Projects using this library
|
|||||||
|
|
||||||
* `FiveM <https://fivem.net/>`_: a modification framework for GTA V
|
* `FiveM <https://fivem.net/>`_: a modification framework for GTA V
|
||||||
|
|
||||||
* `MongoDB <https://mongodb.com/>`_: Distributed document database
|
* `fmtlog <https://github.com/MengRao/fmtlog>`_: a performant fmtlib-style
|
||||||
|
logging library with latency in nanoseconds
|
||||||
|
|
||||||
* `MongoDB Smasher <https://github.com/duckie/mongo_smasher>`_: A small tool to
|
* `Folly <https://github.com/facebook/folly>`_: Facebook open-source library
|
||||||
|
|
||||||
|
* `GemRB <https://gemrb.org/>`_: a portable open-source implementation of
|
||||||
|
Bioware’s Infinity Engine
|
||||||
|
|
||||||
|
* `Grand Mountain Adventure
|
||||||
|
<https://store.steampowered.com/app/1247360/Grand_Mountain_Adventure/>`_:
|
||||||
|
a beautiful open-world ski & snowboarding game
|
||||||
|
|
||||||
|
* `HarpyWar/pvpgn <https://github.com/pvpgn/pvpgn-server>`_:
|
||||||
|
Player vs Player Gaming Network with tweaks
|
||||||
|
|
||||||
|
* `KBEngine <https://github.com/kbengine/kbengine>`_: an open-source MMOG server
|
||||||
|
engine
|
||||||
|
|
||||||
|
* `Keypirinha <https://keypirinha.com/>`_: a semantic launcher for Windows
|
||||||
|
|
||||||
|
* `Kodi <https://kodi.tv/>`_ (formerly xbmc): home theater software
|
||||||
|
|
||||||
|
* `Knuth <https://kth.cash/>`_: high-performance Bitcoin full-node
|
||||||
|
|
||||||
|
* `Microsoft Verona <https://github.com/microsoft/verona>`_:
|
||||||
|
research programming language for concurrent ownership
|
||||||
|
|
||||||
|
* `MongoDB <https://mongodb.com/>`_: distributed document database
|
||||||
|
|
||||||
|
* `MongoDB Smasher <https://github.com/duckie/mongo_smasher>`_: a small tool to
|
||||||
generate randomized datasets
|
generate randomized datasets
|
||||||
|
|
||||||
* `OpenSpace <https://openspaceproject.com/>`_: An open-source astrovisualization
|
* `OpenSpace <https://openspaceproject.com/>`_: an open-source
|
||||||
framework
|
astrovisualization framework
|
||||||
|
|
||||||
* `PenUltima Online (POL) <https://www.polserver.com/>`_:
|
* `PenUltima Online (POL) <https://www.polserver.com/>`_:
|
||||||
An MMO server, compatible with most Ultima Online clients
|
an MMO server, compatible with most Ultima Online clients
|
||||||
|
|
||||||
* `quasardb <https://www.quasardb.net/>`_: A distributed, high-performance,
|
* `PyTorch <https://github.com/pytorch/pytorch>`_: an open-source machine
|
||||||
|
learning library
|
||||||
|
|
||||||
|
* `quasardb <https://www.quasardb.net/>`_: a distributed, high-performance,
|
||||||
associative database
|
associative database
|
||||||
|
|
||||||
* `readpe <https://bitbucket.org/sys_dev/readpe>`_: Read Portable Executable
|
* `Quill <https://github.com/odygrd/quill>`_: asynchronous low-latency logging library
|
||||||
|
|
||||||
* `redis-cerberus <https://github.com/HunanTV/redis-cerberus>`_: A Redis cluster
|
* `QKW <https://github.com/ravijanjam/qkw>`_: generalizing aliasing to simplify
|
||||||
|
navigation, and executing complex multi-line terminal command sequences
|
||||||
|
|
||||||
|
* `redis-cerberus <https://github.com/HunanTV/redis-cerberus>`_: a Redis cluster
|
||||||
proxy
|
proxy
|
||||||
|
|
||||||
* `rpclib <http://rpclib.net/>`_: A modern C++ msgpack-RPC server and client
|
* `redpanda <https://vectorized.io/redpanda>`_: a 10x faster Kafka® replacement
|
||||||
|
for mission critical systems written in C++
|
||||||
|
|
||||||
|
* `rpclib <http://rpclib.net/>`_: a modern C++ msgpack-RPC server and client
|
||||||
library
|
library
|
||||||
|
|
||||||
* `Saddy <https://github.com/mamontov-cpp/saddy-graphics-engine-2d>`_:
|
* `Salesforce Analytics Cloud
|
||||||
Small crossplatform 2D graphic engine
|
<https://www.salesforce.com/analytics-cloud/overview/>`_:
|
||||||
|
business intelligence software
|
||||||
|
|
||||||
* `Salesforce Analytics Cloud <https://www.salesforce.com/analytics-cloud/overview/>`_:
|
* `Scylla <https://www.scylladb.com/>`_: a Cassandra-compatible NoSQL data store
|
||||||
Business intelligence software
|
|
||||||
|
|
||||||
* `Scylla <https://www.scylladb.com/>`_: A Cassandra-compatible NoSQL data store
|
|
||||||
that can handle 1 million transactions per second on a single server
|
that can handle 1 million transactions per second on a single server
|
||||||
|
|
||||||
* `Seastar <http://www.seastar-project.org/>`_: An advanced, open-source C++
|
* `Seastar <http://www.seastar-project.org/>`_: an advanced, open-source C++
|
||||||
framework for high-performance server applications on modern hardware
|
framework for high-performance server applications on modern hardware
|
||||||
|
|
||||||
* `spdlog <https://github.com/gabime/spdlog>`_: Super fast C++ logging library
|
* `spdlog <https://github.com/gabime/spdlog>`_: super fast C++ logging library
|
||||||
|
|
||||||
* `Stellar <https://www.stellar.org/>`_: Financial platform
|
* `Stellar <https://www.stellar.org/>`_: financial platform
|
||||||
|
|
||||||
* `Touch Surgery <https://www.touchsurgery.com/>`_: Surgery simulator
|
* `Touch Surgery <https://www.touchsurgery.com/>`_: surgery simulator
|
||||||
|
|
||||||
* `TrinityCore <https://github.com/TrinityCore/TrinityCore>`_: Open-source
|
* `TrinityCore <https://github.com/TrinityCore/TrinityCore>`_: open-source
|
||||||
MMORPG framework
|
MMORPG framework
|
||||||
|
|
||||||
|
* `Windows Terminal <https://github.com/microsoft/terminal>`_: the new Windows
|
||||||
|
terminal
|
||||||
|
|
||||||
`More... <https://github.com/search?q=fmtlib&type=Code>`_
|
`More... <https://github.com/search?q=fmtlib&type=Code>`_
|
||||||
|
|
||||||
If you are aware of other projects using this library, please let me know
|
If you are aware of other projects using this library, please let me know
|
||||||
@ -400,15 +472,15 @@ Boost Format
|
|||||||
|
|
||||||
This is a very powerful library which supports both ``printf``-like format
|
This is a very powerful library which supports both ``printf``-like format
|
||||||
strings and positional arguments. Its main drawback is performance. According to
|
strings and positional arguments. Its main drawback is performance. According to
|
||||||
various benchmarks it is much slower than other methods considered here. Boost
|
various benchmarks, it is much slower than other methods considered here. Boost
|
||||||
Format also has excessive build times and severe code bloat issues (see
|
Format also has excessive build times and severe code bloat issues (see
|
||||||
`Benchmarks`_).
|
`Benchmarks`_).
|
||||||
|
|
||||||
FastFormat
|
FastFormat
|
||||||
~~~~~~~~~~
|
~~~~~~~~~~
|
||||||
|
|
||||||
This is an interesting library which is fast, safe and has positional
|
This is an interesting library which is fast, safe and has positional arguments.
|
||||||
arguments. However it has significant limitations, citing its author:
|
However, it has significant limitations, citing its author:
|
||||||
|
|
||||||
Three features that have no hope of being accommodated within the
|
Three features that have no hope of being accommodated within the
|
||||||
current design are:
|
current design are:
|
||||||
@ -417,8 +489,8 @@ arguments. However it has significant limitations, citing its author:
|
|||||||
* Octal/hexadecimal encoding
|
* Octal/hexadecimal encoding
|
||||||
* Runtime width/alignment specification
|
* Runtime width/alignment specification
|
||||||
|
|
||||||
It is also quite big and has a heavy dependency, STLSoft, which might be
|
It is also quite big and has a heavy dependency, STLSoft, which might be too
|
||||||
too restrictive for using it in some projects.
|
restrictive for using it in some projects.
|
||||||
|
|
||||||
Boost Spirit.Karma
|
Boost Spirit.Karma
|
||||||
~~~~~~~~~~~~~~~~~~
|
~~~~~~~~~~~~~~~~~~
|
||||||
@ -426,32 +498,9 @@ Boost Spirit.Karma
|
|||||||
This is not really a formatting library but I decided to include it here for
|
This is not really a formatting library but I decided to include it here for
|
||||||
completeness. As iostreams, it suffers from the problem of mixing verbatim text
|
completeness. As iostreams, it suffers from the problem of mixing verbatim text
|
||||||
with arguments. The library is pretty fast, but slower on integer formatting
|
with arguments. The library is pretty fast, but slower on integer formatting
|
||||||
than ``fmt::format_int`` on Karma's own benchmark,
|
than ``fmt::format_to`` with format string compilation on Karma's own benchmark,
|
||||||
see `Fast integer to string conversion in C++
|
see `Converting a hundred million integers to strings per second
|
||||||
<http://zverovich.net/2013/09/07/integer-to-string-conversion-in-cplusplus.html>`_.
|
<http://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html>`_.
|
||||||
|
|
||||||
FAQ
|
|
||||||
---
|
|
||||||
|
|
||||||
Q: how can I capture formatting arguments and format them later?
|
|
||||||
|
|
||||||
A: use ``std::tuple``:
|
|
||||||
|
|
||||||
.. code:: c++
|
|
||||||
|
|
||||||
template <typename... Args>
|
|
||||||
auto capture(const Args&... args) {
|
|
||||||
return std::make_tuple(args...);
|
|
||||||
}
|
|
||||||
|
|
||||||
auto print_message = [](const auto&... args) {
|
|
||||||
fmt::print(args...);
|
|
||||||
};
|
|
||||||
|
|
||||||
// Capture and store arguments:
|
|
||||||
auto args = capture("{} {}", 42, "foo");
|
|
||||||
// Do formatting:
|
|
||||||
std::apply(print_message, args);
|
|
||||||
|
|
||||||
License
|
License
|
||||||
-------
|
-------
|
||||||
@ -459,18 +508,19 @@ License
|
|||||||
{fmt} is distributed under the MIT `license
|
{fmt} is distributed under the MIT `license
|
||||||
<https://github.com/fmtlib/fmt/blob/master/LICENSE.rst>`_.
|
<https://github.com/fmtlib/fmt/blob/master/LICENSE.rst>`_.
|
||||||
|
|
||||||
The `Format String Syntax
|
Documentation License
|
||||||
<https://fmt.dev/latest/syntax.html>`_
|
---------------------
|
||||||
section in the documentation is based on the one from Python `string module
|
|
||||||
documentation <https://docs.python.org/3/library/string.html#module-string>`_
|
|
||||||
adapted for the current library. For this reason the documentation is
|
|
||||||
distributed under the Python Software Foundation license available in
|
|
||||||
`doc/python-license.txt
|
|
||||||
<https://raw.github.com/fmtlib/fmt/master/doc/python-license.txt>`_.
|
|
||||||
It only applies if you distribute the documentation of fmt.
|
|
||||||
|
|
||||||
Acknowledgments
|
The `Format String Syntax <https://fmt.dev/latest/syntax.html>`_
|
||||||
---------------
|
section in the documentation is based on the one from Python `string module
|
||||||
|
documentation <https://docs.python.org/3/library/string.html#module-string>`_.
|
||||||
|
For this reason the documentation is distributed under the Python Software
|
||||||
|
Foundation license available in `doc/python-license.txt
|
||||||
|
<https://raw.github.com/fmtlib/fmt/master/doc/python-license.txt>`_.
|
||||||
|
It only applies if you distribute the documentation of {fmt}.
|
||||||
|
|
||||||
|
Maintainers
|
||||||
|
-----------
|
||||||
|
|
||||||
The {fmt} library is maintained by Victor Zverovich (`vitaut
|
The {fmt} library is maintained by Victor Zverovich (`vitaut
|
||||||
<https://github.com/vitaut>`_) and Jonathan Müller (`foonathan
|
<https://github.com/vitaut>`_) and Jonathan Müller (`foonathan
|
||||||
@ -479,23 +529,3 @@ See `Contributors <https://github.com/fmtlib/fmt/graphs/contributors>`_ and
|
|||||||
`Releases <https://github.com/fmtlib/fmt/releases>`_ for some of the names.
|
`Releases <https://github.com/fmtlib/fmt/releases>`_ for some of the names.
|
||||||
Let us know if your contribution is not listed or mentioned incorrectly and
|
Let us know if your contribution is not listed or mentioned incorrectly and
|
||||||
we'll make it right.
|
we'll make it right.
|
||||||
|
|
||||||
The benchmark section of this readme file and the performance tests are taken
|
|
||||||
from the excellent `tinyformat <https://github.com/c42f/tinyformat>`_ library
|
|
||||||
written by Chris Foster. Boost Format library is acknowledged transitively
|
|
||||||
since it had some influence on tinyformat.
|
|
||||||
Some ideas used in the implementation are borrowed from `Loki
|
|
||||||
<http://loki-lib.sourceforge.net/>`_ SafeFormat and `Diagnostic API
|
|
||||||
<https://clang.llvm.org/doxygen/classclang_1_1Diagnostic.html>`_ in
|
|
||||||
`Clang <https://clang.llvm.org/>`_.
|
|
||||||
Format string syntax and the documentation are based on Python's `str.format
|
|
||||||
<https://docs.python.org/3/library/stdtypes.html#str.format>`_.
|
|
||||||
Thanks `Doug Turnbull <https://github.com/softwaredoug>`_ for his valuable
|
|
||||||
comments and contribution to the design of the type-safe API and
|
|
||||||
`Gregory Czajkowski <https://github.com/gcflymoto>`_ for implementing binary
|
|
||||||
formatting. Thanks `Ruslan Baratov <https://github.com/ruslo>`_ for comprehensive
|
|
||||||
`comparison of integer formatting algorithms <https://github.com/ruslo/int-dec-format-tests>`_
|
|
||||||
and useful comments regarding performance, `Boris Kaul <https://github.com/localvoid>`_ for
|
|
||||||
`C++ counting digits benchmark <https://github.com/localvoid/cxx-benchmark-count-digits>`_.
|
|
||||||
Thanks to `CarterLi <https://github.com/CarterLi>`_ for contributing various
|
|
||||||
improvements to the code.
|
|
||||||
|
20
externals/fmt/doc/CMakeLists.txt
vendored
20
externals/fmt/doc/CMakeLists.txt
vendored
@ -1,12 +1,26 @@
|
|||||||
find_program(DOXYGEN doxygen)
|
find_program(DOXYGEN doxygen
|
||||||
|
PATHS "$ENV{ProgramFiles}/doxygen/bin"
|
||||||
|
"$ENV{ProgramFiles\(x86\)}/doxygen/bin")
|
||||||
if (NOT DOXYGEN)
|
if (NOT DOXYGEN)
|
||||||
message(STATUS "Target 'doc' disabled (requires doxygen)")
|
message(STATUS "Target 'doc' disabled (requires doxygen)")
|
||||||
return ()
|
return ()
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
|
# Find the Python interpreter and set the PYTHON_EXECUTABLE variable.
|
||||||
|
if (CMAKE_VERSION VERSION_LESS 3.12)
|
||||||
|
# This logic is deprecated in CMake after 3.12.
|
||||||
|
find_package(PythonInterp QUIET REQUIRED)
|
||||||
|
else ()
|
||||||
|
find_package(Python QUIET REQUIRED)
|
||||||
|
set(PYTHON_EXECUTABLE ${Python_EXECUTABLE})
|
||||||
|
endif ()
|
||||||
|
|
||||||
add_custom_target(doc
|
add_custom_target(doc
|
||||||
COMMAND ${CMAKE_CURRENT_SOURCE_DIR}/build.py ${FMT_VERSION}
|
COMMAND ${PYTHON_EXECUTABLE} ${CMAKE_CURRENT_SOURCE_DIR}/build.py
|
||||||
|
${FMT_VERSION}
|
||||||
SOURCES api.rst syntax.rst usage.rst build.py conf.py _templates/layout.html)
|
SOURCES api.rst syntax.rst usage.rst build.py conf.py _templates/layout.html)
|
||||||
|
|
||||||
|
include(GNUInstallDirs)
|
||||||
install(DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/html/
|
install(DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/html/
|
||||||
DESTINATION share/doc/fmt OPTIONAL)
|
DESTINATION ${CMAKE_INSTALL_DATAROOTDIR}/doc/fmt OPTIONAL
|
||||||
|
PATTERN ".doctrees" EXCLUDE)
|
||||||
|
28
externals/fmt/doc/_static/breathe.css
vendored
28
externals/fmt/doc/_static/breathe.css
vendored
@ -1,28 +0,0 @@
|
|||||||
|
|
||||||
/* -- breathe specific styles ----------------------------------------------- */
|
|
||||||
|
|
||||||
/* So enum value descriptions are displayed inline to the item */
|
|
||||||
.breatheenumvalues li tt + p {
|
|
||||||
display: inline;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* So parameter descriptions are displayed inline to the item */
|
|
||||||
.breatheparameterlist li tt + p {
|
|
||||||
display: inline;
|
|
||||||
}
|
|
||||||
|
|
||||||
.container .breathe-sectiondef {
|
|
||||||
width: inherit;
|
|
||||||
}
|
|
||||||
|
|
||||||
.github-btn {
|
|
||||||
border: 0;
|
|
||||||
overflow: hidden;
|
|
||||||
}
|
|
||||||
|
|
||||||
.jumbotron {
|
|
||||||
background-size: 100% 4px;
|
|
||||||
background-repeat: repeat-y;
|
|
||||||
color: white;
|
|
||||||
text-align: center;
|
|
||||||
}
|
|
13
externals/fmt/doc/_templates/layout.html
vendored
13
externals/fmt/doc/_templates/layout.html
vendored
@ -6,14 +6,13 @@
|
|||||||
<meta name="author" content="Victor Zverovich">
|
<meta name="author" content="Victor Zverovich">
|
||||||
<link rel="stylesheet" href="_static/fmt.css">
|
<link rel="stylesheet" href="_static/fmt.css">
|
||||||
{# Google Analytics #}
|
{# Google Analytics #}
|
||||||
|
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
|
||||||
<script>
|
<script>
|
||||||
(function(i,s,o,g,r,a,m){i['GoogleAnalyticsObject']=r;i[r]=i[r]||function(){
|
window.dataLayer = window.dataLayer || [];
|
||||||
(i[r].q=i[r].q||[]).push(arguments)},i[r].l=1*new Date();
|
function gtag(){dataLayer.push(arguments);}
|
||||||
a=s.createElement(o),m=s.getElementsByTagName(o)[0];a.async=1;
|
gtag('js', new Date());
|
||||||
a.src=g;m.parentNode.insertBefore(a,m)
|
|
||||||
})(window,document,'script','//www.google-analytics.com/analytics.js','ga');
|
gtag('config', 'UA-20116650-4');
|
||||||
ga('create', 'UA-20116650-4', 'fmtlib.net');
|
|
||||||
ga('send', 'pageview');
|
|
||||||
</script>
|
</script>
|
||||||
{% endblock %}
|
{% endblock %}
|
||||||
|
|
||||||
|
474
externals/fmt/doc/api.rst
vendored
474
externals/fmt/doc/api.rst
vendored
@ -6,15 +6,19 @@ API Reference
|
|||||||
|
|
||||||
The {fmt} library API consists of the following parts:
|
The {fmt} library API consists of the following parts:
|
||||||
|
|
||||||
* :ref:`fmt/core.h <core-api>`: the core API providing argument handling
|
* :ref:`fmt/core.h <core-api>`: the core API providing main formatting functions
|
||||||
facilities and a lightweight subset of formatting functions
|
for ``char``/UTF-8 with C++20 compile-time checks and minimal dependencies
|
||||||
* :ref:`fmt/format.h <format-api>`: the full format API providing compile-time
|
* :ref:`fmt/format.h <format-api>`: the full format API providing additional
|
||||||
format string checks, output iterator and user-defined type support
|
formatting functions and locale support
|
||||||
* :ref:`fmt/ranges.h <ranges-api>`: additional formatting support for ranges
|
* :ref:`fmt/ranges.h <ranges-api>`: formatting of ranges and tuples
|
||||||
and tuples
|
|
||||||
* :ref:`fmt/chrono.h <chrono-api>`: date and time formatting
|
* :ref:`fmt/chrono.h <chrono-api>`: date and time formatting
|
||||||
|
* :ref:`fmt/std.h <std-api>`: formatters for standard library types
|
||||||
|
* :ref:`fmt/compile.h <compile-api>`: format string compilation
|
||||||
|
* :ref:`fmt/color.h <color-api>`: terminal color and text style
|
||||||
|
* :ref:`fmt/os.h <os-api>`: system APIs
|
||||||
* :ref:`fmt/ostream.h <ostream-api>`: ``std::ostream`` support
|
* :ref:`fmt/ostream.h <ostream-api>`: ``std::ostream`` support
|
||||||
* :ref:`fmt/printf.h <printf-api>`: ``printf`` formatting
|
* :ref:`fmt/printf.h <printf-api>`: ``printf`` formatting
|
||||||
|
* :ref:`fmt/xchar.h <xchar-api>`: optional ``wchar_t`` support
|
||||||
|
|
||||||
All functions and types provided by the library reside in namespace ``fmt`` and
|
All functions and types provided by the library reside in namespace ``fmt`` and
|
||||||
macros have prefix ``FMT_``.
|
macros have prefix ``FMT_``.
|
||||||
@ -24,34 +28,65 @@ macros have prefix ``FMT_``.
|
|||||||
Core API
|
Core API
|
||||||
========
|
========
|
||||||
|
|
||||||
``fmt/core.h`` defines the core API which provides argument handling facilities
|
``fmt/core.h`` defines the core API which provides main formatting functions
|
||||||
and a lightweight subset of formatting functions. In the header-only mode
|
for ``char``/UTF-8 with C++20 compile-time checks. It has minimal include
|
||||||
include ``fmt/format.h`` instead of ``fmt/core.h``.
|
dependencies for better compile times. This header is only beneficial when
|
||||||
|
using {fmt} as a library and not in the header-only mode.
|
||||||
|
|
||||||
The following functions use :ref:`format string syntax <syntax>`
|
The following functions use :ref:`format string syntax <syntax>`
|
||||||
similar to that of Python's `str.format
|
similar to that of Python's `str.format
|
||||||
<http://docs.python.org/3/library/stdtypes.html#str.format>`_.
|
<https://docs.python.org/3/library/stdtypes.html#str.format>`_.
|
||||||
They take *format_str* and *args* as arguments.
|
They take *fmt* and *args* as arguments.
|
||||||
|
|
||||||
*format_str* is a format string that contains literal text and replacement
|
*fmt* is a format string that contains literal text and replacement fields
|
||||||
fields surrounded by braces ``{}``. The fields are replaced with formatted
|
surrounded by braces ``{}``. The fields are replaced with formatted arguments
|
||||||
arguments in the resulting string. A function taking *format_str* doesn't
|
in the resulting string. `~fmt::format_string` is a format string which can be
|
||||||
participate in an overload resolution if the latter is not a string.
|
implicitly constructed from a string literal or a ``constexpr`` string and is
|
||||||
|
checked at compile time in C++20. To pass a runtime format string wrap it in
|
||||||
|
`fmt::runtime`.
|
||||||
|
|
||||||
*args* is an argument list representing objects to be formatted.
|
*args* is an argument list representing objects to be formatted.
|
||||||
|
|
||||||
.. _format:
|
.. _format:
|
||||||
|
|
||||||
.. doxygenfunction:: format(const S&, Args&&...)
|
.. doxygenfunction:: format(format_string<T...> fmt, T&&... args) -> std::string
|
||||||
.. doxygenfunction:: vformat(const S&, basic_format_args<buffer_context<Char>>)
|
.. doxygenfunction:: vformat(string_view fmt, format_args args) -> std::string
|
||||||
|
|
||||||
|
.. doxygenfunction:: format_to(OutputIt out, format_string<T...> fmt, T&&... args) -> OutputIt
|
||||||
|
.. doxygenfunction:: format_to_n(OutputIt out, size_t n, format_string<T...> fmt, T&&... args) -> format_to_n_result<OutputIt>
|
||||||
|
.. doxygenfunction:: formatted_size(format_string<T...> fmt, T&&... args) -> size_t
|
||||||
|
|
||||||
|
.. doxygenstruct:: fmt::format_to_n_result
|
||||||
|
:members:
|
||||||
|
|
||||||
.. _print:
|
.. _print:
|
||||||
|
|
||||||
.. doxygenfunction:: print(const S&, Args&&...)
|
.. doxygenfunction:: fmt::print(format_string<T...> fmt, T&&... args)
|
||||||
.. doxygenfunction:: vprint(string_view, format_args)
|
.. doxygenfunction:: fmt::vprint(string_view fmt, format_args args)
|
||||||
|
|
||||||
.. doxygenfunction:: print(std::FILE *, const S&, Args&&...)
|
.. doxygenfunction:: print(std::FILE *f, format_string<T...> fmt, T&&... args)
|
||||||
.. doxygenfunction:: vprint(std::FILE *, string_view, format_args)
|
.. doxygenfunction:: vprint(std::FILE *f, string_view fmt, format_args args)
|
||||||
|
|
||||||
|
Compile-Time Format String Checks
|
||||||
|
---------------------------------
|
||||||
|
|
||||||
|
Compile-time checks are enabled by default on compilers that support C++20
|
||||||
|
``consteval``. On older compilers you can use the ``FMT_STRING`` macro defined
|
||||||
|
in ``fmt/format.h`` instead. It requires C++14 and is a no-op in C++11.
|
||||||
|
|
||||||
|
.. doxygendefine:: FMT_STRING
|
||||||
|
|
||||||
|
To force the use of legacy compile-time checks, define the preprocessor variable
|
||||||
|
``FMT_ENFORCE_COMPILE_STRING``. When set, functions accepting ``FMT_STRING``
|
||||||
|
will fail to compile with regular strings. Runtime-checked formatting is still
|
||||||
|
possible using ``fmt::vformat``, ``fmt::vprint``, etc.
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_format_string
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::format_string
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::runtime(string_view) -> basic_runtime<char>
|
||||||
|
|
||||||
Named Arguments
|
Named Arguments
|
||||||
---------------
|
---------------
|
||||||
@ -63,19 +98,56 @@ Named arguments are not supported in compile-time checks at the moment.
|
|||||||
Argument Lists
|
Argument Lists
|
||||||
--------------
|
--------------
|
||||||
|
|
||||||
|
You can create your own formatting function with compile-time checks and small
|
||||||
|
binary footprint, for example (https://godbolt.org/z/oba4Mc):
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
#include <fmt/format.h>
|
||||||
|
|
||||||
|
void vlog(const char* file, int line, fmt::string_view format,
|
||||||
|
fmt::format_args args) {
|
||||||
|
fmt::print("{}: {}: ", file, line);
|
||||||
|
fmt::vprint(format, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename S, typename... Args>
|
||||||
|
void log(const char* file, int line, const S& format, Args&&... args) {
|
||||||
|
vlog(file, line, format, fmt::make_format_args(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
#define MY_LOG(format, ...) \
|
||||||
|
log(__FILE__, __LINE__, FMT_STRING(format), __VA_ARGS__)
|
||||||
|
|
||||||
|
MY_LOG("invalid squishiness: {}", 42);
|
||||||
|
|
||||||
|
Note that ``vlog`` is not parameterized on argument types which improves compile
|
||||||
|
times and reduces binary code size compared to a fully parameterized version.
|
||||||
|
|
||||||
.. doxygenfunction:: fmt::make_format_args(const Args&...)
|
.. doxygenfunction:: fmt::make_format_args(const Args&...)
|
||||||
|
|
||||||
.. doxygenclass:: fmt::format_arg_store
|
.. doxygenclass:: fmt::format_arg_store
|
||||||
:members:
|
:members:
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::dynamic_format_arg_store
|
||||||
|
:members:
|
||||||
|
|
||||||
.. doxygenclass:: fmt::basic_format_args
|
.. doxygenclass:: fmt::basic_format_args
|
||||||
:members:
|
:members:
|
||||||
|
|
||||||
.. doxygenstruct:: fmt::format_args
|
.. doxygentypedef:: fmt::format_args
|
||||||
|
|
||||||
.. doxygenclass:: fmt::basic_format_arg
|
.. doxygenclass:: fmt::basic_format_arg
|
||||||
:members:
|
:members:
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_format_parse_context
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_format_context
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::format_context
|
||||||
|
|
||||||
Compatibility
|
Compatibility
|
||||||
-------------
|
-------------
|
||||||
|
|
||||||
@ -83,12 +155,11 @@ Compatibility
|
|||||||
:members:
|
:members:
|
||||||
|
|
||||||
.. doxygentypedef:: fmt::string_view
|
.. doxygentypedef:: fmt::string_view
|
||||||
.. doxygentypedef:: fmt::wstring_view
|
|
||||||
|
|
||||||
Locale
|
Locale
|
||||||
------
|
------
|
||||||
|
|
||||||
All formatting is locale-independent by default. Use the ``'n'`` format
|
All formatting is locale-independent by default. Use the ``'L'`` format
|
||||||
specifier to insert the appropriate number separator characters from the
|
specifier to insert the appropriate number separator characters from the
|
||||||
locale::
|
locale::
|
||||||
|
|
||||||
@ -96,42 +167,42 @@ locale::
|
|||||||
#include <locale>
|
#include <locale>
|
||||||
|
|
||||||
std::locale::global(std::locale("en_US.UTF-8"));
|
std::locale::global(std::locale("en_US.UTF-8"));
|
||||||
auto s = fmt::format("{:n}", 1000000); // s == "1,000,000"
|
auto s = fmt::format("{:L}", 1000000); // s == "1,000,000"
|
||||||
|
|
||||||
.. _format-api:
|
.. _format-api:
|
||||||
|
|
||||||
Format API
|
Format API
|
||||||
==========
|
==========
|
||||||
|
|
||||||
``fmt/format.h`` defines the full format API providing compile-time format
|
``fmt/format.h`` defines the full format API providing additional formatting
|
||||||
string checks, output iterator and user-defined type support.
|
functions and locale support.
|
||||||
|
|
||||||
Compile-time Format String Checks
|
.. _udt:
|
||||||
---------------------------------
|
|
||||||
|
|
||||||
Compile-time checks are supported for built-in and string types as well as
|
Formatting User-Defined Types
|
||||||
user-defined types with ``constexpr`` ``parse`` functions in their ``formatter``
|
|
||||||
specializations.
|
|
||||||
|
|
||||||
.. doxygendefine:: FMT_STRING
|
|
||||||
|
|
||||||
Formatting User-defined Types
|
|
||||||
-----------------------------
|
-----------------------------
|
||||||
|
|
||||||
|
The {fmt} library provides formatters for many standard C++ types.
|
||||||
|
See :ref:`fmt/ranges.h <ranges-api>` for ranges and tuples including standard
|
||||||
|
containers such as ``std::vector``, :ref:`fmt/chrono.h <chrono-api>` for date
|
||||||
|
and time formatting and :ref:`fmt/std.h <std-api>` for path and variant
|
||||||
|
formatting.
|
||||||
|
|
||||||
To make a user-defined type formattable, specialize the ``formatter<T>`` struct
|
To make a user-defined type formattable, specialize the ``formatter<T>`` struct
|
||||||
template and implement ``parse`` and ``format`` methods::
|
template and implement ``parse`` and ``format`` methods::
|
||||||
|
|
||||||
#include <fmt/format.h>
|
#include <fmt/format.h>
|
||||||
|
|
||||||
struct point { double x, y; };
|
struct point {
|
||||||
|
double x, y;
|
||||||
|
};
|
||||||
|
|
||||||
template <>
|
template <> struct fmt::formatter<point> {
|
||||||
struct fmt::formatter<point> {
|
|
||||||
// Presentation format: 'f' - fixed, 'e' - exponential.
|
// Presentation format: 'f' - fixed, 'e' - exponential.
|
||||||
char presentation = 'f';
|
char presentation = 'f';
|
||||||
|
|
||||||
// Parses format specifications of the form ['f' | 'e'].
|
// Parses format specifications of the form ['f' | 'e'].
|
||||||
constexpr auto parse(format_parse_context& ctx) {
|
constexpr auto parse(format_parse_context& ctx) -> decltype(ctx.begin()) {
|
||||||
// [ctx.begin(), ctx.end()) is a character range that contains a part of
|
// [ctx.begin(), ctx.end()) is a character range that contains a part of
|
||||||
// the format string starting from the format specifications to be parsed,
|
// the format string starting from the format specifications to be parsed,
|
||||||
// e.g. in
|
// e.g. in
|
||||||
@ -143,13 +214,16 @@ template and implement ``parse`` and ``format`` methods::
|
|||||||
// the formatter should parse the 'f' specifier and return an iterator
|
// the formatter should parse the 'f' specifier and return an iterator
|
||||||
// pointing to '}'.
|
// pointing to '}'.
|
||||||
|
|
||||||
|
// Please also note that this character range may be empty, in case of
|
||||||
|
// the "{}" format string, so therefore you should check ctx.begin()
|
||||||
|
// for equality with ctx.end().
|
||||||
|
|
||||||
// Parse the presentation format and store it in the formatter:
|
// Parse the presentation format and store it in the formatter:
|
||||||
auto it = ctx.begin(), end = ctx.end();
|
auto it = ctx.begin(), end = ctx.end();
|
||||||
if (it != end && (*it == 'f' || *it == 'e')) presentation = *it++;
|
if (it != end && (*it == 'f' || *it == 'e')) presentation = *it++;
|
||||||
|
|
||||||
// Check if reached the end of the range:
|
// Check if reached the end of the range:
|
||||||
if (it != end && *it != '}')
|
if (it != end && *it != '}') throw format_error("invalid format");
|
||||||
throw format_error("invalid format");
|
|
||||||
|
|
||||||
// Return an iterator past the end of the parsed range:
|
// Return an iterator past the end of the parsed range:
|
||||||
return it;
|
return it;
|
||||||
@ -158,12 +232,11 @@ template and implement ``parse`` and ``format`` methods::
|
|||||||
// Formats the point p using the parsed format specification (presentation)
|
// Formats the point p using the parsed format specification (presentation)
|
||||||
// stored in this formatter.
|
// stored in this formatter.
|
||||||
template <typename FormatContext>
|
template <typename FormatContext>
|
||||||
auto format(const point& p, FormatContext& ctx) {
|
auto format(const point& p, FormatContext& ctx) const -> decltype(ctx.out()) {
|
||||||
// ctx.out() is an output iterator to write to.
|
// ctx.out() is an output iterator to write to.
|
||||||
return format_to(
|
return presentation == 'f'
|
||||||
ctx.out(),
|
? fmt::format_to(ctx.out(), "({:.1f}, {:.1f})", p.x, p.y)
|
||||||
presentation == 'f' ? "({:.1f}, {:.1f})" : "({:.1e}, {:.1e})",
|
: fmt::format_to(ctx.out(), "({:.1e}, {:.1e})", p.x, p.y);
|
||||||
p.x, p.y);
|
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
@ -178,11 +251,10 @@ example::
|
|||||||
|
|
||||||
enum class color {red, green, blue};
|
enum class color {red, green, blue};
|
||||||
|
|
||||||
template <>
|
template <> struct fmt::formatter<color>: formatter<string_view> {
|
||||||
struct fmt::formatter<color>: formatter<string_view> {
|
|
||||||
// parse is inherited from formatter<string_view>.
|
// parse is inherited from formatter<string_view>.
|
||||||
template <typename FormatContext>
|
template <typename FormatContext>
|
||||||
auto format(color c, FormatContext& ctx) {
|
auto format(color c, FormatContext& ctx) const {
|
||||||
string_view name = "unknown";
|
string_view name = "unknown";
|
||||||
switch (c) {
|
switch (c) {
|
||||||
case color::red: name = "red"; break;
|
case color::red: name = "red"; break;
|
||||||
@ -193,6 +265,15 @@ example::
|
|||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
|
Since ``parse`` is inherited from ``formatter<string_view>`` it will recognize
|
||||||
|
all string format specifications, for example
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
fmt::format("{:>10}", color::blue)
|
||||||
|
|
||||||
|
will return ``" blue"``.
|
||||||
|
|
||||||
You can also write a formatter for a hierarchy of classes::
|
You can also write a formatter for a hierarchy of classes::
|
||||||
|
|
||||||
#include <type_traits>
|
#include <type_traits>
|
||||||
@ -211,7 +292,7 @@ You can also write a formatter for a hierarchy of classes::
|
|||||||
struct fmt::formatter<T, std::enable_if_t<std::is_base_of<A, T>::value, char>> :
|
struct fmt::formatter<T, std::enable_if_t<std::is_base_of<A, T>::value, char>> :
|
||||||
fmt::formatter<std::string> {
|
fmt::formatter<std::string> {
|
||||||
template <typename FormatCtx>
|
template <typename FormatCtx>
|
||||||
auto format(const A& a, FormatCtx& ctx) {
|
auto format(const A& a, FormatCtx& ctx) const {
|
||||||
return fmt::formatter<std::string>::format(a.name(), ctx);
|
return fmt::formatter<std::string>::format(a.name(), ctx);
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -222,44 +303,56 @@ You can also write a formatter for a hierarchy of classes::
|
|||||||
fmt::print("{}", a); // prints "B"
|
fmt::print("{}", a); // prints "B"
|
||||||
}
|
}
|
||||||
|
|
||||||
.. doxygenclass:: fmt::basic_format_parse_context
|
If a type provides both a ``formatter`` specialization and an implicit
|
||||||
:members:
|
conversion to a formattable type, the specialization takes precedence over the
|
||||||
|
conversion.
|
||||||
|
|
||||||
Output Iterator Support
|
For enums {fmt} also provides the ``format_as`` extension API. To format an enum
|
||||||
-----------------------
|
via this API define ``format_as`` that takes this enum and converts it to the
|
||||||
|
underlying type. ``format_as`` should be defined in the same namespace as the
|
||||||
|
enum.
|
||||||
|
|
||||||
.. doxygenfunction:: fmt::format_to(OutputIt, const S&, Args&&...)
|
Example (https://godbolt.org/z/r7vvGE1v7)::
|
||||||
.. doxygenfunction:: fmt::format_to_n(OutputIt, std::size_t, string_view, Args&&...)
|
|
||||||
.. doxygenstruct:: fmt::format_to_n_result
|
|
||||||
:members:
|
|
||||||
|
|
||||||
Literal-based API
|
#include <fmt/format.h>
|
||||||
|
|
||||||
|
namespace kevin_namespacy {
|
||||||
|
enum class film {
|
||||||
|
house_of_cards, american_beauty, se7en = 7
|
||||||
|
};
|
||||||
|
auto format_as(film f) { return fmt::underlying(f); }
|
||||||
|
}
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
fmt::print("{}\n", kevin_namespacy::film::se7en); // prints "7"
|
||||||
|
}
|
||||||
|
|
||||||
|
Literal-Based API
|
||||||
-----------------
|
-----------------
|
||||||
|
|
||||||
The following user-defined literals are defined in ``fmt/format.h``.
|
The following user-defined literals are defined in ``fmt/format.h``.
|
||||||
|
|
||||||
.. doxygenfunction:: operator""_format(const char *, std::size_t)
|
.. doxygenfunction:: operator""_a()
|
||||||
|
|
||||||
.. doxygenfunction:: operator""_a(const char *, std::size_t)
|
|
||||||
|
|
||||||
Utilities
|
Utilities
|
||||||
---------
|
---------
|
||||||
|
|
||||||
.. doxygenstruct:: fmt::is_char
|
.. doxygenfunction:: fmt::ptr(T p) -> const void*
|
||||||
|
.. doxygenfunction:: fmt::ptr(const std::unique_ptr<T> &p) -> const void*
|
||||||
|
.. doxygenfunction:: fmt::ptr(const std::shared_ptr<T> &p) -> const void*
|
||||||
|
|
||||||
.. doxygentypedef:: fmt::char_t
|
.. doxygenfunction:: fmt::underlying(Enum e) -> typename std::underlying_type<Enum>::type
|
||||||
|
|
||||||
.. doxygenfunction:: fmt::formatted_size(string_view, const Args&...)
|
.. doxygenfunction:: fmt::to_string(const T &value) -> std::string
|
||||||
|
|
||||||
.. doxygenfunction:: fmt::to_string(const T&)
|
.. doxygenfunction:: fmt::join(Range &&range, string_view sep) -> join_view<detail::iterator_t<Range>, detail::sentinel_t<Range>>
|
||||||
|
|
||||||
.. doxygenfunction:: fmt::to_wstring(const T&)
|
.. doxygenfunction:: fmt::join(It begin, Sentinel end, string_view sep) -> join_view<It, Sentinel>
|
||||||
|
|
||||||
.. doxygenfunction:: fmt::to_string_view(const Char *)
|
.. doxygenfunction:: fmt::group_digits(T value) -> group_digits_view<T>
|
||||||
|
|
||||||
.. doxygenfunction:: fmt::join(const Range&, string_view)
|
.. doxygenclass:: fmt::detail::buffer
|
||||||
|
:members:
|
||||||
.. doxygenfunction:: fmt::join(It, It, string_view)
|
|
||||||
|
|
||||||
.. doxygenclass:: fmt::basic_memory_buffer
|
.. doxygenclass:: fmt::basic_memory_buffer
|
||||||
:protected-members:
|
:protected-members:
|
||||||
@ -268,20 +361,14 @@ Utilities
|
|||||||
System Errors
|
System Errors
|
||||||
-------------
|
-------------
|
||||||
|
|
||||||
fmt does not use ``errno`` to communicate errors to the user, but it may call
|
{fmt} does not use ``errno`` to communicate errors to the user, but it may call
|
||||||
system functions which set ``errno``. Users should not make any assumptions about
|
system functions which set ``errno``. Users should not make any assumptions
|
||||||
the value of ``errno`` being preserved by library functions.
|
about the value of ``errno`` being preserved by library functions.
|
||||||
|
|
||||||
.. doxygenclass:: fmt::system_error
|
.. doxygenfunction:: fmt::system_error
|
||||||
:members:
|
|
||||||
|
|
||||||
.. doxygenfunction:: fmt::format_system_error
|
.. doxygenfunction:: fmt::format_system_error
|
||||||
|
|
||||||
.. doxygenclass:: fmt::windows_error
|
|
||||||
:members:
|
|
||||||
|
|
||||||
.. _formatstrings:
|
|
||||||
|
|
||||||
Custom Allocators
|
Custom Allocators
|
||||||
-----------------
|
-----------------
|
||||||
|
|
||||||
@ -300,8 +387,8 @@ allocator::
|
|||||||
|
|
||||||
custom_string vformat(custom_allocator alloc, fmt::string_view format_str,
|
custom_string vformat(custom_allocator alloc, fmt::string_view format_str,
|
||||||
fmt::format_args args) {
|
fmt::format_args args) {
|
||||||
custom_memory_buffer buf(alloc);
|
auto buf = custom_memory_buffer(alloc);
|
||||||
fmt::vformat_to(buf, format_str, args);
|
fmt::vformat_to(std::back_inserter(buf), format_str, args);
|
||||||
return custom_string(buf.data(), buf.size(), alloc);
|
return custom_string(buf.data(), buf.size(), alloc);
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -312,59 +399,15 @@ allocator::
|
|||||||
return vformat(alloc, format_str, fmt::make_format_args(args...));
|
return vformat(alloc, format_str, fmt::make_format_args(args...));
|
||||||
}
|
}
|
||||||
|
|
||||||
The allocator will be used for the output container only. If you are using named
|
The allocator will be used for the output container only. Formatting functions
|
||||||
arguments, the container that stores pointers to them will be allocated using
|
normally don't do any allocations for built-in and string types except for
|
||||||
the default allocator. Also floating-point formatting falls back on ``sprintf``
|
non-default floating-point formatting that occasionally falls back on
|
||||||
which may do allocations.
|
``sprintf``.
|
||||||
|
|
||||||
Custom Formatting of Built-in Types
|
|
||||||
-----------------------------------
|
|
||||||
|
|
||||||
It is possible to change the way arguments are formatted by providing a
|
|
||||||
custom argument formatter class::
|
|
||||||
|
|
||||||
using arg_formatter = fmt::arg_formatter<fmt::buffer_range<char>>;
|
|
||||||
|
|
||||||
// A custom argument formatter that formats negative integers as unsigned
|
|
||||||
// with the ``x`` format specifier.
|
|
||||||
class custom_arg_formatter : public arg_formatter {
|
|
||||||
public:
|
|
||||||
custom_arg_formatter(fmt::format_context& ctx,
|
|
||||||
fmt::format_parse_context* parse_ctx = nullptr,
|
|
||||||
fmt::format_specs* spec = nullptr)
|
|
||||||
: arg_formatter(ctx, parse_ctx, spec) {}
|
|
||||||
|
|
||||||
using arg_formatter::operator();
|
|
||||||
|
|
||||||
auto operator()(int value) {
|
|
||||||
if (specs() && specs()->type == 'x')
|
|
||||||
return (*this)(static_cast<unsigned>(value)); // convert to unsigned and format
|
|
||||||
return arg_formatter::operator()(value);
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
std::string custom_vformat(fmt::string_view format_str, fmt::format_args args) {
|
|
||||||
fmt::memory_buffer buffer;
|
|
||||||
// Pass custom argument formatter as a template arg to vformat_to.
|
|
||||||
fmt::vformat_to<custom_arg_formatter>(buffer, format_str, args);
|
|
||||||
return fmt::to_string(buffer);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename ...Args>
|
|
||||||
inline std::string custom_format(
|
|
||||||
fmt::string_view format_str, const Args&... args) {
|
|
||||||
return custom_vformat(format_str, fmt::make_format_args(args...));
|
|
||||||
}
|
|
||||||
|
|
||||||
std::string s = custom_format("{:x}", -42); // s == "ffffffd6"
|
|
||||||
|
|
||||||
.. doxygenclass:: fmt::arg_formatter
|
|
||||||
:members:
|
|
||||||
|
|
||||||
.. _ranges-api:
|
.. _ranges-api:
|
||||||
|
|
||||||
Ranges and Tuple Formatting
|
Range and Tuple Formatting
|
||||||
===========================
|
==========================
|
||||||
|
|
||||||
The library also supports convenient formatting of ranges and tuples::
|
The library also supports convenient formatting of ranges and tuples::
|
||||||
|
|
||||||
@ -391,18 +434,110 @@ Using ``fmt::join``, you can separate tuple elements with a custom separator::
|
|||||||
Date and Time Formatting
|
Date and Time Formatting
|
||||||
========================
|
========================
|
||||||
|
|
||||||
The library supports `strftime
|
``fmt/chrono.h`` provides formatters for
|
||||||
<http://en.cppreference.com/w/cpp/chrono/c/strftime>`_-like date and time
|
|
||||||
formatting::
|
* `std::chrono::duration <https://en.cppreference.com/w/cpp/chrono/duration>`_
|
||||||
|
* `std::chrono::time_point
|
||||||
|
<https://en.cppreference.com/w/cpp/chrono/time_point>`_
|
||||||
|
* `std::tm <https://en.cppreference.com/w/cpp/chrono/c/tm>`_
|
||||||
|
|
||||||
|
The format syntax is described in :ref:`chrono-specs`.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
#include <fmt/chrono.h>
|
#include <fmt/chrono.h>
|
||||||
|
|
||||||
|
int main() {
|
||||||
std::time_t t = std::time(nullptr);
|
std::time_t t = std::time(nullptr);
|
||||||
// Prints "The date is 2016-04-29." (with the current date)
|
|
||||||
fmt::print("The date is {:%Y-%m-%d}.", *std::localtime(&t));
|
|
||||||
|
|
||||||
The format string syntax is described in the documentation of
|
// Prints "The date is 2020-11-07." (with the current date):
|
||||||
`strftime <http://en.cppreference.com/w/cpp/chrono/c/strftime>`_.
|
fmt::print("The date is {:%Y-%m-%d}.", fmt::localtime(t));
|
||||||
|
|
||||||
|
using namespace std::literals::chrono_literals;
|
||||||
|
|
||||||
|
// Prints "Default format: 42s 100ms":
|
||||||
|
fmt::print("Default format: {} {}\n", 42s, 100ms);
|
||||||
|
|
||||||
|
// Prints "strftime-like format: 03:15:30":
|
||||||
|
fmt::print("strftime-like format: {:%H:%M:%S}\n", 3h + 15min + 30s);
|
||||||
|
}
|
||||||
|
|
||||||
|
.. doxygenfunction:: localtime(std::time_t time)
|
||||||
|
|
||||||
|
.. doxygenfunction:: gmtime(std::time_t time)
|
||||||
|
|
||||||
|
.. _std-api:
|
||||||
|
|
||||||
|
Standard Library Types Formatting
|
||||||
|
=================================
|
||||||
|
|
||||||
|
``fmt/std.h`` provides formatters for:
|
||||||
|
|
||||||
|
* `std::filesystem::path <https://en.cppreference.com/w/cpp/filesystem/path>`_
|
||||||
|
* `std::thread::id <https://en.cppreference.com/w/cpp/thread/thread/id>`_
|
||||||
|
* `std::monostate <https://en.cppreference.com/w/cpp/utility/variant/monostate>`_
|
||||||
|
* `std::variant <https://en.cppreference.com/w/cpp/utility/variant/variant>`_
|
||||||
|
|
||||||
|
Formatting Variants
|
||||||
|
-------------------
|
||||||
|
|
||||||
|
A ``std::variant`` is only formattable if every variant alternative is formattable, and requires the
|
||||||
|
``__cpp_lib_variant`` `library feature <https://en.cppreference.com/w/cpp/feature_test>`_.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
#include <fmt/std.h>
|
||||||
|
|
||||||
|
std::variant<char, float> v0{'x'};
|
||||||
|
// Prints "variant('x')"
|
||||||
|
fmt::print("{}", v0);
|
||||||
|
|
||||||
|
std::variant<std::monostate, char> v1;
|
||||||
|
// Prints "variant(monostate)"
|
||||||
|
|
||||||
|
.. _compile-api:
|
||||||
|
|
||||||
|
Format String Compilation
|
||||||
|
=========================
|
||||||
|
|
||||||
|
``fmt/compile.h`` provides format string compilation enabled via the
|
||||||
|
``FMT_COMPILE`` macro or the ``_cf`` user-defined literal. Format strings
|
||||||
|
marked with ``FMT_COMPILE`` or ``_cf`` are parsed, checked and converted into
|
||||||
|
efficient formatting code at compile-time. This supports arguments of built-in
|
||||||
|
and string types as well as user-defined types with ``constexpr`` ``parse``
|
||||||
|
functions in their ``formatter`` specializations. Format string compilation can
|
||||||
|
generate more binary code compared to the default API and is only recommended in
|
||||||
|
places where formatting is a performance bottleneck.
|
||||||
|
|
||||||
|
.. doxygendefine:: FMT_COMPILE
|
||||||
|
|
||||||
|
.. doxygenfunction:: operator""_cf()
|
||||||
|
|
||||||
|
.. _color-api:
|
||||||
|
|
||||||
|
Terminal Color and Text Style
|
||||||
|
=============================
|
||||||
|
|
||||||
|
``fmt/color.h`` provides support for terminal color and text style output.
|
||||||
|
|
||||||
|
.. doxygenfunction:: print(const text_style &ts, const S &format_str, const Args&... args)
|
||||||
|
|
||||||
|
.. doxygenfunction:: fg(detail::color_type)
|
||||||
|
|
||||||
|
.. doxygenfunction:: bg(detail::color_type)
|
||||||
|
|
||||||
|
.. doxygenfunction:: styled(const T& value, text_style ts)
|
||||||
|
|
||||||
|
.. _os-api:
|
||||||
|
|
||||||
|
System APIs
|
||||||
|
===========
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::ostream
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::windows_error
|
||||||
|
:members:
|
||||||
|
|
||||||
.. _ostream-api:
|
.. _ostream-api:
|
||||||
|
|
||||||
@ -410,24 +545,28 @@ The format string syntax is described in the documentation of
|
|||||||
========================
|
========================
|
||||||
|
|
||||||
``fmt/ostream.h`` provides ``std::ostream`` support including formatting of
|
``fmt/ostream.h`` provides ``std::ostream`` support including formatting of
|
||||||
user-defined types that have overloaded ``operator<<``::
|
user-defined types that have an overloaded insertion operator (``operator<<``).
|
||||||
|
In order to make a type formattable via ``std::ostream`` you should provide a
|
||||||
|
``formatter`` specialization inherited from ``ostream_formatter``::
|
||||||
|
|
||||||
#include <fmt/ostream.h>
|
#include <fmt/ostream.h>
|
||||||
|
|
||||||
class date {
|
struct date {
|
||||||
int year_, month_, day_;
|
int year, month, day;
|
||||||
public:
|
|
||||||
date(int year, int month, int day): year_(year), month_(month), day_(day) {}
|
|
||||||
|
|
||||||
friend std::ostream& operator<<(std::ostream& os, const date& d) {
|
friend std::ostream& operator<<(std::ostream& os, const date& d) {
|
||||||
return os << d.year_ << '-' << d.month_ << '-' << d.day_;
|
return os << d.year << '-' << d.month << '-' << d.day;
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
std::string s = fmt::format("The date is {}", date(2012, 12, 9));
|
template <> struct fmt::formatter<date> : ostream_formatter {};
|
||||||
|
|
||||||
|
std::string s = fmt::format("The date is {}", date{2012, 12, 9});
|
||||||
// s == "The date is 2012-12-9"
|
// s == "The date is 2012-12-9"
|
||||||
|
|
||||||
.. doxygenfunction:: print(std::basic_ostream<Char>&, const S&, Args&&...)
|
.. doxygenfunction:: streamed(const T &)
|
||||||
|
|
||||||
|
.. doxygenfunction:: print(std::ostream &os, format_string<T...> fmt, T&&... args)
|
||||||
|
|
||||||
.. _printf-api:
|
.. _printf-api:
|
||||||
|
|
||||||
@ -436,15 +575,42 @@ user-defined types that have overloaded ``operator<<``::
|
|||||||
|
|
||||||
The header ``fmt/printf.h`` provides ``printf``-like formatting functionality.
|
The header ``fmt/printf.h`` provides ``printf``-like formatting functionality.
|
||||||
The following functions use `printf format string syntax
|
The following functions use `printf format string syntax
|
||||||
<http://pubs.opengroup.org/onlinepubs/009695399/functions/fprintf.html>`_ with
|
<https://pubs.opengroup.org/onlinepubs/009695399/functions/fprintf.html>`_ with
|
||||||
the POSIX extension for positional arguments. Unlike their standard
|
the POSIX extension for positional arguments. Unlike their standard
|
||||||
counterparts, the ``fmt`` functions are type-safe and throw an exception if an
|
counterparts, the ``fmt`` functions are type-safe and throw an exception if an
|
||||||
argument type doesn't match its format specification.
|
argument type doesn't match its format specification.
|
||||||
|
|
||||||
.. doxygenfunction:: printf(const S&, const Args&...)
|
.. doxygenfunction:: printf(const S &format_str, const T&... args)
|
||||||
|
|
||||||
.. doxygenfunction:: fprintf(std::FILE *, const S&, const Args&...)
|
.. doxygenfunction:: fprintf(std::FILE *f, const S &fmt, const T&... args) -> int
|
||||||
|
|
||||||
.. doxygenfunction:: fprintf(std::basic_ostream<Char>&, const S&, const Args&...)
|
.. doxygenfunction:: sprintf(const S&, const T&...)
|
||||||
|
|
||||||
.. doxygenfunction:: sprintf(const S&, const Args&...)
|
.. _xchar-api:
|
||||||
|
|
||||||
|
``wchar_t`` Support
|
||||||
|
===================
|
||||||
|
|
||||||
|
The optional header ``fmt/xchar.h`` provides support for ``wchar_t`` and exotic
|
||||||
|
character types.
|
||||||
|
|
||||||
|
.. doxygenstruct:: fmt::is_char
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::wstring_view
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::wformat_context
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::to_wstring(const T &value)
|
||||||
|
|
||||||
|
Compatibility with C++20 ``std::format``
|
||||||
|
========================================
|
||||||
|
|
||||||
|
{fmt} implements nearly all of the `C++20 formatting library
|
||||||
|
<https://en.cppreference.com/w/cpp/utility/format>`_ with the following
|
||||||
|
differences:
|
||||||
|
|
||||||
|
* Names are defined in the ``fmt`` namespace instead of ``std`` to avoid
|
||||||
|
collisions with standard library implementations.
|
||||||
|
* Width calculation doesn't use grapheme clusterization. The latter has been
|
||||||
|
implemented in a separate branch but hasn't been integrated yet.
|
||||||
|
* Most C++20 chrono types are not supported yet.
|
||||||
|
@ -90,12 +90,14 @@
|
|||||||
VERSION: '{{ release|e }}',
|
VERSION: '{{ release|e }}',
|
||||||
COLLAPSE_INDEX: false,
|
COLLAPSE_INDEX: false,
|
||||||
FILE_SUFFIX: '{{ '' if no_search_suffix else file_suffix }}',
|
FILE_SUFFIX: '{{ '' if no_search_suffix else file_suffix }}',
|
||||||
|
LINK_SUFFIX: '{{ link_suffix }}',
|
||||||
|
SOURCELINK_SUFFIX: '{{ sourcelink_suffix }}',
|
||||||
HAS_SOURCE: {{ has_source|lower }},
|
HAS_SOURCE: {{ has_source|lower }},
|
||||||
SOURCELINK_SUFFIX: '{{ sourcelink_suffix }}'
|
SOURCELINK_SUFFIX: '{{ sourcelink_suffix }}'
|
||||||
};
|
};
|
||||||
</script>
|
</script>
|
||||||
{%- for scriptfile in script_files %}
|
{%- for scriptfile in script_files %}
|
||||||
<script type="text/javascript" src="{{ pathto(scriptfile, 1) }}"></script>
|
{{ js_tag(scriptfile) }}
|
||||||
{%- endfor %}
|
{%- endfor %}
|
||||||
{%- endmacro %}
|
{%- endmacro %}
|
||||||
|
|
||||||
|
114
externals/fmt/doc/build.py
vendored
114
externals/fmt/doc/build.py
vendored
@ -1,63 +1,38 @@
|
|||||||
#!/usr/bin/env python
|
#!/usr/bin/env python3
|
||||||
# Build the documentation.
|
# Build the documentation.
|
||||||
|
|
||||||
from __future__ import print_function
|
import errno, os, re, sys
|
||||||
import errno, os, shutil, sys, tempfile
|
from subprocess import check_call, CalledProcessError, Popen, PIPE, STDOUT
|
||||||
from subprocess import check_call, check_output, CalledProcessError, Popen, PIPE
|
|
||||||
from distutils.version import LooseVersion
|
|
||||||
|
|
||||||
versions = ['1.0.0', '1.1.0', '2.0.0', '3.0.2', '4.0.0', '4.1.0', '5.0.0', '5.1.0', '5.2.0', '5.2.1', '5.3.0', '6.0.0', '6.1.0', '6.1.1', '6.1.2', '6.2.0']
|
versions = ['1.0.0', '1.1.0', '2.0.0', '3.0.2', '4.0.0', '4.1.0', '5.0.0', '5.1.0', '5.2.0', '5.2.1', '5.3.0', '6.0.0', '6.1.0', '6.1.1', '6.1.2', '6.2.0', '6.2.1', '7.0.0', '7.0.1', '7.0.2', '7.0.3', '7.1.0', '7.1.1', '7.1.2', '7.1.3', '8.0.0', '8.0.1', '8.1.0', '8.1.1', '9.0.0', '9.1.0']
|
||||||
|
|
||||||
def pip_install(package, commit=None, **kwargs):
|
class Pip:
|
||||||
|
def __init__(self, venv_dir):
|
||||||
|
self.path = os.path.join(venv_dir, 'bin', 'pip')
|
||||||
|
|
||||||
|
def install(self, package, commit=None):
|
||||||
"Install package using pip."
|
"Install package using pip."
|
||||||
min_version = kwargs.get('min_version')
|
|
||||||
if min_version:
|
|
||||||
from pkg_resources import get_distribution, DistributionNotFound
|
|
||||||
try:
|
|
||||||
installed_version = get_distribution(os.path.basename(package)).version
|
|
||||||
if LooseVersion(installed_version) >= min_version:
|
|
||||||
print('{} {} already installed'.format(package, min_version))
|
|
||||||
return
|
|
||||||
except DistributionNotFound:
|
|
||||||
pass
|
|
||||||
if commit:
|
if commit:
|
||||||
package = 'git+https://github.com/{0}.git@{1}'.format(package, commit)
|
package = 'git+https://github.com/{0}.git@{1}'.format(package, commit)
|
||||||
print('Installing {0}'.format(package))
|
print('Installing {0}'.format(package))
|
||||||
check_call(['pip', 'install', package])
|
check_call([self.path, 'install', package])
|
||||||
|
|
||||||
def create_build_env(dirname='virtualenv'):
|
def create_build_env(venv_dir='virtualenv'):
|
||||||
# Create virtualenv.
|
# Create virtualenv.
|
||||||
if not os.path.exists(dirname):
|
if not os.path.exists(venv_dir):
|
||||||
check_call(['virtualenv', dirname])
|
check_call(['python3', '-m', 'venv', venv_dir])
|
||||||
import sysconfig
|
# Install Sphinx and Breathe. Require the exact version of Sphinx which is
|
||||||
scripts_dir = os.path.basename(sysconfig.get_path('scripts'))
|
# compatible with Breathe.
|
||||||
activate_this_file = os.path.join(dirname, scripts_dir, 'activate_this.py')
|
pip = Pip(venv_dir)
|
||||||
with open(activate_this_file) as f:
|
pip.install('wheel')
|
||||||
exec(f.read(), dict(__file__=activate_this_file))
|
pip.install('six')
|
||||||
# Import get_distribution after activating virtualenv to get info about
|
# See: https://github.com/sphinx-doc/sphinx/issues/9777
|
||||||
# the correct packages.
|
pip.install('docutils==0.17.1')
|
||||||
from pkg_resources import get_distribution, DistributionNotFound
|
# Jinja2 >= 3.1 incompatible with sphinx 3.3.0
|
||||||
# Upgrade pip because installation of sphinx with pip 1.1 available on Travis
|
# See: https://github.com/sphinx-doc/sphinx/issues/10291
|
||||||
# is broken (see #207) and it doesn't support the show command.
|
pip.install('Jinja2<3.1')
|
||||||
pip_version = get_distribution('pip').version
|
pip.install('sphinx-doc/sphinx', 'v3.3.0')
|
||||||
if LooseVersion(pip_version) < LooseVersion('1.5.4'):
|
pip.install('michaeljones/breathe', 'v4.25.0')
|
||||||
print("Updating pip")
|
|
||||||
check_call(['pip', 'install', '--upgrade', 'pip'])
|
|
||||||
# Upgrade distribute because installation of sphinx with distribute 0.6.24
|
|
||||||
# available on Travis is broken (see #207).
|
|
||||||
try:
|
|
||||||
distribute_version = get_distribution('distribute').version
|
|
||||||
if LooseVersion(distribute_version) <= LooseVersion('0.6.24'):
|
|
||||||
print("Updating distribute")
|
|
||||||
check_call(['pip', 'install', '--upgrade', 'distribute'])
|
|
||||||
except DistributionNotFound:
|
|
||||||
pass
|
|
||||||
# Install Sphinx and Breathe.
|
|
||||||
pip_install('sphinx-doc/sphinx', '12b83372ac9316e8cbe86e7fed889296a4cc29ee',
|
|
||||||
min_version='1.4.1.dev20160531')
|
|
||||||
pip_install('michaeljones/breathe',
|
|
||||||
'129222318f7c8f865d2631e7da7b033567e7f56a',
|
|
||||||
min_version='4.2.0')
|
|
||||||
|
|
||||||
def build_docs(version='dev', **kwargs):
|
def build_docs(version='dev', **kwargs):
|
||||||
doc_dir = kwargs.get('doc_dir', os.path.dirname(os.path.realpath(__file__)))
|
doc_dir = kwargs.get('doc_dir', os.path.dirname(os.path.realpath(__file__)))
|
||||||
@ -66,16 +41,17 @@ def build_docs(version='dev', **kwargs):
|
|||||||
'include_dir', os.path.join(os.path.dirname(doc_dir), 'include', 'fmt'))
|
'include_dir', os.path.join(os.path.dirname(doc_dir), 'include', 'fmt'))
|
||||||
# Build docs.
|
# Build docs.
|
||||||
cmd = ['doxygen', '-']
|
cmd = ['doxygen', '-']
|
||||||
p = Popen(cmd, stdin=PIPE)
|
p = Popen(cmd, stdin=PIPE, stdout=PIPE, stderr=STDOUT)
|
||||||
doxyxml_dir = os.path.join(work_dir, 'doxyxml')
|
doxyxml_dir = os.path.join(work_dir, 'doxyxml')
|
||||||
p.communicate(input=r'''
|
out, _ = p.communicate(input=r'''
|
||||||
PROJECT_NAME = fmt
|
PROJECT_NAME = fmt
|
||||||
GENERATE_LATEX = NO
|
GENERATE_LATEX = NO
|
||||||
GENERATE_MAN = NO
|
GENERATE_MAN = NO
|
||||||
GENERATE_RTF = NO
|
GENERATE_RTF = NO
|
||||||
CASE_SENSE_NAMES = NO
|
CASE_SENSE_NAMES = NO
|
||||||
INPUT = {0}/core.h {0}/format.h {0}/os.h {0}/ostream.h \
|
INPUT = {0}/chrono.h {0}/color.h {0}/core.h {0}/compile.h \
|
||||||
{0}/printf.h {0}/time.h
|
{0}/format.h {0}/os.h {0}/ostream.h {0}/printf.h \
|
||||||
|
{0}/xchar.h
|
||||||
QUIET = YES
|
QUIET = YES
|
||||||
JAVADOC_AUTOBRIEF = YES
|
JAVADOC_AUTOBRIEF = YES
|
||||||
AUTOLINK_SUPPORT = NO
|
AUTOLINK_SUPPORT = NO
|
||||||
@ -86,28 +62,50 @@ def build_docs(version='dev', **kwargs):
|
|||||||
ALIASES += "endrst=\endverbatim"
|
ALIASES += "endrst=\endverbatim"
|
||||||
MACRO_EXPANSION = YES
|
MACRO_EXPANSION = YES
|
||||||
PREDEFINED = _WIN32=1 \
|
PREDEFINED = _WIN32=1 \
|
||||||
|
__linux__=1 \
|
||||||
|
FMT_ENABLE_IF(...)= \
|
||||||
FMT_USE_VARIADIC_TEMPLATES=1 \
|
FMT_USE_VARIADIC_TEMPLATES=1 \
|
||||||
FMT_USE_RVALUE_REFERENCES=1 \
|
FMT_USE_RVALUE_REFERENCES=1 \
|
||||||
FMT_USE_USER_DEFINED_LITERALS=1 \
|
FMT_USE_USER_DEFINED_LITERALS=1 \
|
||||||
FMT_USE_ALIAS_TEMPLATES=1 \
|
FMT_USE_ALIAS_TEMPLATES=1 \
|
||||||
|
FMT_USE_NONTYPE_TEMPLATE_ARGS=1 \
|
||||||
FMT_API= \
|
FMT_API= \
|
||||||
"FMT_BEGIN_NAMESPACE=namespace fmt {{" \
|
"FMT_BEGIN_NAMESPACE=namespace fmt {{" \
|
||||||
"FMT_END_NAMESPACE=}}" \
|
"FMT_END_NAMESPACE=}}" \
|
||||||
"FMT_STRING_ALIAS=1" \
|
"FMT_STRING_ALIAS=1" \
|
||||||
"FMT_ENABLE_IF(B)="
|
"FMT_VARIADIC(...)=" \
|
||||||
EXCLUDE_SYMBOLS = fmt::internal::* StringValue write_str
|
"FMT_VARIADIC_W(...)=" \
|
||||||
|
"FMT_DOC=1"
|
||||||
|
EXCLUDE_SYMBOLS = fmt::formatter fmt::printf_formatter fmt::arg_join \
|
||||||
|
fmt::basic_format_arg::handle
|
||||||
'''.format(include_dir, doxyxml_dir).encode('UTF-8'))
|
'''.format(include_dir, doxyxml_dir).encode('UTF-8'))
|
||||||
|
out = out.decode('utf-8')
|
||||||
|
internal_symbols = [
|
||||||
|
'fmt::detail::.*',
|
||||||
|
'basic_data<>',
|
||||||
|
'fmt::type_identity',
|
||||||
|
'fmt::dynamic_formatter'
|
||||||
|
]
|
||||||
|
noisy_warnings = [
|
||||||
|
'warning: (Compound|Member .* of class) (' + '|'.join(internal_symbols) + \
|
||||||
|
') is not documented.',
|
||||||
|
'warning: Internal inconsistency: .* does not belong to any container!'
|
||||||
|
]
|
||||||
|
for w in noisy_warnings:
|
||||||
|
out = re.sub('.*' + w + '\n', '', out)
|
||||||
|
print(out)
|
||||||
if p.returncode != 0:
|
if p.returncode != 0:
|
||||||
raise CalledProcessError(p.returncode, cmd)
|
raise CalledProcessError(p.returncode, cmd)
|
||||||
|
|
||||||
html_dir = os.path.join(work_dir, 'html')
|
html_dir = os.path.join(work_dir, 'html')
|
||||||
main_versions = reversed(versions[-3:])
|
main_versions = reversed(versions[-3:])
|
||||||
check_call(['sphinx-build',
|
check_call([os.path.join(work_dir, 'virtualenv', 'bin', 'sphinx-build'),
|
||||||
'-Dbreathe_projects.format=' + os.path.abspath(doxyxml_dir),
|
'-Dbreathe_projects.format=' + os.path.abspath(doxyxml_dir),
|
||||||
'-Dversion=' + version, '-Drelease=' + version,
|
'-Dversion=' + version, '-Drelease=' + version,
|
||||||
'-Aversion=' + version, '-Aversions=' + ','.join(main_versions),
|
'-Aversion=' + version, '-Aversions=' + ','.join(main_versions),
|
||||||
'-b', 'html', doc_dir, html_dir])
|
'-b', 'html', doc_dir, html_dir])
|
||||||
try:
|
try:
|
||||||
check_call(['lessc', '--clean-css',
|
check_call(['lessc', '--verbose', '--clean-css',
|
||||||
'--include-path=' + os.path.join(doc_dir, 'bootstrap'),
|
'--include-path=' + os.path.join(doc_dir, 'bootstrap'),
|
||||||
os.path.join(doc_dir, 'fmt.less'),
|
os.path.join(doc_dir, 'fmt.less'),
|
||||||
os.path.join(html_dir, '_static', 'fmt.css')])
|
os.path.join(html_dir, '_static', 'fmt.css')])
|
||||||
|
5
externals/fmt/doc/fmt.less
vendored
5
externals/fmt/doc/fmt.less
vendored
@ -56,6 +56,11 @@ div.sphinxsidebar {
|
|||||||
padding: 0;
|
padding: 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Override center alignment in tables.
|
||||||
|
td {
|
||||||
|
text-align: left;
|
||||||
|
}
|
||||||
|
|
||||||
p.rubric {
|
p.rubric {
|
||||||
margin-top: 10px;
|
margin-top: 10px;
|
||||||
}
|
}
|
||||||
|
616
externals/fmt/doc/html/_sources/api.rst.txt
vendored
Normal file
616
externals/fmt/doc/html/_sources/api.rst.txt
vendored
Normal file
@ -0,0 +1,616 @@
|
|||||||
|
.. _string-formatting-api:
|
||||||
|
|
||||||
|
*************
|
||||||
|
API Reference
|
||||||
|
*************
|
||||||
|
|
||||||
|
The {fmt} library API consists of the following parts:
|
||||||
|
|
||||||
|
* :ref:`fmt/core.h <core-api>`: the core API providing main formatting functions
|
||||||
|
for ``char``/UTF-8 with C++20 compile-time checks and minimal dependencies
|
||||||
|
* :ref:`fmt/format.h <format-api>`: the full format API providing additional
|
||||||
|
formatting functions and locale support
|
||||||
|
* :ref:`fmt/ranges.h <ranges-api>`: formatting of ranges and tuples
|
||||||
|
* :ref:`fmt/chrono.h <chrono-api>`: date and time formatting
|
||||||
|
* :ref:`fmt/std.h <std-api>`: formatters for standard library types
|
||||||
|
* :ref:`fmt/compile.h <compile-api>`: format string compilation
|
||||||
|
* :ref:`fmt/color.h <color-api>`: terminal color and text style
|
||||||
|
* :ref:`fmt/os.h <os-api>`: system APIs
|
||||||
|
* :ref:`fmt/ostream.h <ostream-api>`: ``std::ostream`` support
|
||||||
|
* :ref:`fmt/printf.h <printf-api>`: ``printf`` formatting
|
||||||
|
* :ref:`fmt/xchar.h <xchar-api>`: optional ``wchar_t`` support
|
||||||
|
|
||||||
|
All functions and types provided by the library reside in namespace ``fmt`` and
|
||||||
|
macros have prefix ``FMT_``.
|
||||||
|
|
||||||
|
.. _core-api:
|
||||||
|
|
||||||
|
Core API
|
||||||
|
========
|
||||||
|
|
||||||
|
``fmt/core.h`` defines the core API which provides main formatting functions
|
||||||
|
for ``char``/UTF-8 with C++20 compile-time checks. It has minimal include
|
||||||
|
dependencies for better compile times. This header is only beneficial when
|
||||||
|
using {fmt} as a library and not in the header-only mode.
|
||||||
|
|
||||||
|
The following functions use :ref:`format string syntax <syntax>`
|
||||||
|
similar to that of Python's `str.format
|
||||||
|
<https://docs.python.org/3/library/stdtypes.html#str.format>`_.
|
||||||
|
They take *fmt* and *args* as arguments.
|
||||||
|
|
||||||
|
*fmt* is a format string that contains literal text and replacement fields
|
||||||
|
surrounded by braces ``{}``. The fields are replaced with formatted arguments
|
||||||
|
in the resulting string. `~fmt::format_string` is a format string which can be
|
||||||
|
implicitly constructed from a string literal or a ``constexpr`` string and is
|
||||||
|
checked at compile time in C++20. To pass a runtime format string wrap it in
|
||||||
|
`fmt::runtime`.
|
||||||
|
|
||||||
|
*args* is an argument list representing objects to be formatted.
|
||||||
|
|
||||||
|
.. _format:
|
||||||
|
|
||||||
|
.. doxygenfunction:: format(format_string<T...> fmt, T&&... args) -> std::string
|
||||||
|
.. doxygenfunction:: vformat(string_view fmt, format_args args) -> std::string
|
||||||
|
|
||||||
|
.. doxygenfunction:: format_to(OutputIt out, format_string<T...> fmt, T&&... args) -> OutputIt
|
||||||
|
.. doxygenfunction:: format_to_n(OutputIt out, size_t n, format_string<T...> fmt, T&&... args) -> format_to_n_result<OutputIt>
|
||||||
|
.. doxygenfunction:: formatted_size(format_string<T...> fmt, T&&... args) -> size_t
|
||||||
|
|
||||||
|
.. doxygenstruct:: fmt::format_to_n_result
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. _print:
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::print(format_string<T...> fmt, T&&... args)
|
||||||
|
.. doxygenfunction:: fmt::vprint(string_view fmt, format_args args)
|
||||||
|
|
||||||
|
.. doxygenfunction:: print(std::FILE *f, format_string<T...> fmt, T&&... args)
|
||||||
|
.. doxygenfunction:: vprint(std::FILE *f, string_view fmt, format_args args)
|
||||||
|
|
||||||
|
Compile-Time Format String Checks
|
||||||
|
---------------------------------
|
||||||
|
|
||||||
|
Compile-time checks are enabled by default on compilers that support C++20
|
||||||
|
``consteval``. On older compilers you can use the ``FMT_STRING`` macro defined
|
||||||
|
in ``fmt/format.h`` instead. It requires C++14 and is a no-op in C++11.
|
||||||
|
|
||||||
|
.. doxygendefine:: FMT_STRING
|
||||||
|
|
||||||
|
To force the use of legacy compile-time checks, define the preprocessor variable
|
||||||
|
``FMT_ENFORCE_COMPILE_STRING``. When set, functions accepting ``FMT_STRING``
|
||||||
|
will fail to compile with regular strings. Runtime-checked formatting is still
|
||||||
|
possible using ``fmt::vformat``, ``fmt::vprint``, etc.
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_format_string
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::format_string
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::runtime(string_view) -> basic_runtime<char>
|
||||||
|
|
||||||
|
Named Arguments
|
||||||
|
---------------
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::arg(const S&, const T&)
|
||||||
|
|
||||||
|
Named arguments are not supported in compile-time checks at the moment.
|
||||||
|
|
||||||
|
Argument Lists
|
||||||
|
--------------
|
||||||
|
|
||||||
|
You can create your own formatting function with compile-time checks and small
|
||||||
|
binary footprint, for example (https://godbolt.org/z/oba4Mc):
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
#include <fmt/format.h>
|
||||||
|
|
||||||
|
void vlog(const char* file, int line, fmt::string_view format,
|
||||||
|
fmt::format_args args) {
|
||||||
|
fmt::print("{}: {}: ", file, line);
|
||||||
|
fmt::vprint(format, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename S, typename... Args>
|
||||||
|
void log(const char* file, int line, const S& format, Args&&... args) {
|
||||||
|
vlog(file, line, format, fmt::make_format_args(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
#define MY_LOG(format, ...) \
|
||||||
|
log(__FILE__, __LINE__, FMT_STRING(format), __VA_ARGS__)
|
||||||
|
|
||||||
|
MY_LOG("invalid squishiness: {}", 42);
|
||||||
|
|
||||||
|
Note that ``vlog`` is not parameterized on argument types which improves compile
|
||||||
|
times and reduces binary code size compared to a fully parameterized version.
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::make_format_args(const Args&...)
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::format_arg_store
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::dynamic_format_arg_store
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_format_args
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::format_args
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_format_arg
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_format_parse_context
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_format_context
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::format_context
|
||||||
|
|
||||||
|
Compatibility
|
||||||
|
-------------
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_string_view
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::string_view
|
||||||
|
|
||||||
|
Locale
|
||||||
|
------
|
||||||
|
|
||||||
|
All formatting is locale-independent by default. Use the ``'L'`` format
|
||||||
|
specifier to insert the appropriate number separator characters from the
|
||||||
|
locale::
|
||||||
|
|
||||||
|
#include <fmt/core.h>
|
||||||
|
#include <locale>
|
||||||
|
|
||||||
|
std::locale::global(std::locale("en_US.UTF-8"));
|
||||||
|
auto s = fmt::format("{:L}", 1000000); // s == "1,000,000"
|
||||||
|
|
||||||
|
.. _format-api:
|
||||||
|
|
||||||
|
Format API
|
||||||
|
==========
|
||||||
|
|
||||||
|
``fmt/format.h`` defines the full format API providing additional formatting
|
||||||
|
functions and locale support.
|
||||||
|
|
||||||
|
.. _udt:
|
||||||
|
|
||||||
|
Formatting User-Defined Types
|
||||||
|
-----------------------------
|
||||||
|
|
||||||
|
The {fmt} library provides formatters for many standard C++ types.
|
||||||
|
See :ref:`fmt/ranges.h <ranges-api>` for ranges and tuples including standard
|
||||||
|
containers such as ``std::vector``, :ref:`fmt/chrono.h <chrono-api>` for date
|
||||||
|
and time formatting and :ref:`fmt/std.h <std-api>` for path and variant
|
||||||
|
formatting.
|
||||||
|
|
||||||
|
To make a user-defined type formattable, specialize the ``formatter<T>`` struct
|
||||||
|
template and implement ``parse`` and ``format`` methods::
|
||||||
|
|
||||||
|
#include <fmt/format.h>
|
||||||
|
|
||||||
|
struct point {
|
||||||
|
double x, y;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <> struct fmt::formatter<point> {
|
||||||
|
// Presentation format: 'f' - fixed, 'e' - exponential.
|
||||||
|
char presentation = 'f';
|
||||||
|
|
||||||
|
// Parses format specifications of the form ['f' | 'e'].
|
||||||
|
constexpr auto parse(format_parse_context& ctx) -> decltype(ctx.begin()) {
|
||||||
|
// [ctx.begin(), ctx.end()) is a character range that contains a part of
|
||||||
|
// the format string starting from the format specifications to be parsed,
|
||||||
|
// e.g. in
|
||||||
|
//
|
||||||
|
// fmt::format("{:f} - point of interest", point{1, 2});
|
||||||
|
//
|
||||||
|
// the range will contain "f} - point of interest". The formatter should
|
||||||
|
// parse specifiers until '}' or the end of the range. In this example
|
||||||
|
// the formatter should parse the 'f' specifier and return an iterator
|
||||||
|
// pointing to '}'.
|
||||||
|
|
||||||
|
// Please also note that this character range may be empty, in case of
|
||||||
|
// the "{}" format string, so therefore you should check ctx.begin()
|
||||||
|
// for equality with ctx.end().
|
||||||
|
|
||||||
|
// Parse the presentation format and store it in the formatter:
|
||||||
|
auto it = ctx.begin(), end = ctx.end();
|
||||||
|
if (it != end && (*it == 'f' || *it == 'e')) presentation = *it++;
|
||||||
|
|
||||||
|
// Check if reached the end of the range:
|
||||||
|
if (it != end && *it != '}') throw format_error("invalid format");
|
||||||
|
|
||||||
|
// Return an iterator past the end of the parsed range:
|
||||||
|
return it;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Formats the point p using the parsed format specification (presentation)
|
||||||
|
// stored in this formatter.
|
||||||
|
template <typename FormatContext>
|
||||||
|
auto format(const point& p, FormatContext& ctx) const -> decltype(ctx.out()) {
|
||||||
|
// ctx.out() is an output iterator to write to.
|
||||||
|
return presentation == 'f'
|
||||||
|
? fmt::format_to(ctx.out(), "({:.1f}, {:.1f})", p.x, p.y)
|
||||||
|
: fmt::format_to(ctx.out(), "({:.1e}, {:.1e})", p.x, p.y);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
Then you can pass objects of type ``point`` to any formatting function::
|
||||||
|
|
||||||
|
point p = {1, 2};
|
||||||
|
std::string s = fmt::format("{:f}", p);
|
||||||
|
// s == "(1.0, 2.0)"
|
||||||
|
|
||||||
|
You can also reuse existing formatters via inheritance or composition, for
|
||||||
|
example::
|
||||||
|
|
||||||
|
enum class color {red, green, blue};
|
||||||
|
|
||||||
|
template <> struct fmt::formatter<color>: formatter<string_view> {
|
||||||
|
// parse is inherited from formatter<string_view>.
|
||||||
|
template <typename FormatContext>
|
||||||
|
auto format(color c, FormatContext& ctx) const {
|
||||||
|
string_view name = "unknown";
|
||||||
|
switch (c) {
|
||||||
|
case color::red: name = "red"; break;
|
||||||
|
case color::green: name = "green"; break;
|
||||||
|
case color::blue: name = "blue"; break;
|
||||||
|
}
|
||||||
|
return formatter<string_view>::format(name, ctx);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
Since ``parse`` is inherited from ``formatter<string_view>`` it will recognize
|
||||||
|
all string format specifications, for example
|
||||||
|
|
||||||
|
.. code-block:: c++
|
||||||
|
|
||||||
|
fmt::format("{:>10}", color::blue)
|
||||||
|
|
||||||
|
will return ``" blue"``.
|
||||||
|
|
||||||
|
You can also write a formatter for a hierarchy of classes::
|
||||||
|
|
||||||
|
#include <type_traits>
|
||||||
|
#include <fmt/format.h>
|
||||||
|
|
||||||
|
struct A {
|
||||||
|
virtual ~A() {}
|
||||||
|
virtual std::string name() const { return "A"; }
|
||||||
|
};
|
||||||
|
|
||||||
|
struct B : A {
|
||||||
|
virtual std::string name() const { return "B"; }
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
struct fmt::formatter<T, std::enable_if_t<std::is_base_of<A, T>::value, char>> :
|
||||||
|
fmt::formatter<std::string> {
|
||||||
|
template <typename FormatCtx>
|
||||||
|
auto format(const A& a, FormatCtx& ctx) const {
|
||||||
|
return fmt::formatter<std::string>::format(a.name(), ctx);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
B b;
|
||||||
|
A& a = b;
|
||||||
|
fmt::print("{}", a); // prints "B"
|
||||||
|
}
|
||||||
|
|
||||||
|
If a type provides both a ``formatter`` specialization and an implicit
|
||||||
|
conversion to a formattable type, the specialization takes precedence over the
|
||||||
|
conversion.
|
||||||
|
|
||||||
|
For enums {fmt} also provides the ``format_as`` extension API. To format an enum
|
||||||
|
via this API define ``format_as`` that takes this enum and converts it to the
|
||||||
|
underlying type. ``format_as`` should be defined in the same namespace as the
|
||||||
|
enum.
|
||||||
|
|
||||||
|
Example (https://godbolt.org/z/r7vvGE1v7)::
|
||||||
|
|
||||||
|
#include <fmt/format.h>
|
||||||
|
|
||||||
|
namespace kevin_namespacy {
|
||||||
|
enum class film {
|
||||||
|
house_of_cards, american_beauty, se7en = 7
|
||||||
|
};
|
||||||
|
auto format_as(film f) { return fmt::underlying(f); }
|
||||||
|
}
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
fmt::print("{}\n", kevin_namespacy::film::se7en); // prints "7"
|
||||||
|
}
|
||||||
|
|
||||||
|
Literal-Based API
|
||||||
|
-----------------
|
||||||
|
|
||||||
|
The following user-defined literals are defined in ``fmt/format.h``.
|
||||||
|
|
||||||
|
.. doxygenfunction:: operator""_a()
|
||||||
|
|
||||||
|
Utilities
|
||||||
|
---------
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::ptr(T p) -> const void*
|
||||||
|
.. doxygenfunction:: fmt::ptr(const std::unique_ptr<T> &p) -> const void*
|
||||||
|
.. doxygenfunction:: fmt::ptr(const std::shared_ptr<T> &p) -> const void*
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::underlying(Enum e) -> typename std::underlying_type<Enum>::type
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::to_string(const T &value) -> std::string
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::join(Range &&range, string_view sep) -> join_view<detail::iterator_t<Range>, detail::sentinel_t<Range>>
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::join(It begin, Sentinel end, string_view sep) -> join_view<It, Sentinel>
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::group_digits(T value) -> group_digits_view<T>
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::detail::buffer
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::basic_memory_buffer
|
||||||
|
:protected-members:
|
||||||
|
:members:
|
||||||
|
|
||||||
|
System Errors
|
||||||
|
-------------
|
||||||
|
|
||||||
|
{fmt} does not use ``errno`` to communicate errors to the user, but it may call
|
||||||
|
system functions which set ``errno``. Users should not make any assumptions
|
||||||
|
about the value of ``errno`` being preserved by library functions.
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::system_error
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::format_system_error
|
||||||
|
|
||||||
|
Custom Allocators
|
||||||
|
-----------------
|
||||||
|
|
||||||
|
The {fmt} library supports custom dynamic memory allocators.
|
||||||
|
A custom allocator class can be specified as a template argument to
|
||||||
|
:class:`fmt::basic_memory_buffer`::
|
||||||
|
|
||||||
|
using custom_memory_buffer =
|
||||||
|
fmt::basic_memory_buffer<char, fmt::inline_buffer_size, custom_allocator>;
|
||||||
|
|
||||||
|
It is also possible to write a formatting function that uses a custom
|
||||||
|
allocator::
|
||||||
|
|
||||||
|
using custom_string =
|
||||||
|
std::basic_string<char, std::char_traits<char>, custom_allocator>;
|
||||||
|
|
||||||
|
custom_string vformat(custom_allocator alloc, fmt::string_view format_str,
|
||||||
|
fmt::format_args args) {
|
||||||
|
auto buf = custom_memory_buffer(alloc);
|
||||||
|
fmt::vformat_to(std::back_inserter(buf), format_str, args);
|
||||||
|
return custom_string(buf.data(), buf.size(), alloc);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename ...Args>
|
||||||
|
inline custom_string format(custom_allocator alloc,
|
||||||
|
fmt::string_view format_str,
|
||||||
|
const Args& ... args) {
|
||||||
|
return vformat(alloc, format_str, fmt::make_format_args(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
The allocator will be used for the output container only. Formatting functions
|
||||||
|
normally don't do any allocations for built-in and string types except for
|
||||||
|
non-default floating-point formatting that occasionally falls back on
|
||||||
|
``sprintf``.
|
||||||
|
|
||||||
|
.. _ranges-api:
|
||||||
|
|
||||||
|
Range and Tuple Formatting
|
||||||
|
==========================
|
||||||
|
|
||||||
|
The library also supports convenient formatting of ranges and tuples::
|
||||||
|
|
||||||
|
#include <fmt/ranges.h>
|
||||||
|
|
||||||
|
std::tuple<char, int, float> t{'a', 1, 2.0f};
|
||||||
|
// Prints "('a', 1, 2.0)"
|
||||||
|
fmt::print("{}", t);
|
||||||
|
|
||||||
|
|
||||||
|
NOTE: currently, the overload of ``fmt::join`` for iterables exists in the main
|
||||||
|
``format.h`` header, but expect this to change in the future.
|
||||||
|
|
||||||
|
Using ``fmt::join``, you can separate tuple elements with a custom separator::
|
||||||
|
|
||||||
|
#include <fmt/ranges.h>
|
||||||
|
|
||||||
|
std::tuple<int, char> t = {1, 'a'};
|
||||||
|
// Prints "1, a"
|
||||||
|
fmt::print("{}", fmt::join(t, ", "));
|
||||||
|
|
||||||
|
.. _chrono-api:
|
||||||
|
|
||||||
|
Date and Time Formatting
|
||||||
|
========================
|
||||||
|
|
||||||
|
``fmt/chrono.h`` provides formatters for
|
||||||
|
|
||||||
|
* `std::chrono::duration <https://en.cppreference.com/w/cpp/chrono/duration>`_
|
||||||
|
* `std::chrono::time_point
|
||||||
|
<https://en.cppreference.com/w/cpp/chrono/time_point>`_
|
||||||
|
* `std::tm <https://en.cppreference.com/w/cpp/chrono/c/tm>`_
|
||||||
|
|
||||||
|
The format syntax is described in :ref:`chrono-specs`.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
#include <fmt/chrono.h>
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
std::time_t t = std::time(nullptr);
|
||||||
|
|
||||||
|
// Prints "The date is 2020-11-07." (with the current date):
|
||||||
|
fmt::print("The date is {:%Y-%m-%d}.", fmt::localtime(t));
|
||||||
|
|
||||||
|
using namespace std::literals::chrono_literals;
|
||||||
|
|
||||||
|
// Prints "Default format: 42s 100ms":
|
||||||
|
fmt::print("Default format: {} {}\n", 42s, 100ms);
|
||||||
|
|
||||||
|
// Prints "strftime-like format: 03:15:30":
|
||||||
|
fmt::print("strftime-like format: {:%H:%M:%S}\n", 3h + 15min + 30s);
|
||||||
|
}
|
||||||
|
|
||||||
|
.. doxygenfunction:: localtime(std::time_t time)
|
||||||
|
|
||||||
|
.. doxygenfunction:: gmtime(std::time_t time)
|
||||||
|
|
||||||
|
.. _std-api:
|
||||||
|
|
||||||
|
Standard Library Types Formatting
|
||||||
|
=================================
|
||||||
|
|
||||||
|
``fmt/std.h`` provides formatters for:
|
||||||
|
|
||||||
|
* `std::filesystem::path <https://en.cppreference.com/w/cpp/filesystem/path>`_
|
||||||
|
* `std::thread::id <https://en.cppreference.com/w/cpp/thread/thread/id>`_
|
||||||
|
* `std::monostate <https://en.cppreference.com/w/cpp/utility/variant/monostate>`_
|
||||||
|
* `std::variant <https://en.cppreference.com/w/cpp/utility/variant/variant>`_
|
||||||
|
|
||||||
|
Formatting Variants
|
||||||
|
-------------------
|
||||||
|
|
||||||
|
A ``std::variant`` is only formattable if every variant alternative is formattable, and requires the
|
||||||
|
``__cpp_lib_variant`` `library feature <https://en.cppreference.com/w/cpp/feature_test>`_.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
#include <fmt/std.h>
|
||||||
|
|
||||||
|
std::variant<char, float> v0{'x'};
|
||||||
|
// Prints "variant('x')"
|
||||||
|
fmt::print("{}", v0);
|
||||||
|
|
||||||
|
std::variant<std::monostate, char> v1;
|
||||||
|
// Prints "variant(monostate)"
|
||||||
|
|
||||||
|
.. _compile-api:
|
||||||
|
|
||||||
|
Format String Compilation
|
||||||
|
=========================
|
||||||
|
|
||||||
|
``fmt/compile.h`` provides format string compilation enabled via the
|
||||||
|
``FMT_COMPILE`` macro or the ``_cf`` user-defined literal. Format strings
|
||||||
|
marked with ``FMT_COMPILE`` or ``_cf`` are parsed, checked and converted into
|
||||||
|
efficient formatting code at compile-time. This supports arguments of built-in
|
||||||
|
and string types as well as user-defined types with ``constexpr`` ``parse``
|
||||||
|
functions in their ``formatter`` specializations. Format string compilation can
|
||||||
|
generate more binary code compared to the default API and is only recommended in
|
||||||
|
places where formatting is a performance bottleneck.
|
||||||
|
|
||||||
|
.. doxygendefine:: FMT_COMPILE
|
||||||
|
|
||||||
|
.. doxygenfunction:: operator""_cf()
|
||||||
|
|
||||||
|
.. _color-api:
|
||||||
|
|
||||||
|
Terminal Color and Text Style
|
||||||
|
=============================
|
||||||
|
|
||||||
|
``fmt/color.h`` provides support for terminal color and text style output.
|
||||||
|
|
||||||
|
.. doxygenfunction:: print(const text_style &ts, const S &format_str, const Args&... args)
|
||||||
|
|
||||||
|
.. doxygenfunction:: fg(detail::color_type)
|
||||||
|
|
||||||
|
.. doxygenfunction:: bg(detail::color_type)
|
||||||
|
|
||||||
|
.. doxygenfunction:: styled(const T& value, text_style ts)
|
||||||
|
|
||||||
|
.. _os-api:
|
||||||
|
|
||||||
|
System APIs
|
||||||
|
===========
|
||||||
|
|
||||||
|
.. doxygenclass:: fmt::ostream
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::windows_error
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. _ostream-api:
|
||||||
|
|
||||||
|
``std::ostream`` Support
|
||||||
|
========================
|
||||||
|
|
||||||
|
``fmt/ostream.h`` provides ``std::ostream`` support including formatting of
|
||||||
|
user-defined types that have an overloaded insertion operator (``operator<<``).
|
||||||
|
In order to make a type formattable via ``std::ostream`` you should provide a
|
||||||
|
``formatter`` specialization inherited from ``ostream_formatter``::
|
||||||
|
|
||||||
|
#include <fmt/ostream.h>
|
||||||
|
|
||||||
|
struct date {
|
||||||
|
int year, month, day;
|
||||||
|
|
||||||
|
friend std::ostream& operator<<(std::ostream& os, const date& d) {
|
||||||
|
return os << d.year << '-' << d.month << '-' << d.day;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <> struct fmt::formatter<date> : ostream_formatter {};
|
||||||
|
|
||||||
|
std::string s = fmt::format("The date is {}", date{2012, 12, 9});
|
||||||
|
// s == "The date is 2012-12-9"
|
||||||
|
|
||||||
|
.. doxygenfunction:: streamed(const T &)
|
||||||
|
|
||||||
|
.. doxygenfunction:: print(std::ostream &os, format_string<T...> fmt, T&&... args)
|
||||||
|
|
||||||
|
.. _printf-api:
|
||||||
|
|
||||||
|
``printf`` Formatting
|
||||||
|
=====================
|
||||||
|
|
||||||
|
The header ``fmt/printf.h`` provides ``printf``-like formatting functionality.
|
||||||
|
The following functions use `printf format string syntax
|
||||||
|
<https://pubs.opengroup.org/onlinepubs/009695399/functions/fprintf.html>`_ with
|
||||||
|
the POSIX extension for positional arguments. Unlike their standard
|
||||||
|
counterparts, the ``fmt`` functions are type-safe and throw an exception if an
|
||||||
|
argument type doesn't match its format specification.
|
||||||
|
|
||||||
|
.. doxygenfunction:: printf(const S &format_str, const T&... args)
|
||||||
|
|
||||||
|
.. doxygenfunction:: fprintf(std::FILE *f, const S &fmt, const T&... args) -> int
|
||||||
|
|
||||||
|
.. doxygenfunction:: sprintf(const S&, const T&...)
|
||||||
|
|
||||||
|
.. _xchar-api:
|
||||||
|
|
||||||
|
``wchar_t`` Support
|
||||||
|
===================
|
||||||
|
|
||||||
|
The optional header ``fmt/xchar.h`` provides support for ``wchar_t`` and exotic
|
||||||
|
character types.
|
||||||
|
|
||||||
|
.. doxygenstruct:: fmt::is_char
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::wstring_view
|
||||||
|
|
||||||
|
.. doxygentypedef:: fmt::wformat_context
|
||||||
|
|
||||||
|
.. doxygenfunction:: fmt::to_wstring(const T &value)
|
||||||
|
|
||||||
|
Compatibility with C++20 ``std::format``
|
||||||
|
========================================
|
||||||
|
|
||||||
|
{fmt} implements nearly all of the `C++20 formatting library
|
||||||
|
<https://en.cppreference.com/w/cpp/utility/format>`_ with the following
|
||||||
|
differences:
|
||||||
|
|
||||||
|
* Names are defined in the ``fmt`` namespace instead of ``std`` to avoid
|
||||||
|
collisions with standard library implementations.
|
||||||
|
* Width calculation doesn't use grapheme clusterization. The latter has been
|
||||||
|
implemented in a separate branch but hasn't been integrated yet.
|
||||||
|
* Most C++20 chrono types are not supported yet.
|
10
externals/fmt/doc/html/_sources/contents.rst.txt
vendored
Normal file
10
externals/fmt/doc/html/_sources/contents.rst.txt
vendored
Normal file
@ -0,0 +1,10 @@
|
|||||||
|
########
|
||||||
|
Contents
|
||||||
|
########
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 2
|
||||||
|
|
||||||
|
usage
|
||||||
|
api
|
||||||
|
syntax
|
198
externals/fmt/doc/html/_sources/index.rst.txt
vendored
Normal file
198
externals/fmt/doc/html/_sources/index.rst.txt
vendored
Normal file
@ -0,0 +1,198 @@
|
|||||||
|
Overview
|
||||||
|
========
|
||||||
|
|
||||||
|
**{fmt}** is an open-source formatting library providing a fast and safe
|
||||||
|
alternative to C stdio and C++ iostreams.
|
||||||
|
|
||||||
|
.. raw:: html
|
||||||
|
|
||||||
|
<div class="panel panel-default">
|
||||||
|
<div class="panel-heading">What users say:</div>
|
||||||
|
<div class="panel-body">
|
||||||
|
Thanks for creating this library. It’s been a hole in C++ for
|
||||||
|
a long time. I’ve used both <code>boost::format</code> and
|
||||||
|
<code>loki::SPrintf</code>, and neither felt like the right answer.
|
||||||
|
This does.
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
.. _format-api-intro:
|
||||||
|
|
||||||
|
Format API
|
||||||
|
----------
|
||||||
|
|
||||||
|
The format API is similar in spirit to the C ``printf`` family of function but
|
||||||
|
is safer, simpler and several times `faster
|
||||||
|
<https://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html>`_
|
||||||
|
than common standard library implementations.
|
||||||
|
The `format string syntax <syntax.html>`_ is similar to the one used by
|
||||||
|
`str.format <https://docs.python.org/3/library/stdtypes.html#str.format>`_ in
|
||||||
|
Python:
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
std::string s = fmt::format("The answer is {}.", 42);
|
||||||
|
|
||||||
|
The ``fmt::format`` function returns a string "The answer is 42.". You can use
|
||||||
|
``fmt::memory_buffer`` to avoid constructing ``std::string``:
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
auto out = fmt::memory_buffer();
|
||||||
|
fmt::format_to(std::back_inserter(out),
|
||||||
|
"For a moment, {} happened.", "nothing");
|
||||||
|
auto data = out.data(); // pointer to the formatted data
|
||||||
|
auto size = out.size(); // size of the formatted data
|
||||||
|
|
||||||
|
The ``fmt::print`` function performs formatting and writes the result to a stream:
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
fmt::print(stderr, "System error code = {}\n", errno);
|
||||||
|
|
||||||
|
If you omit the file argument the function will print to ``stdout``:
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
fmt::print("Don't {}\n", "panic");
|
||||||
|
|
||||||
|
The format API also supports positional arguments useful for localization:
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
fmt::print("I'd rather be {1} than {0}.", "right", "happy");
|
||||||
|
|
||||||
|
You can pass named arguments with ``fmt::arg``:
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
fmt::print("Hello, {name}! The answer is {number}. Goodbye, {name}.",
|
||||||
|
fmt::arg("name", "World"), fmt::arg("number", 42));
|
||||||
|
|
||||||
|
If your compiler supports C++11 user-defined literals, the suffix ``_a`` offers
|
||||||
|
an alternative, slightly terser syntax for named arguments:
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
using namespace fmt::literals;
|
||||||
|
fmt::print("Hello, {name}! The answer is {number}. Goodbye, {name}.",
|
||||||
|
"name"_a="World", "number"_a=42);
|
||||||
|
|
||||||
|
.. _safety:
|
||||||
|
|
||||||
|
Safety
|
||||||
|
------
|
||||||
|
|
||||||
|
The library is fully type safe, automatic memory management prevents buffer
|
||||||
|
overflow, errors in format strings are reported using exceptions or at compile
|
||||||
|
time. For example, the code
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
fmt::format("The answer is {:d}", "forty-two");
|
||||||
|
|
||||||
|
throws the ``format_error`` exception because the argument ``"forty-two"`` is a
|
||||||
|
string while the format code ``d`` only applies to integers.
|
||||||
|
|
||||||
|
The code
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
format(FMT_STRING("The answer is {:d}"), "forty-two");
|
||||||
|
|
||||||
|
reports a compile-time error on compilers that support relaxed ``constexpr``.
|
||||||
|
See `here <api.html#compile-time-format-string-checks>`_ for details.
|
||||||
|
|
||||||
|
The following code
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
fmt::format("Cyrillic letter {}", L'\x42e');
|
||||||
|
|
||||||
|
produces a compile-time error because wide character ``L'\x42e'`` cannot be
|
||||||
|
formatted into a narrow string. For comparison, writing a wide character to
|
||||||
|
``std::ostream`` results in its numeric value being written to the stream
|
||||||
|
(i.e. 1070 instead of letter 'ю' which is represented by ``L'\x42e'`` if we
|
||||||
|
use Unicode) which is rarely desirable.
|
||||||
|
|
||||||
|
Compact Binary Code
|
||||||
|
-------------------
|
||||||
|
|
||||||
|
The library produces compact per-call compiled code. For example
|
||||||
|
(`godbolt <https://godbolt.org/g/TZU4KF>`_),
|
||||||
|
|
||||||
|
.. code:: c++
|
||||||
|
|
||||||
|
#include <fmt/core.h>
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
fmt::print("The answer is {}.", 42);
|
||||||
|
}
|
||||||
|
|
||||||
|
compiles to just
|
||||||
|
|
||||||
|
.. code:: asm
|
||||||
|
|
||||||
|
main: # @main
|
||||||
|
sub rsp, 24
|
||||||
|
mov qword ptr [rsp], 42
|
||||||
|
mov rcx, rsp
|
||||||
|
mov edi, offset .L.str
|
||||||
|
mov esi, 17
|
||||||
|
mov edx, 1
|
||||||
|
call fmt::v7::vprint(fmt::v7::basic_string_view<char>, fmt::v7::format_args)
|
||||||
|
xor eax, eax
|
||||||
|
add rsp, 24
|
||||||
|
ret
|
||||||
|
.L.str:
|
||||||
|
.asciz "The answer is {}."
|
||||||
|
|
||||||
|
.. _portability:
|
||||||
|
|
||||||
|
Portability
|
||||||
|
-----------
|
||||||
|
|
||||||
|
The library is highly portable and relies only on a small set of C++11 features:
|
||||||
|
|
||||||
|
* variadic templates
|
||||||
|
* type traits
|
||||||
|
* rvalue references
|
||||||
|
* decltype
|
||||||
|
* trailing return types
|
||||||
|
* deleted functions
|
||||||
|
* alias templates
|
||||||
|
|
||||||
|
These are available in GCC 4.8, Clang 3.4, MSVC 19.0 (2015) and more recent
|
||||||
|
compiler version. For older compilers use {fmt} `version 4.x
|
||||||
|
<https://github.com/fmtlib/fmt/releases/tag/4.1.0>`_ which is maintained and
|
||||||
|
only requires C++98.
|
||||||
|
|
||||||
|
The output of all formatting functions is consistent across platforms.
|
||||||
|
For example,
|
||||||
|
|
||||||
|
.. code::
|
||||||
|
|
||||||
|
fmt::print("{}", std::numeric_limits<double>::infinity());
|
||||||
|
|
||||||
|
always prints ``inf`` while the output of ``printf`` is platform-dependent.
|
||||||
|
|
||||||
|
.. _ease-of-use:
|
||||||
|
|
||||||
|
Ease of Use
|
||||||
|
-----------
|
||||||
|
|
||||||
|
{fmt} has a small self-contained code base with the core library consisting of
|
||||||
|
just three header files and no external dependencies.
|
||||||
|
A permissive MIT `license <https://github.com/fmtlib/fmt#license>`_ allows
|
||||||
|
using the library both in open-source and commercial projects.
|
||||||
|
|
||||||
|
`Learn more... <contents.html>`_
|
||||||
|
|
||||||
|
.. raw:: html
|
||||||
|
|
||||||
|
<a class="btn btn-success" href="https://github.com/fmtlib/fmt">GitHub Repository</a>
|
||||||
|
|
||||||
|
<div class="section footer">
|
||||||
|
<iframe src="https://ghbtns.com/github-btn.html?user=fmtlib&repo=fmt&type=watch&count=true"
|
||||||
|
class="github-btn" width="100" height="20"></iframe>
|
||||||
|
</div>
|
514
externals/fmt/doc/html/_sources/syntax.rst.txt
vendored
Normal file
514
externals/fmt/doc/html/_sources/syntax.rst.txt
vendored
Normal file
@ -0,0 +1,514 @@
|
|||||||
|
.. _syntax:
|
||||||
|
|
||||||
|
********************
|
||||||
|
Format String Syntax
|
||||||
|
********************
|
||||||
|
|
||||||
|
Formatting functions such as :ref:`fmt::format() <format>` and
|
||||||
|
:ref:`fmt::print() <print>` use the same format string syntax described in this
|
||||||
|
section.
|
||||||
|
|
||||||
|
Format strings contain "replacement fields" surrounded by curly braces ``{}``.
|
||||||
|
Anything that is not contained in braces is considered literal text, which is
|
||||||
|
copied unchanged to the output. If you need to include a brace character in the
|
||||||
|
literal text, it can be escaped by doubling: ``{{`` and ``}}``.
|
||||||
|
|
||||||
|
The grammar for a replacement field is as follows:
|
||||||
|
|
||||||
|
.. productionlist:: sf
|
||||||
|
replacement_field: "{" [`arg_id`] [":" (`format_spec` | `chrono_format_spec`)] "}"
|
||||||
|
arg_id: `integer` | `identifier`
|
||||||
|
integer: `digit`+
|
||||||
|
digit: "0"..."9"
|
||||||
|
identifier: `id_start` `id_continue`*
|
||||||
|
id_start: "a"..."z" | "A"..."Z" | "_"
|
||||||
|
id_continue: `id_start` | `digit`
|
||||||
|
|
||||||
|
In less formal terms, the replacement field can start with an *arg_id*
|
||||||
|
that specifies the argument whose value is to be formatted and inserted into
|
||||||
|
the output instead of the replacement field.
|
||||||
|
The *arg_id* is optionally followed by a *format_spec*, which is preceded by a
|
||||||
|
colon ``':'``. These specify a non-default format for the replacement value.
|
||||||
|
|
||||||
|
See also the :ref:`formatspec` section.
|
||||||
|
|
||||||
|
If the numerical arg_ids in a format string are 0, 1, 2, ... in sequence,
|
||||||
|
they can all be omitted (not just some) and the numbers 0, 1, 2, ... will be
|
||||||
|
automatically inserted in that order.
|
||||||
|
|
||||||
|
Named arguments can be referred to by their names or indices.
|
||||||
|
|
||||||
|
Some simple format string examples::
|
||||||
|
|
||||||
|
"First, thou shalt count to {0}" // References the first argument
|
||||||
|
"Bring me a {}" // Implicitly references the first argument
|
||||||
|
"From {} to {}" // Same as "From {0} to {1}"
|
||||||
|
|
||||||
|
The *format_spec* field contains a specification of how the value should be
|
||||||
|
presented, including such details as field width, alignment, padding, decimal
|
||||||
|
precision and so on. Each value type can define its own "formatting
|
||||||
|
mini-language" or interpretation of the *format_spec*.
|
||||||
|
|
||||||
|
Most built-in types support a common formatting mini-language, which is
|
||||||
|
described in the next section.
|
||||||
|
|
||||||
|
A *format_spec* field can also include nested replacement fields in certain
|
||||||
|
positions within it. These nested replacement fields can contain only an
|
||||||
|
argument id; format specifications are not allowed. This allows the formatting
|
||||||
|
of a value to be dynamically specified.
|
||||||
|
|
||||||
|
See the :ref:`formatexamples` section for some examples.
|
||||||
|
|
||||||
|
.. _formatspec:
|
||||||
|
|
||||||
|
Format Specification Mini-Language
|
||||||
|
==================================
|
||||||
|
|
||||||
|
"Format specifications" are used within replacement fields contained within a
|
||||||
|
format string to define how individual values are presented (see
|
||||||
|
:ref:`syntax`). Each formattable type may define how the format
|
||||||
|
specification is to be interpreted.
|
||||||
|
|
||||||
|
Most built-in types implement the following options for format specifications,
|
||||||
|
although some of the formatting options are only supported by the numeric types.
|
||||||
|
|
||||||
|
The general form of a *standard format specifier* is:
|
||||||
|
|
||||||
|
.. productionlist:: sf
|
||||||
|
format_spec: [[`fill`]`align`][`sign`]["#"]["0"][`width`]["." `precision`]["L"][`type`]
|
||||||
|
fill: <a character other than '{' or '}'>
|
||||||
|
align: "<" | ">" | "^"
|
||||||
|
sign: "+" | "-" | " "
|
||||||
|
width: `integer` | "{" [`arg_id`] "}"
|
||||||
|
precision: `integer` | "{" [`arg_id`] "}"
|
||||||
|
type: "a" | "A" | "b" | "B" | "c" | "d" | "e" | "E" | "f" | "F" | "g" | "G" |
|
||||||
|
: "o" | "p" | "s" | "x" | "X"
|
||||||
|
|
||||||
|
The *fill* character can be any Unicode code point other than ``'{'`` or
|
||||||
|
``'}'``. The presence of a fill character is signaled by the character following
|
||||||
|
it, which must be one of the alignment options. If the second character of
|
||||||
|
*format_spec* is not a valid alignment option, then it is assumed that both the
|
||||||
|
fill character and the alignment option are absent.
|
||||||
|
|
||||||
|
The meaning of the various alignment options is as follows:
|
||||||
|
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| Option | Meaning |
|
||||||
|
+=========+==========================================================+
|
||||||
|
| ``'<'`` | Forces the field to be left-aligned within the available |
|
||||||
|
| | space (this is the default for most objects). |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'>'`` | Forces the field to be right-aligned within the |
|
||||||
|
| | available space (this is the default for numbers). |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'^'`` | Forces the field to be centered within the available |
|
||||||
|
| | space. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
|
Note that unless a minimum field width is defined, the field width will always
|
||||||
|
be the same size as the data to fill it, so that the alignment option has no
|
||||||
|
meaning in this case.
|
||||||
|
|
||||||
|
The *sign* option is only valid for number types, and can be one of the
|
||||||
|
following:
|
||||||
|
|
||||||
|
+---------+------------------------------------------------------------+
|
||||||
|
| Option | Meaning |
|
||||||
|
+=========+============================================================+
|
||||||
|
| ``'+'`` | indicates that a sign should be used for both |
|
||||||
|
| | nonnegative as well as negative numbers. |
|
||||||
|
+---------+------------------------------------------------------------+
|
||||||
|
| ``'-'`` | indicates that a sign should be used only for negative |
|
||||||
|
| | numbers (this is the default behavior). |
|
||||||
|
+---------+------------------------------------------------------------+
|
||||||
|
| space | indicates that a leading space should be used on |
|
||||||
|
| | nonnegative numbers, and a minus sign on negative numbers. |
|
||||||
|
+---------+------------------------------------------------------------+
|
||||||
|
|
||||||
|
The ``'#'`` option causes the "alternate form" to be used for the
|
||||||
|
conversion. The alternate form is defined differently for different
|
||||||
|
types. This option is only valid for integer and floating-point types.
|
||||||
|
For integers, when binary, octal, or hexadecimal output is used, this
|
||||||
|
option adds the prefix respective ``"0b"`` (``"0B"``), ``"0"``, or
|
||||||
|
``"0x"`` (``"0X"``) to the output value. Whether the prefix is
|
||||||
|
lower-case or upper-case is determined by the case of the type
|
||||||
|
specifier, for example, the prefix ``"0x"`` is used for the type ``'x'``
|
||||||
|
and ``"0X"`` is used for ``'X'``. For floating-point numbers the
|
||||||
|
alternate form causes the result of the conversion to always contain a
|
||||||
|
decimal-point character, even if no digits follow it. Normally, a
|
||||||
|
decimal-point character appears in the result of these conversions
|
||||||
|
only if a digit follows it. In addition, for ``'g'`` and ``'G'``
|
||||||
|
conversions, trailing zeros are not removed from the result.
|
||||||
|
|
||||||
|
.. ifconfig:: False
|
||||||
|
|
||||||
|
The ``','`` option signals the use of a comma for a thousands separator.
|
||||||
|
For a locale aware separator, use the ``'L'`` integer presentation type
|
||||||
|
instead.
|
||||||
|
|
||||||
|
*width* is a decimal integer defining the minimum field width. If not
|
||||||
|
specified, then the field width will be determined by the content.
|
||||||
|
|
||||||
|
Preceding the *width* field by a zero (``'0'``) character enables sign-aware
|
||||||
|
zero-padding for numeric types. It forces the padding to be placed after the
|
||||||
|
sign or base (if any) but before the digits. This is used for printing fields in
|
||||||
|
the form '+000000120'. This option is only valid for numeric types and it has no
|
||||||
|
effect on formatting of infinity and NaN.
|
||||||
|
|
||||||
|
The *precision* is a decimal number indicating how many digits should be
|
||||||
|
displayed after the decimal point for a floating-point value formatted with
|
||||||
|
``'f'`` and ``'F'``, or before and after the decimal point for a floating-point
|
||||||
|
value formatted with ``'g'`` or ``'G'``. For non-number types the field
|
||||||
|
indicates the maximum field size - in other words, how many characters will be
|
||||||
|
used from the field content. The *precision* is not allowed for integer,
|
||||||
|
character, Boolean, and pointer values. Note that a C string must be
|
||||||
|
null-terminated even if precision is specified.
|
||||||
|
|
||||||
|
The ``'L'`` option uses the current locale setting to insert the appropriate
|
||||||
|
number separator characters. This option is only valid for numeric types.
|
||||||
|
|
||||||
|
Finally, the *type* determines how the data should be presented.
|
||||||
|
|
||||||
|
The available string presentation types are:
|
||||||
|
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| Type | Meaning |
|
||||||
|
+=========+==========================================================+
|
||||||
|
| ``'s'`` | String format. This is the default type for strings and |
|
||||||
|
| | may be omitted. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| none | The same as ``'s'``. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
|
The available character presentation types are:
|
||||||
|
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| Type | Meaning |
|
||||||
|
+=========+==========================================================+
|
||||||
|
| ``'c'`` | Character format. This is the default type for |
|
||||||
|
| | characters and may be omitted. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| none | The same as ``'c'``. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
|
The available integer presentation types are:
|
||||||
|
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| Type | Meaning |
|
||||||
|
+=========+==========================================================+
|
||||||
|
| ``'b'`` | Binary format. Outputs the number in base 2. Using the |
|
||||||
|
| | ``'#'`` option with this type adds the prefix ``"0b"`` |
|
||||||
|
| | to the output value. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'B'`` | Binary format. Outputs the number in base 2. Using the |
|
||||||
|
| | ``'#'`` option with this type adds the prefix ``"0B"`` |
|
||||||
|
| | to the output value. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'c'`` | Character format. Outputs the number as a character. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'d'`` | Decimal integer. Outputs the number in base 10. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'o'`` | Octal format. Outputs the number in base 8. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'x'`` | Hex format. Outputs the number in base 16, using |
|
||||||
|
| | lower-case letters for the digits above 9. Using the |
|
||||||
|
| | ``'#'`` option with this type adds the prefix ``"0x"`` |
|
||||||
|
| | to the output value. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'X'`` | Hex format. Outputs the number in base 16, using |
|
||||||
|
| | upper-case letters for the digits above 9. Using the |
|
||||||
|
| | ``'#'`` option with this type adds the prefix ``"0X"`` |
|
||||||
|
| | to the output value. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| none | The same as ``'d'``. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
|
Integer presentation types can also be used with character and Boolean values.
|
||||||
|
Boolean values are formatted using textual representation, either ``true`` or
|
||||||
|
``false``, if the presentation type is not specified.
|
||||||
|
|
||||||
|
The available presentation types for floating-point values are:
|
||||||
|
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| Type | Meaning |
|
||||||
|
+=========+==========================================================+
|
||||||
|
| ``'a'`` | Hexadecimal floating point format. Prints the number in |
|
||||||
|
| | base 16 with prefix ``"0x"`` and lower-case letters for |
|
||||||
|
| | digits above 9. Uses ``'p'`` to indicate the exponent. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'A'`` | Same as ``'a'`` except it uses upper-case letters for |
|
||||||
|
| | the prefix, digits above 9 and to indicate the exponent. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'e'`` | Exponent notation. Prints the number in scientific |
|
||||||
|
| | notation using the letter 'e' to indicate the exponent. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'E'`` | Exponent notation. Same as ``'e'`` except it uses an |
|
||||||
|
| | upper-case ``'E'`` as the separator character. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'f'`` | Fixed point. Displays the number as a fixed-point |
|
||||||
|
| | number. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'F'`` | Fixed point. Same as ``'f'``, but converts ``nan`` to |
|
||||||
|
| | ``NAN`` and ``inf`` to ``INF``. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'g'`` | General format. For a given precision ``p >= 1``, |
|
||||||
|
| | this rounds the number to ``p`` significant digits and |
|
||||||
|
| | then formats the result in either fixed-point format |
|
||||||
|
| | or in scientific notation, depending on its magnitude. |
|
||||||
|
| | |
|
||||||
|
| | A precision of ``0`` is treated as equivalent to a |
|
||||||
|
| | precision of ``1``. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'G'`` | General format. Same as ``'g'`` except switches to |
|
||||||
|
| | ``'E'`` if the number gets too large. The |
|
||||||
|
| | representations of infinity and NaN are uppercased, too. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| none | Similar to ``'g'``, except that the default precision is |
|
||||||
|
| | as high as needed to represent the particular value. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
|
.. ifconfig:: False
|
||||||
|
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| | The precise rules are as follows: suppose that the |
|
||||||
|
| | result formatted with presentation type ``'e'`` and |
|
||||||
|
| | precision ``p-1`` would have exponent ``exp``. Then |
|
||||||
|
| | if ``-4 <= exp < p``, the number is formatted |
|
||||||
|
| | with presentation type ``'f'`` and precision |
|
||||||
|
| | ``p-1-exp``. Otherwise, the number is formatted |
|
||||||
|
| | with presentation type ``'e'`` and precision ``p-1``. |
|
||||||
|
| | In both cases insignificant trailing zeros are removed |
|
||||||
|
| | from the significand, and the decimal point is also |
|
||||||
|
| | removed if there are no remaining digits following it. |
|
||||||
|
| | |
|
||||||
|
| | Positive and negative infinity, positive and negative |
|
||||||
|
| | zero, and nans, are formatted as ``inf``, ``-inf``, |
|
||||||
|
| | ``0``, ``-0`` and ``nan`` respectively, regardless of |
|
||||||
|
| | the precision. |
|
||||||
|
| | |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
|
The available presentation types for pointers are:
|
||||||
|
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| Type | Meaning |
|
||||||
|
+=========+==========================================================+
|
||||||
|
| ``'p'`` | Pointer format. This is the default type for |
|
||||||
|
| | pointers and may be omitted. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
| none | The same as ``'p'``. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
|
.. _chrono-specs:
|
||||||
|
|
||||||
|
Chrono Format Specifications
|
||||||
|
============================
|
||||||
|
|
||||||
|
Format specifications for chrono types and ``std::tm`` have the following
|
||||||
|
syntax:
|
||||||
|
|
||||||
|
.. productionlist:: sf
|
||||||
|
chrono_format_spec: [[`fill`]`align`][`width`]["." `precision`][`chrono_specs`]
|
||||||
|
chrono_specs: [`chrono_specs`] `conversion_spec` | `chrono_specs` `literal_char`
|
||||||
|
conversion_spec: "%" [`modifier`] `chrono_type`
|
||||||
|
literal_char: <a character other than '{', '}' or '%'>
|
||||||
|
modifier: "E" | "O"
|
||||||
|
chrono_type: "a" | "A" | "b" | "B" | "c" | "C" | "d" | "D" | "e" | "F" |
|
||||||
|
: "g" | "G" | "h" | "H" | "I" | "j" | "m" | "M" | "n" | "p" |
|
||||||
|
: "q" | "Q" | "r" | "R" | "S" | "t" | "T" | "u" | "U" | "V" |
|
||||||
|
: "w" | "W" | "x" | "X" | "y" | "Y" | "z" | "Z" | "%"
|
||||||
|
|
||||||
|
Literal chars are copied unchanged to the output. Precision is valid only for
|
||||||
|
``std::chrono::duration`` types with a floating-point representation type.
|
||||||
|
|
||||||
|
The available presentation types (*chrono_type*) for chrono durations and time
|
||||||
|
points are:
|
||||||
|
|
||||||
|
+---------+--------------------------------------------------------------------+
|
||||||
|
| Type | Meaning |
|
||||||
|
+=========+====================================================================+
|
||||||
|
| ``'H'`` | The hour (24-hour clock) as a decimal number. If the result is a |
|
||||||
|
| | single digit, it is prefixed with 0. The modified command ``%OH`` |
|
||||||
|
| | produces the locale's alternative representation. |
|
||||||
|
+---------+--------------------------------------------------------------------+
|
||||||
|
| ``'M'`` | The minute as a decimal number. If the result is a single digit, |
|
||||||
|
| | it is prefixed with 0. The modified command ``%OM`` produces the |
|
||||||
|
| | locale's alternative representation. |
|
||||||
|
+---------+--------------------------------------------------------------------+
|
||||||
|
| ``'S'`` | Seconds as a decimal number. If the number of seconds is less than |
|
||||||
|
| | 10, the result is prefixed with 0. If the precision of the input |
|
||||||
|
| | cannot be exactly represented with seconds, then the format is a |
|
||||||
|
| | decimal floating-point number with a fixed format and a precision |
|
||||||
|
| | matching that of the precision of the input (or to a microseconds |
|
||||||
|
| | precision if the conversion to floating-point decimal seconds |
|
||||||
|
| | cannot be made within 18 fractional digits). The character for the |
|
||||||
|
| | decimal point is localized according to the locale. The modified |
|
||||||
|
| | command ``%OS`` produces the locale's alternative representation. |
|
||||||
|
+---------+--------------------------------------------------------------------+
|
||||||
|
|
||||||
|
Specifiers that have a calendaric component such as ``'d'`` (the day of month)
|
||||||
|
are valid only for ``std::tm`` and not durations or time points.
|
||||||
|
|
||||||
|
.. range-specs:
|
||||||
|
|
||||||
|
Range Format Specifications
|
||||||
|
===========================
|
||||||
|
|
||||||
|
Format specifications for range types have the following syntax:
|
||||||
|
|
||||||
|
.. productionlist:: sf
|
||||||
|
range_format_spec: [":" [`underlying_spec`]]
|
||||||
|
|
||||||
|
The `underlying_spec` is parsed based on the formatter of the range's
|
||||||
|
reference type.
|
||||||
|
|
||||||
|
By default, a range of characters or strings is printed escaped and quoted. But
|
||||||
|
if any `underlying_spec` is provided (even if it is empty), then the characters
|
||||||
|
or strings are printed according to the provided specification.
|
||||||
|
|
||||||
|
Examples::
|
||||||
|
|
||||||
|
fmt::format("{}", std::vector{10, 20, 30});
|
||||||
|
// Result: [10, 20, 30]
|
||||||
|
fmt::format("{::#x}", std::vector{10, 20, 30});
|
||||||
|
// Result: [0xa, 0x14, 0x13]
|
||||||
|
fmt::format("{}", vector{'h', 'e', 'l', 'l', 'o'});
|
||||||
|
// Result: ['h', 'e', 'l', 'l', 'o']
|
||||||
|
fmt::format("{::}", vector{'h', 'e', 'l', 'l', 'o'});
|
||||||
|
// Result: [h, e, l, l, o]
|
||||||
|
fmt::format("{::d}", vector{'h', 'e', 'l', 'l', 'o'});
|
||||||
|
// Result: [104, 101, 108, 108, 111]
|
||||||
|
|
||||||
|
.. _formatexamples:
|
||||||
|
|
||||||
|
Format Examples
|
||||||
|
===============
|
||||||
|
|
||||||
|
This section contains examples of the format syntax and comparison with
|
||||||
|
the printf formatting.
|
||||||
|
|
||||||
|
In most of the cases the syntax is similar to the printf formatting, with the
|
||||||
|
addition of the ``{}`` and with ``:`` used instead of ``%``.
|
||||||
|
For example, ``"%03.2f"`` can be translated to ``"{:03.2f}"``.
|
||||||
|
|
||||||
|
The new format syntax also supports new and different options, shown in the
|
||||||
|
following examples.
|
||||||
|
|
||||||
|
Accessing arguments by position::
|
||||||
|
|
||||||
|
fmt::format("{0}, {1}, {2}", 'a', 'b', 'c');
|
||||||
|
// Result: "a, b, c"
|
||||||
|
fmt::format("{}, {}, {}", 'a', 'b', 'c');
|
||||||
|
// Result: "a, b, c"
|
||||||
|
fmt::format("{2}, {1}, {0}", 'a', 'b', 'c');
|
||||||
|
// Result: "c, b, a"
|
||||||
|
fmt::format("{0}{1}{0}", "abra", "cad"); // arguments' indices can be repeated
|
||||||
|
// Result: "abracadabra"
|
||||||
|
|
||||||
|
Aligning the text and specifying a width::
|
||||||
|
|
||||||
|
fmt::format("{:<30}", "left aligned");
|
||||||
|
// Result: "left aligned "
|
||||||
|
fmt::format("{:>30}", "right aligned");
|
||||||
|
// Result: " right aligned"
|
||||||
|
fmt::format("{:^30}", "centered");
|
||||||
|
// Result: " centered "
|
||||||
|
fmt::format("{:*^30}", "centered"); // use '*' as a fill char
|
||||||
|
// Result: "***********centered***********"
|
||||||
|
|
||||||
|
Dynamic width::
|
||||||
|
|
||||||
|
fmt::format("{:<{}}", "left aligned", 30);
|
||||||
|
// Result: "left aligned "
|
||||||
|
|
||||||
|
Dynamic precision::
|
||||||
|
|
||||||
|
fmt::format("{:.{}f}", 3.14, 1);
|
||||||
|
// Result: "3.1"
|
||||||
|
|
||||||
|
Replacing ``%+f``, ``%-f``, and ``% f`` and specifying a sign::
|
||||||
|
|
||||||
|
fmt::format("{:+f}; {:+f}", 3.14, -3.14); // show it always
|
||||||
|
// Result: "+3.140000; -3.140000"
|
||||||
|
fmt::format("{: f}; {: f}", 3.14, -3.14); // show a space for positive numbers
|
||||||
|
// Result: " 3.140000; -3.140000"
|
||||||
|
fmt::format("{:-f}; {:-f}", 3.14, -3.14); // show only the minus -- same as '{:f}; {:f}'
|
||||||
|
// Result: "3.140000; -3.140000"
|
||||||
|
|
||||||
|
Replacing ``%x`` and ``%o`` and converting the value to different bases::
|
||||||
|
|
||||||
|
fmt::format("int: {0:d}; hex: {0:x}; oct: {0:o}; bin: {0:b}", 42);
|
||||||
|
// Result: "int: 42; hex: 2a; oct: 52; bin: 101010"
|
||||||
|
// with 0x or 0 or 0b as prefix:
|
||||||
|
fmt::format("int: {0:d}; hex: {0:#x}; oct: {0:#o}; bin: {0:#b}", 42);
|
||||||
|
// Result: "int: 42; hex: 0x2a; oct: 052; bin: 0b101010"
|
||||||
|
|
||||||
|
Padded hex byte with prefix and always prints both hex characters::
|
||||||
|
|
||||||
|
fmt::format("{:#04x}", 0);
|
||||||
|
// Result: "0x00"
|
||||||
|
|
||||||
|
Box drawing using Unicode fill::
|
||||||
|
|
||||||
|
fmt::print(
|
||||||
|
"┌{0:─^{2}}┐\n"
|
||||||
|
"│{1: ^{2}}│\n"
|
||||||
|
"└{0:─^{2}}┘\n", "", "Hello, world!", 20);
|
||||||
|
|
||||||
|
prints::
|
||||||
|
|
||||||
|
┌────────────────────┐
|
||||||
|
│ Hello, world! │
|
||||||
|
└────────────────────┘
|
||||||
|
|
||||||
|
Using type-specific formatting::
|
||||||
|
|
||||||
|
#include <fmt/chrono.h>
|
||||||
|
|
||||||
|
auto t = tm();
|
||||||
|
t.tm_year = 2010 - 1900;
|
||||||
|
t.tm_mon = 7;
|
||||||
|
t.tm_mday = 4;
|
||||||
|
t.tm_hour = 12;
|
||||||
|
t.tm_min = 15;
|
||||||
|
t.tm_sec = 58;
|
||||||
|
fmt::print("{:%Y-%m-%d %H:%M:%S}", t);
|
||||||
|
// Prints: 2010-08-04 12:15:58
|
||||||
|
|
||||||
|
Using the comma as a thousands separator::
|
||||||
|
|
||||||
|
#include <fmt/format.h>
|
||||||
|
|
||||||
|
auto s = fmt::format(std::locale("en_US.UTF-8"), "{:L}", 1234567890);
|
||||||
|
// s == "1,234,567,890"
|
||||||
|
|
||||||
|
.. ifconfig:: False
|
||||||
|
|
||||||
|
Nesting arguments and more complex examples::
|
||||||
|
|
||||||
|
>>> for align, text in zip('<^>', ['left', 'center', 'right']):
|
||||||
|
... '{0:{fill}{align}16}") << text, fill=align, align=align)
|
||||||
|
...
|
||||||
|
'left<<<<<<<<<<<<'
|
||||||
|
'^^^^^center^^^^^'
|
||||||
|
'>>>>>>>>>>>right'
|
||||||
|
>>>
|
||||||
|
>>> octets = [192, 168, 0, 1]
|
||||||
|
Format("{:02X}{:02X}{:02X}{:02X}") << *octets)
|
||||||
|
'C0A80001'
|
||||||
|
>>> int(_, 16)
|
||||||
|
3232235521
|
||||||
|
>>>
|
||||||
|
>>> width = 5
|
||||||
|
>>> for num in range(5,12):
|
||||||
|
... for base in 'dXob':
|
||||||
|
... print('{0:{width}{base}}") << num, base=base, width=width), end=' ')
|
||||||
|
... print()
|
||||||
|
...
|
||||||
|
5 5 5 101
|
||||||
|
6 6 6 110
|
||||||
|
7 7 7 111
|
||||||
|
8 8 10 1000
|
||||||
|
9 9 11 1001
|
||||||
|
10 A 12 1010
|
||||||
|
11 B 13 1011
|
212
externals/fmt/doc/html/_sources/usage.rst.txt
vendored
Normal file
212
externals/fmt/doc/html/_sources/usage.rst.txt
vendored
Normal file
@ -0,0 +1,212 @@
|
|||||||
|
*****
|
||||||
|
Usage
|
||||||
|
*****
|
||||||
|
|
||||||
|
To use the {fmt} library, add :file:`fmt/core.h`, :file:`fmt/format.h`,
|
||||||
|
:file:`fmt/format-inl.h`, :file:`src/format.cc` and optionally other headers
|
||||||
|
from a `release archive <https://github.com/fmtlib/fmt/releases/latest>`_ or
|
||||||
|
the `Git repository <https://github.com/fmtlib/fmt>`_ to your project.
|
||||||
|
Alternatively, you can :ref:`build the library with CMake <building>`.
|
||||||
|
|
||||||
|
.. _building:
|
||||||
|
|
||||||
|
Building the Library
|
||||||
|
====================
|
||||||
|
|
||||||
|
The included `CMake build script`__ can be used to build the fmt
|
||||||
|
library on a wide range of platforms. CMake is freely available for
|
||||||
|
download from https://www.cmake.org/download/.
|
||||||
|
|
||||||
|
__ https://github.com/fmtlib/fmt/blob/master/CMakeLists.txt
|
||||||
|
|
||||||
|
CMake works by generating native makefiles or project files that can
|
||||||
|
be used in the compiler environment of your choice. The typical
|
||||||
|
workflow starts with::
|
||||||
|
|
||||||
|
mkdir build # Create a directory to hold the build output.
|
||||||
|
cd build
|
||||||
|
cmake .. # Generate native build scripts.
|
||||||
|
|
||||||
|
where :file:`{<path/to/fmt>}` is a path to the ``fmt`` repository.
|
||||||
|
|
||||||
|
If you are on a \*nix system, you should now see a Makefile in the
|
||||||
|
current directory. Now you can build the library by running :command:`make`.
|
||||||
|
|
||||||
|
Once the library has been built you can invoke :command:`make test` to run
|
||||||
|
the tests.
|
||||||
|
|
||||||
|
You can control generation of the make ``test`` target with the ``FMT_TEST``
|
||||||
|
CMake option. This can be useful if you include fmt as a subdirectory in
|
||||||
|
your project but don't want to add fmt's tests to your ``test`` target.
|
||||||
|
|
||||||
|
If you use Windows and have Visual Studio installed, a :file:`FMT.sln`
|
||||||
|
file and several :file:`.vcproj` files will be created. You can then build them
|
||||||
|
using Visual Studio or msbuild.
|
||||||
|
|
||||||
|
On Mac OS X with Xcode installed, an :file:`.xcodeproj` file will be generated.
|
||||||
|
|
||||||
|
To build a `shared library`__ set the ``BUILD_SHARED_LIBS`` CMake variable to
|
||||||
|
``TRUE``::
|
||||||
|
|
||||||
|
cmake -DBUILD_SHARED_LIBS=TRUE ...
|
||||||
|
|
||||||
|
__ https://en.wikipedia.org/wiki/Library_%28computing%29#Shared_libraries
|
||||||
|
|
||||||
|
|
||||||
|
To build a `static library` with position independent code (required if the main
|
||||||
|
consumer of the fmt library is a shared library i.e. a Python extension) set the
|
||||||
|
``CMAKE_POSITION_INDEPENDENT_CODE`` CMake variable to ``TRUE``::
|
||||||
|
|
||||||
|
cmake -DCMAKE_POSITION_INDEPENDENT_CODE=TRUE ...
|
||||||
|
|
||||||
|
|
||||||
|
Installing the Library
|
||||||
|
======================
|
||||||
|
|
||||||
|
After building the library you can install it on a Unix-like system by running
|
||||||
|
:command:`sudo make install`.
|
||||||
|
|
||||||
|
Usage with CMake
|
||||||
|
================
|
||||||
|
|
||||||
|
You can add the ``fmt`` library directory into your project and include it in
|
||||||
|
your ``CMakeLists.txt`` file::
|
||||||
|
|
||||||
|
add_subdirectory(fmt)
|
||||||
|
|
||||||
|
or
|
||||||
|
|
||||||
|
::
|
||||||
|
|
||||||
|
add_subdirectory(fmt EXCLUDE_FROM_ALL)
|
||||||
|
|
||||||
|
to exclude it from ``make``, ``make all``, or ``cmake --build .``.
|
||||||
|
|
||||||
|
You can detect and use an installed version of {fmt} as follows::
|
||||||
|
|
||||||
|
find_package(fmt)
|
||||||
|
target_link_libraries(<your-target> fmt::fmt)
|
||||||
|
|
||||||
|
Setting up your target to use a header-only version of ``fmt`` is equally easy::
|
||||||
|
|
||||||
|
target_link_libraries(<your-target> PRIVATE fmt::fmt-header-only)
|
||||||
|
|
||||||
|
Usage with build2
|
||||||
|
=================
|
||||||
|
|
||||||
|
You can use `build2 <https://build2.org>`_, a dependency manager and a
|
||||||
|
build-system combined, to use ``fmt``.
|
||||||
|
|
||||||
|
Currently this package is available in these package repositories:
|
||||||
|
|
||||||
|
- **https://cppget.org/fmt/** for released and published versions.
|
||||||
|
- `The git repository with the sources of the build2 package of fmt <https://github.com/build2-packaging/fmt.git>`_
|
||||||
|
for unreleased or custom revisions of ``fmt``.
|
||||||
|
|
||||||
|
**Usage:**
|
||||||
|
|
||||||
|
- ``build2`` package name: ``fmt``
|
||||||
|
- Library target name : ``lib{fmt}``
|
||||||
|
|
||||||
|
For example, to make your ``build2`` project depend on ``fmt``:
|
||||||
|
|
||||||
|
- Add one of the repositories to your configurations, or in your
|
||||||
|
``repositories.manifest``, if not already there::
|
||||||
|
|
||||||
|
:
|
||||||
|
role: prerequisite
|
||||||
|
location: https://pkg.cppget.org/1/stable
|
||||||
|
|
||||||
|
- Add this package as a dependency to your ``./manifest`` file
|
||||||
|
(example for ``v7.0.x``)::
|
||||||
|
|
||||||
|
depends: fmt ~7.0.0
|
||||||
|
|
||||||
|
- Import the target and use it as a prerequisite to your own target
|
||||||
|
using `fmt` in the appropriate ``buildfile``::
|
||||||
|
|
||||||
|
import fmt = fmt%lib{fmt}
|
||||||
|
lib{mylib} : cxx{**} ... $fmt
|
||||||
|
|
||||||
|
Then build your project as usual with `b` or `bdep update`.
|
||||||
|
|
||||||
|
For ``build2`` newcomers or to get more details and use cases, you can read the
|
||||||
|
``build2``
|
||||||
|
`toolchain introduction <https://build2.org/build2-toolchain/doc/build2-toolchain-intro.xhtml>`_.
|
||||||
|
|
||||||
|
Building the Documentation
|
||||||
|
==========================
|
||||||
|
|
||||||
|
To build the documentation you need the following software installed on your
|
||||||
|
system:
|
||||||
|
|
||||||
|
* `Python <https://www.python.org/>`_ with pip and virtualenv
|
||||||
|
* `Doxygen <http://www.stack.nl/~dimitri/doxygen/>`_
|
||||||
|
* `Less <http://lesscss.org/>`_ with ``less-plugin-clean-css``.
|
||||||
|
Ubuntu doesn't package the ``clean-css`` plugin so you should use ``npm``
|
||||||
|
instead of ``apt`` to install both ``less`` and the plugin::
|
||||||
|
|
||||||
|
sudo npm install -g less less-plugin-clean-css.
|
||||||
|
|
||||||
|
First generate makefiles or project files using CMake as described in
|
||||||
|
the previous section. Then compile the ``doc`` target/project, for example::
|
||||||
|
|
||||||
|
make doc
|
||||||
|
|
||||||
|
This will generate the HTML documentation in ``doc/html``.
|
||||||
|
|
||||||
|
Conda
|
||||||
|
=====
|
||||||
|
|
||||||
|
fmt can be installed on Linux, macOS and Windows with
|
||||||
|
`Conda <https://docs.conda.io/en/latest/>`__, using its
|
||||||
|
`conda-forge <https://conda-forge.org>`__
|
||||||
|
`package <https://github.com/conda-forge/fmt-feedstock>`__, as follows::
|
||||||
|
|
||||||
|
conda install -c conda-forge fmt
|
||||||
|
|
||||||
|
Vcpkg
|
||||||
|
=====
|
||||||
|
|
||||||
|
You can download and install fmt using the `vcpkg
|
||||||
|
<https://github.com/Microsoft/vcpkg>`__ dependency manager::
|
||||||
|
|
||||||
|
git clone https://github.com/Microsoft/vcpkg.git
|
||||||
|
cd vcpkg
|
||||||
|
./bootstrap-vcpkg.sh
|
||||||
|
./vcpkg integrate install
|
||||||
|
./vcpkg install fmt
|
||||||
|
|
||||||
|
The fmt port in vcpkg is kept up to date by Microsoft team members and community
|
||||||
|
contributors. If the version is out of date, please `create an issue or pull
|
||||||
|
request <https://github.com/Microsoft/vcpkg>`__ on the vcpkg repository.
|
||||||
|
|
||||||
|
LHelper
|
||||||
|
=======
|
||||||
|
|
||||||
|
You can download and install fmt using
|
||||||
|
`lhelper <https://github.com/franko/lhelper>`__ dependency manager::
|
||||||
|
|
||||||
|
lhelper activate <some-environment>
|
||||||
|
lhelper install fmt
|
||||||
|
|
||||||
|
All the recipes for lhelper are kept in the
|
||||||
|
`lhelper's recipe <https://github.com/franko/lhelper-recipes>`__ repository.
|
||||||
|
|
||||||
|
Android NDK
|
||||||
|
===========
|
||||||
|
|
||||||
|
fmt provides `Android.mk file`__ that can be used to build the library
|
||||||
|
with `Android NDK <https://developer.android.com/tools/sdk/ndk/index.html>`_.
|
||||||
|
For an example of using fmt with Android NDK, see the
|
||||||
|
`android-ndk-example <https://github.com/fmtlib/android-ndk-example>`_
|
||||||
|
repository.
|
||||||
|
|
||||||
|
__ https://github.com/fmtlib/fmt/blob/master/support/Android.mk
|
||||||
|
|
||||||
|
Homebrew
|
||||||
|
========
|
||||||
|
|
||||||
|
fmt can be installed on OS X using `Homebrew <https://brew.sh/>`_::
|
||||||
|
|
||||||
|
brew install fmt
|
856
externals/fmt/doc/html/_static/basic.css
vendored
Normal file
856
externals/fmt/doc/html/_static/basic.css
vendored
Normal file
@ -0,0 +1,856 @@
|
|||||||
|
/*
|
||||||
|
* basic.css
|
||||||
|
* ~~~~~~~~~
|
||||||
|
*
|
||||||
|
* Sphinx stylesheet -- basic theme.
|
||||||
|
*
|
||||||
|
* :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS.
|
||||||
|
* :license: BSD, see LICENSE for details.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
|
||||||
|
/* -- main layout ----------------------------------------------------------- */
|
||||||
|
|
||||||
|
div.clearer {
|
||||||
|
clear: both;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.section::after {
|
||||||
|
display: block;
|
||||||
|
content: '';
|
||||||
|
clear: left;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- relbar ---------------------------------------------------------------- */
|
||||||
|
|
||||||
|
div.related {
|
||||||
|
width: 100%;
|
||||||
|
font-size: 90%;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.related h3 {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.related ul {
|
||||||
|
margin: 0;
|
||||||
|
padding: 0 0 0 10px;
|
||||||
|
list-style: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.related li {
|
||||||
|
display: inline;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.related li.right {
|
||||||
|
float: right;
|
||||||
|
margin-right: 5px;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- sidebar --------------------------------------------------------------- */
|
||||||
|
|
||||||
|
div.sphinxsidebarwrapper {
|
||||||
|
padding: 10px 5px 0 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar {
|
||||||
|
float: left;
|
||||||
|
width: 230px;
|
||||||
|
margin-left: -100%;
|
||||||
|
font-size: 90%;
|
||||||
|
word-wrap: break-word;
|
||||||
|
overflow-wrap : break-word;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar ul {
|
||||||
|
list-style: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar ul ul,
|
||||||
|
div.sphinxsidebar ul.want-points {
|
||||||
|
margin-left: 20px;
|
||||||
|
list-style: square;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar ul ul {
|
||||||
|
margin-top: 0;
|
||||||
|
margin-bottom: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar form {
|
||||||
|
margin-top: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar input {
|
||||||
|
border: 1px solid #98dbcc;
|
||||||
|
font-family: sans-serif;
|
||||||
|
font-size: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar #searchbox form.search {
|
||||||
|
overflow: hidden;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar #searchbox input[type="text"] {
|
||||||
|
float: left;
|
||||||
|
width: 80%;
|
||||||
|
padding: 0.25em;
|
||||||
|
box-sizing: border-box;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar #searchbox input[type="submit"] {
|
||||||
|
float: left;
|
||||||
|
width: 20%;
|
||||||
|
border-left: none;
|
||||||
|
padding: 0.25em;
|
||||||
|
box-sizing: border-box;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
img {
|
||||||
|
border: 0;
|
||||||
|
max-width: 100%;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- search page ----------------------------------------------------------- */
|
||||||
|
|
||||||
|
ul.search {
|
||||||
|
margin: 10px 0 0 20px;
|
||||||
|
padding: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.search li {
|
||||||
|
padding: 5px 0 5px 20px;
|
||||||
|
background-image: url(file.png);
|
||||||
|
background-repeat: no-repeat;
|
||||||
|
background-position: 0 7px;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.search li a {
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.search li div.context {
|
||||||
|
color: #888;
|
||||||
|
margin: 2px 0 0 30px;
|
||||||
|
text-align: left;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.keywordmatches li.goodmatch a {
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- index page ------------------------------------------------------------ */
|
||||||
|
|
||||||
|
table.contentstable {
|
||||||
|
width: 90%;
|
||||||
|
margin-left: auto;
|
||||||
|
margin-right: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.contentstable p.biglink {
|
||||||
|
line-height: 150%;
|
||||||
|
}
|
||||||
|
|
||||||
|
a.biglink {
|
||||||
|
font-size: 1.3em;
|
||||||
|
}
|
||||||
|
|
||||||
|
span.linkdescr {
|
||||||
|
font-style: italic;
|
||||||
|
padding-top: 5px;
|
||||||
|
font-size: 90%;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- general index --------------------------------------------------------- */
|
||||||
|
|
||||||
|
table.indextable {
|
||||||
|
width: 100%;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.indextable td {
|
||||||
|
text-align: left;
|
||||||
|
vertical-align: top;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.indextable ul {
|
||||||
|
margin-top: 0;
|
||||||
|
margin-bottom: 0;
|
||||||
|
list-style-type: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.indextable > tbody > tr > td > ul {
|
||||||
|
padding-left: 0em;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.indextable tr.pcap {
|
||||||
|
height: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.indextable tr.cap {
|
||||||
|
margin-top: 10px;
|
||||||
|
background-color: #f2f2f2;
|
||||||
|
}
|
||||||
|
|
||||||
|
img.toggler {
|
||||||
|
margin-right: 3px;
|
||||||
|
margin-top: 3px;
|
||||||
|
cursor: pointer;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.modindex-jumpbox {
|
||||||
|
border-top: 1px solid #ddd;
|
||||||
|
border-bottom: 1px solid #ddd;
|
||||||
|
margin: 1em 0 1em 0;
|
||||||
|
padding: 0.4em;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.genindex-jumpbox {
|
||||||
|
border-top: 1px solid #ddd;
|
||||||
|
border-bottom: 1px solid #ddd;
|
||||||
|
margin: 1em 0 1em 0;
|
||||||
|
padding: 0.4em;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- domain module index --------------------------------------------------- */
|
||||||
|
|
||||||
|
table.modindextable td {
|
||||||
|
padding: 2px;
|
||||||
|
border-collapse: collapse;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- general body styles --------------------------------------------------- */
|
||||||
|
|
||||||
|
div.body {
|
||||||
|
min-width: 450px;
|
||||||
|
max-width: 800px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.body p, div.body dd, div.body li, div.body blockquote {
|
||||||
|
-moz-hyphens: auto;
|
||||||
|
-ms-hyphens: auto;
|
||||||
|
-webkit-hyphens: auto;
|
||||||
|
hyphens: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
a.headerlink {
|
||||||
|
visibility: hidden;
|
||||||
|
}
|
||||||
|
|
||||||
|
a.brackets:before,
|
||||||
|
span.brackets > a:before{
|
||||||
|
content: "[";
|
||||||
|
}
|
||||||
|
|
||||||
|
a.brackets:after,
|
||||||
|
span.brackets > a:after {
|
||||||
|
content: "]";
|
||||||
|
}
|
||||||
|
|
||||||
|
h1:hover > a.headerlink,
|
||||||
|
h2:hover > a.headerlink,
|
||||||
|
h3:hover > a.headerlink,
|
||||||
|
h4:hover > a.headerlink,
|
||||||
|
h5:hover > a.headerlink,
|
||||||
|
h6:hover > a.headerlink,
|
||||||
|
dt:hover > a.headerlink,
|
||||||
|
caption:hover > a.headerlink,
|
||||||
|
p.caption:hover > a.headerlink,
|
||||||
|
div.code-block-caption:hover > a.headerlink {
|
||||||
|
visibility: visible;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.body p.caption {
|
||||||
|
text-align: inherit;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.body td {
|
||||||
|
text-align: left;
|
||||||
|
}
|
||||||
|
|
||||||
|
.first {
|
||||||
|
margin-top: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
p.rubric {
|
||||||
|
margin-top: 30px;
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
|
img.align-left, .figure.align-left, object.align-left {
|
||||||
|
clear: left;
|
||||||
|
float: left;
|
||||||
|
margin-right: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
img.align-right, .figure.align-right, object.align-right {
|
||||||
|
clear: right;
|
||||||
|
float: right;
|
||||||
|
margin-left: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
img.align-center, .figure.align-center, object.align-center {
|
||||||
|
display: block;
|
||||||
|
margin-left: auto;
|
||||||
|
margin-right: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
img.align-default, .figure.align-default {
|
||||||
|
display: block;
|
||||||
|
margin-left: auto;
|
||||||
|
margin-right: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
.align-left {
|
||||||
|
text-align: left;
|
||||||
|
}
|
||||||
|
|
||||||
|
.align-center {
|
||||||
|
text-align: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
.align-default {
|
||||||
|
text-align: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
.align-right {
|
||||||
|
text-align: right;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- sidebars -------------------------------------------------------------- */
|
||||||
|
|
||||||
|
div.sidebar {
|
||||||
|
margin: 0 0 0.5em 1em;
|
||||||
|
border: 1px solid #ddb;
|
||||||
|
padding: 7px;
|
||||||
|
background-color: #ffe;
|
||||||
|
width: 40%;
|
||||||
|
float: right;
|
||||||
|
clear: right;
|
||||||
|
overflow-x: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
p.sidebar-title {
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.admonition, div.topic, blockquote {
|
||||||
|
clear: left;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- topics ---------------------------------------------------------------- */
|
||||||
|
|
||||||
|
div.topic {
|
||||||
|
border: 1px solid #ccc;
|
||||||
|
padding: 7px;
|
||||||
|
margin: 10px 0 10px 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
p.topic-title {
|
||||||
|
font-size: 1.1em;
|
||||||
|
font-weight: bold;
|
||||||
|
margin-top: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- admonitions ----------------------------------------------------------- */
|
||||||
|
|
||||||
|
div.admonition {
|
||||||
|
margin-top: 10px;
|
||||||
|
margin-bottom: 10px;
|
||||||
|
padding: 7px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.admonition dt {
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
|
p.admonition-title {
|
||||||
|
margin: 0px 10px 5px 0px;
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.body p.centered {
|
||||||
|
text-align: center;
|
||||||
|
margin-top: 25px;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- content of sidebars/topics/admonitions -------------------------------- */
|
||||||
|
|
||||||
|
div.sidebar > :last-child,
|
||||||
|
div.topic > :last-child,
|
||||||
|
div.admonition > :last-child {
|
||||||
|
margin-bottom: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sidebar::after,
|
||||||
|
div.topic::after,
|
||||||
|
div.admonition::after,
|
||||||
|
blockquote::after {
|
||||||
|
display: block;
|
||||||
|
content: '';
|
||||||
|
clear: both;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- tables ---------------------------------------------------------------- */
|
||||||
|
|
||||||
|
table.docutils {
|
||||||
|
margin-top: 10px;
|
||||||
|
margin-bottom: 10px;
|
||||||
|
border: 0;
|
||||||
|
border-collapse: collapse;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.align-center {
|
||||||
|
margin-left: auto;
|
||||||
|
margin-right: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.align-default {
|
||||||
|
margin-left: auto;
|
||||||
|
margin-right: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
table caption span.caption-number {
|
||||||
|
font-style: italic;
|
||||||
|
}
|
||||||
|
|
||||||
|
table caption span.caption-text {
|
||||||
|
}
|
||||||
|
|
||||||
|
table.docutils td, table.docutils th {
|
||||||
|
padding: 1px 8px 1px 5px;
|
||||||
|
border-top: 0;
|
||||||
|
border-left: 0;
|
||||||
|
border-right: 0;
|
||||||
|
border-bottom: 1px solid #aaa;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.footnote td, table.footnote th {
|
||||||
|
border: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
th {
|
||||||
|
text-align: left;
|
||||||
|
padding-right: 5px;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.citation {
|
||||||
|
border-left: solid 1px gray;
|
||||||
|
margin-left: 1px;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.citation td {
|
||||||
|
border-bottom: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
th > :first-child,
|
||||||
|
td > :first-child {
|
||||||
|
margin-top: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
th > :last-child,
|
||||||
|
td > :last-child {
|
||||||
|
margin-bottom: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- figures --------------------------------------------------------------- */
|
||||||
|
|
||||||
|
div.figure {
|
||||||
|
margin: 0.5em;
|
||||||
|
padding: 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.figure p.caption {
|
||||||
|
padding: 0.3em;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.figure p.caption span.caption-number {
|
||||||
|
font-style: italic;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.figure p.caption span.caption-text {
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- field list styles ----------------------------------------------------- */
|
||||||
|
|
||||||
|
table.field-list td, table.field-list th {
|
||||||
|
border: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field-list ul {
|
||||||
|
margin: 0;
|
||||||
|
padding-left: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field-list p {
|
||||||
|
margin: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field-name {
|
||||||
|
-moz-hyphens: manual;
|
||||||
|
-ms-hyphens: manual;
|
||||||
|
-webkit-hyphens: manual;
|
||||||
|
hyphens: manual;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- hlist styles ---------------------------------------------------------- */
|
||||||
|
|
||||||
|
table.hlist {
|
||||||
|
margin: 1em 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.hlist td {
|
||||||
|
vertical-align: top;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/* -- other body styles ----------------------------------------------------- */
|
||||||
|
|
||||||
|
ol.arabic {
|
||||||
|
list-style: decimal;
|
||||||
|
}
|
||||||
|
|
||||||
|
ol.loweralpha {
|
||||||
|
list-style: lower-alpha;
|
||||||
|
}
|
||||||
|
|
||||||
|
ol.upperalpha {
|
||||||
|
list-style: upper-alpha;
|
||||||
|
}
|
||||||
|
|
||||||
|
ol.lowerroman {
|
||||||
|
list-style: lower-roman;
|
||||||
|
}
|
||||||
|
|
||||||
|
ol.upperroman {
|
||||||
|
list-style: upper-roman;
|
||||||
|
}
|
||||||
|
|
||||||
|
:not(li) > ol > li:first-child > :first-child,
|
||||||
|
:not(li) > ul > li:first-child > :first-child {
|
||||||
|
margin-top: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
:not(li) > ol > li:last-child > :last-child,
|
||||||
|
:not(li) > ul > li:last-child > :last-child {
|
||||||
|
margin-bottom: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
ol.simple ol p,
|
||||||
|
ol.simple ul p,
|
||||||
|
ul.simple ol p,
|
||||||
|
ul.simple ul p {
|
||||||
|
margin-top: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
ol.simple > li:not(:first-child) > p,
|
||||||
|
ul.simple > li:not(:first-child) > p {
|
||||||
|
margin-top: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
ol.simple p,
|
||||||
|
ul.simple p {
|
||||||
|
margin-bottom: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl.footnote > dt,
|
||||||
|
dl.citation > dt {
|
||||||
|
float: left;
|
||||||
|
margin-right: 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl.footnote > dd,
|
||||||
|
dl.citation > dd {
|
||||||
|
margin-bottom: 0em;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl.footnote > dd:after,
|
||||||
|
dl.citation > dd:after {
|
||||||
|
content: "";
|
||||||
|
clear: both;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl.field-list {
|
||||||
|
display: grid;
|
||||||
|
grid-template-columns: fit-content(30%) auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl.field-list > dt {
|
||||||
|
font-weight: bold;
|
||||||
|
word-break: break-word;
|
||||||
|
padding-left: 0.5em;
|
||||||
|
padding-right: 5px;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl.field-list > dt:after {
|
||||||
|
content: ":";
|
||||||
|
}
|
||||||
|
|
||||||
|
dl.field-list > dd {
|
||||||
|
padding-left: 0.5em;
|
||||||
|
margin-top: 0em;
|
||||||
|
margin-left: 0em;
|
||||||
|
margin-bottom: 0em;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl {
|
||||||
|
margin-bottom: 15px;
|
||||||
|
}
|
||||||
|
|
||||||
|
dd > :first-child {
|
||||||
|
margin-top: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
dd ul, dd table {
|
||||||
|
margin-bottom: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
dd {
|
||||||
|
margin-top: 3px;
|
||||||
|
margin-bottom: 10px;
|
||||||
|
margin-left: 30px;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl > dd:last-child,
|
||||||
|
dl > dd:last-child > :last-child {
|
||||||
|
margin-bottom: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
dt:target, span.highlighted {
|
||||||
|
background-color: #fbe54e;
|
||||||
|
}
|
||||||
|
|
||||||
|
rect.highlighted {
|
||||||
|
fill: #fbe54e;
|
||||||
|
}
|
||||||
|
|
||||||
|
dl.glossary dt {
|
||||||
|
font-weight: bold;
|
||||||
|
font-size: 1.1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.optional {
|
||||||
|
font-size: 1.3em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.sig-paren {
|
||||||
|
font-size: larger;
|
||||||
|
}
|
||||||
|
|
||||||
|
.versionmodified {
|
||||||
|
font-style: italic;
|
||||||
|
}
|
||||||
|
|
||||||
|
.system-message {
|
||||||
|
background-color: #fda;
|
||||||
|
padding: 5px;
|
||||||
|
border: 3px solid red;
|
||||||
|
}
|
||||||
|
|
||||||
|
.footnote:target {
|
||||||
|
background-color: #ffa;
|
||||||
|
}
|
||||||
|
|
||||||
|
.line-block {
|
||||||
|
display: block;
|
||||||
|
margin-top: 1em;
|
||||||
|
margin-bottom: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.line-block .line-block {
|
||||||
|
margin-top: 0;
|
||||||
|
margin-bottom: 0;
|
||||||
|
margin-left: 1.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.guilabel, .menuselection {
|
||||||
|
font-family: sans-serif;
|
||||||
|
}
|
||||||
|
|
||||||
|
.accelerator {
|
||||||
|
text-decoration: underline;
|
||||||
|
}
|
||||||
|
|
||||||
|
.classifier {
|
||||||
|
font-style: oblique;
|
||||||
|
}
|
||||||
|
|
||||||
|
.classifier:before {
|
||||||
|
font-style: normal;
|
||||||
|
margin: 0.5em;
|
||||||
|
content: ":";
|
||||||
|
}
|
||||||
|
|
||||||
|
abbr, acronym {
|
||||||
|
border-bottom: dotted 1px;
|
||||||
|
cursor: help;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- code displays --------------------------------------------------------- */
|
||||||
|
|
||||||
|
pre {
|
||||||
|
overflow: auto;
|
||||||
|
overflow-y: hidden; /* fixes display issues on Chrome browsers */
|
||||||
|
}
|
||||||
|
|
||||||
|
pre, div[class*="highlight-"] {
|
||||||
|
clear: both;
|
||||||
|
}
|
||||||
|
|
||||||
|
span.pre {
|
||||||
|
-moz-hyphens: none;
|
||||||
|
-ms-hyphens: none;
|
||||||
|
-webkit-hyphens: none;
|
||||||
|
hyphens: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
div[class*="highlight-"] {
|
||||||
|
margin: 1em 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
td.linenos pre {
|
||||||
|
border: 0;
|
||||||
|
background-color: transparent;
|
||||||
|
color: #aaa;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.highlighttable {
|
||||||
|
display: block;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.highlighttable tbody {
|
||||||
|
display: block;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.highlighttable tr {
|
||||||
|
display: flex;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.highlighttable td {
|
||||||
|
margin: 0;
|
||||||
|
padding: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.highlighttable td.linenos {
|
||||||
|
padding-right: 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.highlighttable td.code {
|
||||||
|
flex: 1;
|
||||||
|
overflow: hidden;
|
||||||
|
}
|
||||||
|
|
||||||
|
.highlight .hll {
|
||||||
|
display: block;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.highlight pre,
|
||||||
|
table.highlighttable pre {
|
||||||
|
margin: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.code-block-caption + div {
|
||||||
|
margin-top: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.code-block-caption {
|
||||||
|
margin-top: 1em;
|
||||||
|
padding: 2px 5px;
|
||||||
|
font-size: small;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.code-block-caption code {
|
||||||
|
background-color: transparent;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.highlighttable td.linenos,
|
||||||
|
span.linenos,
|
||||||
|
div.doctest > div.highlight span.gp { /* gp: Generic.Prompt */
|
||||||
|
user-select: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.code-block-caption span.caption-number {
|
||||||
|
padding: 0.1em 0.3em;
|
||||||
|
font-style: italic;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.code-block-caption span.caption-text {
|
||||||
|
}
|
||||||
|
|
||||||
|
div.literal-block-wrapper {
|
||||||
|
margin: 1em 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
code.descname {
|
||||||
|
background-color: transparent;
|
||||||
|
font-weight: bold;
|
||||||
|
font-size: 1.2em;
|
||||||
|
}
|
||||||
|
|
||||||
|
code.descclassname {
|
||||||
|
background-color: transparent;
|
||||||
|
}
|
||||||
|
|
||||||
|
code.xref, a code {
|
||||||
|
background-color: transparent;
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
|
h1 code, h2 code, h3 code, h4 code, h5 code, h6 code {
|
||||||
|
background-color: transparent;
|
||||||
|
}
|
||||||
|
|
||||||
|
.viewcode-link {
|
||||||
|
float: right;
|
||||||
|
}
|
||||||
|
|
||||||
|
.viewcode-back {
|
||||||
|
float: right;
|
||||||
|
font-family: sans-serif;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.viewcode-block:target {
|
||||||
|
margin: -1px -10px;
|
||||||
|
padding: 0 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- math display ---------------------------------------------------------- */
|
||||||
|
|
||||||
|
img.math {
|
||||||
|
vertical-align: middle;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.body div.math p {
|
||||||
|
text-align: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
span.eqno {
|
||||||
|
float: right;
|
||||||
|
}
|
||||||
|
|
||||||
|
span.eqno a.headerlink {
|
||||||
|
position: absolute;
|
||||||
|
z-index: 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.math:hover a.headerlink {
|
||||||
|
visibility: visible;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* -- printout stylesheet --------------------------------------------------- */
|
||||||
|
|
||||||
|
@media print {
|
||||||
|
div.document,
|
||||||
|
div.documentwrapper,
|
||||||
|
div.bodywrapper {
|
||||||
|
margin: 0 !important;
|
||||||
|
width: 100%;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.sphinxsidebar,
|
||||||
|
div.related,
|
||||||
|
div.footer,
|
||||||
|
#top-link {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
}
|
7
externals/fmt/doc/html/_static/bootstrap.min.js
vendored
Normal file
7
externals/fmt/doc/html/_static/bootstrap.min.js
vendored
Normal file
File diff suppressed because one or more lines are too long
316
externals/fmt/doc/html/_static/doctools.js
vendored
Normal file
316
externals/fmt/doc/html/_static/doctools.js
vendored
Normal file
@ -0,0 +1,316 @@
|
|||||||
|
/*
|
||||||
|
* doctools.js
|
||||||
|
* ~~~~~~~~~~~
|
||||||
|
*
|
||||||
|
* Sphinx JavaScript utilities for all documentation.
|
||||||
|
*
|
||||||
|
* :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS.
|
||||||
|
* :license: BSD, see LICENSE for details.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* select a different prefix for underscore
|
||||||
|
*/
|
||||||
|
$u = _.noConflict();
|
||||||
|
|
||||||
|
/**
|
||||||
|
* make the code below compatible with browsers without
|
||||||
|
* an installed firebug like debugger
|
||||||
|
if (!window.console || !console.firebug) {
|
||||||
|
var names = ["log", "debug", "info", "warn", "error", "assert", "dir",
|
||||||
|
"dirxml", "group", "groupEnd", "time", "timeEnd", "count", "trace",
|
||||||
|
"profile", "profileEnd"];
|
||||||
|
window.console = {};
|
||||||
|
for (var i = 0; i < names.length; ++i)
|
||||||
|
window.console[names[i]] = function() {};
|
||||||
|
}
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* small helper function to urldecode strings
|
||||||
|
*/
|
||||||
|
jQuery.urldecode = function(x) {
|
||||||
|
return decodeURIComponent(x).replace(/\+/g, ' ');
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* small helper function to urlencode strings
|
||||||
|
*/
|
||||||
|
jQuery.urlencode = encodeURIComponent;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* This function returns the parsed url parameters of the
|
||||||
|
* current request. Multiple values per key are supported,
|
||||||
|
* it will always return arrays of strings for the value parts.
|
||||||
|
*/
|
||||||
|
jQuery.getQueryParameters = function(s) {
|
||||||
|
if (typeof s === 'undefined')
|
||||||
|
s = document.location.search;
|
||||||
|
var parts = s.substr(s.indexOf('?') + 1).split('&');
|
||||||
|
var result = {};
|
||||||
|
for (var i = 0; i < parts.length; i++) {
|
||||||
|
var tmp = parts[i].split('=', 2);
|
||||||
|
var key = jQuery.urldecode(tmp[0]);
|
||||||
|
var value = jQuery.urldecode(tmp[1]);
|
||||||
|
if (key in result)
|
||||||
|
result[key].push(value);
|
||||||
|
else
|
||||||
|
result[key] = [value];
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* highlight a given string on a jquery object by wrapping it in
|
||||||
|
* span elements with the given class name.
|
||||||
|
*/
|
||||||
|
jQuery.fn.highlightText = function(text, className) {
|
||||||
|
function highlight(node, addItems) {
|
||||||
|
if (node.nodeType === 3) {
|
||||||
|
var val = node.nodeValue;
|
||||||
|
var pos = val.toLowerCase().indexOf(text);
|
||||||
|
if (pos >= 0 &&
|
||||||
|
!jQuery(node.parentNode).hasClass(className) &&
|
||||||
|
!jQuery(node.parentNode).hasClass("nohighlight")) {
|
||||||
|
var span;
|
||||||
|
var isInSVG = jQuery(node).closest("body, svg, foreignObject").is("svg");
|
||||||
|
if (isInSVG) {
|
||||||
|
span = document.createElementNS("http://www.w3.org/2000/svg", "tspan");
|
||||||
|
} else {
|
||||||
|
span = document.createElement("span");
|
||||||
|
span.className = className;
|
||||||
|
}
|
||||||
|
span.appendChild(document.createTextNode(val.substr(pos, text.length)));
|
||||||
|
node.parentNode.insertBefore(span, node.parentNode.insertBefore(
|
||||||
|
document.createTextNode(val.substr(pos + text.length)),
|
||||||
|
node.nextSibling));
|
||||||
|
node.nodeValue = val.substr(0, pos);
|
||||||
|
if (isInSVG) {
|
||||||
|
var rect = document.createElementNS("http://www.w3.org/2000/svg", "rect");
|
||||||
|
var bbox = node.parentElement.getBBox();
|
||||||
|
rect.x.baseVal.value = bbox.x;
|
||||||
|
rect.y.baseVal.value = bbox.y;
|
||||||
|
rect.width.baseVal.value = bbox.width;
|
||||||
|
rect.height.baseVal.value = bbox.height;
|
||||||
|
rect.setAttribute('class', className);
|
||||||
|
addItems.push({
|
||||||
|
"parent": node.parentNode,
|
||||||
|
"target": rect});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else if (!jQuery(node).is("button, select, textarea")) {
|
||||||
|
jQuery.each(node.childNodes, function() {
|
||||||
|
highlight(this, addItems);
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
var addItems = [];
|
||||||
|
var result = this.each(function() {
|
||||||
|
highlight(this, addItems);
|
||||||
|
});
|
||||||
|
for (var i = 0; i < addItems.length; ++i) {
|
||||||
|
jQuery(addItems[i].parent).before(addItems[i].target);
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
};
|
||||||
|
|
||||||
|
/*
|
||||||
|
* backward compatibility for jQuery.browser
|
||||||
|
* This will be supported until firefox bug is fixed.
|
||||||
|
*/
|
||||||
|
if (!jQuery.browser) {
|
||||||
|
jQuery.uaMatch = function(ua) {
|
||||||
|
ua = ua.toLowerCase();
|
||||||
|
|
||||||
|
var match = /(chrome)[ \/]([\w.]+)/.exec(ua) ||
|
||||||
|
/(webkit)[ \/]([\w.]+)/.exec(ua) ||
|
||||||
|
/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) ||
|
||||||
|
/(msie) ([\w.]+)/.exec(ua) ||
|
||||||
|
ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) ||
|
||||||
|
[];
|
||||||
|
|
||||||
|
return {
|
||||||
|
browser: match[ 1 ] || "",
|
||||||
|
version: match[ 2 ] || "0"
|
||||||
|
};
|
||||||
|
};
|
||||||
|
jQuery.browser = {};
|
||||||
|
jQuery.browser[jQuery.uaMatch(navigator.userAgent).browser] = true;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Small JavaScript module for the documentation.
|
||||||
|
*/
|
||||||
|
var Documentation = {
|
||||||
|
|
||||||
|
init : function() {
|
||||||
|
this.fixFirefoxAnchorBug();
|
||||||
|
this.highlightSearchWords();
|
||||||
|
this.initIndexTable();
|
||||||
|
if (DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) {
|
||||||
|
this.initOnKeyListeners();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* i18n support
|
||||||
|
*/
|
||||||
|
TRANSLATIONS : {},
|
||||||
|
PLURAL_EXPR : function(n) { return n === 1 ? 0 : 1; },
|
||||||
|
LOCALE : 'unknown',
|
||||||
|
|
||||||
|
// gettext and ngettext don't access this so that the functions
|
||||||
|
// can safely bound to a different name (_ = Documentation.gettext)
|
||||||
|
gettext : function(string) {
|
||||||
|
var translated = Documentation.TRANSLATIONS[string];
|
||||||
|
if (typeof translated === 'undefined')
|
||||||
|
return string;
|
||||||
|
return (typeof translated === 'string') ? translated : translated[0];
|
||||||
|
},
|
||||||
|
|
||||||
|
ngettext : function(singular, plural, n) {
|
||||||
|
var translated = Documentation.TRANSLATIONS[singular];
|
||||||
|
if (typeof translated === 'undefined')
|
||||||
|
return (n == 1) ? singular : plural;
|
||||||
|
return translated[Documentation.PLURALEXPR(n)];
|
||||||
|
},
|
||||||
|
|
||||||
|
addTranslations : function(catalog) {
|
||||||
|
for (var key in catalog.messages)
|
||||||
|
this.TRANSLATIONS[key] = catalog.messages[key];
|
||||||
|
this.PLURAL_EXPR = new Function('n', 'return +(' + catalog.plural_expr + ')');
|
||||||
|
this.LOCALE = catalog.locale;
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* add context elements like header anchor links
|
||||||
|
*/
|
||||||
|
addContextElements : function() {
|
||||||
|
$('div[id] > :header:first').each(function() {
|
||||||
|
$('<a class="headerlink">\u00B6</a>').
|
||||||
|
attr('href', '#' + this.id).
|
||||||
|
attr('title', _('Permalink to this headline')).
|
||||||
|
appendTo(this);
|
||||||
|
});
|
||||||
|
$('dt[id]').each(function() {
|
||||||
|
$('<a class="headerlink">\u00B6</a>').
|
||||||
|
attr('href', '#' + this.id).
|
||||||
|
attr('title', _('Permalink to this definition')).
|
||||||
|
appendTo(this);
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* workaround a firefox stupidity
|
||||||
|
* see: https://bugzilla.mozilla.org/show_bug.cgi?id=645075
|
||||||
|
*/
|
||||||
|
fixFirefoxAnchorBug : function() {
|
||||||
|
if (document.location.hash && $.browser.mozilla)
|
||||||
|
window.setTimeout(function() {
|
||||||
|
document.location.href += '';
|
||||||
|
}, 10);
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* highlight the search words provided in the url in the text
|
||||||
|
*/
|
||||||
|
highlightSearchWords : function() {
|
||||||
|
var params = $.getQueryParameters();
|
||||||
|
var terms = (params.highlight) ? params.highlight[0].split(/\s+/) : [];
|
||||||
|
if (terms.length) {
|
||||||
|
var body = $('div.body');
|
||||||
|
if (!body.length) {
|
||||||
|
body = $('body');
|
||||||
|
}
|
||||||
|
window.setTimeout(function() {
|
||||||
|
$.each(terms, function() {
|
||||||
|
body.highlightText(this.toLowerCase(), 'highlighted');
|
||||||
|
});
|
||||||
|
}, 10);
|
||||||
|
$('<p class="highlight-link"><a href="javascript:Documentation.' +
|
||||||
|
'hideSearchWords()">' + _('Hide Search Matches') + '</a></p>')
|
||||||
|
.appendTo($('#searchbox'));
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* init the domain index toggle buttons
|
||||||
|
*/
|
||||||
|
initIndexTable : function() {
|
||||||
|
var togglers = $('img.toggler').click(function() {
|
||||||
|
var src = $(this).attr('src');
|
||||||
|
var idnum = $(this).attr('id').substr(7);
|
||||||
|
$('tr.cg-' + idnum).toggle();
|
||||||
|
if (src.substr(-9) === 'minus.png')
|
||||||
|
$(this).attr('src', src.substr(0, src.length-9) + 'plus.png');
|
||||||
|
else
|
||||||
|
$(this).attr('src', src.substr(0, src.length-8) + 'minus.png');
|
||||||
|
}).css('display', '');
|
||||||
|
if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) {
|
||||||
|
togglers.click();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* helper function to hide the search marks again
|
||||||
|
*/
|
||||||
|
hideSearchWords : function() {
|
||||||
|
$('#searchbox .highlight-link').fadeOut(300);
|
||||||
|
$('span.highlighted').removeClass('highlighted');
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* make the url absolute
|
||||||
|
*/
|
||||||
|
makeURL : function(relativeURL) {
|
||||||
|
return DOCUMENTATION_OPTIONS.URL_ROOT + '/' + relativeURL;
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* get the current relative url
|
||||||
|
*/
|
||||||
|
getCurrentURL : function() {
|
||||||
|
var path = document.location.pathname;
|
||||||
|
var parts = path.split(/\//);
|
||||||
|
$.each(DOCUMENTATION_OPTIONS.URL_ROOT.split(/\//), function() {
|
||||||
|
if (this === '..')
|
||||||
|
parts.pop();
|
||||||
|
});
|
||||||
|
var url = parts.join('/');
|
||||||
|
return path.substring(url.lastIndexOf('/') + 1, path.length - 1);
|
||||||
|
},
|
||||||
|
|
||||||
|
initOnKeyListeners: function() {
|
||||||
|
$(document).keydown(function(event) {
|
||||||
|
var activeElementType = document.activeElement.tagName;
|
||||||
|
// don't navigate when in search box, textarea, dropdown or button
|
||||||
|
if (activeElementType !== 'TEXTAREA' && activeElementType !== 'INPUT' && activeElementType !== 'SELECT'
|
||||||
|
&& activeElementType !== 'BUTTON' && !event.altKey && !event.ctrlKey && !event.metaKey
|
||||||
|
&& !event.shiftKey) {
|
||||||
|
switch (event.keyCode) {
|
||||||
|
case 37: // left
|
||||||
|
var prevHref = $('link[rel="prev"]').prop('href');
|
||||||
|
if (prevHref) {
|
||||||
|
window.location.href = prevHref;
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
case 39: // right
|
||||||
|
var nextHref = $('link[rel="next"]').prop('href');
|
||||||
|
if (nextHref) {
|
||||||
|
window.location.href = nextHref;
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
});
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// quick alias for translations
|
||||||
|
_ = Documentation.gettext;
|
||||||
|
|
||||||
|
$(document).ready(function() {
|
||||||
|
Documentation.init();
|
||||||
|
});
|
12
externals/fmt/doc/html/_static/documentation_options.js
vendored
Normal file
12
externals/fmt/doc/html/_static/documentation_options.js
vendored
Normal file
@ -0,0 +1,12 @@
|
|||||||
|
var DOCUMENTATION_OPTIONS = {
|
||||||
|
URL_ROOT: document.getElementById("documentation_options").getAttribute('data-url_root'),
|
||||||
|
VERSION: '9.1.0',
|
||||||
|
LANGUAGE: 'None',
|
||||||
|
COLLAPSE_INDEX: false,
|
||||||
|
BUILDER: 'html',
|
||||||
|
FILE_SUFFIX: '.html',
|
||||||
|
LINK_SUFFIX: '.html',
|
||||||
|
HAS_SOURCE: true,
|
||||||
|
SOURCELINK_SUFFIX: '.txt',
|
||||||
|
NAVIGATION_WITH_KEYS: false
|
||||||
|
};
|
BIN
externals/fmt/doc/html/_static/file.png
vendored
Normal file
BIN
externals/fmt/doc/html/_static/file.png
vendored
Normal file
Binary file not shown.
After Width: | Height: | Size: 286 B |
6724
externals/fmt/doc/html/_static/fmt.css
vendored
Normal file
6724
externals/fmt/doc/html/_static/fmt.css
vendored
Normal file
File diff suppressed because it is too large
Load Diff
BIN
externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.eot
vendored
Normal file
BIN
externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.eot
vendored
Normal file
Binary file not shown.
229
externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.svg
vendored
Normal file
229
externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.svg
vendored
Normal file
@ -0,0 +1,229 @@
|
|||||||
|
<?xml version="1.0" standalone="no"?>
|
||||||
|
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
|
||||||
|
<svg xmlns="http://www.w3.org/2000/svg">
|
||||||
|
<metadata></metadata>
|
||||||
|
<defs>
|
||||||
|
<font id="glyphicons_halflingsregular" horiz-adv-x="1200" >
|
||||||
|
<font-face units-per-em="1200" ascent="960" descent="-240" />
|
||||||
|
<missing-glyph horiz-adv-x="500" />
|
||||||
|
<glyph />
|
||||||
|
<glyph />
|
||||||
|
<glyph unicode="
" />
|
||||||
|
<glyph unicode=" " />
|
||||||
|
<glyph unicode="*" d="M100 500v200h259l-183 183l141 141l183 -183v259h200v-259l183 183l141 -141l-183 -183h259v-200h-259l183 -183l-141 -141l-183 183v-259h-200v259l-183 -183l-141 141l183 183h-259z" />
|
||||||
|
<glyph unicode="+" d="M0 400v300h400v400h300v-400h400v-300h-400v-400h-300v400h-400z" />
|
||||||
|
<glyph unicode=" " />
|
||||||
|
<glyph unicode=" " horiz-adv-x="652" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="1304" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="652" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="1304" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="434" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="326" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="217" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="217" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="163" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="260" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="72" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="260" />
|
||||||
|
<glyph unicode=" " horiz-adv-x="326" />
|
||||||
|
<glyph unicode="€" d="M100 500l100 100h113q0 47 5 100h-218l100 100h135q37 167 112 257q117 141 297 141q242 0 354 -189q60 -103 66 -209h-181q0 55 -25.5 99t-63.5 68t-75 36.5t-67 12.5q-24 0 -52.5 -10t-62.5 -32t-65.5 -67t-50.5 -107h379l-100 -100h-300q-6 -46 -6 -100h406l-100 -100 h-300q9 -74 33 -132t52.5 -91t62 -54.5t59 -29t46.5 -7.5q29 0 66 13t75 37t63.5 67.5t25.5 96.5h174q-31 -172 -128 -278q-107 -117 -274 -117q-205 0 -324 158q-36 46 -69 131.5t-45 205.5h-217z" />
|
||||||
|
<glyph unicode="−" d="M200 400h900v300h-900v-300z" />
|
||||||
|
<glyph unicode="◼" horiz-adv-x="500" d="M0 0z" />
|
||||||
|
<glyph unicode="☁" d="M-14 494q0 -80 56.5 -137t135.5 -57h750q120 0 205 86.5t85 207.5t-85 207t-205 86q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5z" />
|
||||||
|
<glyph unicode="✉" d="M0 100l400 400l200 -200l200 200l400 -400h-1200zM0 300v600l300 -300zM0 1100l600 -603l600 603h-1200zM900 600l300 300v-600z" />
|
||||||
|
<glyph unicode="✏" d="M-13 -13l333 112l-223 223zM187 403l214 -214l614 614l-214 214zM887 1103l214 -214l99 92q13 13 13 32.5t-13 33.5l-153 153q-15 13 -33 13t-33 -13z" />
|
||||||
|
<glyph unicode="" d="M0 1200h1200l-500 -550v-550h300v-100h-800v100h300v550z" />
|
||||||
|
<glyph unicode="" d="M14 84q18 -55 86 -75.5t147 5.5q65 21 109 69t44 90v606l600 155v-521q-64 16 -138 -7q-79 -26 -122.5 -83t-25.5 -111q18 -55 86 -75.5t147 4.5q70 23 111.5 63.5t41.5 95.5v881q0 10 -7 15.5t-17 2.5l-752 -193q-10 -3 -17 -12.5t-7 -19.5v-689q-64 17 -138 -7 q-79 -25 -122.5 -82t-25.5 -112z" />
|
||||||
|
<glyph unicode="" d="M23 693q0 200 142 342t342 142t342 -142t142 -342q0 -142 -78 -261l300 -300q7 -8 7 -18t-7 -18l-109 -109q-8 -7 -18 -7t-18 7l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 693q0 -136 97 -233t234 -97t233.5 96.5t96.5 233.5t-96.5 233.5t-233.5 96.5 t-234 -97t-97 -233z" />
|
||||||
|
<glyph unicode="" d="M100 784q0 64 28 123t73 100.5t104.5 64t119 20.5t120 -38.5t104.5 -104.5q48 69 109.5 105t121.5 38t118.5 -20.5t102.5 -64t71 -100.5t27 -123q0 -57 -33.5 -117.5t-94 -124.5t-126.5 -127.5t-150 -152.5t-146 -174q-62 85 -145.5 174t-149.5 152.5t-126.5 127.5 t-94 124.5t-33.5 117.5z" />
|
||||||
|
<glyph unicode="" d="M-72 800h479l146 400h2l146 -400h472l-382 -278l145 -449l-384 275l-382 -275l146 447zM168 71l2 1z" />
|
||||||
|
<glyph unicode="" d="M-72 800h479l146 400h2l146 -400h472l-382 -278l145 -449l-384 275l-382 -275l146 447zM168 71l2 1zM237 700l196 -142l-73 -226l192 140l195 -141l-74 229l193 140h-235l-77 211l-78 -211h-239z" />
|
||||||
|
<glyph unicode="" d="M0 0v143l400 257v100q-37 0 -68.5 74.5t-31.5 125.5v200q0 124 88 212t212 88t212 -88t88 -212v-200q0 -51 -31.5 -125.5t-68.5 -74.5v-100l400 -257v-143h-1200z" />
|
||||||
|
<glyph unicode="" d="M0 0v1100h1200v-1100h-1200zM100 100h100v100h-100v-100zM100 300h100v100h-100v-100zM100 500h100v100h-100v-100zM100 700h100v100h-100v-100zM100 900h100v100h-100v-100zM300 100h600v400h-600v-400zM300 600h600v400h-600v-400zM1000 100h100v100h-100v-100z M1000 300h100v100h-100v-100zM1000 500h100v100h-100v-100zM1000 700h100v100h-100v-100zM1000 900h100v100h-100v-100z" />
|
||||||
|
<glyph unicode="" d="M0 50v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5zM0 650v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5zM600 50v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5zM600 650v400q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-400 q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5z" />
|
||||||
|
<glyph unicode="" d="M0 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM0 450v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200 q-21 0 -35.5 14.5t-14.5 35.5zM0 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5 t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 450v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5 v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 450v200q0 21 14.5 35.5t35.5 14.5h200 q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM800 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5z" />
|
||||||
|
<glyph unicode="" d="M0 50v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM0 450q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v200q0 21 -14.5 35.5t-35.5 14.5h-200q-21 0 -35.5 -14.5 t-14.5 -35.5v-200zM0 850v200q0 21 14.5 35.5t35.5 14.5h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5zM400 50v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5 t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5zM400 450v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5zM400 850v200q0 21 14.5 35.5t35.5 14.5h700q21 0 35.5 -14.5t14.5 -35.5 v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5z" />
|
||||||
|
<glyph unicode="" d="M29 454l419 -420l818 820l-212 212l-607 -607l-206 207z" />
|
||||||
|
<glyph unicode="" d="M106 318l282 282l-282 282l212 212l282 -282l282 282l212 -212l-282 -282l282 -282l-212 -212l-282 282l-282 -282z" />
|
||||||
|
<glyph unicode="" d="M23 693q0 200 142 342t342 142t342 -142t142 -342q0 -142 -78 -261l300 -300q7 -8 7 -18t-7 -18l-109 -109q-8 -7 -18 -7t-18 7l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 693q0 -136 97 -233t234 -97t233.5 96.5t96.5 233.5t-96.5 233.5t-233.5 96.5 t-234 -97t-97 -233zM300 600v200h100v100h200v-100h100v-200h-100v-100h-200v100h-100z" />
|
||||||
|
<glyph unicode="" d="M23 694q0 200 142 342t342 142t342 -142t142 -342q0 -141 -78 -262l300 -299q7 -7 7 -18t-7 -18l-109 -109q-8 -8 -18 -8t-18 8l-300 300q-119 -78 -261 -78q-200 0 -342 142t-142 342zM176 694q0 -136 97 -233t234 -97t233.5 97t96.5 233t-96.5 233t-233.5 97t-234 -97 t-97 -233zM300 601h400v200h-400v-200z" />
|
||||||
|
<glyph unicode="" d="M23 600q0 183 105 331t272 210v-166q-103 -55 -165 -155t-62 -220q0 -177 125 -302t302 -125t302 125t125 302q0 120 -62 220t-165 155v166q167 -62 272 -210t105 -331q0 -118 -45.5 -224.5t-123 -184t-184 -123t-224.5 -45.5t-224.5 45.5t-184 123t-123 184t-45.5 224.5 zM500 750q0 -21 14.5 -35.5t35.5 -14.5h100q21 0 35.5 14.5t14.5 35.5v400q0 21 -14.5 35.5t-35.5 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-400z" />
|
||||||
|
<glyph unicode="" d="M100 1h200v300h-200v-300zM400 1v500h200v-500h-200zM700 1v800h200v-800h-200zM1000 1v1200h200v-1200h-200z" />
|
||||||
|
<glyph unicode="" d="M26 601q0 -33 6 -74l151 -38l2 -6q14 -49 38 -93l3 -5l-80 -134q45 -59 105 -105l133 81l5 -3q45 -26 94 -39l5 -2l38 -151q40 -5 74 -5q27 0 74 5l38 151l6 2q46 13 93 39l5 3l134 -81q56 44 104 105l-80 134l3 5q24 44 39 93l1 6l152 38q5 40 5 74q0 28 -5 73l-152 38 l-1 6q-16 51 -39 93l-3 5l80 134q-44 58 -104 105l-134 -81l-5 3q-45 25 -93 39l-6 1l-38 152q-40 5 -74 5q-27 0 -74 -5l-38 -152l-5 -1q-50 -14 -94 -39l-5 -3l-133 81q-59 -47 -105 -105l80 -134l-3 -5q-25 -47 -38 -93l-2 -6l-151 -38q-6 -48 -6 -73zM385 601 q0 88 63 151t152 63t152 -63t63 -151q0 -89 -63 -152t-152 -63t-152 63t-63 152z" />
|
||||||
|
<glyph unicode="" d="M100 1025v50q0 10 7.5 17.5t17.5 7.5h275v100q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5v-100h275q10 0 17.5 -7.5t7.5 -17.5v-50q0 -11 -7 -18t-18 -7h-1050q-11 0 -18 7t-7 18zM200 100v800h900v-800q0 -41 -29.5 -71t-70.5 -30h-700q-41 0 -70.5 30 t-29.5 71zM300 100h100v700h-100v-700zM500 100h100v700h-100v-700zM500 1100h300v100h-300v-100zM700 100h100v700h-100v-700zM900 100h100v700h-100v-700z" />
|
||||||
|
<glyph unicode="" d="M1 601l656 644l644 -644h-200v-600h-300v400h-300v-400h-300v600h-200z" />
|
||||||
|
<glyph unicode="" d="M100 25v1150q0 11 7 18t18 7h475v-500h400v-675q0 -11 -7 -18t-18 -7h-850q-11 0 -18 7t-7 18zM700 800v300l300 -300h-300z" />
|
||||||
|
<glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM500 500v400h100 v-300h200v-100h-300z" />
|
||||||
|
<glyph unicode="" d="M-100 0l431 1200h209l-21 -300h162l-20 300h208l431 -1200h-538l-41 400h-242l-40 -400h-539zM488 500h224l-27 300h-170z" />
|
||||||
|
<glyph unicode="" d="M0 0v400h490l-290 300h200v500h300v-500h200l-290 -300h490v-400h-1100zM813 200h175v100h-175v-100z" />
|
||||||
|
<glyph unicode="" d="M1 600q0 122 47.5 233t127.5 191t191 127.5t233 47.5t233 -47.5t191 -127.5t127.5 -191t47.5 -233t-47.5 -233t-127.5 -191t-191 -127.5t-233 -47.5t-233 47.5t-191 127.5t-127.5 191t-47.5 233zM188 600q0 -170 121 -291t291 -121t291 121t121 291t-121 291t-291 121 t-291 -121t-121 -291zM350 600h150v300h200v-300h150l-250 -300z" />
|
||||||
|
<glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM350 600l250 300 l250 -300h-150v-300h-200v300h-150z" />
|
||||||
|
<glyph unicode="" d="M0 25v475l200 700h800l199 -700l1 -475q0 -11 -7 -18t-18 -7h-1150q-11 0 -18 7t-7 18zM200 500h200l50 -200h300l50 200h200l-97 500h-606z" />
|
||||||
|
<glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -172 121.5 -293t292.5 -121t292.5 121t121.5 293q0 171 -121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM500 397v401 l297 -200z" />
|
||||||
|
<glyph unicode="" d="M23 600q0 -118 45.5 -224.5t123 -184t184 -123t224.5 -45.5t224.5 45.5t184 123t123 184t45.5 224.5h-150q0 -177 -125 -302t-302 -125t-302 125t-125 302t125 302t302 125q136 0 246 -81l-146 -146h400v400l-145 -145q-157 122 -355 122q-118 0 -224.5 -45.5t-184 -123 t-123 -184t-45.5 -224.5z" />
|
||||||
|
<glyph unicode="" d="M23 600q0 118 45.5 224.5t123 184t184 123t224.5 45.5q198 0 355 -122l145 145v-400h-400l147 147q-112 80 -247 80q-177 0 -302 -125t-125 -302h-150zM100 0v400h400l-147 -147q112 -80 247 -80q177 0 302 125t125 302h150q0 -118 -45.5 -224.5t-123 -184t-184 -123 t-224.5 -45.5q-198 0 -355 122z" />
|
||||||
|
<glyph unicode="" d="M100 0h1100v1200h-1100v-1200zM200 100v900h900v-900h-900zM300 200v100h100v-100h-100zM300 400v100h100v-100h-100zM300 600v100h100v-100h-100zM300 800v100h100v-100h-100zM500 200h500v100h-500v-100zM500 400v100h500v-100h-500zM500 600v100h500v-100h-500z M500 800v100h500v-100h-500z" />
|
||||||
|
<glyph unicode="" d="M0 100v600q0 41 29.5 70.5t70.5 29.5h100v200q0 82 59 141t141 59h300q82 0 141 -59t59 -141v-200h100q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-900q-41 0 -70.5 29.5t-29.5 70.5zM400 800h300v150q0 21 -14.5 35.5t-35.5 14.5h-200 q-21 0 -35.5 -14.5t-14.5 -35.5v-150z" />
|
||||||
|
<glyph unicode="" d="M100 0v1100h100v-1100h-100zM300 400q60 60 127.5 84t127.5 17.5t122 -23t119 -30t110 -11t103 42t91 120.5v500q-40 -81 -101.5 -115.5t-127.5 -29.5t-138 25t-139.5 40t-125.5 25t-103 -29.5t-65 -115.5v-500z" />
|
||||||
|
<glyph unicode="" d="M0 275q0 -11 7 -18t18 -7h50q11 0 18 7t7 18v300q0 127 70.5 231.5t184.5 161.5t245 57t245 -57t184.5 -161.5t70.5 -231.5v-300q0 -11 7 -18t18 -7h50q11 0 18 7t7 18v300q0 116 -49.5 227t-131 192.5t-192.5 131t-227 49.5t-227 -49.5t-192.5 -131t-131 -192.5 t-49.5 -227v-300zM200 20v460q0 8 6 14t14 6h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14zM800 20v460q0 8 6 14t14 6h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14z" />
|
||||||
|
<glyph unicode="" d="M0 400h300l300 -200v800l-300 -200h-300v-400zM688 459l141 141l-141 141l71 71l141 -141l141 141l71 -71l-141 -141l141 -141l-71 -71l-141 141l-141 -141z" />
|
||||||
|
<glyph unicode="" d="M0 400h300l300 -200v800l-300 -200h-300v-400zM700 857l69 53q111 -135 111 -310q0 -169 -106 -302l-67 54q86 110 86 248q0 146 -93 257z" />
|
||||||
|
<glyph unicode="" d="M0 401v400h300l300 200v-800l-300 200h-300zM702 858l69 53q111 -135 111 -310q0 -170 -106 -303l-67 55q86 110 86 248q0 145 -93 257zM889 951l7 -8q123 -151 123 -344q0 -189 -119 -339l-7 -8l81 -66l6 8q142 178 142 405q0 230 -144 408l-6 8z" />
|
||||||
|
<glyph unicode="" d="M0 0h500v500h-200v100h-100v-100h-200v-500zM0 600h100v100h400v100h100v100h-100v300h-500v-600zM100 100v300h300v-300h-300zM100 800v300h300v-300h-300zM200 200v100h100v-100h-100zM200 900h100v100h-100v-100zM500 500v100h300v-300h200v-100h-100v-100h-200v100 h-100v100h100v200h-200zM600 0v100h100v-100h-100zM600 1000h100v-300h200v-300h300v200h-200v100h200v500h-600v-200zM800 800v300h300v-300h-300zM900 0v100h300v-100h-300zM900 900v100h100v-100h-100zM1100 200v100h100v-100h-100z" />
|
||||||
|
<glyph unicode="" d="M0 200h100v1000h-100v-1000zM100 0v100h300v-100h-300zM200 200v1000h100v-1000h-100zM500 0v91h100v-91h-100zM500 200v1000h200v-1000h-200zM700 0v91h100v-91h-100zM800 200v1000h100v-1000h-100zM900 0v91h200v-91h-200zM1000 200v1000h200v-1000h-200z" />
|
||||||
|
<glyph unicode="" d="M0 700l1 475q0 10 7.5 17.5t17.5 7.5h474l700 -700l-500 -500zM148 953q0 -42 29 -71q30 -30 71.5 -30t71.5 30q29 29 29 71t-29 71q-30 30 -71.5 30t-71.5 -30q-29 -29 -29 -71z" />
|
||||||
|
<glyph unicode="" d="M1 700l1 475q0 11 7 18t18 7h474l700 -700l-500 -500zM148 953q0 -42 30 -71q29 -30 71 -30t71 30q30 29 30 71t-30 71q-29 30 -71 30t-71 -30q-30 -29 -30 -71zM701 1200h100l700 -700l-500 -500l-50 50l450 450z" />
|
||||||
|
<glyph unicode="" d="M100 0v1025l175 175h925v-1000l-100 -100v1000h-750l-100 -100h750v-1000h-900z" />
|
||||||
|
<glyph unicode="" d="M200 0l450 444l450 -443v1150q0 20 -14.5 35t-35.5 15h-800q-21 0 -35.5 -15t-14.5 -35v-1151z" />
|
||||||
|
<glyph unicode="" d="M0 100v700h200l100 -200h600l100 200h200v-700h-200v200h-800v-200h-200zM253 829l40 -124h592l62 124l-94 346q-2 11 -10 18t-18 7h-450q-10 0 -18 -7t-10 -18zM281 24l38 152q2 10 11.5 17t19.5 7h500q10 0 19.5 -7t11.5 -17l38 -152q2 -10 -3.5 -17t-15.5 -7h-600 q-10 0 -15.5 7t-3.5 17z" />
|
||||||
|
<glyph unicode="" d="M0 200q0 -41 29.5 -70.5t70.5 -29.5h1000q41 0 70.5 29.5t29.5 70.5v600q0 41 -29.5 70.5t-70.5 29.5h-150q-4 8 -11.5 21.5t-33 48t-53 61t-69 48t-83.5 21.5h-200q-41 0 -82 -20.5t-70 -50t-52 -59t-34 -50.5l-12 -20h-150q-41 0 -70.5 -29.5t-29.5 -70.5v-600z M356 500q0 100 72 172t172 72t172 -72t72 -172t-72 -172t-172 -72t-172 72t-72 172zM494 500q0 -44 31 -75t75 -31t75 31t31 75t-31 75t-75 31t-75 -31t-31 -75zM900 700v100h100v-100h-100z" />
|
||||||
|
<glyph unicode="" d="M53 0h365v66q-41 0 -72 11t-49 38t1 71l92 234h391l82 -222q16 -45 -5.5 -88.5t-74.5 -43.5v-66h417v66q-34 1 -74 43q-18 19 -33 42t-21 37l-6 13l-385 998h-93l-399 -1006q-24 -48 -52 -75q-12 -12 -33 -25t-36 -20l-15 -7v-66zM416 521l178 457l46 -140l116 -317h-340 z" />
|
||||||
|
<glyph unicode="" d="M100 0v89q41 7 70.5 32.5t29.5 65.5v827q0 28 -1 39.5t-5.5 26t-15.5 21t-29 14t-49 14.5v71l471 -1q120 0 213 -88t93 -228q0 -55 -11.5 -101.5t-28 -74t-33.5 -47.5t-28 -28l-12 -7q8 -3 21.5 -9t48 -31.5t60.5 -58t47.5 -91.5t21.5 -129q0 -84 -59 -156.5t-142 -111 t-162 -38.5h-500zM400 200h161q89 0 153 48.5t64 132.5q0 90 -62.5 154.5t-156.5 64.5h-159v-400zM400 700h139q76 0 130 61.5t54 138.5q0 82 -84 130.5t-239 48.5v-379z" />
|
||||||
|
<glyph unicode="" d="M200 0v57q77 7 134.5 40.5t65.5 80.5l173 849q10 56 -10 74t-91 37q-6 1 -10.5 2.5t-9.5 2.5v57h425l2 -57q-33 -8 -62 -25.5t-46 -37t-29.5 -38t-17.5 -30.5l-5 -12l-128 -825q-10 -52 14 -82t95 -36v-57h-500z" />
|
||||||
|
<glyph unicode="" d="M-75 200h75v800h-75l125 167l125 -167h-75v-800h75l-125 -167zM300 900v300h150h700h150v-300h-50q0 29 -8 48.5t-18.5 30t-33.5 15t-39.5 5.5t-50.5 1h-200v-850l100 -50v-100h-400v100l100 50v850h-200q-34 0 -50.5 -1t-40 -5.5t-33.5 -15t-18.5 -30t-8.5 -48.5h-49z " />
|
||||||
|
<glyph unicode="" d="M33 51l167 125v-75h800v75l167 -125l-167 -125v75h-800v-75zM100 901v300h150h700h150v-300h-50q0 29 -8 48.5t-18 30t-33.5 15t-40 5.5t-50.5 1h-200v-650l100 -50v-100h-400v100l100 50v650h-200q-34 0 -50.5 -1t-39.5 -5.5t-33.5 -15t-18.5 -30t-8 -48.5h-50z" />
|
||||||
|
<glyph unicode="" d="M0 50q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 350q0 -20 14.5 -35t35.5 -15h800q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-800q-21 0 -35.5 -14.5t-14.5 -35.5 v-100zM0 650q0 -20 14.5 -35t35.5 -15h1000q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1000q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 950q0 -20 14.5 -35t35.5 -15h600q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-600q-21 0 -35.5 -14.5 t-14.5 -35.5v-100z" />
|
||||||
|
<glyph unicode="" d="M0 50q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM0 650q0 -20 14.5 -35t35.5 -15h1100q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5 v-100zM200 350q0 -20 14.5 -35t35.5 -15h700q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-700q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM200 950q0 -20 14.5 -35t35.5 -15h700q21 0 35.5 15t14.5 35v100q0 21 -14.5 35.5t-35.5 14.5h-700q-21 0 -35.5 -14.5 t-14.5 -35.5v-100z" />
|
||||||
|
<glyph unicode="" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM100 650v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1000q-21 0 -35.5 15 t-14.5 35zM300 350v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM500 950v100q0 21 14.5 35.5t35.5 14.5h600q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-600 q-21 0 -35.5 15t-14.5 35z" />
|
||||||
|
<glyph unicode="" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM0 350v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15 t-14.5 35zM0 650v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100q-21 0 -35.5 15t-14.5 35zM0 950v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-1100 q-21 0 -35.5 15t-14.5 35z" />
|
||||||
|
<glyph unicode="" d="M0 50v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15t-14.5 35zM0 350v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15 t-14.5 35zM0 650v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15t-14.5 35zM0 950v100q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-100q-21 0 -35.5 15 t-14.5 35zM300 50v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM300 350v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800 q-21 0 -35.5 15t-14.5 35zM300 650v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15h-800q-21 0 -35.5 15t-14.5 35zM300 950v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -20 -14.5 -35t-35.5 -15 h-800q-21 0 -35.5 15t-14.5 35z" />
|
||||||
|
<glyph unicode="" d="M-101 500v100h201v75l166 -125l-166 -125v75h-201zM300 0h100v1100h-100v-1100zM500 50q0 -20 14.5 -35t35.5 -15h600q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-600q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 350q0 -20 14.5 -35t35.5 -15h300q20 0 35 15t15 35 v100q0 21 -15 35.5t-35 14.5h-300q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 650q0 -20 14.5 -35t35.5 -15h500q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM500 950q0 -20 14.5 -35t35.5 -15h100q20 0 35 15t15 35v100 q0 21 -15 35.5t-35 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-100z" />
|
||||||
|
<glyph unicode="" d="M1 50q0 -20 14.5 -35t35.5 -15h600q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-600q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 350q0 -20 14.5 -35t35.5 -15h300q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-300q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 650 q0 -20 14.5 -35t35.5 -15h500q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM1 950q0 -20 14.5 -35t35.5 -15h100q20 0 35 15t15 35v100q0 21 -15 35.5t-35 14.5h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-100zM801 0v1100h100v-1100 h-100zM934 550l167 -125v75h200v100h-200v75z" />
|
||||||
|
<glyph unicode="" d="M0 275v650q0 31 22 53t53 22h750q31 0 53 -22t22 -53v-650q0 -31 -22 -53t-53 -22h-750q-31 0 -53 22t-22 53zM900 600l300 300v-600z" />
|
||||||
|
<glyph unicode="" d="M0 44v1012q0 18 13 31t31 13h1112q19 0 31.5 -13t12.5 -31v-1012q0 -18 -12.5 -31t-31.5 -13h-1112q-18 0 -31 13t-13 31zM100 263l247 182l298 -131l-74 156l293 318l236 -288v500h-1000v-737zM208 750q0 56 39 95t95 39t95 -39t39 -95t-39 -95t-95 -39t-95 39t-39 95z " />
|
||||||
|
<glyph unicode="" d="M148 745q0 124 60.5 231.5t165 172t226.5 64.5q123 0 227 -63t164.5 -169.5t60.5 -229.5t-73 -272q-73 -114 -166.5 -237t-150.5 -189l-57 -66q-10 9 -27 26t-66.5 70.5t-96 109t-104 135.5t-100.5 155q-63 139 -63 262zM342 772q0 -107 75.5 -182.5t181.5 -75.5 q107 0 182.5 75.5t75.5 182.5t-75.5 182t-182.5 75t-182 -75.5t-75 -181.5z" />
|
||||||
|
<glyph unicode="" d="M1 600q0 122 47.5 233t127.5 191t191 127.5t233 47.5t233 -47.5t191 -127.5t127.5 -191t47.5 -233t-47.5 -233t-127.5 -191t-191 -127.5t-233 -47.5t-233 47.5t-191 127.5t-127.5 191t-47.5 233zM173 600q0 -177 125.5 -302t301.5 -125v854q-176 0 -301.5 -125 t-125.5 -302z" />
|
||||||
|
<glyph unicode="" d="M117 406q0 94 34 186t88.5 172.5t112 159t115 177t87.5 194.5q21 -71 57.5 -142.5t76 -130.5t83 -118.5t82 -117t70 -116t50 -125.5t18.5 -136q0 -89 -39 -165.5t-102 -126.5t-140 -79.5t-156 -33.5q-114 6 -211.5 53t-161.5 139t-64 210zM243 414q14 -82 59.5 -136 t136.5 -80l16 98q-7 6 -18 17t-34 48t-33 77q-15 73 -14 143.5t10 122.5l9 51q-92 -110 -119.5 -185t-12.5 -156z" />
|
||||||
|
<glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5q366 -6 397 -14l-186 -186h-311q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v125l200 200v-225q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5 t-117.5 282.5zM436 341l161 50l412 412l-114 113l-405 -405zM995 1015l113 -113l113 113l-21 85l-92 28z" />
|
||||||
|
<glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h261l2 -80q-133 -32 -218 -120h-145q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5l200 153v-53q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5 zM423 524q30 38 81.5 64t103 35.5t99 14t77.5 3.5l29 -1v-209l360 324l-359 318v-216q-7 0 -19 -1t-48 -8t-69.5 -18.5t-76.5 -37t-76.5 -59t-62 -88t-39.5 -121.5z" />
|
||||||
|
<glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q61 0 127 -23l-178 -177h-349q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v69l200 200v-169q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5 t-117.5 282.5zM342 632l283 -284l567 567l-137 137l-430 -431l-146 147z" />
|
||||||
|
<glyph unicode="" d="M0 603l300 296v-198h200v200h-200l300 300l295 -300h-195v-200h200v198l300 -296l-300 -300v198h-200v-200h195l-295 -300l-300 300h200v200h-200v-198z" />
|
||||||
|
<glyph unicode="" d="M200 50v1000q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-437l500 487v-1100l-500 488v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5z" />
|
||||||
|
<glyph unicode="" d="M0 50v1000q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-437l500 487v-487l500 487v-1100l-500 488v-488l-500 488v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5z" />
|
||||||
|
<glyph unicode="" d="M136 550l564 550v-487l500 487v-1100l-500 488v-488z" />
|
||||||
|
<glyph unicode="" d="M200 0l900 550l-900 550v-1100z" />
|
||||||
|
<glyph unicode="" d="M200 150q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v800q0 21 -14.5 35.5t-35.5 14.5h-200q-21 0 -35.5 -14.5t-14.5 -35.5v-800zM600 150q0 -21 14.5 -35.5t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v800q0 21 -14.5 35.5t-35.5 14.5h-200 q-21 0 -35.5 -14.5t-14.5 -35.5v-800z" />
|
||||||
|
<glyph unicode="" d="M200 150q0 -20 14.5 -35t35.5 -15h800q21 0 35.5 15t14.5 35v800q0 21 -14.5 35.5t-35.5 14.5h-800q-21 0 -35.5 -14.5t-14.5 -35.5v-800z" />
|
||||||
|
<glyph unicode="" d="M0 0v1100l500 -487v487l564 -550l-564 -550v488z" />
|
||||||
|
<glyph unicode="" d="M0 0v1100l500 -487v487l500 -487v437q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-1000q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v438l-500 -488v488z" />
|
||||||
|
<glyph unicode="" d="M300 0v1100l500 -487v437q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-1000q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v438z" />
|
||||||
|
<glyph unicode="" d="M100 250v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5zM100 500h1100l-550 564z" />
|
||||||
|
<glyph unicode="" d="M185 599l592 -592l240 240l-353 353l353 353l-240 240z" />
|
||||||
|
<glyph unicode="" d="M272 194l353 353l-353 353l241 240l572 -571l21 -22l-1 -1v-1l-592 -591z" />
|
||||||
|
<glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM300 500h200v-200h200v200h200v200h-200v200h-200v-200h-200v-200z" />
|
||||||
|
<glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM300 500h600v200h-600v-200z" />
|
||||||
|
<glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM246 459l213 -213l141 142l141 -142l213 213l-142 141l142 141l-213 212l-141 -141l-141 142l-212 -213l141 -141 z" />
|
||||||
|
<glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM270 551l276 -277l411 411l-175 174l-236 -236l-102 102z" />
|
||||||
|
<glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM364 700h143q4 0 11.5 -1t11 -1t6.5 3t3 9t1 11t3.5 8.5t3.5 6t5.5 4t6.5 2.5t9 1.5t9 0.5h11.5h12.5 q19 0 30 -10t11 -26q0 -22 -4 -28t-27 -22q-5 -1 -12.5 -3t-27 -13.5t-34 -27t-26.5 -46t-11 -68.5h200q5 3 14 8t31.5 25.5t39.5 45.5t31 69t14 94q0 51 -17.5 89t-42 58t-58.5 32t-58.5 15t-51.5 3q-50 0 -90.5 -12t-75 -38.5t-53.5 -74.5t-19 -114zM500 300h200v100h-200 v-100z" />
|
||||||
|
<glyph unicode="" d="M3 600q0 162 80 299.5t217.5 217.5t299.5 80t299.5 -80t217.5 -217.5t80 -299.5t-80 -299.5t-217.5 -217.5t-299.5 -80t-299.5 80t-217.5 217.5t-80 299.5zM400 300h400v100h-100v300h-300v-100h100v-200h-100v-100zM500 800h200v100h-200v-100z" />
|
||||||
|
<glyph unicode="" d="M0 500v200h195q31 125 98.5 199.5t206.5 100.5v200h200v-200q54 -20 113 -60t112.5 -105.5t71.5 -134.5h203v-200h-203q-25 -102 -116.5 -186t-180.5 -117v-197h-200v197q-140 27 -208 102.5t-98 200.5h-194zM290 500q24 -73 79.5 -127.5t130.5 -78.5v206h200v-206 q149 48 201 206h-201v200h200q-25 74 -75.5 127t-124.5 77v-204h-200v203q-75 -23 -130 -77t-79 -126h209v-200h-210z" />
|
||||||
|
<glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM356 465l135 135 l-135 135l109 109l135 -135l135 135l109 -109l-135 -135l135 -135l-109 -109l-135 135l-135 -135z" />
|
||||||
|
<glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM322 537l141 141 l87 -87l204 205l142 -142l-346 -345z" />
|
||||||
|
<glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -115 62 -215l568 567q-100 62 -216 62q-171 0 -292.5 -121.5t-121.5 -292.5zM391 245q97 -59 209 -59q171 0 292.5 121.5t121.5 292.5 q0 112 -59 209z" />
|
||||||
|
<glyph unicode="" d="M0 547l600 453v-300h600v-300h-600v-301z" />
|
||||||
|
<glyph unicode="" d="M0 400v300h600v300l600 -453l-600 -448v301h-600z" />
|
||||||
|
<glyph unicode="" d="M204 600l450 600l444 -600h-298v-600h-300v600h-296z" />
|
||||||
|
<glyph unicode="" d="M104 600h296v600h300v-600h298l-449 -600z" />
|
||||||
|
<glyph unicode="" d="M0 200q6 132 41 238.5t103.5 193t184 138t271.5 59.5v271l600 -453l-600 -448v301q-95 -2 -183 -20t-170 -52t-147 -92.5t-100 -135.5z" />
|
||||||
|
<glyph unicode="" d="M0 0v400l129 -129l294 294l142 -142l-294 -294l129 -129h-400zM635 777l142 -142l294 294l129 -129v400h-400l129 -129z" />
|
||||||
|
<glyph unicode="" d="M34 176l295 295l-129 129h400v-400l-129 130l-295 -295zM600 600v400l129 -129l295 295l142 -141l-295 -295l129 -130h-400z" />
|
||||||
|
<glyph unicode="" d="M23 600q0 118 45.5 224.5t123 184t184 123t224.5 45.5t224.5 -45.5t184 -123t123 -184t45.5 -224.5t-45.5 -224.5t-123 -184t-184 -123t-224.5 -45.5t-224.5 45.5t-184 123t-123 184t-45.5 224.5zM456 851l58 -302q4 -20 21.5 -34.5t37.5 -14.5h54q20 0 37.5 14.5 t21.5 34.5l58 302q4 20 -8 34.5t-32 14.5h-207q-21 0 -33 -14.5t-8 -34.5zM500 300h200v100h-200v-100z" />
|
||||||
|
<glyph unicode="" d="M0 800h100v-200h400v300h200v-300h400v200h100v100h-111q1 1 1 6.5t-1.5 15t-3.5 17.5l-34 172q-11 39 -41.5 63t-69.5 24q-32 0 -61 -17l-239 -144q-22 -13 -40 -35q-19 24 -40 36l-238 144q-33 18 -62 18q-39 0 -69.5 -23t-40.5 -61l-35 -177q-2 -8 -3 -18t-1 -15v-6 h-111v-100zM100 0h400v400h-400v-400zM200 900q-3 0 14 48t36 96l18 47l213 -191h-281zM700 0v400h400v-400h-400zM731 900l202 197q5 -12 12 -32.5t23 -64t25 -72t7 -28.5h-269z" />
|
||||||
|
<glyph unicode="" d="M0 -22v143l216 193q-9 53 -13 83t-5.5 94t9 113t38.5 114t74 124q47 60 99.5 102.5t103 68t127.5 48t145.5 37.5t184.5 43.5t220 58.5q0 -189 -22 -343t-59 -258t-89 -181.5t-108.5 -120t-122 -68t-125.5 -30t-121.5 -1.5t-107.5 12.5t-87.5 17t-56.5 7.5l-99 -55z M238.5 300.5q19.5 -6.5 86.5 76.5q55 66 367 234q70 38 118.5 69.5t102 79t99 111.5t86.5 148q22 50 24 60t-6 19q-7 5 -17 5t-26.5 -14.5t-33.5 -39.5q-35 -51 -113.5 -108.5t-139.5 -89.5l-61 -32q-369 -197 -458 -401q-48 -111 -28.5 -117.5z" />
|
||||||
|
<glyph unicode="" d="M111 408q0 -33 5 -63q9 -56 44 -119.5t105 -108.5q31 -21 64 -16t62 23.5t57 49.5t48 61.5t35 60.5q32 66 39 184.5t-13 157.5q79 -80 122 -164t26 -184q-5 -33 -20.5 -69.5t-37.5 -80.5q-10 -19 -14.5 -29t-12 -26t-9 -23.5t-3 -19t2.5 -15.5t11 -9.5t19.5 -5t30.5 2.5 t42 8q57 20 91 34t87.5 44.5t87 64t65.5 88.5t47 122q38 172 -44.5 341.5t-246.5 278.5q22 -44 43 -129q39 -159 -32 -154q-15 2 -33 9q-79 33 -120.5 100t-44 175.5t48.5 257.5q-13 -8 -34 -23.5t-72.5 -66.5t-88.5 -105.5t-60 -138t-8 -166.5q2 -12 8 -41.5t8 -43t6 -39.5 t3.5 -39.5t-1 -33.5t-6 -31.5t-13.5 -24t-21 -20.5t-31 -12q-38 -10 -67 13t-40.5 61.5t-15 81.5t10.5 75q-52 -46 -83.5 -101t-39 -107t-7.5 -85z" />
|
||||||
|
<glyph unicode="" d="M-61 600l26 40q6 10 20 30t49 63.5t74.5 85.5t97 90t116.5 83.5t132.5 59t145.5 23.5t145.5 -23.5t132.5 -59t116.5 -83.5t97 -90t74.5 -85.5t49 -63.5t20 -30l26 -40l-26 -40q-6 -10 -20 -30t-49 -63.5t-74.5 -85.5t-97 -90t-116.5 -83.5t-132.5 -59t-145.5 -23.5 t-145.5 23.5t-132.5 59t-116.5 83.5t-97 90t-74.5 85.5t-49 63.5t-20 30zM120 600q7 -10 40.5 -58t56 -78.5t68 -77.5t87.5 -75t103 -49.5t125 -21.5t123.5 20t100.5 45.5t85.5 71.5t66.5 75.5t58 81.5t47 66q-1 1 -28.5 37.5t-42 55t-43.5 53t-57.5 63.5t-58.5 54 q49 -74 49 -163q0 -124 -88 -212t-212 -88t-212 88t-88 212q0 85 46 158q-102 -87 -226 -258zM377 656q49 -124 154 -191l105 105q-37 24 -75 72t-57 84l-20 36z" />
|
||||||
|
<glyph unicode="" d="M-61 600l26 40q6 10 20 30t49 63.5t74.5 85.5t97 90t116.5 83.5t132.5 59t145.5 23.5q61 0 121 -17l37 142h148l-314 -1200h-148l37 143q-82 21 -165 71.5t-140 102t-109.5 112t-72 88.5t-29.5 43zM120 600q210 -282 393 -336l37 141q-107 18 -178.5 101.5t-71.5 193.5 q0 85 46 158q-102 -87 -226 -258zM377 656q49 -124 154 -191l47 47l23 87q-30 28 -59 69t-44 68l-14 26zM780 161l38 145q22 15 44.5 34t46 44t40.5 44t41 50.5t33.5 43.5t33 44t24.5 34q-97 127 -140 175l39 146q67 -54 131.5 -125.5t87.5 -103.5t36 -52l26 -40l-26 -40 q-7 -12 -25.5 -38t-63.5 -79.5t-95.5 -102.5t-124 -100t-146.5 -79z" />
|
||||||
|
<glyph unicode="" d="M-97.5 34q13.5 -34 50.5 -34h1294q37 0 50.5 35.5t-7.5 67.5l-642 1056q-20 34 -48 36.5t-48 -29.5l-642 -1066q-21 -32 -7.5 -66zM155 200l445 723l445 -723h-345v100h-200v-100h-345zM500 600l100 -300l100 300v100h-200v-100z" />
|
||||||
|
<glyph unicode="" d="M100 262v41q0 20 11 44.5t26 38.5l363 325v339q0 62 44 106t106 44t106 -44t44 -106v-339l363 -325q15 -14 26 -38.5t11 -44.5v-41q0 -20 -12 -26.5t-29 5.5l-359 249v-263q100 -91 100 -113v-64q0 -20 -13 -28.5t-32 0.5l-94 78h-222l-94 -78q-19 -9 -32 -0.5t-13 28.5 v64q0 22 100 113v263l-359 -249q-17 -12 -29 -5.5t-12 26.5z" />
|
||||||
|
<glyph unicode="" d="M0 50q0 -20 14.5 -35t35.5 -15h1000q21 0 35.5 15t14.5 35v750h-1100v-750zM0 900h1100v150q0 21 -14.5 35.5t-35.5 14.5h-150v100h-100v-100h-500v100h-100v-100h-150q-21 0 -35.5 -14.5t-14.5 -35.5v-150zM100 100v100h100v-100h-100zM100 300v100h100v-100h-100z M100 500v100h100v-100h-100zM300 100v100h100v-100h-100zM300 300v100h100v-100h-100zM300 500v100h100v-100h-100zM500 100v100h100v-100h-100zM500 300v100h100v-100h-100zM500 500v100h100v-100h-100zM700 100v100h100v-100h-100zM700 300v100h100v-100h-100zM700 500 v100h100v-100h-100zM900 100v100h100v-100h-100zM900 300v100h100v-100h-100zM900 500v100h100v-100h-100z" />
|
||||||
|
<glyph unicode="" d="M0 200v200h259l600 600h241v198l300 -295l-300 -300v197h-159l-600 -600h-341zM0 800h259l122 -122l141 142l-181 180h-341v-200zM678 381l141 142l122 -123h159v198l300 -295l-300 -300v197h-241z" />
|
||||||
|
<glyph unicode="" d="M0 400v600q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-596l-304 -300v300h-100q-41 0 -70.5 29.5t-29.5 70.5z" />
|
||||||
|
<glyph unicode="" d="M100 600v200h300v-250q0 -113 6 -145q17 -92 102 -117q39 -11 92 -11q37 0 66.5 5.5t50 15.5t36 24t24 31.5t14 37.5t7 42t2.5 45t0 47v25v250h300v-200q0 -42 -3 -83t-15 -104t-31.5 -116t-58 -109.5t-89 -96.5t-129 -65.5t-174.5 -25.5t-174.5 25.5t-129 65.5t-89 96.5 t-58 109.5t-31.5 116t-15 104t-3 83zM100 900v300h300v-300h-300zM800 900v300h300v-300h-300z" />
|
||||||
|
<glyph unicode="" d="M-30 411l227 -227l352 353l353 -353l226 227l-578 579z" />
|
||||||
|
<glyph unicode="" d="M70 797l580 -579l578 579l-226 227l-353 -353l-352 353z" />
|
||||||
|
<glyph unicode="" d="M-198 700l299 283l300 -283h-203v-400h385l215 -200h-800v600h-196zM402 1000l215 -200h381v-400h-198l299 -283l299 283h-200v600h-796z" />
|
||||||
|
<glyph unicode="" d="M18 939q-5 24 10 42q14 19 39 19h896l38 162q5 17 18.5 27.5t30.5 10.5h94q20 0 35 -14.5t15 -35.5t-15 -35.5t-35 -14.5h-54l-201 -961q-2 -4 -6 -10.5t-19 -17.5t-33 -11h-31v-50q0 -20 -14.5 -35t-35.5 -15t-35.5 15t-14.5 35v50h-300v-50q0 -20 -14.5 -35t-35.5 -15 t-35.5 15t-14.5 35v50h-50q-21 0 -35.5 15t-14.5 35q0 21 14.5 35.5t35.5 14.5h535l48 200h-633q-32 0 -54.5 21t-27.5 43z" />
|
||||||
|
<glyph unicode="" d="M0 0v800h1200v-800h-1200zM0 900v100h200q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5h500v-100h-1200z" />
|
||||||
|
<glyph unicode="" d="M1 0l300 700h1200l-300 -700h-1200zM1 400v600h200q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5h500v-200h-1000z" />
|
||||||
|
<glyph unicode="" d="M302 300h198v600h-198l298 300l298 -300h-198v-600h198l-298 -300z" />
|
||||||
|
<glyph unicode="" d="M0 600l300 298v-198h600v198l300 -298l-300 -297v197h-600v-197z" />
|
||||||
|
<glyph unicode="" d="M0 100v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM31 400l172 739q5 22 23 41.5t38 19.5h672q19 0 37.5 -22.5t23.5 -45.5l172 -732h-1138zM800 100h100v100h-100v-100z M1000 100h100v100h-100v-100z" />
|
||||||
|
<glyph unicode="" d="M-101 600v50q0 24 25 49t50 38l25 13v-250l-11 5.5t-24 14t-30 21.5t-24 27.5t-11 31.5zM100 500v250v8v8v7t0.5 7t1.5 5.5t2 5t3 4t4.5 3.5t6 1.5t7.5 0.5h200l675 250v-850l-675 200h-38l47 -276q2 -12 -3 -17.5t-11 -6t-21 -0.5h-8h-83q-20 0 -34.5 14t-18.5 35 q-55 337 -55 351zM1100 200v850q0 21 14.5 35.5t35.5 14.5q20 0 35 -14.5t15 -35.5v-850q0 -20 -15 -35t-35 -15q-21 0 -35.5 15t-14.5 35z" />
|
||||||
|
<glyph unicode="" d="M74 350q0 21 13.5 35.5t33.5 14.5h18l117 173l63 327q15 77 76 140t144 83l-18 32q-6 19 3 32t29 13h94q20 0 29 -10.5t3 -29.5q-18 -36 -18 -37q83 -19 144 -82.5t76 -140.5l63 -327l118 -173h17q20 0 33.5 -14.5t13.5 -35.5q0 -20 -13 -40t-31 -27q-8 -3 -23 -8.5 t-65 -20t-103 -25t-132.5 -19.5t-158.5 -9q-125 0 -245.5 20.5t-178.5 40.5l-58 20q-18 7 -31 27.5t-13 40.5zM497 110q12 -49 40 -79.5t63 -30.5t63 30.5t39 79.5q-48 -6 -102 -6t-103 6z" />
|
||||||
|
<glyph unicode="" d="M21 445l233 -45l-78 -224l224 78l45 -233l155 179l155 -179l45 233l224 -78l-78 224l234 45l-180 155l180 156l-234 44l78 225l-224 -78l-45 233l-155 -180l-155 180l-45 -233l-224 78l78 -225l-233 -44l179 -156z" />
|
||||||
|
<glyph unicode="" d="M0 200h200v600h-200v-600zM300 275q0 -75 100 -75h61q124 -100 139 -100h250q46 0 83 57l238 344q29 31 29 74v100q0 44 -30.5 84.5t-69.5 40.5h-328q28 118 28 125v150q0 44 -30.5 84.5t-69.5 40.5h-50q-27 0 -51 -20t-38 -48l-96 -198l-145 -196q-20 -26 -20 -63v-400z M400 300v375l150 213l100 212h50v-175l-50 -225h450v-125l-250 -375h-214l-136 100h-100z" />
|
||||||
|
<glyph unicode="" d="M0 400v600h200v-600h-200zM300 525v400q0 75 100 75h61q124 100 139 100h250q46 0 83 -57l238 -344q29 -31 29 -74v-100q0 -44 -30.5 -84.5t-69.5 -40.5h-328q28 -118 28 -125v-150q0 -44 -30.5 -84.5t-69.5 -40.5h-50q-27 0 -51 20t-38 48l-96 198l-145 196 q-20 26 -20 63zM400 525l150 -212l100 -213h50v175l-50 225h450v125l-250 375h-214l-136 -100h-100v-375z" />
|
||||||
|
<glyph unicode="" d="M8 200v600h200v-600h-200zM308 275v525q0 17 14 35.5t28 28.5l14 9l362 230q14 6 25 6q17 0 29 -12l109 -112q14 -14 14 -34q0 -18 -11 -32l-85 -121h302q85 0 138.5 -38t53.5 -110t-54.5 -111t-138.5 -39h-107l-130 -339q-7 -22 -20.5 -41.5t-28.5 -19.5h-341 q-7 0 -90 81t-83 94zM408 289l100 -89h293l131 339q6 21 19.5 41t28.5 20h203q16 0 25 15t9 36q0 20 -9 34.5t-25 14.5h-457h-6.5h-7.5t-6.5 0.5t-6 1t-5 1.5t-5.5 2.5t-4 4t-4 5.5q-5 12 -5 20q0 14 10 27l147 183l-86 83l-339 -236v-503z" />
|
||||||
|
<glyph unicode="" d="M-101 651q0 72 54 110t139 38l302 -1l-85 121q-11 16 -11 32q0 21 14 34l109 113q13 12 29 12q11 0 25 -6l365 -230q7 -4 17 -10.5t26.5 -26t16.5 -36.5v-526q0 -13 -86 -93.5t-94 -80.5h-341q-16 0 -29.5 20t-19.5 41l-130 339h-107q-84 0 -139 39t-55 111zM-1 601h222 q15 0 28.5 -20.5t19.5 -40.5l131 -339h293l107 89v502l-343 237l-87 -83l145 -184q10 -11 10 -26q0 -11 -5 -20q-1 -3 -3.5 -5.5l-4 -4t-5 -2.5t-5.5 -1.5t-6.5 -1t-6.5 -0.5h-7.5h-6.5h-476v-100zM1000 201v600h200v-600h-200z" />
|
||||||
|
<glyph unicode="" d="M97 719l230 -363q4 -6 10.5 -15.5t26 -25t36.5 -15.5h525q13 0 94 83t81 90v342q0 15 -20 28.5t-41 19.5l-339 131v106q0 84 -39 139t-111 55t-110 -53.5t-38 -138.5v-302l-121 84q-15 12 -33.5 11.5t-32.5 -13.5l-112 -110q-22 -22 -6 -53zM172 739l83 86l183 -146 q22 -18 47 -5q3 1 5.5 3.5l4 4t2.5 5t1.5 5.5t1 6.5t0.5 6.5v7.5v6.5v456q0 22 25 31t50 -0.5t25 -30.5v-202q0 -16 20 -29.5t41 -19.5l339 -130v-294l-89 -100h-503zM400 0v200h600v-200h-600z" />
|
||||||
|
<glyph unicode="" d="M2 585q-16 -31 6 -53l112 -110q13 -13 32 -13.5t34 10.5l121 85q0 -51 -0.5 -153.5t-0.5 -148.5q0 -84 38.5 -138t110.5 -54t111 55t39 139v106l339 131q20 6 40.5 19.5t20.5 28.5v342q0 7 -81 90t-94 83h-525q-17 0 -35.5 -14t-28.5 -28l-10 -15zM77 565l236 339h503 l89 -100v-294l-340 -130q-20 -6 -40 -20t-20 -29v-202q0 -22 -25 -31t-50 0t-25 31v456v14.5t-1.5 11.5t-5 12t-9.5 7q-24 13 -46 -5l-184 -146zM305 1104v200h600v-200h-600z" />
|
||||||
|
<glyph unicode="" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM298 701l2 -201h300l-2 -194l402 294l-402 298v-197h-300z" />
|
||||||
|
<glyph unicode="" d="M0 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t231.5 47.5q122 0 232.5 -47.5t190.5 -127.5t127.5 -190.5t47.5 -232.5q0 -162 -80 -299.5t-218 -217.5t-300 -80t-299.5 80t-217.5 217.5t-80 299.5zM200 600l402 -294l-2 194h300l2 201h-300v197z" />
|
||||||
|
<glyph unicode="" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM300 600h200v-300h200v300h200l-300 400z" />
|
||||||
|
<glyph unicode="" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q162 0 299.5 -80t217.5 -218t80 -300t-80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM300 600l300 -400l300 400h-200v300h-200v-300h-200z" />
|
||||||
|
<glyph unicode="" d="M5 597q0 122 47.5 232.5t127.5 190.5t190.5 127.5t232.5 47.5q121 0 231.5 -47.5t190.5 -127.5t127.5 -190.5t47.5 -232.5q0 -162 -80 -299.5t-217.5 -217.5t-299.5 -80t-300 80t-218 217.5t-80 299.5zM254 780q-8 -33 5.5 -92.5t7.5 -87.5q0 -9 17 -44t16 -60 q12 0 23 -5.5t23 -15t20 -13.5q24 -12 108 -42q22 -8 53 -31.5t59.5 -38.5t57.5 -11q8 -18 -15 -55t-20 -57q42 -71 87 -80q0 -6 -3 -15.5t-3.5 -14.5t4.5 -17q104 -3 221 112q30 29 47 47t34.5 49t20.5 62q-14 9 -37 9.5t-36 7.5q-14 7 -49 15t-52 19q-9 0 -39.5 -0.5 t-46.5 -1.5t-39 -6.5t-39 -16.5q-50 -35 -66 -12q-4 2 -3.5 25.5t0.5 25.5q-6 13 -26.5 17t-24.5 7q2 22 -2 41t-16.5 28t-38.5 -20q-23 -25 -42 4q-19 28 -8 58q6 16 22 22q6 -1 26 -1.5t33.5 -4t19.5 -13.5q12 -19 32 -37.5t34 -27.5l14 -8q0 3 9.5 39.5t5.5 57.5 q-4 23 14.5 44.5t22.5 31.5q5 14 10 35t8.5 31t15.5 22.5t34 21.5q-6 18 10 37q8 0 23.5 -1.5t24.5 -1.5t20.5 4.5t20.5 15.5q-10 23 -30.5 42.5t-38 30t-49 26.5t-43.5 23q11 39 2 44q31 -13 58 -14.5t39 3.5l11 4q7 36 -16.5 53.5t-64.5 28.5t-56 23q-19 -3 -37 0 q-15 -12 -36.5 -21t-34.5 -12t-44 -8t-39 -6q-15 -3 -45.5 0.5t-45.5 -2.5q-21 -7 -52 -26.5t-34 -34.5q-3 -11 6.5 -22.5t8.5 -18.5q-3 -34 -27.5 -90.5t-29.5 -79.5zM518 916q3 12 16 30t16 25q10 -10 18.5 -10t14 6t14.5 14.5t16 12.5q0 -24 17 -66.5t17 -43.5 q-9 2 -31 5t-36 5t-32 8t-30 14zM692 1003h1h-1z" />
|
||||||
|
<glyph unicode="" d="M0 164.5q0 21.5 15 37.5l600 599q-33 101 6 201.5t135 154.5q164 92 306 -9l-259 -138l145 -232l251 126q13 -175 -151 -267q-123 -70 -253 -23l-596 -596q-15 -16 -36.5 -16t-36.5 16l-111 110q-15 15 -15 36.5z" />
|
||||||
|
<glyph unicode="" horiz-adv-x="1220" d="M0 196v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM0 596v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000 q-41 0 -70.5 29.5t-29.5 70.5zM0 996v100q0 41 29.5 70.5t70.5 29.5h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM600 596h500v100h-500v-100zM800 196h300v100h-300v-100zM900 996h200v100h-200v-100z" />
|
||||||
|
<glyph unicode="" d="M100 1100v100h1000v-100h-1000zM150 1000h900l-350 -500v-300l-200 -200v500z" />
|
||||||
|
<glyph unicode="" d="M0 200v200h1200v-200q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5zM0 500v400q0 41 29.5 70.5t70.5 29.5h300v100q0 41 29.5 70.5t70.5 29.5h200q41 0 70.5 -29.5t29.5 -70.5v-100h300q41 0 70.5 -29.5t29.5 -70.5v-400h-500v100h-200v-100h-500z M500 1000h200v100h-200v-100z" />
|
||||||
|
<glyph unicode="" d="M0 0v400l129 -129l200 200l142 -142l-200 -200l129 -129h-400zM0 800l129 129l200 -200l142 142l-200 200l129 129h-400v-400zM729 329l142 142l200 -200l129 129v-400h-400l129 129zM729 871l200 200l-129 129h400v-400l-129 129l-200 -200z" />
|
||||||
|
<glyph unicode="" d="M0 596q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM182 596q0 -172 121.5 -293t292.5 -121t292.5 121t121.5 293q0 171 -121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM291 655 q0 23 15.5 38.5t38.5 15.5t39 -16t16 -38q0 -23 -16 -39t-39 -16q-22 0 -38 16t-16 39zM400 850q0 22 16 38.5t39 16.5q22 0 38 -16t16 -39t-16 -39t-38 -16q-23 0 -39 16.5t-16 38.5zM514 609q0 32 20.5 56.5t51.5 29.5l122 126l1 1q-9 14 -9 28q0 22 16 38.5t39 16.5 q22 0 38 -16t16 -39t-16 -39t-38 -16q-14 0 -29 10l-55 -145q17 -22 17 -51q0 -36 -25.5 -61.5t-61.5 -25.5t-61.5 25.5t-25.5 61.5zM800 655q0 22 16 38t39 16t38.5 -15.5t15.5 -38.5t-16 -39t-38 -16q-23 0 -39 16t-16 39z" />
|
||||||
|
<glyph unicode="" d="M-40 375q-13 -95 35 -173q35 -57 94 -89t129 -32q63 0 119 28q33 16 65 40.5t52.5 45.5t59.5 64q40 44 57 61l394 394q35 35 47 84t-3 96q-27 87 -117 104q-20 2 -29 2q-46 0 -78.5 -16.5t-67.5 -51.5l-389 -396l-7 -7l69 -67l377 373q20 22 39 38q23 23 50 23 q38 0 53 -36q16 -39 -20 -75l-547 -547q-52 -52 -125 -52q-55 0 -100 33t-54 96q-5 35 2.5 66t31.5 63t42 50t56 54q24 21 44 41l348 348q52 52 82.5 79.5t84 54t107.5 26.5q25 0 48 -4q95 -17 154 -94.5t51 -175.5q-7 -101 -98 -192l-252 -249l-253 -256l7 -7l69 -60 l517 511q67 67 95 157t11 183q-16 87 -67 154t-130 103q-69 33 -152 33q-107 0 -197 -55q-40 -24 -111 -95l-512 -512q-68 -68 -81 -163z" />
|
||||||
|
<glyph unicode="" d="M80 784q0 131 98.5 229.5t230.5 98.5q143 0 241 -129q103 129 246 129q129 0 226 -98.5t97 -229.5q0 -46 -17.5 -91t-61 -99t-77 -89.5t-104.5 -105.5q-197 -191 -293 -322l-17 -23l-16 23q-43 58 -100 122.5t-92 99.5t-101 100q-71 70 -104.5 105.5t-77 89.5t-61 99 t-17.5 91zM250 784q0 -27 30.5 -70t61.5 -75.5t95 -94.5l22 -22q93 -90 190 -201q82 92 195 203l12 12q64 62 97.5 97t64.5 79t31 72q0 71 -48 119.5t-105 48.5q-74 0 -132 -83l-118 -171l-114 174q-51 80 -123 80q-60 0 -109.5 -49.5t-49.5 -118.5z" />
|
||||||
|
<glyph unicode="" d="M57 353q0 -95 66 -159l141 -142q68 -66 159 -66q93 0 159 66l283 283q66 66 66 159t-66 159l-141 141q-8 9 -19 17l-105 -105l212 -212l-389 -389l-247 248l95 95l-18 18q-46 45 -75 101l-55 -55q-66 -66 -66 -159zM269 706q0 -93 66 -159l141 -141q7 -7 19 -17l105 105 l-212 212l389 389l247 -247l-95 -96l18 -17q47 -49 77 -100l29 29q35 35 62.5 88t27.5 96q0 93 -66 159l-141 141q-66 66 -159 66q-95 0 -159 -66l-283 -283q-66 -64 -66 -159z" />
|
||||||
|
<glyph unicode="" d="M200 100v953q0 21 30 46t81 48t129 38t163 15t162 -15t127 -38t79 -48t29 -46v-953q0 -41 -29.5 -70.5t-70.5 -29.5h-600q-41 0 -70.5 29.5t-29.5 70.5zM300 300h600v700h-600v-700zM496 150q0 -43 30.5 -73.5t73.5 -30.5t73.5 30.5t30.5 73.5t-30.5 73.5t-73.5 30.5 t-73.5 -30.5t-30.5 -73.5z" />
|
||||||
|
<glyph unicode="" d="M0 0l303 380l207 208l-210 212h300l267 279l-35 36q-15 14 -15 35t15 35q14 15 35 15t35 -15l283 -282q15 -15 15 -36t-15 -35q-14 -15 -35 -15t-35 15l-36 35l-279 -267v-300l-212 210l-208 -207z" />
|
||||||
|
<glyph unicode="" d="M295 433h139q5 -77 48.5 -126.5t117.5 -64.5v335q-6 1 -15.5 4t-11.5 3q-46 14 -79 26.5t-72 36t-62.5 52t-40 72.5t-16.5 99q0 92 44 159.5t109 101t144 40.5v78h100v-79q38 -4 72.5 -13.5t75.5 -31.5t71 -53.5t51.5 -84t24.5 -118.5h-159q-8 72 -35 109.5t-101 50.5 v-307l64 -14q34 -7 64 -16.5t70 -31.5t67.5 -52t47.5 -80.5t20 -112.5q0 -139 -89 -224t-244 -96v-77h-100v78q-152 17 -237 104q-40 40 -52.5 93.5t-15.5 139.5zM466 889q0 -29 8 -51t16.5 -34t29.5 -22.5t31 -13.5t38 -10q7 -2 11 -3v274q-61 -8 -97.5 -37.5t-36.5 -102.5 zM700 237q170 18 170 151q0 64 -44 99.5t-126 60.5v-311z" />
|
||||||
|
<glyph unicode="" d="M100 600v100h166q-24 49 -44 104q-10 26 -14.5 55.5t-3 72.5t25 90t68.5 87q97 88 263 88q129 0 230 -89t101 -208h-153q0 52 -34 89.5t-74 51.5t-76 14q-37 0 -79 -14.5t-62 -35.5q-41 -44 -41 -101q0 -28 16.5 -69.5t28 -62.5t41.5 -72h241v-100h-197q8 -50 -2.5 -115 t-31.5 -94q-41 -59 -99 -113q35 11 84 18t70 7q33 1 103 -16t103 -17q76 0 136 30l50 -147q-41 -25 -80.5 -36.5t-59 -13t-61.5 -1.5q-23 0 -128 33t-155 29q-39 -4 -82 -17t-66 -25l-24 -11l-55 145l16.5 11t15.5 10t13.5 9.5t14.5 12t14.5 14t17.5 18.5q48 55 54 126.5 t-30 142.5h-221z" />
|
||||||
|
<glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM602 900l298 300l298 -300h-198v-900h-200v900h-198z" />
|
||||||
|
<glyph unicode="" d="M2 300h198v900h200v-900h198l-298 -300zM700 0v200h100v-100h200v-100h-300zM700 400v100h300v-200h-99v-100h-100v100h99v100h-200zM700 700v500h300v-500h-100v100h-100v-100h-100zM801 900h100v200h-100v-200z" />
|
||||||
|
<glyph unicode="" d="M2 300h198v900h200v-900h198l-298 -300zM700 0v500h300v-500h-100v100h-100v-100h-100zM700 700v200h100v-100h200v-100h-300zM700 1100v100h300v-200h-99v-100h-100v100h99v100h-200zM801 200h100v200h-100v-200z" />
|
||||||
|
<glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM800 100v400h300v-500h-100v100h-200zM800 1100v100h200v-500h-100v400h-100zM901 200h100v200h-100v-200z" />
|
||||||
|
<glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM800 400v100h200v-500h-100v400h-100zM800 800v400h300v-500h-100v100h-200zM901 900h100v200h-100v-200z" />
|
||||||
|
<glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM700 100v200h500v-200h-500zM700 400v200h400v-200h-400zM700 700v200h300v-200h-300zM700 1000v200h200v-200h-200z" />
|
||||||
|
<glyph unicode="" d="M2 300l298 -300l298 300h-198v900h-200v-900h-198zM700 100v200h200v-200h-200zM700 400v200h300v-200h-300zM700 700v200h400v-200h-400zM700 1000v200h500v-200h-500z" />
|
||||||
|
<glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q162 0 281 -118.5t119 -281.5v-300q0 -165 -118.5 -282.5t-281.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500z" />
|
||||||
|
<glyph unicode="" d="M0 400v300q0 163 119 281.5t281 118.5h300q165 0 282.5 -117.5t117.5 -282.5v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-163 0 -281.5 117.5t-118.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM400 300l333 250l-333 250v-500z" />
|
||||||
|
<glyph unicode="" d="M0 400v300q0 163 117.5 281.5t282.5 118.5h300q163 0 281.5 -119t118.5 -281v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-300q-165 0 -282.5 117.5t-117.5 282.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM300 700l250 -333l250 333h-500z" />
|
||||||
|
<glyph unicode="" d="M0 400v300q0 165 117.5 282.5t282.5 117.5h300q165 0 282.5 -117.5t117.5 -282.5v-300q0 -162 -118.5 -281t-281.5 -119h-300q-165 0 -282.5 118.5t-117.5 281.5zM200 300q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5 h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM300 400h500l-250 333z" />
|
||||||
|
<glyph unicode="" d="M0 400v300h300v200l400 -350l-400 -350v200h-300zM500 0v200h500q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5h-500v200h400q165 0 282.5 -117.5t117.5 -282.5v-300q0 -165 -117.5 -282.5t-282.5 -117.5h-400z" />
|
||||||
|
<glyph unicode="" d="M217 519q8 -19 31 -19h302q-155 -438 -160 -458q-5 -21 4 -32l9 -8h9q14 0 26 15q11 13 274.5 321.5t264.5 308.5q14 19 5 36q-8 17 -31 17l-301 -1q1 4 78 219.5t79 227.5q2 15 -5 27l-9 9h-9q-15 0 -25 -16q-4 -6 -98 -111.5t-228.5 -257t-209.5 -237.5q-16 -19 -6 -41 z" />
|
||||||
|
<glyph unicode="" d="M0 400q0 -165 117.5 -282.5t282.5 -117.5h300q47 0 100 15v185h-500q-41 0 -70.5 29.5t-29.5 70.5v500q0 41 29.5 70.5t70.5 29.5h500v185q-14 4 -114 7.5t-193 5.5l-93 2q-165 0 -282.5 -117.5t-117.5 -282.5v-300zM600 400v300h300v200l400 -350l-400 -350v200h-300z " />
|
||||||
|
<glyph unicode="" d="M0 400q0 -165 117.5 -282.5t282.5 -117.5h300q163 0 281.5 117.5t118.5 282.5v98l-78 73l-122 -123v-148q0 -41 -29.5 -70.5t-70.5 -29.5h-500q-41 0 -70.5 29.5t-29.5 70.5v500q0 41 29.5 70.5t70.5 29.5h156l118 122l-74 78h-100q-165 0 -282.5 -117.5t-117.5 -282.5 v-300zM496 709l353 342l-149 149h500v-500l-149 149l-342 -353z" />
|
||||||
|
<glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM406 600 q0 80 57 137t137 57t137 -57t57 -137t-57 -137t-137 -57t-137 57t-57 137z" />
|
||||||
|
<glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 800l445 -500l450 500h-295v400h-300v-400h-300zM900 150h100v50h-100v-50z" />
|
||||||
|
<glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 700h300v-300h300v300h295l-445 500zM900 150h100v50h-100v-50z" />
|
||||||
|
<glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 705l305 -305l596 596l-154 155l-442 -442l-150 151zM900 150h100v50h-100v-50z" />
|
||||||
|
<glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM100 988l97 -98l212 213l-97 97zM200 400l697 1l3 699l-250 -239l-149 149l-212 -212l149 -149zM900 150h100v50h-100v-50z" />
|
||||||
|
<glyph unicode="" d="M0 0v275q0 11 7 18t18 7h1048q11 0 19 -7.5t8 -17.5v-275h-1100zM200 612l212 -212l98 97l-213 212zM300 1200l239 -250l-149 -149l212 -212l149 148l249 -237l-1 697zM900 150h100v50h-100v-50z" />
|
||||||
|
<glyph unicode="" d="M23 415l1177 784v-1079l-475 272l-310 -393v416h-392zM494 210l672 938l-672 -712v-226z" />
|
||||||
|
<glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-850q0 -21 -15 -35.5t-35 -14.5h-150v400h-700v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 1000h100v200h-100v-200z" />
|
||||||
|
<glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-218l-276 -275l-120 120l-126 -127h-378v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM581 306l123 123l120 -120l353 352l123 -123l-475 -476zM600 1000h100v200h-100v-200z" />
|
||||||
|
<glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-269l-103 -103l-170 170l-298 -298h-329v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 1000h100v200h-100v-200zM700 133l170 170l-170 170l127 127l170 -170l170 170l127 -128l-170 -169l170 -170 l-127 -127l-170 170l-170 -170z" />
|
||||||
|
<glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-300h-400v-200h-500v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 300l300 -300l300 300h-200v300h-200v-300h-200zM600 1000v200h100v-200h-100z" />
|
||||||
|
<glyph unicode="" d="M0 150v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100l200 -200v-402l-200 200l-298 -298h-402v-400h-150q-21 0 -35.5 14.5t-14.5 35.5zM600 300h200v-300h200v300h200l-300 300zM600 1000v200h100v-200h-100z" />
|
||||||
|
<glyph unicode="" d="M0 250q0 -21 14.5 -35.5t35.5 -14.5h1100q21 0 35.5 14.5t14.5 35.5v550h-1200v-550zM0 900h1200v150q0 21 -14.5 35.5t-35.5 14.5h-1100q-21 0 -35.5 -14.5t-14.5 -35.5v-150zM100 300v200h400v-200h-400z" />
|
||||||
|
<glyph unicode="" d="M0 400l300 298v-198h400v-200h-400v-198zM100 800v200h100v-200h-100zM300 800v200h100v-200h-100zM500 800v200h400v198l300 -298l-300 -298v198h-400zM800 300v200h100v-200h-100zM1000 300h100v200h-100v-200z" />
|
||||||
|
<glyph unicode="" d="M100 700v400l50 100l50 -100v-300h100v300l50 100l50 -100v-300h100v300l50 100l50 -100v-400l-100 -203v-447q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v447zM800 597q0 -29 10.5 -55.5t25 -43t29 -28.5t25.5 -18l10 -5v-397q0 -21 14.5 -35.5 t35.5 -14.5h200q21 0 35.5 14.5t14.5 35.5v1106q0 31 -18 40.5t-44 -7.5l-276 -116q-25 -17 -43.5 -51.5t-18.5 -65.5v-359z" />
|
||||||
|
<glyph unicode="" d="M100 0h400v56q-75 0 -87.5 6t-12.5 44v394h500v-394q0 -38 -12.5 -44t-87.5 -6v-56h400v56q-4 0 -11 0.5t-24 3t-30 7t-24 15t-11 24.5v888q0 22 25 34.5t50 13.5l25 2v56h-400v-56q75 0 87.5 -6t12.5 -44v-394h-500v394q0 38 12.5 44t87.5 6v56h-400v-56q4 0 11 -0.5 t24 -3t30 -7t24 -15t11 -24.5v-888q0 -22 -25 -34.5t-50 -13.5l-25 -2v-56z" />
|
||||||
|
<glyph unicode="" d="M0 300q0 -41 29.5 -70.5t70.5 -29.5h300q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5h-300q-41 0 -70.5 -29.5t-29.5 -70.5v-500zM100 100h400l200 200h105l295 98v-298h-425l-100 -100h-375zM100 300v200h300v-200h-300zM100 600v200h300v-200h-300z M100 1000h400l200 -200v-98l295 98h105v200h-425l-100 100h-375zM700 402v163l400 133v-163z" />
|
||||||
|
<glyph unicode="" d="M16.5 974.5q0.5 -21.5 16 -90t46.5 -140t104 -177.5t175 -208q103 -103 207.5 -176t180 -103.5t137 -47t92.5 -16.5l31 1l163 162q17 18 13.5 41t-22.5 37l-192 136q-19 14 -45 12t-42 -19l-118 -118q-142 101 -268 227t-227 268l118 118q17 17 20 41.5t-11 44.5 l-139 194q-14 19 -36.5 22t-40.5 -14l-162 -162q-1 -11 -0.5 -32.5z" />
|
||||||
|
<glyph unicode="" d="M0 50v212q0 20 10.5 45.5t24.5 39.5l365 303v50q0 4 1 10.5t12 22.5t30 28.5t60 23t97 10.5t97 -10t60 -23.5t30 -27.5t12 -24l1 -10v-50l365 -303q14 -14 24.5 -39.5t10.5 -45.5v-212q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-20 0 -35 14.5t-15 35.5zM0 712 q0 -21 14.5 -33.5t34.5 -8.5l202 33q20 4 34.5 21t14.5 38v146q141 24 300 24t300 -24v-146q0 -21 14.5 -38t34.5 -21l202 -33q20 -4 34.5 8.5t14.5 33.5v200q-6 8 -19 20.5t-63 45t-112 57t-171 45t-235 20.5q-92 0 -175 -10.5t-141.5 -27t-108.5 -36.5t-81.5 -40 t-53.5 -36.5t-31 -27.5l-9 -10v-200z" />
|
||||||
|
<glyph unicode="" d="M100 0v100h1100v-100h-1100zM175 200h950l-125 150v250l100 100v400h-100v-200h-100v200h-200v-200h-100v200h-200v-200h-100v200h-100v-400l100 -100v-250z" />
|
||||||
|
<glyph unicode="" d="M100 0h300v400q0 41 -29.5 70.5t-70.5 29.5h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-400zM500 0v1000q0 41 29.5 70.5t70.5 29.5h100q41 0 70.5 -29.5t29.5 -70.5v-1000h-300zM900 0v700q0 41 29.5 70.5t70.5 29.5h100q41 0 70.5 -29.5t29.5 -70.5v-700h-300z" />
|
||||||
|
<glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v300h-200v100h200v100h-300v-300h200v-100h-200v-100zM600 300h200v100h100v300h-100v100h-200v-500 zM700 400v300h100v-300h-100z" />
|
||||||
|
<glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h100v200h100v-200h100v500h-100v-200h-100v200h-100v-500zM600 300h200v100h100v300h-100v100h-200v-500 zM700 400v300h100v-300h-100z" />
|
||||||
|
<glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v100h-200v300h200v100h-300v-500zM600 300h300v100h-200v300h200v100h-300v-500z" />
|
||||||
|
<glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 550l300 -150v300zM600 400l300 150l-300 150v-300z" />
|
||||||
|
<glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300v500h700v-500h-700zM300 400h130q41 0 68 42t27 107t-28.5 108t-66.5 43h-130v-300zM575 549 q0 -65 27 -107t68 -42h130v300h-130q-38 0 -66.5 -43t-28.5 -108z" />
|
||||||
|
<glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v300h-200v100h200v100h-300v-300h200v-100h-200v-100zM601 300h100v100h-100v-100zM700 700h100 v-400h100v500h-200v-100z" />
|
||||||
|
<glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 300h300v400h-200v100h-100v-500zM301 400v200h100v-200h-100zM601 300h100v100h-100v-100zM700 700h100 v-400h100v500h-200v-100z" />
|
||||||
|
<glyph unicode="" d="M-100 300v500q0 124 88 212t212 88h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212zM100 200h900v700h-900v-700zM200 700v100h300v-300h-99v-100h-100v100h99v200h-200zM201 300v100h100v-100h-100zM601 300v100h100v-100h-100z M700 700v100h200v-500h-100v400h-100z" />
|
||||||
|
<glyph unicode="" d="M4 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM186 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM400 500v200 l100 100h300v-100h-300v-200h300v-100h-300z" />
|
||||||
|
<glyph unicode="" d="M0 600q0 162 80 299t217 217t299 80t299 -80t217 -217t80 -299t-80 -299t-217 -217t-299 -80t-299 80t-217 217t-80 299zM182 600q0 -171 121.5 -292.5t292.5 -121.5t292.5 121.5t121.5 292.5t-121.5 292.5t-292.5 121.5t-292.5 -121.5t-121.5 -292.5zM400 400v400h300 l100 -100v-100h-100v100h-200v-100h200v-100h-200v-100h-100zM700 400v100h100v-100h-100z" />
|
||||||
|
<glyph unicode="" d="M-14 494q0 -80 56.5 -137t135.5 -57h222v300h400v-300h128q120 0 205 86.5t85 207.5t-85 207t-205 86q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5zM300 200h200v300h200v-300h200 l-300 -300z" />
|
||||||
|
<glyph unicode="" d="M-14 494q0 -80 56.5 -137t135.5 -57h8l414 414l403 -403q94 26 154.5 104.5t60.5 178.5q0 120 -85 206.5t-205 86.5q-46 0 -90 -14q-44 97 -134.5 156.5t-200.5 59.5q-152 0 -260 -107.5t-108 -260.5q0 -25 2 -37q-66 -14 -108.5 -67.5t-42.5 -122.5zM300 200l300 300 l300 -300h-200v-300h-200v300h-200z" />
|
||||||
|
<glyph unicode="" d="M100 200h400v-155l-75 -45h350l-75 45v155h400l-270 300h170l-270 300h170l-300 333l-300 -333h170l-270 -300h170z" />
|
||||||
|
<glyph unicode="" d="M121 700q0 -53 28.5 -97t75.5 -65q-4 -16 -4 -38q0 -74 52.5 -126.5t126.5 -52.5q56 0 100 30v-306l-75 -45h350l-75 45v306q46 -30 100 -30q74 0 126.5 52.5t52.5 126.5q0 24 -9 55q50 32 79.5 83t29.5 112q0 90 -61.5 155.5t-150.5 71.5q-26 89 -99.5 145.5 t-167.5 56.5q-116 0 -197.5 -81.5t-81.5 -197.5q0 -4 1 -11.5t1 -11.5q-14 2 -23 2q-74 0 -126.5 -52.5t-52.5 -126.5z" />
|
||||||
|
</font>
|
||||||
|
</defs></svg>
|
After Width: | Height: | Size: 62 KiB |
BIN
externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.ttf
vendored
Normal file
BIN
externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.ttf
vendored
Normal file
Binary file not shown.
BIN
externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.woff
vendored
Normal file
BIN
externals/fmt/doc/html/_static/fonts/glyphicons-halflings-regular.woff
vendored
Normal file
Binary file not shown.
10872
externals/fmt/doc/html/_static/jquery-3.5.1.js
vendored
Normal file
10872
externals/fmt/doc/html/_static/jquery-3.5.1.js
vendored
Normal file
File diff suppressed because it is too large
Load Diff
2
externals/fmt/doc/html/_static/jquery.js
vendored
Normal file
2
externals/fmt/doc/html/_static/jquery.js
vendored
Normal file
File diff suppressed because one or more lines are too long
297
externals/fmt/doc/html/_static/language_data.js
vendored
Normal file
297
externals/fmt/doc/html/_static/language_data.js
vendored
Normal file
@ -0,0 +1,297 @@
|
|||||||
|
/*
|
||||||
|
* language_data.js
|
||||||
|
* ~~~~~~~~~~~~~~~~
|
||||||
|
*
|
||||||
|
* This script contains the language-specific data used by searchtools.js,
|
||||||
|
* namely the list of stopwords, stemmer, scorer and splitter.
|
||||||
|
*
|
||||||
|
* :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS.
|
||||||
|
* :license: BSD, see LICENSE for details.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
|
||||||
|
var stopwords = ["a","and","are","as","at","be","but","by","for","if","in","into","is","it","near","no","not","of","on","or","such","that","the","their","then","there","these","they","this","to","was","will","with"];
|
||||||
|
|
||||||
|
|
||||||
|
/* Non-minified version JS is _stemmer.js if file is provided */
|
||||||
|
/**
|
||||||
|
* Porter Stemmer
|
||||||
|
*/
|
||||||
|
var Stemmer = function() {
|
||||||
|
|
||||||
|
var step2list = {
|
||||||
|
ational: 'ate',
|
||||||
|
tional: 'tion',
|
||||||
|
enci: 'ence',
|
||||||
|
anci: 'ance',
|
||||||
|
izer: 'ize',
|
||||||
|
bli: 'ble',
|
||||||
|
alli: 'al',
|
||||||
|
entli: 'ent',
|
||||||
|
eli: 'e',
|
||||||
|
ousli: 'ous',
|
||||||
|
ization: 'ize',
|
||||||
|
ation: 'ate',
|
||||||
|
ator: 'ate',
|
||||||
|
alism: 'al',
|
||||||
|
iveness: 'ive',
|
||||||
|
fulness: 'ful',
|
||||||
|
ousness: 'ous',
|
||||||
|
aliti: 'al',
|
||||||
|
iviti: 'ive',
|
||||||
|
biliti: 'ble',
|
||||||
|
logi: 'log'
|
||||||
|
};
|
||||||
|
|
||||||
|
var step3list = {
|
||||||
|
icate: 'ic',
|
||||||
|
ative: '',
|
||||||
|
alize: 'al',
|
||||||
|
iciti: 'ic',
|
||||||
|
ical: 'ic',
|
||||||
|
ful: '',
|
||||||
|
ness: ''
|
||||||
|
};
|
||||||
|
|
||||||
|
var c = "[^aeiou]"; // consonant
|
||||||
|
var v = "[aeiouy]"; // vowel
|
||||||
|
var C = c + "[^aeiouy]*"; // consonant sequence
|
||||||
|
var V = v + "[aeiou]*"; // vowel sequence
|
||||||
|
|
||||||
|
var mgr0 = "^(" + C + ")?" + V + C; // [C]VC... is m>0
|
||||||
|
var meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$"; // [C]VC[V] is m=1
|
||||||
|
var mgr1 = "^(" + C + ")?" + V + C + V + C; // [C]VCVC... is m>1
|
||||||
|
var s_v = "^(" + C + ")?" + v; // vowel in stem
|
||||||
|
|
||||||
|
this.stemWord = function (w) {
|
||||||
|
var stem;
|
||||||
|
var suffix;
|
||||||
|
var firstch;
|
||||||
|
var origword = w;
|
||||||
|
|
||||||
|
if (w.length < 3)
|
||||||
|
return w;
|
||||||
|
|
||||||
|
var re;
|
||||||
|
var re2;
|
||||||
|
var re3;
|
||||||
|
var re4;
|
||||||
|
|
||||||
|
firstch = w.substr(0,1);
|
||||||
|
if (firstch == "y")
|
||||||
|
w = firstch.toUpperCase() + w.substr(1);
|
||||||
|
|
||||||
|
// Step 1a
|
||||||
|
re = /^(.+?)(ss|i)es$/;
|
||||||
|
re2 = /^(.+?)([^s])s$/;
|
||||||
|
|
||||||
|
if (re.test(w))
|
||||||
|
w = w.replace(re,"$1$2");
|
||||||
|
else if (re2.test(w))
|
||||||
|
w = w.replace(re2,"$1$2");
|
||||||
|
|
||||||
|
// Step 1b
|
||||||
|
re = /^(.+?)eed$/;
|
||||||
|
re2 = /^(.+?)(ed|ing)$/;
|
||||||
|
if (re.test(w)) {
|
||||||
|
var fp = re.exec(w);
|
||||||
|
re = new RegExp(mgr0);
|
||||||
|
if (re.test(fp[1])) {
|
||||||
|
re = /.$/;
|
||||||
|
w = w.replace(re,"");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else if (re2.test(w)) {
|
||||||
|
var fp = re2.exec(w);
|
||||||
|
stem = fp[1];
|
||||||
|
re2 = new RegExp(s_v);
|
||||||
|
if (re2.test(stem)) {
|
||||||
|
w = stem;
|
||||||
|
re2 = /(at|bl|iz)$/;
|
||||||
|
re3 = new RegExp("([^aeiouylsz])\\1$");
|
||||||
|
re4 = new RegExp("^" + C + v + "[^aeiouwxy]$");
|
||||||
|
if (re2.test(w))
|
||||||
|
w = w + "e";
|
||||||
|
else if (re3.test(w)) {
|
||||||
|
re = /.$/;
|
||||||
|
w = w.replace(re,"");
|
||||||
|
}
|
||||||
|
else if (re4.test(w))
|
||||||
|
w = w + "e";
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Step 1c
|
||||||
|
re = /^(.+?)y$/;
|
||||||
|
if (re.test(w)) {
|
||||||
|
var fp = re.exec(w);
|
||||||
|
stem = fp[1];
|
||||||
|
re = new RegExp(s_v);
|
||||||
|
if (re.test(stem))
|
||||||
|
w = stem + "i";
|
||||||
|
}
|
||||||
|
|
||||||
|
// Step 2
|
||||||
|
re = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/;
|
||||||
|
if (re.test(w)) {
|
||||||
|
var fp = re.exec(w);
|
||||||
|
stem = fp[1];
|
||||||
|
suffix = fp[2];
|
||||||
|
re = new RegExp(mgr0);
|
||||||
|
if (re.test(stem))
|
||||||
|
w = stem + step2list[suffix];
|
||||||
|
}
|
||||||
|
|
||||||
|
// Step 3
|
||||||
|
re = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/;
|
||||||
|
if (re.test(w)) {
|
||||||
|
var fp = re.exec(w);
|
||||||
|
stem = fp[1];
|
||||||
|
suffix = fp[2];
|
||||||
|
re = new RegExp(mgr0);
|
||||||
|
if (re.test(stem))
|
||||||
|
w = stem + step3list[suffix];
|
||||||
|
}
|
||||||
|
|
||||||
|
// Step 4
|
||||||
|
re = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/;
|
||||||
|
re2 = /^(.+?)(s|t)(ion)$/;
|
||||||
|
if (re.test(w)) {
|
||||||
|
var fp = re.exec(w);
|
||||||
|
stem = fp[1];
|
||||||
|
re = new RegExp(mgr1);
|
||||||
|
if (re.test(stem))
|
||||||
|
w = stem;
|
||||||
|
}
|
||||||
|
else if (re2.test(w)) {
|
||||||
|
var fp = re2.exec(w);
|
||||||
|
stem = fp[1] + fp[2];
|
||||||
|
re2 = new RegExp(mgr1);
|
||||||
|
if (re2.test(stem))
|
||||||
|
w = stem;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Step 5
|
||||||
|
re = /^(.+?)e$/;
|
||||||
|
if (re.test(w)) {
|
||||||
|
var fp = re.exec(w);
|
||||||
|
stem = fp[1];
|
||||||
|
re = new RegExp(mgr1);
|
||||||
|
re2 = new RegExp(meq1);
|
||||||
|
re3 = new RegExp("^" + C + v + "[^aeiouwxy]$");
|
||||||
|
if (re.test(stem) || (re2.test(stem) && !(re3.test(stem))))
|
||||||
|
w = stem;
|
||||||
|
}
|
||||||
|
re = /ll$/;
|
||||||
|
re2 = new RegExp(mgr1);
|
||||||
|
if (re.test(w) && re2.test(w)) {
|
||||||
|
re = /.$/;
|
||||||
|
w = w.replace(re,"");
|
||||||
|
}
|
||||||
|
|
||||||
|
// and turn initial Y back to y
|
||||||
|
if (firstch == "y")
|
||||||
|
w = firstch.toLowerCase() + w.substr(1);
|
||||||
|
return w;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
var splitChars = (function() {
|
||||||
|
var result = {};
|
||||||
|
var singles = [96, 180, 187, 191, 215, 247, 749, 885, 903, 907, 909, 930, 1014, 1648,
|
||||||
|
1748, 1809, 2416, 2473, 2481, 2526, 2601, 2609, 2612, 2615, 2653, 2702,
|
||||||
|
2706, 2729, 2737, 2740, 2857, 2865, 2868, 2910, 2928, 2948, 2961, 2971,
|
||||||
|
2973, 3085, 3089, 3113, 3124, 3213, 3217, 3241, 3252, 3295, 3341, 3345,
|
||||||
|
3369, 3506, 3516, 3633, 3715, 3721, 3736, 3744, 3748, 3750, 3756, 3761,
|
||||||
|
3781, 3912, 4239, 4347, 4681, 4695, 4697, 4745, 4785, 4799, 4801, 4823,
|
||||||
|
4881, 5760, 5901, 5997, 6313, 7405, 8024, 8026, 8028, 8030, 8117, 8125,
|
||||||
|
8133, 8181, 8468, 8485, 8487, 8489, 8494, 8527, 11311, 11359, 11687, 11695,
|
||||||
|
11703, 11711, 11719, 11727, 11735, 12448, 12539, 43010, 43014, 43019, 43587,
|
||||||
|
43696, 43713, 64286, 64297, 64311, 64317, 64319, 64322, 64325, 65141];
|
||||||
|
var i, j, start, end;
|
||||||
|
for (i = 0; i < singles.length; i++) {
|
||||||
|
result[singles[i]] = true;
|
||||||
|
}
|
||||||
|
var ranges = [[0, 47], [58, 64], [91, 94], [123, 169], [171, 177], [182, 184], [706, 709],
|
||||||
|
[722, 735], [741, 747], [751, 879], [888, 889], [894, 901], [1154, 1161],
|
||||||
|
[1318, 1328], [1367, 1368], [1370, 1376], [1416, 1487], [1515, 1519], [1523, 1568],
|
||||||
|
[1611, 1631], [1642, 1645], [1750, 1764], [1767, 1773], [1789, 1790], [1792, 1807],
|
||||||
|
[1840, 1868], [1958, 1968], [1970, 1983], [2027, 2035], [2038, 2041], [2043, 2047],
|
||||||
|
[2070, 2073], [2075, 2083], [2085, 2087], [2089, 2307], [2362, 2364], [2366, 2383],
|
||||||
|
[2385, 2391], [2402, 2405], [2419, 2424], [2432, 2436], [2445, 2446], [2449, 2450],
|
||||||
|
[2483, 2485], [2490, 2492], [2494, 2509], [2511, 2523], [2530, 2533], [2546, 2547],
|
||||||
|
[2554, 2564], [2571, 2574], [2577, 2578], [2618, 2648], [2655, 2661], [2672, 2673],
|
||||||
|
[2677, 2692], [2746, 2748], [2750, 2767], [2769, 2783], [2786, 2789], [2800, 2820],
|
||||||
|
[2829, 2830], [2833, 2834], [2874, 2876], [2878, 2907], [2914, 2917], [2930, 2946],
|
||||||
|
[2955, 2957], [2966, 2968], [2976, 2978], [2981, 2983], [2987, 2989], [3002, 3023],
|
||||||
|
[3025, 3045], [3059, 3076], [3130, 3132], [3134, 3159], [3162, 3167], [3170, 3173],
|
||||||
|
[3184, 3191], [3199, 3204], [3258, 3260], [3262, 3293], [3298, 3301], [3312, 3332],
|
||||||
|
[3386, 3388], [3390, 3423], [3426, 3429], [3446, 3449], [3456, 3460], [3479, 3481],
|
||||||
|
[3518, 3519], [3527, 3584], [3636, 3647], [3655, 3663], [3674, 3712], [3717, 3718],
|
||||||
|
[3723, 3724], [3726, 3731], [3752, 3753], [3764, 3772], [3774, 3775], [3783, 3791],
|
||||||
|
[3802, 3803], [3806, 3839], [3841, 3871], [3892, 3903], [3949, 3975], [3980, 4095],
|
||||||
|
[4139, 4158], [4170, 4175], [4182, 4185], [4190, 4192], [4194, 4196], [4199, 4205],
|
||||||
|
[4209, 4212], [4226, 4237], [4250, 4255], [4294, 4303], [4349, 4351], [4686, 4687],
|
||||||
|
[4702, 4703], [4750, 4751], [4790, 4791], [4806, 4807], [4886, 4887], [4955, 4968],
|
||||||
|
[4989, 4991], [5008, 5023], [5109, 5120], [5741, 5742], [5787, 5791], [5867, 5869],
|
||||||
|
[5873, 5887], [5906, 5919], [5938, 5951], [5970, 5983], [6001, 6015], [6068, 6102],
|
||||||
|
[6104, 6107], [6109, 6111], [6122, 6127], [6138, 6159], [6170, 6175], [6264, 6271],
|
||||||
|
[6315, 6319], [6390, 6399], [6429, 6469], [6510, 6511], [6517, 6527], [6572, 6592],
|
||||||
|
[6600, 6607], [6619, 6655], [6679, 6687], [6741, 6783], [6794, 6799], [6810, 6822],
|
||||||
|
[6824, 6916], [6964, 6980], [6988, 6991], [7002, 7042], [7073, 7085], [7098, 7167],
|
||||||
|
[7204, 7231], [7242, 7244], [7294, 7400], [7410, 7423], [7616, 7679], [7958, 7959],
|
||||||
|
[7966, 7967], [8006, 8007], [8014, 8015], [8062, 8063], [8127, 8129], [8141, 8143],
|
||||||
|
[8148, 8149], [8156, 8159], [8173, 8177], [8189, 8303], [8306, 8307], [8314, 8318],
|
||||||
|
[8330, 8335], [8341, 8449], [8451, 8454], [8456, 8457], [8470, 8472], [8478, 8483],
|
||||||
|
[8506, 8507], [8512, 8516], [8522, 8525], [8586, 9311], [9372, 9449], [9472, 10101],
|
||||||
|
[10132, 11263], [11493, 11498], [11503, 11516], [11518, 11519], [11558, 11567],
|
||||||
|
[11622, 11630], [11632, 11647], [11671, 11679], [11743, 11822], [11824, 12292],
|
||||||
|
[12296, 12320], [12330, 12336], [12342, 12343], [12349, 12352], [12439, 12444],
|
||||||
|
[12544, 12548], [12590, 12592], [12687, 12689], [12694, 12703], [12728, 12783],
|
||||||
|
[12800, 12831], [12842, 12880], [12896, 12927], [12938, 12976], [12992, 13311],
|
||||||
|
[19894, 19967], [40908, 40959], [42125, 42191], [42238, 42239], [42509, 42511],
|
||||||
|
[42540, 42559], [42592, 42593], [42607, 42622], [42648, 42655], [42736, 42774],
|
||||||
|
[42784, 42785], [42889, 42890], [42893, 43002], [43043, 43055], [43062, 43071],
|
||||||
|
[43124, 43137], [43188, 43215], [43226, 43249], [43256, 43258], [43260, 43263],
|
||||||
|
[43302, 43311], [43335, 43359], [43389, 43395], [43443, 43470], [43482, 43519],
|
||||||
|
[43561, 43583], [43596, 43599], [43610, 43615], [43639, 43641], [43643, 43647],
|
||||||
|
[43698, 43700], [43703, 43704], [43710, 43711], [43715, 43738], [43742, 43967],
|
||||||
|
[44003, 44015], [44026, 44031], [55204, 55215], [55239, 55242], [55292, 55295],
|
||||||
|
[57344, 63743], [64046, 64047], [64110, 64111], [64218, 64255], [64263, 64274],
|
||||||
|
[64280, 64284], [64434, 64466], [64830, 64847], [64912, 64913], [64968, 65007],
|
||||||
|
[65020, 65135], [65277, 65295], [65306, 65312], [65339, 65344], [65371, 65381],
|
||||||
|
[65471, 65473], [65480, 65481], [65488, 65489], [65496, 65497]];
|
||||||
|
for (i = 0; i < ranges.length; i++) {
|
||||||
|
start = ranges[i][0];
|
||||||
|
end = ranges[i][1];
|
||||||
|
for (j = start; j <= end; j++) {
|
||||||
|
result[j] = true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
})();
|
||||||
|
|
||||||
|
function splitQuery(query) {
|
||||||
|
var result = [];
|
||||||
|
var start = -1;
|
||||||
|
for (var i = 0; i < query.length; i++) {
|
||||||
|
if (splitChars[query.charCodeAt(i)]) {
|
||||||
|
if (start !== -1) {
|
||||||
|
result.push(query.slice(start, i));
|
||||||
|
start = -1;
|
||||||
|
}
|
||||||
|
} else if (start === -1) {
|
||||||
|
start = i;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (start !== -1) {
|
||||||
|
result.push(query.slice(start));
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
BIN
externals/fmt/doc/html/_static/minus.png
vendored
Normal file
BIN
externals/fmt/doc/html/_static/minus.png
vendored
Normal file
Binary file not shown.
After Width: | Height: | Size: 90 B |
BIN
externals/fmt/doc/html/_static/plus.png
vendored
Normal file
BIN
externals/fmt/doc/html/_static/plus.png
vendored
Normal file
Binary file not shown.
After Width: | Height: | Size: 90 B |
74
externals/fmt/doc/html/_static/pygments.css
vendored
Normal file
74
externals/fmt/doc/html/_static/pygments.css
vendored
Normal file
@ -0,0 +1,74 @@
|
|||||||
|
pre { line-height: 125%; }
|
||||||
|
td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; }
|
||||||
|
span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; }
|
||||||
|
td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; }
|
||||||
|
span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; }
|
||||||
|
.highlight .hll { background-color: #ffffcc }
|
||||||
|
.highlight { background: #eeffcc; }
|
||||||
|
.highlight .c { color: #408090; font-style: italic } /* Comment */
|
||||||
|
.highlight .err { border: 1px solid #FF0000 } /* Error */
|
||||||
|
.highlight .k { color: #007020; font-weight: bold } /* Keyword */
|
||||||
|
.highlight .o { color: #666666 } /* Operator */
|
||||||
|
.highlight .ch { color: #408090; font-style: italic } /* Comment.Hashbang */
|
||||||
|
.highlight .cm { color: #408090; font-style: italic } /* Comment.Multiline */
|
||||||
|
.highlight .cp { color: #007020 } /* Comment.Preproc */
|
||||||
|
.highlight .cpf { color: #408090; font-style: italic } /* Comment.PreprocFile */
|
||||||
|
.highlight .c1 { color: #408090; font-style: italic } /* Comment.Single */
|
||||||
|
.highlight .cs { color: #408090; background-color: #fff0f0 } /* Comment.Special */
|
||||||
|
.highlight .gd { color: #A00000 } /* Generic.Deleted */
|
||||||
|
.highlight .ge { font-style: italic } /* Generic.Emph */
|
||||||
|
.highlight .gr { color: #FF0000 } /* Generic.Error */
|
||||||
|
.highlight .gh { color: #000080; font-weight: bold } /* Generic.Heading */
|
||||||
|
.highlight .gi { color: #00A000 } /* Generic.Inserted */
|
||||||
|
.highlight .go { color: #333333 } /* Generic.Output */
|
||||||
|
.highlight .gp { color: #c65d09; font-weight: bold } /* Generic.Prompt */
|
||||||
|
.highlight .gs { font-weight: bold } /* Generic.Strong */
|
||||||
|
.highlight .gu { color: #800080; font-weight: bold } /* Generic.Subheading */
|
||||||
|
.highlight .gt { color: #0044DD } /* Generic.Traceback */
|
||||||
|
.highlight .kc { color: #007020; font-weight: bold } /* Keyword.Constant */
|
||||||
|
.highlight .kd { color: #007020; font-weight: bold } /* Keyword.Declaration */
|
||||||
|
.highlight .kn { color: #007020; font-weight: bold } /* Keyword.Namespace */
|
||||||
|
.highlight .kp { color: #007020 } /* Keyword.Pseudo */
|
||||||
|
.highlight .kr { color: #007020; font-weight: bold } /* Keyword.Reserved */
|
||||||
|
.highlight .kt { color: #902000 } /* Keyword.Type */
|
||||||
|
.highlight .m { color: #208050 } /* Literal.Number */
|
||||||
|
.highlight .s { color: #4070a0 } /* Literal.String */
|
||||||
|
.highlight .na { color: #4070a0 } /* Name.Attribute */
|
||||||
|
.highlight .nb { color: #007020 } /* Name.Builtin */
|
||||||
|
.highlight .nc { color: #0e84b5; font-weight: bold } /* Name.Class */
|
||||||
|
.highlight .no { color: #60add5 } /* Name.Constant */
|
||||||
|
.highlight .nd { color: #555555; font-weight: bold } /* Name.Decorator */
|
||||||
|
.highlight .ni { color: #d55537; font-weight: bold } /* Name.Entity */
|
||||||
|
.highlight .ne { color: #007020 } /* Name.Exception */
|
||||||
|
.highlight .nf { color: #06287e } /* Name.Function */
|
||||||
|
.highlight .nl { color: #002070; font-weight: bold } /* Name.Label */
|
||||||
|
.highlight .nn { color: #0e84b5; font-weight: bold } /* Name.Namespace */
|
||||||
|
.highlight .nt { color: #062873; font-weight: bold } /* Name.Tag */
|
||||||
|
.highlight .nv { color: #bb60d5 } /* Name.Variable */
|
||||||
|
.highlight .ow { color: #007020; font-weight: bold } /* Operator.Word */
|
||||||
|
.highlight .w { color: #bbbbbb } /* Text.Whitespace */
|
||||||
|
.highlight .mb { color: #208050 } /* Literal.Number.Bin */
|
||||||
|
.highlight .mf { color: #208050 } /* Literal.Number.Float */
|
||||||
|
.highlight .mh { color: #208050 } /* Literal.Number.Hex */
|
||||||
|
.highlight .mi { color: #208050 } /* Literal.Number.Integer */
|
||||||
|
.highlight .mo { color: #208050 } /* Literal.Number.Oct */
|
||||||
|
.highlight .sa { color: #4070a0 } /* Literal.String.Affix */
|
||||||
|
.highlight .sb { color: #4070a0 } /* Literal.String.Backtick */
|
||||||
|
.highlight .sc { color: #4070a0 } /* Literal.String.Char */
|
||||||
|
.highlight .dl { color: #4070a0 } /* Literal.String.Delimiter */
|
||||||
|
.highlight .sd { color: #4070a0; font-style: italic } /* Literal.String.Doc */
|
||||||
|
.highlight .s2 { color: #4070a0 } /* Literal.String.Double */
|
||||||
|
.highlight .se { color: #4070a0; font-weight: bold } /* Literal.String.Escape */
|
||||||
|
.highlight .sh { color: #4070a0 } /* Literal.String.Heredoc */
|
||||||
|
.highlight .si { color: #70a0d0; font-style: italic } /* Literal.String.Interpol */
|
||||||
|
.highlight .sx { color: #c65d09 } /* Literal.String.Other */
|
||||||
|
.highlight .sr { color: #235388 } /* Literal.String.Regex */
|
||||||
|
.highlight .s1 { color: #4070a0 } /* Literal.String.Single */
|
||||||
|
.highlight .ss { color: #517918 } /* Literal.String.Symbol */
|
||||||
|
.highlight .bp { color: #007020 } /* Name.Builtin.Pseudo */
|
||||||
|
.highlight .fm { color: #06287e } /* Name.Function.Magic */
|
||||||
|
.highlight .vc { color: #bb60d5 } /* Name.Variable.Class */
|
||||||
|
.highlight .vg { color: #bb60d5 } /* Name.Variable.Global */
|
||||||
|
.highlight .vi { color: #bb60d5 } /* Name.Variable.Instance */
|
||||||
|
.highlight .vm { color: #bb60d5 } /* Name.Variable.Magic */
|
||||||
|
.highlight .il { color: #208050 } /* Literal.Number.Integer.Long */
|
514
externals/fmt/doc/html/_static/searchtools.js
vendored
Normal file
514
externals/fmt/doc/html/_static/searchtools.js
vendored
Normal file
@ -0,0 +1,514 @@
|
|||||||
|
/*
|
||||||
|
* searchtools.js
|
||||||
|
* ~~~~~~~~~~~~~~~~
|
||||||
|
*
|
||||||
|
* Sphinx JavaScript utilities for the full-text search.
|
||||||
|
*
|
||||||
|
* :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS.
|
||||||
|
* :license: BSD, see LICENSE for details.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
|
||||||
|
if (!Scorer) {
|
||||||
|
/**
|
||||||
|
* Simple result scoring code.
|
||||||
|
*/
|
||||||
|
var Scorer = {
|
||||||
|
// Implement the following function to further tweak the score for each result
|
||||||
|
// The function takes a result array [filename, title, anchor, descr, score]
|
||||||
|
// and returns the new score.
|
||||||
|
/*
|
||||||
|
score: function(result) {
|
||||||
|
return result[4];
|
||||||
|
},
|
||||||
|
*/
|
||||||
|
|
||||||
|
// query matches the full name of an object
|
||||||
|
objNameMatch: 11,
|
||||||
|
// or matches in the last dotted part of the object name
|
||||||
|
objPartialMatch: 6,
|
||||||
|
// Additive scores depending on the priority of the object
|
||||||
|
objPrio: {0: 15, // used to be importantResults
|
||||||
|
1: 5, // used to be objectResults
|
||||||
|
2: -5}, // used to be unimportantResults
|
||||||
|
// Used when the priority is not in the mapping.
|
||||||
|
objPrioDefault: 0,
|
||||||
|
|
||||||
|
// query found in title
|
||||||
|
title: 15,
|
||||||
|
partialTitle: 7,
|
||||||
|
// query found in terms
|
||||||
|
term: 5,
|
||||||
|
partialTerm: 2
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!splitQuery) {
|
||||||
|
function splitQuery(query) {
|
||||||
|
return query.split(/\s+/);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Search Module
|
||||||
|
*/
|
||||||
|
var Search = {
|
||||||
|
|
||||||
|
_index : null,
|
||||||
|
_queued_query : null,
|
||||||
|
_pulse_status : -1,
|
||||||
|
|
||||||
|
htmlToText : function(htmlString) {
|
||||||
|
var virtualDocument = document.implementation.createHTMLDocument('virtual');
|
||||||
|
var htmlElement = $(htmlString, virtualDocument);
|
||||||
|
htmlElement.find('.headerlink').remove();
|
||||||
|
docContent = htmlElement.find('[role=main]')[0];
|
||||||
|
if(docContent === undefined) {
|
||||||
|
console.warn("Content block not found. Sphinx search tries to obtain it " +
|
||||||
|
"via '[role=main]'. Could you check your theme or template.");
|
||||||
|
return "";
|
||||||
|
}
|
||||||
|
return docContent.textContent || docContent.innerText;
|
||||||
|
},
|
||||||
|
|
||||||
|
init : function() {
|
||||||
|
var params = $.getQueryParameters();
|
||||||
|
if (params.q) {
|
||||||
|
var query = params.q[0];
|
||||||
|
$('input[name="q"]')[0].value = query;
|
||||||
|
this.performSearch(query);
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
loadIndex : function(url) {
|
||||||
|
$.ajax({type: "GET", url: url, data: null,
|
||||||
|
dataType: "script", cache: true,
|
||||||
|
complete: function(jqxhr, textstatus) {
|
||||||
|
if (textstatus != "success") {
|
||||||
|
document.getElementById("searchindexloader").src = url;
|
||||||
|
}
|
||||||
|
}});
|
||||||
|
},
|
||||||
|
|
||||||
|
setIndex : function(index) {
|
||||||
|
var q;
|
||||||
|
this._index = index;
|
||||||
|
if ((q = this._queued_query) !== null) {
|
||||||
|
this._queued_query = null;
|
||||||
|
Search.query(q);
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
hasIndex : function() {
|
||||||
|
return this._index !== null;
|
||||||
|
},
|
||||||
|
|
||||||
|
deferQuery : function(query) {
|
||||||
|
this._queued_query = query;
|
||||||
|
},
|
||||||
|
|
||||||
|
stopPulse : function() {
|
||||||
|
this._pulse_status = 0;
|
||||||
|
},
|
||||||
|
|
||||||
|
startPulse : function() {
|
||||||
|
if (this._pulse_status >= 0)
|
||||||
|
return;
|
||||||
|
function pulse() {
|
||||||
|
var i;
|
||||||
|
Search._pulse_status = (Search._pulse_status + 1) % 4;
|
||||||
|
var dotString = '';
|
||||||
|
for (i = 0; i < Search._pulse_status; i++)
|
||||||
|
dotString += '.';
|
||||||
|
Search.dots.text(dotString);
|
||||||
|
if (Search._pulse_status > -1)
|
||||||
|
window.setTimeout(pulse, 500);
|
||||||
|
}
|
||||||
|
pulse();
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* perform a search for something (or wait until index is loaded)
|
||||||
|
*/
|
||||||
|
performSearch : function(query) {
|
||||||
|
// create the required interface elements
|
||||||
|
this.out = $('#search-results');
|
||||||
|
this.title = $('<h2>' + _('Searching') + '</h2>').appendTo(this.out);
|
||||||
|
this.dots = $('<span></span>').appendTo(this.title);
|
||||||
|
this.status = $('<p class="search-summary"> </p>').appendTo(this.out);
|
||||||
|
this.output = $('<ul class="search"/>').appendTo(this.out);
|
||||||
|
|
||||||
|
$('#search-progress').text(_('Preparing search...'));
|
||||||
|
this.startPulse();
|
||||||
|
|
||||||
|
// index already loaded, the browser was quick!
|
||||||
|
if (this.hasIndex())
|
||||||
|
this.query(query);
|
||||||
|
else
|
||||||
|
this.deferQuery(query);
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* execute search (requires search index to be loaded)
|
||||||
|
*/
|
||||||
|
query : function(query) {
|
||||||
|
var i;
|
||||||
|
|
||||||
|
// stem the searchterms and add them to the correct list
|
||||||
|
var stemmer = new Stemmer();
|
||||||
|
var searchterms = [];
|
||||||
|
var excluded = [];
|
||||||
|
var hlterms = [];
|
||||||
|
var tmp = splitQuery(query);
|
||||||
|
var objectterms = [];
|
||||||
|
for (i = 0; i < tmp.length; i++) {
|
||||||
|
if (tmp[i] !== "") {
|
||||||
|
objectterms.push(tmp[i].toLowerCase());
|
||||||
|
}
|
||||||
|
|
||||||
|
if ($u.indexOf(stopwords, tmp[i].toLowerCase()) != -1 || tmp[i] === "") {
|
||||||
|
// skip this "word"
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
// stem the word
|
||||||
|
var word = stemmer.stemWord(tmp[i].toLowerCase());
|
||||||
|
// prevent stemmer from cutting word smaller than two chars
|
||||||
|
if(word.length < 3 && tmp[i].length >= 3) {
|
||||||
|
word = tmp[i];
|
||||||
|
}
|
||||||
|
var toAppend;
|
||||||
|
// select the correct list
|
||||||
|
if (word[0] == '-') {
|
||||||
|
toAppend = excluded;
|
||||||
|
word = word.substr(1);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
toAppend = searchterms;
|
||||||
|
hlterms.push(tmp[i].toLowerCase());
|
||||||
|
}
|
||||||
|
// only add if not already in the list
|
||||||
|
if (!$u.contains(toAppend, word))
|
||||||
|
toAppend.push(word);
|
||||||
|
}
|
||||||
|
var highlightstring = '?highlight=' + $.urlencode(hlterms.join(" "));
|
||||||
|
|
||||||
|
// console.debug('SEARCH: searching for:');
|
||||||
|
// console.info('required: ', searchterms);
|
||||||
|
// console.info('excluded: ', excluded);
|
||||||
|
|
||||||
|
// prepare search
|
||||||
|
var terms = this._index.terms;
|
||||||
|
var titleterms = this._index.titleterms;
|
||||||
|
|
||||||
|
// array of [filename, title, anchor, descr, score]
|
||||||
|
var results = [];
|
||||||
|
$('#search-progress').empty();
|
||||||
|
|
||||||
|
// lookup as object
|
||||||
|
for (i = 0; i < objectterms.length; i++) {
|
||||||
|
var others = [].concat(objectterms.slice(0, i),
|
||||||
|
objectterms.slice(i+1, objectterms.length));
|
||||||
|
results = results.concat(this.performObjectSearch(objectterms[i], others));
|
||||||
|
}
|
||||||
|
|
||||||
|
// lookup as search terms in fulltext
|
||||||
|
results = results.concat(this.performTermsSearch(searchterms, excluded, terms, titleterms));
|
||||||
|
|
||||||
|
// let the scorer override scores with a custom scoring function
|
||||||
|
if (Scorer.score) {
|
||||||
|
for (i = 0; i < results.length; i++)
|
||||||
|
results[i][4] = Scorer.score(results[i]);
|
||||||
|
}
|
||||||
|
|
||||||
|
// now sort the results by score (in opposite order of appearance, since the
|
||||||
|
// display function below uses pop() to retrieve items) and then
|
||||||
|
// alphabetically
|
||||||
|
results.sort(function(a, b) {
|
||||||
|
var left = a[4];
|
||||||
|
var right = b[4];
|
||||||
|
if (left > right) {
|
||||||
|
return 1;
|
||||||
|
} else if (left < right) {
|
||||||
|
return -1;
|
||||||
|
} else {
|
||||||
|
// same score: sort alphabetically
|
||||||
|
left = a[1].toLowerCase();
|
||||||
|
right = b[1].toLowerCase();
|
||||||
|
return (left > right) ? -1 : ((left < right) ? 1 : 0);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
// for debugging
|
||||||
|
//Search.lastresults = results.slice(); // a copy
|
||||||
|
//console.info('search results:', Search.lastresults);
|
||||||
|
|
||||||
|
// print the results
|
||||||
|
var resultCount = results.length;
|
||||||
|
function displayNextItem() {
|
||||||
|
// results left, load the summary and display it
|
||||||
|
if (results.length) {
|
||||||
|
var item = results.pop();
|
||||||
|
var listItem = $('<li style="display:none"></li>');
|
||||||
|
var requestUrl = "";
|
||||||
|
var linkUrl = "";
|
||||||
|
if (DOCUMENTATION_OPTIONS.BUILDER === 'dirhtml') {
|
||||||
|
// dirhtml builder
|
||||||
|
var dirname = item[0] + '/';
|
||||||
|
if (dirname.match(/\/index\/$/)) {
|
||||||
|
dirname = dirname.substring(0, dirname.length-6);
|
||||||
|
} else if (dirname == 'index/') {
|
||||||
|
dirname = '';
|
||||||
|
}
|
||||||
|
requestUrl = DOCUMENTATION_OPTIONS.URL_ROOT + dirname;
|
||||||
|
linkUrl = requestUrl;
|
||||||
|
|
||||||
|
} else {
|
||||||
|
// normal html builders
|
||||||
|
requestUrl = DOCUMENTATION_OPTIONS.URL_ROOT + item[0] + DOCUMENTATION_OPTIONS.FILE_SUFFIX;
|
||||||
|
linkUrl = item[0] + DOCUMENTATION_OPTIONS.LINK_SUFFIX;
|
||||||
|
}
|
||||||
|
listItem.append($('<a/>').attr('href',
|
||||||
|
linkUrl +
|
||||||
|
highlightstring + item[2]).html(item[1]));
|
||||||
|
if (item[3]) {
|
||||||
|
listItem.append($('<span> (' + item[3] + ')</span>'));
|
||||||
|
Search.output.append(listItem);
|
||||||
|
listItem.slideDown(5, function() {
|
||||||
|
displayNextItem();
|
||||||
|
});
|
||||||
|
} else if (DOCUMENTATION_OPTIONS.HAS_SOURCE) {
|
||||||
|
$.ajax({url: requestUrl,
|
||||||
|
dataType: "text",
|
||||||
|
complete: function(jqxhr, textstatus) {
|
||||||
|
var data = jqxhr.responseText;
|
||||||
|
if (data !== '' && data !== undefined) {
|
||||||
|
listItem.append(Search.makeSearchSummary(data, searchterms, hlterms));
|
||||||
|
}
|
||||||
|
Search.output.append(listItem);
|
||||||
|
listItem.slideDown(5, function() {
|
||||||
|
displayNextItem();
|
||||||
|
});
|
||||||
|
}});
|
||||||
|
} else {
|
||||||
|
// no source available, just display title
|
||||||
|
Search.output.append(listItem);
|
||||||
|
listItem.slideDown(5, function() {
|
||||||
|
displayNextItem();
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// search finished, update title and status message
|
||||||
|
else {
|
||||||
|
Search.stopPulse();
|
||||||
|
Search.title.text(_('Search Results'));
|
||||||
|
if (!resultCount)
|
||||||
|
Search.status.text(_('Your search did not match any documents. Please make sure that all words are spelled correctly and that you\'ve selected enough categories.'));
|
||||||
|
else
|
||||||
|
Search.status.text(_('Search finished, found %s page(s) matching the search query.').replace('%s', resultCount));
|
||||||
|
Search.status.fadeIn(500);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
displayNextItem();
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* search for object names
|
||||||
|
*/
|
||||||
|
performObjectSearch : function(object, otherterms) {
|
||||||
|
var filenames = this._index.filenames;
|
||||||
|
var docnames = this._index.docnames;
|
||||||
|
var objects = this._index.objects;
|
||||||
|
var objnames = this._index.objnames;
|
||||||
|
var titles = this._index.titles;
|
||||||
|
|
||||||
|
var i;
|
||||||
|
var results = [];
|
||||||
|
|
||||||
|
for (var prefix in objects) {
|
||||||
|
for (var name in objects[prefix]) {
|
||||||
|
var fullname = (prefix ? prefix + '.' : '') + name;
|
||||||
|
var fullnameLower = fullname.toLowerCase()
|
||||||
|
if (fullnameLower.indexOf(object) > -1) {
|
||||||
|
var score = 0;
|
||||||
|
var parts = fullnameLower.split('.');
|
||||||
|
// check for different match types: exact matches of full name or
|
||||||
|
// "last name" (i.e. last dotted part)
|
||||||
|
if (fullnameLower == object || parts[parts.length - 1] == object) {
|
||||||
|
score += Scorer.objNameMatch;
|
||||||
|
// matches in last name
|
||||||
|
} else if (parts[parts.length - 1].indexOf(object) > -1) {
|
||||||
|
score += Scorer.objPartialMatch;
|
||||||
|
}
|
||||||
|
var match = objects[prefix][name];
|
||||||
|
var objname = objnames[match[1]][2];
|
||||||
|
var title = titles[match[0]];
|
||||||
|
// If more than one term searched for, we require other words to be
|
||||||
|
// found in the name/title/description
|
||||||
|
if (otherterms.length > 0) {
|
||||||
|
var haystack = (prefix + ' ' + name + ' ' +
|
||||||
|
objname + ' ' + title).toLowerCase();
|
||||||
|
var allfound = true;
|
||||||
|
for (i = 0; i < otherterms.length; i++) {
|
||||||
|
if (haystack.indexOf(otherterms[i]) == -1) {
|
||||||
|
allfound = false;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (!allfound) {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
var descr = objname + _(', in ') + title;
|
||||||
|
|
||||||
|
var anchor = match[3];
|
||||||
|
if (anchor === '')
|
||||||
|
anchor = fullname;
|
||||||
|
else if (anchor == '-')
|
||||||
|
anchor = objnames[match[1]][1] + '-' + fullname;
|
||||||
|
// add custom score for some objects according to scorer
|
||||||
|
if (Scorer.objPrio.hasOwnProperty(match[2])) {
|
||||||
|
score += Scorer.objPrio[match[2]];
|
||||||
|
} else {
|
||||||
|
score += Scorer.objPrioDefault;
|
||||||
|
}
|
||||||
|
results.push([docnames[match[0]], fullname, '#'+anchor, descr, score, filenames[match[0]]]);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return results;
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* search for full-text terms in the index
|
||||||
|
*/
|
||||||
|
performTermsSearch : function(searchterms, excluded, terms, titleterms) {
|
||||||
|
var docnames = this._index.docnames;
|
||||||
|
var filenames = this._index.filenames;
|
||||||
|
var titles = this._index.titles;
|
||||||
|
|
||||||
|
var i, j, file;
|
||||||
|
var fileMap = {};
|
||||||
|
var scoreMap = {};
|
||||||
|
var results = [];
|
||||||
|
|
||||||
|
// perform the search on the required terms
|
||||||
|
for (i = 0; i < searchterms.length; i++) {
|
||||||
|
var word = searchterms[i];
|
||||||
|
var files = [];
|
||||||
|
var _o = [
|
||||||
|
{files: terms[word], score: Scorer.term},
|
||||||
|
{files: titleterms[word], score: Scorer.title}
|
||||||
|
];
|
||||||
|
// add support for partial matches
|
||||||
|
if (word.length > 2) {
|
||||||
|
for (var w in terms) {
|
||||||
|
if (w.match(word) && !terms[word]) {
|
||||||
|
_o.push({files: terms[w], score: Scorer.partialTerm})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
for (var w in titleterms) {
|
||||||
|
if (w.match(word) && !titleterms[word]) {
|
||||||
|
_o.push({files: titleterms[w], score: Scorer.partialTitle})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// no match but word was a required one
|
||||||
|
if ($u.every(_o, function(o){return o.files === undefined;})) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
// found search word in contents
|
||||||
|
$u.each(_o, function(o) {
|
||||||
|
var _files = o.files;
|
||||||
|
if (_files === undefined)
|
||||||
|
return
|
||||||
|
|
||||||
|
if (_files.length === undefined)
|
||||||
|
_files = [_files];
|
||||||
|
files = files.concat(_files);
|
||||||
|
|
||||||
|
// set score for the word in each file to Scorer.term
|
||||||
|
for (j = 0; j < _files.length; j++) {
|
||||||
|
file = _files[j];
|
||||||
|
if (!(file in scoreMap))
|
||||||
|
scoreMap[file] = {};
|
||||||
|
scoreMap[file][word] = o.score;
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
// create the mapping
|
||||||
|
for (j = 0; j < files.length; j++) {
|
||||||
|
file = files[j];
|
||||||
|
if (file in fileMap && fileMap[file].indexOf(word) === -1)
|
||||||
|
fileMap[file].push(word);
|
||||||
|
else
|
||||||
|
fileMap[file] = [word];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// now check if the files don't contain excluded terms
|
||||||
|
for (file in fileMap) {
|
||||||
|
var valid = true;
|
||||||
|
|
||||||
|
// check if all requirements are matched
|
||||||
|
var filteredTermCount = // as search terms with length < 3 are discarded: ignore
|
||||||
|
searchterms.filter(function(term){return term.length > 2}).length
|
||||||
|
if (
|
||||||
|
fileMap[file].length != searchterms.length &&
|
||||||
|
fileMap[file].length != filteredTermCount
|
||||||
|
) continue;
|
||||||
|
|
||||||
|
// ensure that none of the excluded terms is in the search result
|
||||||
|
for (i = 0; i < excluded.length; i++) {
|
||||||
|
if (terms[excluded[i]] == file ||
|
||||||
|
titleterms[excluded[i]] == file ||
|
||||||
|
$u.contains(terms[excluded[i]] || [], file) ||
|
||||||
|
$u.contains(titleterms[excluded[i]] || [], file)) {
|
||||||
|
valid = false;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// if we have still a valid result we can add it to the result list
|
||||||
|
if (valid) {
|
||||||
|
// select one (max) score for the file.
|
||||||
|
// for better ranking, we should calculate ranking by using words statistics like basic tf-idf...
|
||||||
|
var score = $u.max($u.map(fileMap[file], function(w){return scoreMap[file][w]}));
|
||||||
|
results.push([docnames[file], titles[file], '', null, score, filenames[file]]);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return results;
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* helper function to return a node containing the
|
||||||
|
* search summary for a given text. keywords is a list
|
||||||
|
* of stemmed words, hlwords is the list of normal, unstemmed
|
||||||
|
* words. the first one is used to find the occurrence, the
|
||||||
|
* latter for highlighting it.
|
||||||
|
*/
|
||||||
|
makeSearchSummary : function(htmlText, keywords, hlwords) {
|
||||||
|
var text = Search.htmlToText(htmlText);
|
||||||
|
var textLower = text.toLowerCase();
|
||||||
|
var start = 0;
|
||||||
|
$.each(keywords, function() {
|
||||||
|
var i = textLower.indexOf(this.toLowerCase());
|
||||||
|
if (i > -1)
|
||||||
|
start = i;
|
||||||
|
});
|
||||||
|
start = Math.max(start - 120, 0);
|
||||||
|
var excerpt = ((start > 0) ? '...' : '') +
|
||||||
|
$.trim(text.substr(start, 240)) +
|
||||||
|
((start + 240 - text.length) ? '...' : '');
|
||||||
|
var rv = $('<div class="context"></div>').text(excerpt);
|
||||||
|
$.each(hlwords, function() {
|
||||||
|
rv = rv.highlightText(this, 'highlighted');
|
||||||
|
});
|
||||||
|
return rv;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
$(document).ready(function() {
|
||||||
|
Search.init();
|
||||||
|
});
|
999
externals/fmt/doc/html/_static/underscore-1.3.1.js
vendored
Normal file
999
externals/fmt/doc/html/_static/underscore-1.3.1.js
vendored
Normal file
@ -0,0 +1,999 @@
|
|||||||
|
// Underscore.js 1.3.1
|
||||||
|
// (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc.
|
||||||
|
// Underscore is freely distributable under the MIT license.
|
||||||
|
// Portions of Underscore are inspired or borrowed from Prototype,
|
||||||
|
// Oliver Steele's Functional, and John Resig's Micro-Templating.
|
||||||
|
// For all details and documentation:
|
||||||
|
// http://documentcloud.github.com/underscore
|
||||||
|
|
||||||
|
(function() {
|
||||||
|
|
||||||
|
// Baseline setup
|
||||||
|
// --------------
|
||||||
|
|
||||||
|
// Establish the root object, `window` in the browser, or `global` on the server.
|
||||||
|
var root = this;
|
||||||
|
|
||||||
|
// Save the previous value of the `_` variable.
|
||||||
|
var previousUnderscore = root._;
|
||||||
|
|
||||||
|
// Establish the object that gets returned to break out of a loop iteration.
|
||||||
|
var breaker = {};
|
||||||
|
|
||||||
|
// Save bytes in the minified (but not gzipped) version:
|
||||||
|
var ArrayProto = Array.prototype, ObjProto = Object.prototype, FuncProto = Function.prototype;
|
||||||
|
|
||||||
|
// Create quick reference variables for speed access to core prototypes.
|
||||||
|
var slice = ArrayProto.slice,
|
||||||
|
unshift = ArrayProto.unshift,
|
||||||
|
toString = ObjProto.toString,
|
||||||
|
hasOwnProperty = ObjProto.hasOwnProperty;
|
||||||
|
|
||||||
|
// All **ECMAScript 5** native function implementations that we hope to use
|
||||||
|
// are declared here.
|
||||||
|
var
|
||||||
|
nativeForEach = ArrayProto.forEach,
|
||||||
|
nativeMap = ArrayProto.map,
|
||||||
|
nativeReduce = ArrayProto.reduce,
|
||||||
|
nativeReduceRight = ArrayProto.reduceRight,
|
||||||
|
nativeFilter = ArrayProto.filter,
|
||||||
|
nativeEvery = ArrayProto.every,
|
||||||
|
nativeSome = ArrayProto.some,
|
||||||
|
nativeIndexOf = ArrayProto.indexOf,
|
||||||
|
nativeLastIndexOf = ArrayProto.lastIndexOf,
|
||||||
|
nativeIsArray = Array.isArray,
|
||||||
|
nativeKeys = Object.keys,
|
||||||
|
nativeBind = FuncProto.bind;
|
||||||
|
|
||||||
|
// Create a safe reference to the Underscore object for use below.
|
||||||
|
var _ = function(obj) { return new wrapper(obj); };
|
||||||
|
|
||||||
|
// Export the Underscore object for **Node.js**, with
|
||||||
|
// backwards-compatibility for the old `require()` API. If we're in
|
||||||
|
// the browser, add `_` as a global object via a string identifier,
|
||||||
|
// for Closure Compiler "advanced" mode.
|
||||||
|
if (typeof exports !== 'undefined') {
|
||||||
|
if (typeof module !== 'undefined' && module.exports) {
|
||||||
|
exports = module.exports = _;
|
||||||
|
}
|
||||||
|
exports._ = _;
|
||||||
|
} else {
|
||||||
|
root['_'] = _;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Current version.
|
||||||
|
_.VERSION = '1.3.1';
|
||||||
|
|
||||||
|
// Collection Functions
|
||||||
|
// --------------------
|
||||||
|
|
||||||
|
// The cornerstone, an `each` implementation, aka `forEach`.
|
||||||
|
// Handles objects with the built-in `forEach`, arrays, and raw objects.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `forEach` if available.
|
||||||
|
var each = _.each = _.forEach = function(obj, iterator, context) {
|
||||||
|
if (obj == null) return;
|
||||||
|
if (nativeForEach && obj.forEach === nativeForEach) {
|
||||||
|
obj.forEach(iterator, context);
|
||||||
|
} else if (obj.length === +obj.length) {
|
||||||
|
for (var i = 0, l = obj.length; i < l; i++) {
|
||||||
|
if (i in obj && iterator.call(context, obj[i], i, obj) === breaker) return;
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
for (var key in obj) {
|
||||||
|
if (_.has(obj, key)) {
|
||||||
|
if (iterator.call(context, obj[key], key, obj) === breaker) return;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return the results of applying the iterator to each element.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `map` if available.
|
||||||
|
_.map = _.collect = function(obj, iterator, context) {
|
||||||
|
var results = [];
|
||||||
|
if (obj == null) return results;
|
||||||
|
if (nativeMap && obj.map === nativeMap) return obj.map(iterator, context);
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
results[results.length] = iterator.call(context, value, index, list);
|
||||||
|
});
|
||||||
|
if (obj.length === +obj.length) results.length = obj.length;
|
||||||
|
return results;
|
||||||
|
};
|
||||||
|
|
||||||
|
// **Reduce** builds up a single result from a list of values, aka `inject`,
|
||||||
|
// or `foldl`. Delegates to **ECMAScript 5**'s native `reduce` if available.
|
||||||
|
_.reduce = _.foldl = _.inject = function(obj, iterator, memo, context) {
|
||||||
|
var initial = arguments.length > 2;
|
||||||
|
if (obj == null) obj = [];
|
||||||
|
if (nativeReduce && obj.reduce === nativeReduce) {
|
||||||
|
if (context) iterator = _.bind(iterator, context);
|
||||||
|
return initial ? obj.reduce(iterator, memo) : obj.reduce(iterator);
|
||||||
|
}
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
if (!initial) {
|
||||||
|
memo = value;
|
||||||
|
initial = true;
|
||||||
|
} else {
|
||||||
|
memo = iterator.call(context, memo, value, index, list);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
if (!initial) throw new TypeError('Reduce of empty array with no initial value');
|
||||||
|
return memo;
|
||||||
|
};
|
||||||
|
|
||||||
|
// The right-associative version of reduce, also known as `foldr`.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `reduceRight` if available.
|
||||||
|
_.reduceRight = _.foldr = function(obj, iterator, memo, context) {
|
||||||
|
var initial = arguments.length > 2;
|
||||||
|
if (obj == null) obj = [];
|
||||||
|
if (nativeReduceRight && obj.reduceRight === nativeReduceRight) {
|
||||||
|
if (context) iterator = _.bind(iterator, context);
|
||||||
|
return initial ? obj.reduceRight(iterator, memo) : obj.reduceRight(iterator);
|
||||||
|
}
|
||||||
|
var reversed = _.toArray(obj).reverse();
|
||||||
|
if (context && !initial) iterator = _.bind(iterator, context);
|
||||||
|
return initial ? _.reduce(reversed, iterator, memo, context) : _.reduce(reversed, iterator);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return the first value which passes a truth test. Aliased as `detect`.
|
||||||
|
_.find = _.detect = function(obj, iterator, context) {
|
||||||
|
var result;
|
||||||
|
any(obj, function(value, index, list) {
|
||||||
|
if (iterator.call(context, value, index, list)) {
|
||||||
|
result = value;
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
});
|
||||||
|
return result;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return all the elements that pass a truth test.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `filter` if available.
|
||||||
|
// Aliased as `select`.
|
||||||
|
_.filter = _.select = function(obj, iterator, context) {
|
||||||
|
var results = [];
|
||||||
|
if (obj == null) return results;
|
||||||
|
if (nativeFilter && obj.filter === nativeFilter) return obj.filter(iterator, context);
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
if (iterator.call(context, value, index, list)) results[results.length] = value;
|
||||||
|
});
|
||||||
|
return results;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return all the elements for which a truth test fails.
|
||||||
|
_.reject = function(obj, iterator, context) {
|
||||||
|
var results = [];
|
||||||
|
if (obj == null) return results;
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
if (!iterator.call(context, value, index, list)) results[results.length] = value;
|
||||||
|
});
|
||||||
|
return results;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Determine whether all of the elements match a truth test.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `every` if available.
|
||||||
|
// Aliased as `all`.
|
||||||
|
_.every = _.all = function(obj, iterator, context) {
|
||||||
|
var result = true;
|
||||||
|
if (obj == null) return result;
|
||||||
|
if (nativeEvery && obj.every === nativeEvery) return obj.every(iterator, context);
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
if (!(result = result && iterator.call(context, value, index, list))) return breaker;
|
||||||
|
});
|
||||||
|
return result;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Determine if at least one element in the object matches a truth test.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `some` if available.
|
||||||
|
// Aliased as `any`.
|
||||||
|
var any = _.some = _.any = function(obj, iterator, context) {
|
||||||
|
iterator || (iterator = _.identity);
|
||||||
|
var result = false;
|
||||||
|
if (obj == null) return result;
|
||||||
|
if (nativeSome && obj.some === nativeSome) return obj.some(iterator, context);
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
if (result || (result = iterator.call(context, value, index, list))) return breaker;
|
||||||
|
});
|
||||||
|
return !!result;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Determine if a given value is included in the array or object using `===`.
|
||||||
|
// Aliased as `contains`.
|
||||||
|
_.include = _.contains = function(obj, target) {
|
||||||
|
var found = false;
|
||||||
|
if (obj == null) return found;
|
||||||
|
if (nativeIndexOf && obj.indexOf === nativeIndexOf) return obj.indexOf(target) != -1;
|
||||||
|
found = any(obj, function(value) {
|
||||||
|
return value === target;
|
||||||
|
});
|
||||||
|
return found;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Invoke a method (with arguments) on every item in a collection.
|
||||||
|
_.invoke = function(obj, method) {
|
||||||
|
var args = slice.call(arguments, 2);
|
||||||
|
return _.map(obj, function(value) {
|
||||||
|
return (_.isFunction(method) ? method || value : value[method]).apply(value, args);
|
||||||
|
});
|
||||||
|
};
|
||||||
|
|
||||||
|
// Convenience version of a common use case of `map`: fetching a property.
|
||||||
|
_.pluck = function(obj, key) {
|
||||||
|
return _.map(obj, function(value){ return value[key]; });
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return the maximum element or (element-based computation).
|
||||||
|
_.max = function(obj, iterator, context) {
|
||||||
|
if (!iterator && _.isArray(obj)) return Math.max.apply(Math, obj);
|
||||||
|
if (!iterator && _.isEmpty(obj)) return -Infinity;
|
||||||
|
var result = {computed : -Infinity};
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
var computed = iterator ? iterator.call(context, value, index, list) : value;
|
||||||
|
computed >= result.computed && (result = {value : value, computed : computed});
|
||||||
|
});
|
||||||
|
return result.value;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return the minimum element (or element-based computation).
|
||||||
|
_.min = function(obj, iterator, context) {
|
||||||
|
if (!iterator && _.isArray(obj)) return Math.min.apply(Math, obj);
|
||||||
|
if (!iterator && _.isEmpty(obj)) return Infinity;
|
||||||
|
var result = {computed : Infinity};
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
var computed = iterator ? iterator.call(context, value, index, list) : value;
|
||||||
|
computed < result.computed && (result = {value : value, computed : computed});
|
||||||
|
});
|
||||||
|
return result.value;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Shuffle an array.
|
||||||
|
_.shuffle = function(obj) {
|
||||||
|
var shuffled = [], rand;
|
||||||
|
each(obj, function(value, index, list) {
|
||||||
|
if (index == 0) {
|
||||||
|
shuffled[0] = value;
|
||||||
|
} else {
|
||||||
|
rand = Math.floor(Math.random() * (index + 1));
|
||||||
|
shuffled[index] = shuffled[rand];
|
||||||
|
shuffled[rand] = value;
|
||||||
|
}
|
||||||
|
});
|
||||||
|
return shuffled;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Sort the object's values by a criterion produced by an iterator.
|
||||||
|
_.sortBy = function(obj, iterator, context) {
|
||||||
|
return _.pluck(_.map(obj, function(value, index, list) {
|
||||||
|
return {
|
||||||
|
value : value,
|
||||||
|
criteria : iterator.call(context, value, index, list)
|
||||||
|
};
|
||||||
|
}).sort(function(left, right) {
|
||||||
|
var a = left.criteria, b = right.criteria;
|
||||||
|
return a < b ? -1 : a > b ? 1 : 0;
|
||||||
|
}), 'value');
|
||||||
|
};
|
||||||
|
|
||||||
|
// Groups the object's values by a criterion. Pass either a string attribute
|
||||||
|
// to group by, or a function that returns the criterion.
|
||||||
|
_.groupBy = function(obj, val) {
|
||||||
|
var result = {};
|
||||||
|
var iterator = _.isFunction(val) ? val : function(obj) { return obj[val]; };
|
||||||
|
each(obj, function(value, index) {
|
||||||
|
var key = iterator(value, index);
|
||||||
|
(result[key] || (result[key] = [])).push(value);
|
||||||
|
});
|
||||||
|
return result;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Use a comparator function to figure out at what index an object should
|
||||||
|
// be inserted so as to maintain order. Uses binary search.
|
||||||
|
_.sortedIndex = function(array, obj, iterator) {
|
||||||
|
iterator || (iterator = _.identity);
|
||||||
|
var low = 0, high = array.length;
|
||||||
|
while (low < high) {
|
||||||
|
var mid = (low + high) >> 1;
|
||||||
|
iterator(array[mid]) < iterator(obj) ? low = mid + 1 : high = mid;
|
||||||
|
}
|
||||||
|
return low;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Safely convert anything iterable into a real, live array.
|
||||||
|
_.toArray = function(iterable) {
|
||||||
|
if (!iterable) return [];
|
||||||
|
if (iterable.toArray) return iterable.toArray();
|
||||||
|
if (_.isArray(iterable)) return slice.call(iterable);
|
||||||
|
if (_.isArguments(iterable)) return slice.call(iterable);
|
||||||
|
return _.values(iterable);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return the number of elements in an object.
|
||||||
|
_.size = function(obj) {
|
||||||
|
return _.toArray(obj).length;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Array Functions
|
||||||
|
// ---------------
|
||||||
|
|
||||||
|
// Get the first element of an array. Passing **n** will return the first N
|
||||||
|
// values in the array. Aliased as `head`. The **guard** check allows it to work
|
||||||
|
// with `_.map`.
|
||||||
|
_.first = _.head = function(array, n, guard) {
|
||||||
|
return (n != null) && !guard ? slice.call(array, 0, n) : array[0];
|
||||||
|
};
|
||||||
|
|
||||||
|
// Returns everything but the last entry of the array. Especcialy useful on
|
||||||
|
// the arguments object. Passing **n** will return all the values in
|
||||||
|
// the array, excluding the last N. The **guard** check allows it to work with
|
||||||
|
// `_.map`.
|
||||||
|
_.initial = function(array, n, guard) {
|
||||||
|
return slice.call(array, 0, array.length - ((n == null) || guard ? 1 : n));
|
||||||
|
};
|
||||||
|
|
||||||
|
// Get the last element of an array. Passing **n** will return the last N
|
||||||
|
// values in the array. The **guard** check allows it to work with `_.map`.
|
||||||
|
_.last = function(array, n, guard) {
|
||||||
|
if ((n != null) && !guard) {
|
||||||
|
return slice.call(array, Math.max(array.length - n, 0));
|
||||||
|
} else {
|
||||||
|
return array[array.length - 1];
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// Returns everything but the first entry of the array. Aliased as `tail`.
|
||||||
|
// Especially useful on the arguments object. Passing an **index** will return
|
||||||
|
// the rest of the values in the array from that index onward. The **guard**
|
||||||
|
// check allows it to work with `_.map`.
|
||||||
|
_.rest = _.tail = function(array, index, guard) {
|
||||||
|
return slice.call(array, (index == null) || guard ? 1 : index);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Trim out all falsy values from an array.
|
||||||
|
_.compact = function(array) {
|
||||||
|
return _.filter(array, function(value){ return !!value; });
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return a completely flattened version of an array.
|
||||||
|
_.flatten = function(array, shallow) {
|
||||||
|
return _.reduce(array, function(memo, value) {
|
||||||
|
if (_.isArray(value)) return memo.concat(shallow ? value : _.flatten(value));
|
||||||
|
memo[memo.length] = value;
|
||||||
|
return memo;
|
||||||
|
}, []);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return a version of the array that does not contain the specified value(s).
|
||||||
|
_.without = function(array) {
|
||||||
|
return _.difference(array, slice.call(arguments, 1));
|
||||||
|
};
|
||||||
|
|
||||||
|
// Produce a duplicate-free version of the array. If the array has already
|
||||||
|
// been sorted, you have the option of using a faster algorithm.
|
||||||
|
// Aliased as `unique`.
|
||||||
|
_.uniq = _.unique = function(array, isSorted, iterator) {
|
||||||
|
var initial = iterator ? _.map(array, iterator) : array;
|
||||||
|
var result = [];
|
||||||
|
_.reduce(initial, function(memo, el, i) {
|
||||||
|
if (0 == i || (isSorted === true ? _.last(memo) != el : !_.include(memo, el))) {
|
||||||
|
memo[memo.length] = el;
|
||||||
|
result[result.length] = array[i];
|
||||||
|
}
|
||||||
|
return memo;
|
||||||
|
}, []);
|
||||||
|
return result;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Produce an array that contains the union: each distinct element from all of
|
||||||
|
// the passed-in arrays.
|
||||||
|
_.union = function() {
|
||||||
|
return _.uniq(_.flatten(arguments, true));
|
||||||
|
};
|
||||||
|
|
||||||
|
// Produce an array that contains every item shared between all the
|
||||||
|
// passed-in arrays. (Aliased as "intersect" for back-compat.)
|
||||||
|
_.intersection = _.intersect = function(array) {
|
||||||
|
var rest = slice.call(arguments, 1);
|
||||||
|
return _.filter(_.uniq(array), function(item) {
|
||||||
|
return _.every(rest, function(other) {
|
||||||
|
return _.indexOf(other, item) >= 0;
|
||||||
|
});
|
||||||
|
});
|
||||||
|
};
|
||||||
|
|
||||||
|
// Take the difference between one array and a number of other arrays.
|
||||||
|
// Only the elements present in just the first array will remain.
|
||||||
|
_.difference = function(array) {
|
||||||
|
var rest = _.flatten(slice.call(arguments, 1));
|
||||||
|
return _.filter(array, function(value){ return !_.include(rest, value); });
|
||||||
|
};
|
||||||
|
|
||||||
|
// Zip together multiple lists into a single array -- elements that share
|
||||||
|
// an index go together.
|
||||||
|
_.zip = function() {
|
||||||
|
var args = slice.call(arguments);
|
||||||
|
var length = _.max(_.pluck(args, 'length'));
|
||||||
|
var results = new Array(length);
|
||||||
|
for (var i = 0; i < length; i++) results[i] = _.pluck(args, "" + i);
|
||||||
|
return results;
|
||||||
|
};
|
||||||
|
|
||||||
|
// If the browser doesn't supply us with indexOf (I'm looking at you, **MSIE**),
|
||||||
|
// we need this function. Return the position of the first occurrence of an
|
||||||
|
// item in an array, or -1 if the item is not included in the array.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `indexOf` if available.
|
||||||
|
// If the array is large and already in sort order, pass `true`
|
||||||
|
// for **isSorted** to use binary search.
|
||||||
|
_.indexOf = function(array, item, isSorted) {
|
||||||
|
if (array == null) return -1;
|
||||||
|
var i, l;
|
||||||
|
if (isSorted) {
|
||||||
|
i = _.sortedIndex(array, item);
|
||||||
|
return array[i] === item ? i : -1;
|
||||||
|
}
|
||||||
|
if (nativeIndexOf && array.indexOf === nativeIndexOf) return array.indexOf(item);
|
||||||
|
for (i = 0, l = array.length; i < l; i++) if (i in array && array[i] === item) return i;
|
||||||
|
return -1;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Delegates to **ECMAScript 5**'s native `lastIndexOf` if available.
|
||||||
|
_.lastIndexOf = function(array, item) {
|
||||||
|
if (array == null) return -1;
|
||||||
|
if (nativeLastIndexOf && array.lastIndexOf === nativeLastIndexOf) return array.lastIndexOf(item);
|
||||||
|
var i = array.length;
|
||||||
|
while (i--) if (i in array && array[i] === item) return i;
|
||||||
|
return -1;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Generate an integer Array containing an arithmetic progression. A port of
|
||||||
|
// the native Python `range()` function. See
|
||||||
|
// [the Python documentation](http://docs.python.org/library/functions.html#range).
|
||||||
|
_.range = function(start, stop, step) {
|
||||||
|
if (arguments.length <= 1) {
|
||||||
|
stop = start || 0;
|
||||||
|
start = 0;
|
||||||
|
}
|
||||||
|
step = arguments[2] || 1;
|
||||||
|
|
||||||
|
var len = Math.max(Math.ceil((stop - start) / step), 0);
|
||||||
|
var idx = 0;
|
||||||
|
var range = new Array(len);
|
||||||
|
|
||||||
|
while(idx < len) {
|
||||||
|
range[idx++] = start;
|
||||||
|
start += step;
|
||||||
|
}
|
||||||
|
|
||||||
|
return range;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Function (ahem) Functions
|
||||||
|
// ------------------
|
||||||
|
|
||||||
|
// Reusable constructor function for prototype setting.
|
||||||
|
var ctor = function(){};
|
||||||
|
|
||||||
|
// Create a function bound to a given object (assigning `this`, and arguments,
|
||||||
|
// optionally). Binding with arguments is also known as `curry`.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `Function.bind` if available.
|
||||||
|
// We check for `func.bind` first, to fail fast when `func` is undefined.
|
||||||
|
_.bind = function bind(func, context) {
|
||||||
|
var bound, args;
|
||||||
|
if (func.bind === nativeBind && nativeBind) return nativeBind.apply(func, slice.call(arguments, 1));
|
||||||
|
if (!_.isFunction(func)) throw new TypeError;
|
||||||
|
args = slice.call(arguments, 2);
|
||||||
|
return bound = function() {
|
||||||
|
if (!(this instanceof bound)) return func.apply(context, args.concat(slice.call(arguments)));
|
||||||
|
ctor.prototype = func.prototype;
|
||||||
|
var self = new ctor;
|
||||||
|
var result = func.apply(self, args.concat(slice.call(arguments)));
|
||||||
|
if (Object(result) === result) return result;
|
||||||
|
return self;
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Bind all of an object's methods to that object. Useful for ensuring that
|
||||||
|
// all callbacks defined on an object belong to it.
|
||||||
|
_.bindAll = function(obj) {
|
||||||
|
var funcs = slice.call(arguments, 1);
|
||||||
|
if (funcs.length == 0) funcs = _.functions(obj);
|
||||||
|
each(funcs, function(f) { obj[f] = _.bind(obj[f], obj); });
|
||||||
|
return obj;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Memoize an expensive function by storing its results.
|
||||||
|
_.memoize = function(func, hasher) {
|
||||||
|
var memo = {};
|
||||||
|
hasher || (hasher = _.identity);
|
||||||
|
return function() {
|
||||||
|
var key = hasher.apply(this, arguments);
|
||||||
|
return _.has(memo, key) ? memo[key] : (memo[key] = func.apply(this, arguments));
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Delays a function for the given number of milliseconds, and then calls
|
||||||
|
// it with the arguments supplied.
|
||||||
|
_.delay = function(func, wait) {
|
||||||
|
var args = slice.call(arguments, 2);
|
||||||
|
return setTimeout(function(){ return func.apply(func, args); }, wait);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Defers a function, scheduling it to run after the current call stack has
|
||||||
|
// cleared.
|
||||||
|
_.defer = function(func) {
|
||||||
|
return _.delay.apply(_, [func, 1].concat(slice.call(arguments, 1)));
|
||||||
|
};
|
||||||
|
|
||||||
|
// Returns a function, that, when invoked, will only be triggered at most once
|
||||||
|
// during a given window of time.
|
||||||
|
_.throttle = function(func, wait) {
|
||||||
|
var context, args, timeout, throttling, more;
|
||||||
|
var whenDone = _.debounce(function(){ more = throttling = false; }, wait);
|
||||||
|
return function() {
|
||||||
|
context = this; args = arguments;
|
||||||
|
var later = function() {
|
||||||
|
timeout = null;
|
||||||
|
if (more) func.apply(context, args);
|
||||||
|
whenDone();
|
||||||
|
};
|
||||||
|
if (!timeout) timeout = setTimeout(later, wait);
|
||||||
|
if (throttling) {
|
||||||
|
more = true;
|
||||||
|
} else {
|
||||||
|
func.apply(context, args);
|
||||||
|
}
|
||||||
|
whenDone();
|
||||||
|
throttling = true;
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Returns a function, that, as long as it continues to be invoked, will not
|
||||||
|
// be triggered. The function will be called after it stops being called for
|
||||||
|
// N milliseconds.
|
||||||
|
_.debounce = function(func, wait) {
|
||||||
|
var timeout;
|
||||||
|
return function() {
|
||||||
|
var context = this, args = arguments;
|
||||||
|
var later = function() {
|
||||||
|
timeout = null;
|
||||||
|
func.apply(context, args);
|
||||||
|
};
|
||||||
|
clearTimeout(timeout);
|
||||||
|
timeout = setTimeout(later, wait);
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Returns a function that will be executed at most one time, no matter how
|
||||||
|
// often you call it. Useful for lazy initialization.
|
||||||
|
_.once = function(func) {
|
||||||
|
var ran = false, memo;
|
||||||
|
return function() {
|
||||||
|
if (ran) return memo;
|
||||||
|
ran = true;
|
||||||
|
return memo = func.apply(this, arguments);
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Returns the first function passed as an argument to the second,
|
||||||
|
// allowing you to adjust arguments, run code before and after, and
|
||||||
|
// conditionally execute the original function.
|
||||||
|
_.wrap = function(func, wrapper) {
|
||||||
|
return function() {
|
||||||
|
var args = [func].concat(slice.call(arguments, 0));
|
||||||
|
return wrapper.apply(this, args);
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Returns a function that is the composition of a list of functions, each
|
||||||
|
// consuming the return value of the function that follows.
|
||||||
|
_.compose = function() {
|
||||||
|
var funcs = arguments;
|
||||||
|
return function() {
|
||||||
|
var args = arguments;
|
||||||
|
for (var i = funcs.length - 1; i >= 0; i--) {
|
||||||
|
args = [funcs[i].apply(this, args)];
|
||||||
|
}
|
||||||
|
return args[0];
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Returns a function that will only be executed after being called N times.
|
||||||
|
_.after = function(times, func) {
|
||||||
|
if (times <= 0) return func();
|
||||||
|
return function() {
|
||||||
|
if (--times < 1) { return func.apply(this, arguments); }
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Object Functions
|
||||||
|
// ----------------
|
||||||
|
|
||||||
|
// Retrieve the names of an object's properties.
|
||||||
|
// Delegates to **ECMAScript 5**'s native `Object.keys`
|
||||||
|
_.keys = nativeKeys || function(obj) {
|
||||||
|
if (obj !== Object(obj)) throw new TypeError('Invalid object');
|
||||||
|
var keys = [];
|
||||||
|
for (var key in obj) if (_.has(obj, key)) keys[keys.length] = key;
|
||||||
|
return keys;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Retrieve the values of an object's properties.
|
||||||
|
_.values = function(obj) {
|
||||||
|
return _.map(obj, _.identity);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Return a sorted list of the function names available on the object.
|
||||||
|
// Aliased as `methods`
|
||||||
|
_.functions = _.methods = function(obj) {
|
||||||
|
var names = [];
|
||||||
|
for (var key in obj) {
|
||||||
|
if (_.isFunction(obj[key])) names.push(key);
|
||||||
|
}
|
||||||
|
return names.sort();
|
||||||
|
};
|
||||||
|
|
||||||
|
// Extend a given object with all the properties in passed-in object(s).
|
||||||
|
_.extend = function(obj) {
|
||||||
|
each(slice.call(arguments, 1), function(source) {
|
||||||
|
for (var prop in source) {
|
||||||
|
obj[prop] = source[prop];
|
||||||
|
}
|
||||||
|
});
|
||||||
|
return obj;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Fill in a given object with default properties.
|
||||||
|
_.defaults = function(obj) {
|
||||||
|
each(slice.call(arguments, 1), function(source) {
|
||||||
|
for (var prop in source) {
|
||||||
|
if (obj[prop] == null) obj[prop] = source[prop];
|
||||||
|
}
|
||||||
|
});
|
||||||
|
return obj;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Create a (shallow-cloned) duplicate of an object.
|
||||||
|
_.clone = function(obj) {
|
||||||
|
if (!_.isObject(obj)) return obj;
|
||||||
|
return _.isArray(obj) ? obj.slice() : _.extend({}, obj);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Invokes interceptor with the obj, and then returns obj.
|
||||||
|
// The primary purpose of this method is to "tap into" a method chain, in
|
||||||
|
// order to perform operations on intermediate results within the chain.
|
||||||
|
_.tap = function(obj, interceptor) {
|
||||||
|
interceptor(obj);
|
||||||
|
return obj;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Internal recursive comparison function.
|
||||||
|
function eq(a, b, stack) {
|
||||||
|
// Identical objects are equal. `0 === -0`, but they aren't identical.
|
||||||
|
// See the Harmony `egal` proposal: http://wiki.ecmascript.org/doku.php?id=harmony:egal.
|
||||||
|
if (a === b) return a !== 0 || 1 / a == 1 / b;
|
||||||
|
// A strict comparison is necessary because `null == undefined`.
|
||||||
|
if (a == null || b == null) return a === b;
|
||||||
|
// Unwrap any wrapped objects.
|
||||||
|
if (a._chain) a = a._wrapped;
|
||||||
|
if (b._chain) b = b._wrapped;
|
||||||
|
// Invoke a custom `isEqual` method if one is provided.
|
||||||
|
if (a.isEqual && _.isFunction(a.isEqual)) return a.isEqual(b);
|
||||||
|
if (b.isEqual && _.isFunction(b.isEqual)) return b.isEqual(a);
|
||||||
|
// Compare `[[Class]]` names.
|
||||||
|
var className = toString.call(a);
|
||||||
|
if (className != toString.call(b)) return false;
|
||||||
|
switch (className) {
|
||||||
|
// Strings, numbers, dates, and booleans are compared by value.
|
||||||
|
case '[object String]':
|
||||||
|
// Primitives and their corresponding object wrappers are equivalent; thus, `"5"` is
|
||||||
|
// equivalent to `new String("5")`.
|
||||||
|
return a == String(b);
|
||||||
|
case '[object Number]':
|
||||||
|
// `NaN`s are equivalent, but non-reflexive. An `egal` comparison is performed for
|
||||||
|
// other numeric values.
|
||||||
|
return a != +a ? b != +b : (a == 0 ? 1 / a == 1 / b : a == +b);
|
||||||
|
case '[object Date]':
|
||||||
|
case '[object Boolean]':
|
||||||
|
// Coerce dates and booleans to numeric primitive values. Dates are compared by their
|
||||||
|
// millisecond representations. Note that invalid dates with millisecond representations
|
||||||
|
// of `NaN` are not equivalent.
|
||||||
|
return +a == +b;
|
||||||
|
// RegExps are compared by their source patterns and flags.
|
||||||
|
case '[object RegExp]':
|
||||||
|
return a.source == b.source &&
|
||||||
|
a.global == b.global &&
|
||||||
|
a.multiline == b.multiline &&
|
||||||
|
a.ignoreCase == b.ignoreCase;
|
||||||
|
}
|
||||||
|
if (typeof a != 'object' || typeof b != 'object') return false;
|
||||||
|
// Assume equality for cyclic structures. The algorithm for detecting cyclic
|
||||||
|
// structures is adapted from ES 5.1 section 15.12.3, abstract operation `JO`.
|
||||||
|
var length = stack.length;
|
||||||
|
while (length--) {
|
||||||
|
// Linear search. Performance is inversely proportional to the number of
|
||||||
|
// unique nested structures.
|
||||||
|
if (stack[length] == a) return true;
|
||||||
|
}
|
||||||
|
// Add the first object to the stack of traversed objects.
|
||||||
|
stack.push(a);
|
||||||
|
var size = 0, result = true;
|
||||||
|
// Recursively compare objects and arrays.
|
||||||
|
if (className == '[object Array]') {
|
||||||
|
// Compare array lengths to determine if a deep comparison is necessary.
|
||||||
|
size = a.length;
|
||||||
|
result = size == b.length;
|
||||||
|
if (result) {
|
||||||
|
// Deep compare the contents, ignoring non-numeric properties.
|
||||||
|
while (size--) {
|
||||||
|
// Ensure commutative equality for sparse arrays.
|
||||||
|
if (!(result = size in a == size in b && eq(a[size], b[size], stack))) break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// Objects with different constructors are not equivalent.
|
||||||
|
if ('constructor' in a != 'constructor' in b || a.constructor != b.constructor) return false;
|
||||||
|
// Deep compare objects.
|
||||||
|
for (var key in a) {
|
||||||
|
if (_.has(a, key)) {
|
||||||
|
// Count the expected number of properties.
|
||||||
|
size++;
|
||||||
|
// Deep compare each member.
|
||||||
|
if (!(result = _.has(b, key) && eq(a[key], b[key], stack))) break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// Ensure that both objects contain the same number of properties.
|
||||||
|
if (result) {
|
||||||
|
for (key in b) {
|
||||||
|
if (_.has(b, key) && !(size--)) break;
|
||||||
|
}
|
||||||
|
result = !size;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// Remove the first object from the stack of traversed objects.
|
||||||
|
stack.pop();
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Perform a deep comparison to check if two objects are equal.
|
||||||
|
_.isEqual = function(a, b) {
|
||||||
|
return eq(a, b, []);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given array, string, or object empty?
|
||||||
|
// An "empty" object has no enumerable own-properties.
|
||||||
|
_.isEmpty = function(obj) {
|
||||||
|
if (_.isArray(obj) || _.isString(obj)) return obj.length === 0;
|
||||||
|
for (var key in obj) if (_.has(obj, key)) return false;
|
||||||
|
return true;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given value a DOM element?
|
||||||
|
_.isElement = function(obj) {
|
||||||
|
return !!(obj && obj.nodeType == 1);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given value an array?
|
||||||
|
// Delegates to ECMA5's native Array.isArray
|
||||||
|
_.isArray = nativeIsArray || function(obj) {
|
||||||
|
return toString.call(obj) == '[object Array]';
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given variable an object?
|
||||||
|
_.isObject = function(obj) {
|
||||||
|
return obj === Object(obj);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given variable an arguments object?
|
||||||
|
_.isArguments = function(obj) {
|
||||||
|
return toString.call(obj) == '[object Arguments]';
|
||||||
|
};
|
||||||
|
if (!_.isArguments(arguments)) {
|
||||||
|
_.isArguments = function(obj) {
|
||||||
|
return !!(obj && _.has(obj, 'callee'));
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
// Is a given value a function?
|
||||||
|
_.isFunction = function(obj) {
|
||||||
|
return toString.call(obj) == '[object Function]';
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given value a string?
|
||||||
|
_.isString = function(obj) {
|
||||||
|
return toString.call(obj) == '[object String]';
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given value a number?
|
||||||
|
_.isNumber = function(obj) {
|
||||||
|
return toString.call(obj) == '[object Number]';
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is the given value `NaN`?
|
||||||
|
_.isNaN = function(obj) {
|
||||||
|
// `NaN` is the only value for which `===` is not reflexive.
|
||||||
|
return obj !== obj;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given value a boolean?
|
||||||
|
_.isBoolean = function(obj) {
|
||||||
|
return obj === true || obj === false || toString.call(obj) == '[object Boolean]';
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given value a date?
|
||||||
|
_.isDate = function(obj) {
|
||||||
|
return toString.call(obj) == '[object Date]';
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is the given value a regular expression?
|
||||||
|
_.isRegExp = function(obj) {
|
||||||
|
return toString.call(obj) == '[object RegExp]';
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given value equal to null?
|
||||||
|
_.isNull = function(obj) {
|
||||||
|
return obj === null;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Is a given variable undefined?
|
||||||
|
_.isUndefined = function(obj) {
|
||||||
|
return obj === void 0;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Has own property?
|
||||||
|
_.has = function(obj, key) {
|
||||||
|
return hasOwnProperty.call(obj, key);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Utility Functions
|
||||||
|
// -----------------
|
||||||
|
|
||||||
|
// Run Underscore.js in *noConflict* mode, returning the `_` variable to its
|
||||||
|
// previous owner. Returns a reference to the Underscore object.
|
||||||
|
_.noConflict = function() {
|
||||||
|
root._ = previousUnderscore;
|
||||||
|
return this;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Keep the identity function around for default iterators.
|
||||||
|
_.identity = function(value) {
|
||||||
|
return value;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Run a function **n** times.
|
||||||
|
_.times = function (n, iterator, context) {
|
||||||
|
for (var i = 0; i < n; i++) iterator.call(context, i);
|
||||||
|
};
|
||||||
|
|
||||||
|
// Escape a string for HTML interpolation.
|
||||||
|
_.escape = function(string) {
|
||||||
|
return (''+string).replace(/&/g, '&').replace(/</g, '<').replace(/>/g, '>').replace(/"/g, '"').replace(/'/g, ''').replace(/\//g,'/');
|
||||||
|
};
|
||||||
|
|
||||||
|
// Add your own custom functions to the Underscore object, ensuring that
|
||||||
|
// they're correctly added to the OOP wrapper as well.
|
||||||
|
_.mixin = function(obj) {
|
||||||
|
each(_.functions(obj), function(name){
|
||||||
|
addToWrapper(name, _[name] = obj[name]);
|
||||||
|
});
|
||||||
|
};
|
||||||
|
|
||||||
|
// Generate a unique integer id (unique within the entire client session).
|
||||||
|
// Useful for temporary DOM ids.
|
||||||
|
var idCounter = 0;
|
||||||
|
_.uniqueId = function(prefix) {
|
||||||
|
var id = idCounter++;
|
||||||
|
return prefix ? prefix + id : id;
|
||||||
|
};
|
||||||
|
|
||||||
|
// By default, Underscore uses ERB-style template delimiters, change the
|
||||||
|
// following template settings to use alternative delimiters.
|
||||||
|
_.templateSettings = {
|
||||||
|
evaluate : /<%([\s\S]+?)%>/g,
|
||||||
|
interpolate : /<%=([\s\S]+?)%>/g,
|
||||||
|
escape : /<%-([\s\S]+?)%>/g
|
||||||
|
};
|
||||||
|
|
||||||
|
// When customizing `templateSettings`, if you don't want to define an
|
||||||
|
// interpolation, evaluation or escaping regex, we need one that is
|
||||||
|
// guaranteed not to match.
|
||||||
|
var noMatch = /.^/;
|
||||||
|
|
||||||
|
// Within an interpolation, evaluation, or escaping, remove HTML escaping
|
||||||
|
// that had been previously added.
|
||||||
|
var unescape = function(code) {
|
||||||
|
return code.replace(/\\\\/g, '\\').replace(/\\'/g, "'");
|
||||||
|
};
|
||||||
|
|
||||||
|
// JavaScript micro-templating, similar to John Resig's implementation.
|
||||||
|
// Underscore templating handles arbitrary delimiters, preserves whitespace,
|
||||||
|
// and correctly escapes quotes within interpolated code.
|
||||||
|
_.template = function(str, data) {
|
||||||
|
var c = _.templateSettings;
|
||||||
|
var tmpl = 'var __p=[],print=function(){__p.push.apply(__p,arguments);};' +
|
||||||
|
'with(obj||{}){__p.push(\'' +
|
||||||
|
str.replace(/\\/g, '\\\\')
|
||||||
|
.replace(/'/g, "\\'")
|
||||||
|
.replace(c.escape || noMatch, function(match, code) {
|
||||||
|
return "',_.escape(" + unescape(code) + "),'";
|
||||||
|
})
|
||||||
|
.replace(c.interpolate || noMatch, function(match, code) {
|
||||||
|
return "'," + unescape(code) + ",'";
|
||||||
|
})
|
||||||
|
.replace(c.evaluate || noMatch, function(match, code) {
|
||||||
|
return "');" + unescape(code).replace(/[\r\n\t]/g, ' ') + ";__p.push('";
|
||||||
|
})
|
||||||
|
.replace(/\r/g, '\\r')
|
||||||
|
.replace(/\n/g, '\\n')
|
||||||
|
.replace(/\t/g, '\\t')
|
||||||
|
+ "');}return __p.join('');";
|
||||||
|
var func = new Function('obj', '_', tmpl);
|
||||||
|
if (data) return func(data, _);
|
||||||
|
return function(data) {
|
||||||
|
return func.call(this, data, _);
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Add a "chain" function, which will delegate to the wrapper.
|
||||||
|
_.chain = function(obj) {
|
||||||
|
return _(obj).chain();
|
||||||
|
};
|
||||||
|
|
||||||
|
// The OOP Wrapper
|
||||||
|
// ---------------
|
||||||
|
|
||||||
|
// If Underscore is called as a function, it returns a wrapped object that
|
||||||
|
// can be used OO-style. This wrapper holds altered versions of all the
|
||||||
|
// underscore functions. Wrapped objects may be chained.
|
||||||
|
var wrapper = function(obj) { this._wrapped = obj; };
|
||||||
|
|
||||||
|
// Expose `wrapper.prototype` as `_.prototype`
|
||||||
|
_.prototype = wrapper.prototype;
|
||||||
|
|
||||||
|
// Helper function to continue chaining intermediate results.
|
||||||
|
var result = function(obj, chain) {
|
||||||
|
return chain ? _(obj).chain() : obj;
|
||||||
|
};
|
||||||
|
|
||||||
|
// A method to easily add functions to the OOP wrapper.
|
||||||
|
var addToWrapper = function(name, func) {
|
||||||
|
wrapper.prototype[name] = function() {
|
||||||
|
var args = slice.call(arguments);
|
||||||
|
unshift.call(args, this._wrapped);
|
||||||
|
return result(func.apply(_, args), this._chain);
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
// Add all of the Underscore functions to the wrapper object.
|
||||||
|
_.mixin(_);
|
||||||
|
|
||||||
|
// Add all mutator Array functions to the wrapper.
|
||||||
|
each(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(name) {
|
||||||
|
var method = ArrayProto[name];
|
||||||
|
wrapper.prototype[name] = function() {
|
||||||
|
var wrapped = this._wrapped;
|
||||||
|
method.apply(wrapped, arguments);
|
||||||
|
var length = wrapped.length;
|
||||||
|
if ((name == 'shift' || name == 'splice') && length === 0) delete wrapped[0];
|
||||||
|
return result(wrapped, this._chain);
|
||||||
|
};
|
||||||
|
});
|
||||||
|
|
||||||
|
// Add all accessor Array functions to the wrapper.
|
||||||
|
each(['concat', 'join', 'slice'], function(name) {
|
||||||
|
var method = ArrayProto[name];
|
||||||
|
wrapper.prototype[name] = function() {
|
||||||
|
return result(method.apply(this._wrapped, arguments), this._chain);
|
||||||
|
};
|
||||||
|
});
|
||||||
|
|
||||||
|
// Start chaining a wrapped Underscore object.
|
||||||
|
wrapper.prototype.chain = function() {
|
||||||
|
this._chain = true;
|
||||||
|
return this;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Extracts the result from a wrapped and chained object.
|
||||||
|
wrapper.prototype.value = function() {
|
||||||
|
return this._wrapped;
|
||||||
|
};
|
||||||
|
|
||||||
|
}).call(this);
|
31
externals/fmt/doc/html/_static/underscore.js
vendored
Normal file
31
externals/fmt/doc/html/_static/underscore.js
vendored
Normal file
@ -0,0 +1,31 @@
|
|||||||
|
// Underscore.js 1.3.1
|
||||||
|
// (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc.
|
||||||
|
// Underscore is freely distributable under the MIT license.
|
||||||
|
// Portions of Underscore are inspired or borrowed from Prototype,
|
||||||
|
// Oliver Steele's Functional, and John Resig's Micro-Templating.
|
||||||
|
// For all details and documentation:
|
||||||
|
// http://documentcloud.github.com/underscore
|
||||||
|
(function(){function q(a,c,d){if(a===c)return a!==0||1/a==1/c;if(a==null||c==null)return a===c;if(a._chain)a=a._wrapped;if(c._chain)c=c._wrapped;if(a.isEqual&&b.isFunction(a.isEqual))return a.isEqual(c);if(c.isEqual&&b.isFunction(c.isEqual))return c.isEqual(a);var e=l.call(a);if(e!=l.call(c))return false;switch(e){case "[object String]":return a==String(c);case "[object Number]":return a!=+a?c!=+c:a==0?1/a==1/c:a==+c;case "[object Date]":case "[object Boolean]":return+a==+c;case "[object RegExp]":return a.source==
|
||||||
|
c.source&&a.global==c.global&&a.multiline==c.multiline&&a.ignoreCase==c.ignoreCase}if(typeof a!="object"||typeof c!="object")return false;for(var f=d.length;f--;)if(d[f]==a)return true;d.push(a);var f=0,g=true;if(e=="[object Array]"){if(f=a.length,g=f==c.length)for(;f--;)if(!(g=f in a==f in c&&q(a[f],c[f],d)))break}else{if("constructor"in a!="constructor"in c||a.constructor!=c.constructor)return false;for(var h in a)if(b.has(a,h)&&(f++,!(g=b.has(c,h)&&q(a[h],c[h],d))))break;if(g){for(h in c)if(b.has(c,
|
||||||
|
h)&&!f--)break;g=!f}}d.pop();return g}var r=this,G=r._,n={},k=Array.prototype,o=Object.prototype,i=k.slice,H=k.unshift,l=o.toString,I=o.hasOwnProperty,w=k.forEach,x=k.map,y=k.reduce,z=k.reduceRight,A=k.filter,B=k.every,C=k.some,p=k.indexOf,D=k.lastIndexOf,o=Array.isArray,J=Object.keys,s=Function.prototype.bind,b=function(a){return new m(a)};if(typeof exports!=="undefined"){if(typeof module!=="undefined"&&module.exports)exports=module.exports=b;exports._=b}else r._=b;b.VERSION="1.3.1";var j=b.each=
|
||||||
|
b.forEach=function(a,c,d){if(a!=null)if(w&&a.forEach===w)a.forEach(c,d);else if(a.length===+a.length)for(var e=0,f=a.length;e<f;e++){if(e in a&&c.call(d,a[e],e,a)===n)break}else for(e in a)if(b.has(a,e)&&c.call(d,a[e],e,a)===n)break};b.map=b.collect=function(a,c,b){var e=[];if(a==null)return e;if(x&&a.map===x)return a.map(c,b);j(a,function(a,g,h){e[e.length]=c.call(b,a,g,h)});if(a.length===+a.length)e.length=a.length;return e};b.reduce=b.foldl=b.inject=function(a,c,d,e){var f=arguments.length>2;a==
|
||||||
|
null&&(a=[]);if(y&&a.reduce===y)return e&&(c=b.bind(c,e)),f?a.reduce(c,d):a.reduce(c);j(a,function(a,b,i){f?d=c.call(e,d,a,b,i):(d=a,f=true)});if(!f)throw new TypeError("Reduce of empty array with no initial value");return d};b.reduceRight=b.foldr=function(a,c,d,e){var f=arguments.length>2;a==null&&(a=[]);if(z&&a.reduceRight===z)return e&&(c=b.bind(c,e)),f?a.reduceRight(c,d):a.reduceRight(c);var g=b.toArray(a).reverse();e&&!f&&(c=b.bind(c,e));return f?b.reduce(g,c,d,e):b.reduce(g,c)};b.find=b.detect=
|
||||||
|
function(a,c,b){var e;E(a,function(a,g,h){if(c.call(b,a,g,h))return e=a,true});return e};b.filter=b.select=function(a,c,b){var e=[];if(a==null)return e;if(A&&a.filter===A)return a.filter(c,b);j(a,function(a,g,h){c.call(b,a,g,h)&&(e[e.length]=a)});return e};b.reject=function(a,c,b){var e=[];if(a==null)return e;j(a,function(a,g,h){c.call(b,a,g,h)||(e[e.length]=a)});return e};b.every=b.all=function(a,c,b){var e=true;if(a==null)return e;if(B&&a.every===B)return a.every(c,b);j(a,function(a,g,h){if(!(e=
|
||||||
|
e&&c.call(b,a,g,h)))return n});return e};var E=b.some=b.any=function(a,c,d){c||(c=b.identity);var e=false;if(a==null)return e;if(C&&a.some===C)return a.some(c,d);j(a,function(a,b,h){if(e||(e=c.call(d,a,b,h)))return n});return!!e};b.include=b.contains=function(a,c){var b=false;if(a==null)return b;return p&&a.indexOf===p?a.indexOf(c)!=-1:b=E(a,function(a){return a===c})};b.invoke=function(a,c){var d=i.call(arguments,2);return b.map(a,function(a){return(b.isFunction(c)?c||a:a[c]).apply(a,d)})};b.pluck=
|
||||||
|
function(a,c){return b.map(a,function(a){return a[c]})};b.max=function(a,c,d){if(!c&&b.isArray(a))return Math.max.apply(Math,a);if(!c&&b.isEmpty(a))return-Infinity;var e={computed:-Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b>=e.computed&&(e={value:a,computed:b})});return e.value};b.min=function(a,c,d){if(!c&&b.isArray(a))return Math.min.apply(Math,a);if(!c&&b.isEmpty(a))return Infinity;var e={computed:Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b<e.computed&&(e={value:a,computed:b})});
|
||||||
|
return e.value};b.shuffle=function(a){var b=[],d;j(a,function(a,f){f==0?b[0]=a:(d=Math.floor(Math.random()*(f+1)),b[f]=b[d],b[d]=a)});return b};b.sortBy=function(a,c,d){return b.pluck(b.map(a,function(a,b,g){return{value:a,criteria:c.call(d,a,b,g)}}).sort(function(a,b){var c=a.criteria,d=b.criteria;return c<d?-1:c>d?1:0}),"value")};b.groupBy=function(a,c){var d={},e=b.isFunction(c)?c:function(a){return a[c]};j(a,function(a,b){var c=e(a,b);(d[c]||(d[c]=[])).push(a)});return d};b.sortedIndex=function(a,
|
||||||
|
c,d){d||(d=b.identity);for(var e=0,f=a.length;e<f;){var g=e+f>>1;d(a[g])<d(c)?e=g+1:f=g}return e};b.toArray=function(a){return!a?[]:a.toArray?a.toArray():b.isArray(a)?i.call(a):b.isArguments(a)?i.call(a):b.values(a)};b.size=function(a){return b.toArray(a).length};b.first=b.head=function(a,b,d){return b!=null&&!d?i.call(a,0,b):a[0]};b.initial=function(a,b,d){return i.call(a,0,a.length-(b==null||d?1:b))};b.last=function(a,b,d){return b!=null&&!d?i.call(a,Math.max(a.length-b,0)):a[a.length-1]};b.rest=
|
||||||
|
b.tail=function(a,b,d){return i.call(a,b==null||d?1:b)};b.compact=function(a){return b.filter(a,function(a){return!!a})};b.flatten=function(a,c){return b.reduce(a,function(a,e){if(b.isArray(e))return a.concat(c?e:b.flatten(e));a[a.length]=e;return a},[])};b.without=function(a){return b.difference(a,i.call(arguments,1))};b.uniq=b.unique=function(a,c,d){var d=d?b.map(a,d):a,e=[];b.reduce(d,function(d,g,h){if(0==h||(c===true?b.last(d)!=g:!b.include(d,g)))d[d.length]=g,e[e.length]=a[h];return d},[]);
|
||||||
|
return e};b.union=function(){return b.uniq(b.flatten(arguments,true))};b.intersection=b.intersect=function(a){var c=i.call(arguments,1);return b.filter(b.uniq(a),function(a){return b.every(c,function(c){return b.indexOf(c,a)>=0})})};b.difference=function(a){var c=b.flatten(i.call(arguments,1));return b.filter(a,function(a){return!b.include(c,a)})};b.zip=function(){for(var a=i.call(arguments),c=b.max(b.pluck(a,"length")),d=Array(c),e=0;e<c;e++)d[e]=b.pluck(a,""+e);return d};b.indexOf=function(a,c,
|
||||||
|
d){if(a==null)return-1;var e;if(d)return d=b.sortedIndex(a,c),a[d]===c?d:-1;if(p&&a.indexOf===p)return a.indexOf(c);for(d=0,e=a.length;d<e;d++)if(d in a&&a[d]===c)return d;return-1};b.lastIndexOf=function(a,b){if(a==null)return-1;if(D&&a.lastIndexOf===D)return a.lastIndexOf(b);for(var d=a.length;d--;)if(d in a&&a[d]===b)return d;return-1};b.range=function(a,b,d){arguments.length<=1&&(b=a||0,a=0);for(var d=arguments[2]||1,e=Math.max(Math.ceil((b-a)/d),0),f=0,g=Array(e);f<e;)g[f++]=a,a+=d;return g};
|
||||||
|
var F=function(){};b.bind=function(a,c){var d,e;if(a.bind===s&&s)return s.apply(a,i.call(arguments,1));if(!b.isFunction(a))throw new TypeError;e=i.call(arguments,2);return d=function(){if(!(this instanceof d))return a.apply(c,e.concat(i.call(arguments)));F.prototype=a.prototype;var b=new F,g=a.apply(b,e.concat(i.call(arguments)));return Object(g)===g?g:b}};b.bindAll=function(a){var c=i.call(arguments,1);c.length==0&&(c=b.functions(a));j(c,function(c){a[c]=b.bind(a[c],a)});return a};b.memoize=function(a,
|
||||||
|
c){var d={};c||(c=b.identity);return function(){var e=c.apply(this,arguments);return b.has(d,e)?d[e]:d[e]=a.apply(this,arguments)}};b.delay=function(a,b){var d=i.call(arguments,2);return setTimeout(function(){return a.apply(a,d)},b)};b.defer=function(a){return b.delay.apply(b,[a,1].concat(i.call(arguments,1)))};b.throttle=function(a,c){var d,e,f,g,h,i=b.debounce(function(){h=g=false},c);return function(){d=this;e=arguments;var b;f||(f=setTimeout(function(){f=null;h&&a.apply(d,e);i()},c));g?h=true:
|
||||||
|
a.apply(d,e);i();g=true}};b.debounce=function(a,b){var d;return function(){var e=this,f=arguments;clearTimeout(d);d=setTimeout(function(){d=null;a.apply(e,f)},b)}};b.once=function(a){var b=false,d;return function(){if(b)return d;b=true;return d=a.apply(this,arguments)}};b.wrap=function(a,b){return function(){var d=[a].concat(i.call(arguments,0));return b.apply(this,d)}};b.compose=function(){var a=arguments;return function(){for(var b=arguments,d=a.length-1;d>=0;d--)b=[a[d].apply(this,b)];return b[0]}};
|
||||||
|
b.after=function(a,b){return a<=0?b():function(){if(--a<1)return b.apply(this,arguments)}};b.keys=J||function(a){if(a!==Object(a))throw new TypeError("Invalid object");var c=[],d;for(d in a)b.has(a,d)&&(c[c.length]=d);return c};b.values=function(a){return b.map(a,b.identity)};b.functions=b.methods=function(a){var c=[],d;for(d in a)b.isFunction(a[d])&&c.push(d);return c.sort()};b.extend=function(a){j(i.call(arguments,1),function(b){for(var d in b)a[d]=b[d]});return a};b.defaults=function(a){j(i.call(arguments,
|
||||||
|
1),function(b){for(var d in b)a[d]==null&&(a[d]=b[d])});return a};b.clone=function(a){return!b.isObject(a)?a:b.isArray(a)?a.slice():b.extend({},a)};b.tap=function(a,b){b(a);return a};b.isEqual=function(a,b){return q(a,b,[])};b.isEmpty=function(a){if(b.isArray(a)||b.isString(a))return a.length===0;for(var c in a)if(b.has(a,c))return false;return true};b.isElement=function(a){return!!(a&&a.nodeType==1)};b.isArray=o||function(a){return l.call(a)=="[object Array]"};b.isObject=function(a){return a===Object(a)};
|
||||||
|
b.isArguments=function(a){return l.call(a)=="[object Arguments]"};if(!b.isArguments(arguments))b.isArguments=function(a){return!(!a||!b.has(a,"callee"))};b.isFunction=function(a){return l.call(a)=="[object Function]"};b.isString=function(a){return l.call(a)=="[object String]"};b.isNumber=function(a){return l.call(a)=="[object Number]"};b.isNaN=function(a){return a!==a};b.isBoolean=function(a){return a===true||a===false||l.call(a)=="[object Boolean]"};b.isDate=function(a){return l.call(a)=="[object Date]"};
|
||||||
|
b.isRegExp=function(a){return l.call(a)=="[object RegExp]"};b.isNull=function(a){return a===null};b.isUndefined=function(a){return a===void 0};b.has=function(a,b){return I.call(a,b)};b.noConflict=function(){r._=G;return this};b.identity=function(a){return a};b.times=function(a,b,d){for(var e=0;e<a;e++)b.call(d,e)};b.escape=function(a){return(""+a).replace(/&/g,"&").replace(/</g,"<").replace(/>/g,">").replace(/"/g,""").replace(/'/g,"'").replace(/\//g,"/")};b.mixin=function(a){j(b.functions(a),
|
||||||
|
function(c){K(c,b[c]=a[c])})};var L=0;b.uniqueId=function(a){var b=L++;return a?a+b:b};b.templateSettings={evaluate:/<%([\s\S]+?)%>/g,interpolate:/<%=([\s\S]+?)%>/g,escape:/<%-([\s\S]+?)%>/g};var t=/.^/,u=function(a){return a.replace(/\\\\/g,"\\").replace(/\\'/g,"'")};b.template=function(a,c){var d=b.templateSettings,d="var __p=[],print=function(){__p.push.apply(__p,arguments);};with(obj||{}){__p.push('"+a.replace(/\\/g,"\\\\").replace(/'/g,"\\'").replace(d.escape||t,function(a,b){return"',_.escape("+
|
||||||
|
u(b)+"),'"}).replace(d.interpolate||t,function(a,b){return"',"+u(b)+",'"}).replace(d.evaluate||t,function(a,b){return"');"+u(b).replace(/[\r\n\t]/g," ")+";__p.push('"}).replace(/\r/g,"\\r").replace(/\n/g,"\\n").replace(/\t/g,"\\t")+"');}return __p.join('');",e=new Function("obj","_",d);return c?e(c,b):function(a){return e.call(this,a,b)}};b.chain=function(a){return b(a).chain()};var m=function(a){this._wrapped=a};b.prototype=m.prototype;var v=function(a,c){return c?b(a).chain():a},K=function(a,c){m.prototype[a]=
|
||||||
|
function(){var a=i.call(arguments);H.call(a,this._wrapped);return v(c.apply(b,a),this._chain)}};b.mixin(b);j("pop,push,reverse,shift,sort,splice,unshift".split(","),function(a){var b=k[a];m.prototype[a]=function(){var d=this._wrapped;b.apply(d,arguments);var e=d.length;(a=="shift"||a=="splice")&&e===0&&delete d[0];return v(d,this._chain)}});j(["concat","join","slice"],function(a){var b=k[a];m.prototype[a]=function(){return v(b.apply(this._wrapped,arguments),this._chain)}});m.prototype.chain=function(){this._chain=
|
||||||
|
true;return this};m.prototype.value=function(){return this._wrapped}}).call(this);
|
1387
externals/fmt/doc/html/api.html
vendored
Normal file
1387
externals/fmt/doc/html/api.html
vendored
Normal file
File diff suppressed because it is too large
Load Diff
189
externals/fmt/doc/html/contents.html
vendored
Normal file
189
externals/fmt/doc/html/contents.html
vendored
Normal file
@ -0,0 +1,189 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
|
||||||
|
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<meta http-equiv="X-UA-Compatible" content="IE=edge">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
|
||||||
|
<meta name="generator" content="Docutils 0.17.1: http://docutils.sourceforge.net/" />
|
||||||
|
|
||||||
|
<title>Contents — fmt 9.1.0 documentation</title>
|
||||||
|
|
||||||
|
<link rel="stylesheet" href="_static/basic.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/pygments.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/breathe.css" type="text/css" />
|
||||||
|
|
||||||
|
<script type="text/javascript">
|
||||||
|
var DOCUMENTATION_OPTIONS = {
|
||||||
|
URL_ROOT: './',
|
||||||
|
VERSION: '9.1.0',
|
||||||
|
COLLAPSE_INDEX: false,
|
||||||
|
FILE_SUFFIX: '.html',
|
||||||
|
LINK_SUFFIX: '.html',
|
||||||
|
SOURCELINK_SUFFIX: '.txt',
|
||||||
|
HAS_SOURCE: true,
|
||||||
|
SOURCELINK_SUFFIX: '.txt'
|
||||||
|
};
|
||||||
|
</script>
|
||||||
|
<script src="_static/jquery.js"></script>
|
||||||
|
<script src="_static/underscore.js"></script>
|
||||||
|
<script src="_static/doctools.js"></script>
|
||||||
|
<script src="_static/language_data.js"></script>
|
||||||
|
<link rel="index" title="Index" href="genindex.html" />
|
||||||
|
<link rel="search" title="Search" href="search.html" />
|
||||||
|
<meta name="description" content="Small, safe and fast formatting library">
|
||||||
|
<meta name="keywords" content="C++, formatting, printf, string, library">
|
||||||
|
<meta name="author" content="Victor Zverovich">
|
||||||
|
<link rel="stylesheet" href="_static/fmt.css">
|
||||||
|
|
||||||
|
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
|
||||||
|
<script>
|
||||||
|
window.dataLayer = window.dataLayer || [];
|
||||||
|
function gtag(){dataLayer.push(arguments);}
|
||||||
|
gtag('js', new Date());
|
||||||
|
|
||||||
|
gtag('config', 'UA-20116650-4');
|
||||||
|
</script>
|
||||||
|
|
||||||
|
</head>
|
||||||
|
<body role="document">
|
||||||
|
<nav class="navbar navbar-inverse">
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
<div class="navbar-content">
|
||||||
|
|
||||||
|
<div class="navbar-header">
|
||||||
|
<button type="button" class="navbar-toggle collapsed"
|
||||||
|
data-toggle="collapse" data-target=".navbar-collapse">
|
||||||
|
<span class="sr-only">Toggle navigation</span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
</button>
|
||||||
|
<a class="navbar-brand" href="index.html">{fmt}</a>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
<div class="collapse navbar-collapse">
|
||||||
|
<ul class="nav navbar-nav">
|
||||||
|
<li class="dropdown">
|
||||||
|
<a href="#" class="dropdown-toggle" data-toggle="dropdown"
|
||||||
|
role="button" aria-expanded="false">9.1.0
|
||||||
|
<span class="caret"></span></a>
|
||||||
|
<ul class="dropdown-menu" role="menu">
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
|
||||||
|
|
||||||
|
<li class="active"><a href="contents.html">Contents
|
||||||
|
<span class="sr-only">(current)</span></a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="usage.html">Usage</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="api.html">API</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="syntax.html">Syntax</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
|
||||||
|
|
||||||
|
<form class="navbar-form navbar-right" role="search" action="search.html"
|
||||||
|
method="get">
|
||||||
|
<div class="form-group">
|
||||||
|
<input type="text" name="q" class="form-control"
|
||||||
|
placeholder="Search" >
|
||||||
|
</div>
|
||||||
|
<input type="hidden" name="check_keywords" value="yes" />
|
||||||
|
<input type="hidden" name="area" value="default" />
|
||||||
|
|
||||||
|
</form>
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</nav>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
|
||||||
|
|
||||||
|
<div class="content">
|
||||||
|
|
||||||
|
<section id="contents">
|
||||||
|
<h1>Contents<a class="headerlink" href="#contents" title="Permalink to this headline">¶</a></h1>
|
||||||
|
<div class="toctree-wrapper compound">
|
||||||
|
<ul>
|
||||||
|
<li class="toctree-l1"><a class="reference internal" href="usage.html">Usage</a><ul>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#building-the-library">Building the Library</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#installing-the-library">Installing the Library</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#usage-with-cmake">Usage with CMake</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#usage-with-build2">Usage with build2</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#building-the-documentation">Building the Documentation</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#conda">Conda</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#vcpkg">Vcpkg</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#lhelper">LHelper</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#android-ndk">Android NDK</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="usage.html#homebrew">Homebrew</a></li>
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
<li class="toctree-l1"><a class="reference internal" href="api.html">API Reference</a><ul>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#core-api">Core API</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#format-api">Format API</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#range-and-tuple-formatting">Range and Tuple Formatting</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#date-and-time-formatting">Date and Time Formatting</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#standard-library-types-formatting">Standard Library Types Formatting</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#format-string-compilation">Format String Compilation</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#terminal-color-and-text-style">Terminal Color and Text Style</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#system-apis">System APIs</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#std-ostream-support"><code class="docutils literal notranslate"><span class="pre">std::ostream</span></code> Support</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#printf-formatting"><code class="docutils literal notranslate"><span class="pre">printf</span></code> Formatting</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#wchar-t-support"><code class="docutils literal notranslate"><span class="pre">wchar_t</span></code> Support</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="api.html#compatibility-with-c-20-std-format">Compatibility with C++20 <code class="docutils literal notranslate"><span class="pre">std::format</span></code></a></li>
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
<li class="toctree-l1"><a class="reference internal" href="syntax.html">Format String Syntax</a><ul>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="syntax.html#format-specification-mini-language">Format Specification Mini-Language</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="syntax.html#chrono-format-specifications">Chrono Format Specifications</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="syntax.html#range-format-specifications">Range Format Specifications</a></li>
|
||||||
|
<li class="toctree-l2"><a class="reference internal" href="syntax.html#format-examples">Format Examples</a></li>
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
</ul>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="footer" role="contentinfo">
|
||||||
|
© Copyright 2012-present, Victor Zverovich.
|
||||||
|
Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<script src="_static/bootstrap.min.js"></script>
|
||||||
|
|
||||||
|
</body>
|
||||||
|
</html>
|
312
externals/fmt/doc/html/genindex.html
vendored
Normal file
312
externals/fmt/doc/html/genindex.html
vendored
Normal file
@ -0,0 +1,312 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
|
||||||
|
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<meta http-equiv="X-UA-Compatible" content="IE=edge">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
|
||||||
|
|
||||||
|
<title>Index — fmt 9.1.0 documentation</title>
|
||||||
|
|
||||||
|
<link rel="stylesheet" href="_static/basic.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/pygments.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/breathe.css" type="text/css" />
|
||||||
|
|
||||||
|
<script type="text/javascript">
|
||||||
|
var DOCUMENTATION_OPTIONS = {
|
||||||
|
URL_ROOT: './',
|
||||||
|
VERSION: '9.1.0',
|
||||||
|
COLLAPSE_INDEX: false,
|
||||||
|
FILE_SUFFIX: '.html',
|
||||||
|
LINK_SUFFIX: '.html',
|
||||||
|
SOURCELINK_SUFFIX: '.txt',
|
||||||
|
HAS_SOURCE: true,
|
||||||
|
SOURCELINK_SUFFIX: '.txt'
|
||||||
|
};
|
||||||
|
</script>
|
||||||
|
<script src="_static/jquery.js"></script>
|
||||||
|
<script src="_static/underscore.js"></script>
|
||||||
|
<script src="_static/doctools.js"></script>
|
||||||
|
<script src="_static/language_data.js"></script>
|
||||||
|
<link rel="index" title="Index" href="#" />
|
||||||
|
<link rel="search" title="Search" href="search.html" />
|
||||||
|
<meta name="description" content="Small, safe and fast formatting library">
|
||||||
|
<meta name="keywords" content="C++, formatting, printf, string, library">
|
||||||
|
<meta name="author" content="Victor Zverovich">
|
||||||
|
<link rel="stylesheet" href="_static/fmt.css">
|
||||||
|
|
||||||
|
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
|
||||||
|
<script>
|
||||||
|
window.dataLayer = window.dataLayer || [];
|
||||||
|
function gtag(){dataLayer.push(arguments);}
|
||||||
|
gtag('js', new Date());
|
||||||
|
|
||||||
|
gtag('config', 'UA-20116650-4');
|
||||||
|
</script>
|
||||||
|
|
||||||
|
</head>
|
||||||
|
<body role="document">
|
||||||
|
<nav class="navbar navbar-inverse">
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
<div class="navbar-content">
|
||||||
|
|
||||||
|
<div class="navbar-header">
|
||||||
|
<button type="button" class="navbar-toggle collapsed"
|
||||||
|
data-toggle="collapse" data-target=".navbar-collapse">
|
||||||
|
<span class="sr-only">Toggle navigation</span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
</button>
|
||||||
|
<a class="navbar-brand" href="index.html">{fmt}</a>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
<div class="collapse navbar-collapse">
|
||||||
|
<ul class="nav navbar-nav">
|
||||||
|
<li class="dropdown">
|
||||||
|
<a href="#" class="dropdown-toggle" data-toggle="dropdown"
|
||||||
|
role="button" aria-expanded="false">9.1.0
|
||||||
|
<span class="caret"></span></a>
|
||||||
|
<ul class="dropdown-menu" role="menu">
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="contents.html">Contents</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="usage.html">Usage</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="api.html">API</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="syntax.html">Syntax</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
|
||||||
|
|
||||||
|
<form class="navbar-form navbar-right" role="search" action="search.html"
|
||||||
|
method="get">
|
||||||
|
<div class="form-group">
|
||||||
|
<input type="text" name="q" class="form-control"
|
||||||
|
placeholder="Search" >
|
||||||
|
</div>
|
||||||
|
<input type="hidden" name="check_keywords" value="yes" />
|
||||||
|
<input type="hidden" name="area" value="default" />
|
||||||
|
|
||||||
|
</form>
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</nav>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
|
||||||
|
|
||||||
|
<div class="content">
|
||||||
|
|
||||||
|
|
||||||
|
<h1 id="index">Index</h1>
|
||||||
|
|
||||||
|
<div class="genindex-jumpbox">
|
||||||
|
<a href="#F"><strong>F</strong></a>
|
||||||
|
|
||||||
|
</div>
|
||||||
|
<h2 id="F">F</h2>
|
||||||
|
<table style="width: 100%" class="indextable genindextable"><tr>
|
||||||
|
<td style="width: 33%; vertical-align: top;"><ul>
|
||||||
|
<li><a href="api.html#_CPPv4I00EN3fmt3argEN6detail9named_argI4Char1TEEPK4CharRK1T">fmt::arg (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt16basic_format_argE">fmt::basic_format_arg (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt17basic_format_argsE">fmt::basic_format_args (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4IDpEN3fmt17basic_format_args17basic_format_argsERK16format_arg_storeI7ContextDp4ArgsE">fmt::basic_format_args::basic_format_args (C++ function)</a>, <a href="api.html#_CPPv4N3fmt17basic_format_args17basic_format_argsEPK10format_argi">[1]</a>, <a href="api.html#_CPPv4N3fmt17basic_format_args17basic_format_argsERK24dynamic_format_arg_storeI7ContextE">[2]</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4NK3fmt17basic_format_args3getEi">fmt::basic_format_args::get (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I00EN3fmt20basic_format_contextE">fmt::basic_format_context (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt20basic_format_context20basic_format_contextE8OutputIt17basic_format_argsI20basic_format_contextEN6detail10locale_refE">fmt::basic_format_context::basic_format_context (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt20basic_format_context9char_typeE">fmt::basic_format_context::char_type (C++ type)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I00EN3fmt26basic_format_parse_contextE">fmt::basic_format_parse_context (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt26basic_format_parse_context10advance_toE8iterator">fmt::basic_format_parse_context::advance_to (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4NK3fmt26basic_format_parse_context5beginEv">fmt::basic_format_parse_context::begin (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt26basic_format_parse_context12check_arg_idEi">fmt::basic_format_parse_context::check_arg_id (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4NK3fmt26basic_format_parse_context3endEv">fmt::basic_format_parse_context::end (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt26basic_format_parse_context11next_arg_idEv">fmt::basic_format_parse_context::next_arg_id (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0DpEN3fmt19basic_format_stringE">fmt::basic_format_string (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0_6size_t0EN3fmt19basic_memory_bufferE">fmt::basic_memory_buffer (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt19basic_memory_buffer19basic_memory_bufferERR19basic_memory_buffer">fmt::basic_memory_buffer::basic_memory_buffer (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt19basic_memory_buffer4growE6size_t">fmt::basic_memory_buffer::grow (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt19basic_memory_bufferaSERR19basic_memory_buffer">fmt::basic_memory_buffer::operator= (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt19basic_memory_buffer7reserveE6size_t">fmt::basic_memory_buffer::reserve (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt19basic_memory_buffer6resizeE6size_t">fmt::basic_memory_buffer::resize (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt17basic_string_viewE">fmt::basic_string_view (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I00EN3fmt17basic_string_view17basic_string_viewERKNSt12basic_stringI4Char6Traits5AllocEE">fmt::basic_string_view::basic_string_view (C++ function)</a>, <a href="api.html#_CPPv4N3fmt17basic_string_view17basic_string_viewEPK4Char">[1]</a>, <a href="api.html#_CPPv4N3fmt17basic_string_view17basic_string_viewEPK4Char6size_t">[2]</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4NK3fmt17basic_string_view4dataEv">fmt::basic_string_view::data (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4NK3fmt17basic_string_view4sizeEv">fmt::basic_string_view::size (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt2bgEN6detail10color_typeE">fmt::bg (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt6detail6bufferE">fmt::detail::buffer (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt6detail6buffer6appendEvPK1UPK1U">fmt::detail::buffer::append (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4NK3fmt6detail6buffer8capacityEv">fmt::detail::buffer::capacity (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt6detail6buffer5clearEv">fmt::detail::buffer::clear (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt6detail6buffer4dataEv">fmt::detail::buffer::data (C++ function)</a>, <a href="api.html#_CPPv4NK3fmt6detail6buffer4dataEv">[1]</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4NK3fmt6detail6buffer4sizeEv">fmt::detail::buffer::size (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt24dynamic_format_arg_storeE">fmt::dynamic_format_arg_store (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt2fgEN6detail10color_typeE">fmt::fg (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4IDpEN3fmt6formatENSt6stringE13format_stringIDp1TEDpRR1T">fmt::format (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0DpEN3fmt16format_arg_storeE">fmt::format_arg_store (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt11format_argsE">fmt::format_args (C++ type)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt14format_contextE">fmt::format_context (C++ type)</a>
|
||||||
|
</li>
|
||||||
|
</ul></td>
|
||||||
|
<td style="width: 33%; vertical-align: top;"><ul>
|
||||||
|
<li><a href="api.html#_CPPv4IDpEN3fmt13format_stringE">fmt::format_string (C++ type)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt19format_system_errorERN6detail6bufferIcEEiPKc">fmt::format_system_error (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0DpEN3fmt9format_toE8OutputIt8OutputIt13format_stringIDp1TEDpRR1T">fmt::format_to (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0DpEN3fmt11format_to_nE18format_to_n_resultI8OutputItE8OutputIt6size_t13format_stringIDp1TEDpRR1T">fmt::format_to_n (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt18format_to_n_resultE">fmt::format_to_n_result (C++ struct)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt18format_to_n_result3outE">fmt::format_to_n_result::out (C++ member)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt18format_to_n_result4sizeE">fmt::format_to_n_result::size (C++ member)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4IDpEN3fmt14formatted_sizeE6size_t13format_stringIDp1TEDpRR1T">fmt::formatted_size (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0Dp0EN3fmt7fprintfEiPNSt4FILEERK1SDpRK1T">fmt::fprintf (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt6gmtimeENSt6time_tE">fmt::gmtime (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt12group_digitsE17group_digits_viewI1TE1T">fmt::group_digits (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt7is_charE">fmt::is_char (C++ struct)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I00EN3fmt4joinE9join_viewI2It8SentinelE2It8Sentinel11string_view">fmt::join (C++ function)</a>, <a href="api.html#_CPPv4I0EN3fmt4joinE9join_viewIN6detail10iterator_tI5RangeEEN6detail10sentinel_tI5RangeEEERR5Range11string_view">[1]</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt9localtimeENSt6time_tE">fmt::localtime (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0DpEN3fmt16make_format_argsE16format_arg_storeI7ContextDp14remove_cvref_tI4ArgsEEDpRR4Args">fmt::make_format_args (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I_N15detail_exported12fixed_stringEEN3fmtli2_aEDav">fmt::operator""_a (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I_N15detail_exported12fixed_stringEEN3fmtli3_cfEDav">fmt::operator""_cf (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt7ostreamE">fmt::ostream (C++ class)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4IDpEN3fmt7ostream11output_fileE7ostream12cstring_viewDp1T">fmt::ostream::output_file (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4IDpEN3fmt7ostream5printEv13format_stringIDp1TEDpRR1T">fmt::ostream::print (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0DpEN3fmt5printEvRK10text_styleRK1SDpRK4Args">fmt::print (C++ function)</a>, <a href="api.html#_CPPv4IDpEN3fmt5printEv13format_stringIDp1TEDpRR1T">[1]</a>, <a href="api.html#_CPPv4IDpEN3fmt5printEvPNSt4FILEE13format_stringIDp1TEDpRR1T">[2]</a>, <a href="api.html#_CPPv4IDpEN3fmt5printEvRNSt7ostreamE13format_stringIDp1TEDpRR1T">[3]</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0DpEN3fmt6printfEiRK1SDpRK1T">fmt::printf (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt3ptrEPKv1T">fmt::ptr (C++ function)</a>, <a href="api.html#_CPPv4I0EN3fmt3ptrEPKvRKNSt10shared_ptrI1TEE">[1]</a>, <a href="api.html#_CPPv4I0EN3fmt3ptrEPKvRKNSt10unique_ptrI1TEE">[2]</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt7runtimeE11string_view">fmt::runtime (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0Dp0EN3fmt7sprintfENSt12basic_stringI4CharEERK1SDpRK1T">fmt::sprintf (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt8streamedEN6detail13streamed_viewI1TEERK1T">fmt::streamed (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt11string_viewE">fmt::string_view (C++ type)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt6styledEN6detail10styled_argI14remove_cvref_tI1TEEERK1T10text_style">fmt::styled (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4IDpEN3fmt12system_errorENSt12system_errorEi13format_stringIDp1TEDpRR1T">fmt::system_error (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt9to_stringENSt6stringERK1T">fmt::to_string (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt10to_wstringENSt7wstringERK1T">fmt::to_wstring (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4I0EN3fmt10underlyingE12underlying_tI4EnumE4Enum">fmt::underlying (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt7vformatE11string_view11format_args">fmt::vformat (C++ function)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt6vprintE11string_view11format_args">fmt::vprint (C++ function)</a>, <a href="api.html#_CPPv4N3fmt6vprintEPNSt4FILEE11string_view11format_args">[1]</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt15wformat_contextE">fmt::wformat_context (C++ type)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#_CPPv4N3fmt12wstring_viewE">fmt::wstring_view (C++ type)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#c.FMT_COMPILE">FMT_COMPILE (C macro)</a>
|
||||||
|
</li>
|
||||||
|
<li><a href="api.html#c.FMT_STRING">FMT_STRING (C macro)</a>
|
||||||
|
</li>
|
||||||
|
</ul></td>
|
||||||
|
</tr></table>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="footer" role="contentinfo">
|
||||||
|
© Copyright 2012-present, Victor Zverovich.
|
||||||
|
Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<script src="_static/bootstrap.min.js"></script>
|
||||||
|
|
||||||
|
</body>
|
||||||
|
</html>
|
325
externals/fmt/doc/html/index.html
vendored
Normal file
325
externals/fmt/doc/html/index.html
vendored
Normal file
@ -0,0 +1,325 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
|
||||||
|
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<meta http-equiv="X-UA-Compatible" content="IE=edge">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
|
||||||
|
<meta name="generator" content="Docutils 0.17.1: http://docutils.sourceforge.net/" />
|
||||||
|
|
||||||
|
<title>Overview — fmt 9.1.0 documentation</title>
|
||||||
|
|
||||||
|
<link rel="stylesheet" href="_static/basic.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/pygments.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/breathe.css" type="text/css" />
|
||||||
|
|
||||||
|
<script type="text/javascript">
|
||||||
|
var DOCUMENTATION_OPTIONS = {
|
||||||
|
URL_ROOT: './',
|
||||||
|
VERSION: '9.1.0',
|
||||||
|
COLLAPSE_INDEX: false,
|
||||||
|
FILE_SUFFIX: '.html',
|
||||||
|
LINK_SUFFIX: '.html',
|
||||||
|
SOURCELINK_SUFFIX: '.txt',
|
||||||
|
HAS_SOURCE: true,
|
||||||
|
SOURCELINK_SUFFIX: '.txt'
|
||||||
|
};
|
||||||
|
</script>
|
||||||
|
<script src="_static/jquery.js"></script>
|
||||||
|
<script src="_static/underscore.js"></script>
|
||||||
|
<script src="_static/doctools.js"></script>
|
||||||
|
<script src="_static/language_data.js"></script>
|
||||||
|
<link rel="index" title="Index" href="genindex.html" />
|
||||||
|
<link rel="search" title="Search" href="search.html" />
|
||||||
|
<meta name="description" content="Small, safe and fast formatting library">
|
||||||
|
<meta name="keywords" content="C++, formatting, printf, string, library">
|
||||||
|
<meta name="author" content="Victor Zverovich">
|
||||||
|
<link rel="stylesheet" href="_static/fmt.css">
|
||||||
|
|
||||||
|
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
|
||||||
|
<script>
|
||||||
|
window.dataLayer = window.dataLayer || [];
|
||||||
|
function gtag(){dataLayer.push(arguments);}
|
||||||
|
gtag('js', new Date());
|
||||||
|
|
||||||
|
gtag('config', 'UA-20116650-4');
|
||||||
|
</script>
|
||||||
|
|
||||||
|
</head>
|
||||||
|
<body role="document">
|
||||||
|
<nav class="navbar navbar-inverse">
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
<div class="navbar-content">
|
||||||
|
|
||||||
|
<div class="navbar-header">
|
||||||
|
<button type="button" class="navbar-toggle collapsed"
|
||||||
|
data-toggle="collapse" data-target=".navbar-collapse">
|
||||||
|
<span class="sr-only">Toggle navigation</span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
</button>
|
||||||
|
<a class="navbar-brand" href="index.html">{fmt}</a>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
<div class="collapse navbar-collapse">
|
||||||
|
<ul class="nav navbar-nav">
|
||||||
|
<li class="dropdown">
|
||||||
|
<a href="#" class="dropdown-toggle" data-toggle="dropdown"
|
||||||
|
role="button" aria-expanded="false">9.1.0
|
||||||
|
<span class="caret"></span></a>
|
||||||
|
<ul class="dropdown-menu" role="menu">
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="contents.html">Contents</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="usage.html">Usage</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="api.html">API</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="syntax.html">Syntax</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
|
||||||
|
|
||||||
|
<form class="navbar-form navbar-right" role="search" action="search.html"
|
||||||
|
method="get">
|
||||||
|
<div class="form-group">
|
||||||
|
<input type="text" name="q" class="form-control"
|
||||||
|
placeholder="Search" >
|
||||||
|
</div>
|
||||||
|
<input type="hidden" name="check_keywords" value="yes" />
|
||||||
|
<input type="hidden" name="area" value="default" />
|
||||||
|
|
||||||
|
</form>
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</nav>
|
||||||
|
|
||||||
|
|
||||||
|
<div class="jumbotron">
|
||||||
|
<div class="tb-container">
|
||||||
|
<h1>{fmt}</h1>
|
||||||
|
<p class="lead">A modern formatting library</p>
|
||||||
|
<div class="btn-group" role="group">
|
||||||
|
|
||||||
|
<a class="btn btn-success"
|
||||||
|
href="https://github.com/fmtlib/fmt/releases/download/9.1.0/fmt-9.1.0.zip">
|
||||||
|
<span class="glyphicon glyphicon-download"></span> Download
|
||||||
|
</a>
|
||||||
|
<button type="button" class="btn btn-success dropdown-toggle"
|
||||||
|
data-toggle="dropdown"><span class="caret"></span></button>
|
||||||
|
<ul class="dropdown-menu">
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="https://github.com/fmtlib/fmt/releases/download/9.1.0/fmt-9.1.0.zip">Version 9.1.0
|
||||||
|
</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="https://github.com/fmtlib/fmt/releases/download/9.0.0/fmt-9.0.0.zip">Version 9.0.0
|
||||||
|
</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="https://github.com/fmtlib/fmt/releases/download/8.1.1/fmt-8.1.1.zip">Version 8.1.1
|
||||||
|
</a></li>
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
|
||||||
|
|
||||||
|
<div class="content">
|
||||||
|
|
||||||
|
<section id="overview">
|
||||||
|
<h1>Overview<a class="headerlink" href="#overview" title="Permalink to this headline">¶</a></h1>
|
||||||
|
<p><strong>{fmt}</strong> is an open-source formatting library providing a fast and safe
|
||||||
|
alternative to C stdio and C++ iostreams.</p>
|
||||||
|
<div class="panel panel-default">
|
||||||
|
<div class="panel-heading">What users say:</div>
|
||||||
|
<div class="panel-body">
|
||||||
|
Thanks for creating this library. It’s been a hole in C++ for
|
||||||
|
a long time. I’ve used both <code>boost::format</code> and
|
||||||
|
<code>loki::SPrintf</code>, and neither felt like the right answer.
|
||||||
|
This does.
|
||||||
|
</div>
|
||||||
|
</div><section id="format-api">
|
||||||
|
<span id="format-api-intro"></span><h2>Format API<a class="headerlink" href="#format-api" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>The format API is similar in spirit to the C <code class="docutils literal notranslate"><span class="pre">printf</span></code> family of function but
|
||||||
|
is safer, simpler and several times <a class="reference external" href="https://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html">faster</a>
|
||||||
|
than common standard library implementations.
|
||||||
|
The <a class="reference external" href="syntax.html">format string syntax</a> is similar to the one used by
|
||||||
|
<a class="reference external" href="https://docs.python.org/3/library/stdtypes.html#str.format">str.format</a> in
|
||||||
|
Python:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">std</span><span class="o">::</span><span class="n">string</span><span class="w"> </span><span class="n">s</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"The answer is {}."</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>The <code class="docutils literal notranslate"><span class="pre">fmt::format</span></code> function returns a string “The answer is 42.”. You can use
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">fmt::memory_buffer</span></code> to avoid constructing <code class="docutils literal notranslate"><span class="pre">std::string</span></code>:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="k">auto</span><span class="w"> </span><span class="n">out</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">memory_buffer</span><span class="p">();</span><span class="w"></span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format_to</span><span class="p">(</span><span class="n">std</span><span class="o">::</span><span class="n">back_inserter</span><span class="p">(</span><span class="n">out</span><span class="p">),</span><span class="w"></span>
|
||||||
|
<span class="w"> </span><span class="s">"For a moment, {} happened."</span><span class="p">,</span><span class="w"> </span><span class="s">"nothing"</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="k">auto</span><span class="w"> </span><span class="n">data</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">out</span><span class="p">.</span><span class="n">data</span><span class="p">();</span><span class="w"> </span><span class="c1">// pointer to the formatted data</span>
|
||||||
|
<span class="k">auto</span><span class="w"> </span><span class="n">size</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">out</span><span class="p">.</span><span class="n">size</span><span class="p">();</span><span class="w"> </span><span class="c1">// size of the formatted data</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>The <code class="docutils literal notranslate"><span class="pre">fmt::print</span></code> function performs formatting and writes the result to a stream:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="n">stderr</span><span class="p">,</span><span class="w"> </span><span class="s">"System error code = {}</span><span class="se">\n</span><span class="s">"</span><span class="p">,</span><span class="w"> </span><span class="n">errno</span><span class="p">);</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>If you omit the file argument the function will print to <code class="docutils literal notranslate"><span class="pre">stdout</span></code>:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">"Don't {}</span><span class="se">\n</span><span class="s">"</span><span class="p">,</span><span class="w"> </span><span class="s">"panic"</span><span class="p">);</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>The format API also supports positional arguments useful for localization:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">"I'd rather be {1} than {0}."</span><span class="p">,</span><span class="w"> </span><span class="s">"right"</span><span class="p">,</span><span class="w"> </span><span class="s">"happy"</span><span class="p">);</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>You can pass named arguments with <code class="docutils literal notranslate"><span class="pre">fmt::arg</span></code>:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">"Hello, {name}! The answer is {number}. Goodbye, {name}."</span><span class="p">,</span><span class="w"></span>
|
||||||
|
<span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">arg</span><span class="p">(</span><span class="s">"name"</span><span class="p">,</span><span class="w"> </span><span class="s">"World"</span><span class="p">),</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">arg</span><span class="p">(</span><span class="s">"number"</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">));</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>If your compiler supports C++11 user-defined literals, the suffix <code class="docutils literal notranslate"><span class="pre">_a</span></code> offers
|
||||||
|
an alternative, slightly terser syntax for named arguments:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="k">using</span><span class="w"> </span><span class="k">namespace</span><span class="w"> </span><span class="nn">fmt</span><span class="o">::</span><span class="nn">literals</span><span class="p">;</span><span class="w"></span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">"Hello, {name}! The answer is {number}. Goodbye, {name}."</span><span class="p">,</span><span class="w"></span>
|
||||||
|
<span class="w"> </span><span class="s">"name"</span><span class="n">_a</span><span class="o">=</span><span class="s">"World"</span><span class="p">,</span><span class="w"> </span><span class="s">"number"</span><span class="n">_a</span><span class="o">=</span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
<section id="safety">
|
||||||
|
<span id="id1"></span><h2>Safety<a class="headerlink" href="#safety" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>The library is fully type safe, automatic memory management prevents buffer
|
||||||
|
overflow, errors in format strings are reported using exceptions or at compile
|
||||||
|
time. For example, the code</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"The answer is {:d}"</span><span class="p">,</span><span class="w"> </span><span class="s">"forty-two"</span><span class="p">);</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>throws the <code class="docutils literal notranslate"><span class="pre">format_error</span></code> exception because the argument <code class="docutils literal notranslate"><span class="pre">"forty-two"</span></code> is a
|
||||||
|
string while the format code <code class="docutils literal notranslate"><span class="pre">d</span></code> only applies to integers.</p>
|
||||||
|
<p>The code</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">format</span><span class="p">(</span><span class="n">FMT_STRING</span><span class="p">(</span><span class="s">"The answer is {:d}"</span><span class="p">),</span><span class="w"> </span><span class="s">"forty-two"</span><span class="p">);</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>reports a compile-time error on compilers that support relaxed <code class="docutils literal notranslate"><span class="pre">constexpr</span></code>.
|
||||||
|
See <a class="reference external" href="api.html#compile-time-format-string-checks">here</a> for details.</p>
|
||||||
|
<p>The following code</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span>fmt::format("Cyrillic letter {}", L'\x42e');
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>produces a compile-time error because wide character <code class="docutils literal notranslate"><span class="pre">L'\x42e'</span></code> cannot be
|
||||||
|
formatted into a narrow string. For comparison, writing a wide character to
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">std::ostream</span></code> results in its numeric value being written to the stream
|
||||||
|
(i.e. 1070 instead of letter ‘ю’ which is represented by <code class="docutils literal notranslate"><span class="pre">L'\x42e'</span></code> if we
|
||||||
|
use Unicode) which is rarely desirable.</p>
|
||||||
|
</section>
|
||||||
|
<section id="compact-binary-code">
|
||||||
|
<h2>Compact Binary Code<a class="headerlink" href="#compact-binary-code" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>The library produces compact per-call compiled code. For example
|
||||||
|
(<a class="reference external" href="https://godbolt.org/g/TZU4KF">godbolt</a>),</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="cp">#include</span><span class="w"> </span><span class="cpf"><fmt/core.h></span><span class="cp"></span>
|
||||||
|
|
||||||
|
<span class="kt">int</span><span class="w"> </span><span class="nf">main</span><span class="p">()</span><span class="w"> </span><span class="p">{</span><span class="w"></span>
|
||||||
|
<span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">"The answer is {}."</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="p">}</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>compiles to just</p>
|
||||||
|
<div class="highlight-asm notranslate"><div class="highlight"><pre><span></span>main: # @main
|
||||||
|
sub rsp, 24
|
||||||
|
mov qword ptr [rsp], 42
|
||||||
|
mov rcx, rsp
|
||||||
|
mov edi, offset .L.str
|
||||||
|
mov esi, 17
|
||||||
|
mov edx, 1
|
||||||
|
call fmt::v7::vprint(fmt::v7::basic_string_view<char>, fmt::v7::format_args)
|
||||||
|
xor eax, eax
|
||||||
|
add rsp, 24
|
||||||
|
ret
|
||||||
|
.L.str:
|
||||||
|
.asciz "The answer is {}."
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
<section id="portability">
|
||||||
|
<span id="id2"></span><h2>Portability<a class="headerlink" href="#portability" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>The library is highly portable and relies only on a small set of C++11 features:</p>
|
||||||
|
<ul class="simple">
|
||||||
|
<li><p>variadic templates</p></li>
|
||||||
|
<li><p>type traits</p></li>
|
||||||
|
<li><p>rvalue references</p></li>
|
||||||
|
<li><p>decltype</p></li>
|
||||||
|
<li><p>trailing return types</p></li>
|
||||||
|
<li><p>deleted functions</p></li>
|
||||||
|
<li><p>alias templates</p></li>
|
||||||
|
</ul>
|
||||||
|
<p>These are available in GCC 4.8, Clang 3.4, MSVC 19.0 (2015) and more recent
|
||||||
|
compiler version. For older compilers use {fmt} <a class="reference external" href="https://github.com/fmtlib/fmt/releases/tag/4.1.0">version 4.x</a> which is maintained and
|
||||||
|
only requires C++98.</p>
|
||||||
|
<p>The output of all formatting functions is consistent across platforms.
|
||||||
|
For example,</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">"{}"</span><span class="p">,</span><span class="w"> </span><span class="n">std</span><span class="o">::</span><span class="n">numeric_limits</span><span class="o"><</span><span class="kt">double</span><span class="o">>::</span><span class="n">infinity</span><span class="p">());</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>always prints <code class="docutils literal notranslate"><span class="pre">inf</span></code> while the output of <code class="docutils literal notranslate"><span class="pre">printf</span></code> is platform-dependent.</p>
|
||||||
|
</section>
|
||||||
|
<section id="ease-of-use">
|
||||||
|
<span id="id3"></span><h2>Ease of Use<a class="headerlink" href="#ease-of-use" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>{fmt} has a small self-contained code base with the core library consisting of
|
||||||
|
just three header files and no external dependencies.
|
||||||
|
A permissive MIT <a class="reference external" href="https://github.com/fmtlib/fmt#license">license</a> allows
|
||||||
|
using the library both in open-source and commercial projects.</p>
|
||||||
|
<p><a class="reference external" href="contents.html">Learn more…</a></p>
|
||||||
|
<a class="btn btn-success" href="https://github.com/fmtlib/fmt">GitHub Repository</a>
|
||||||
|
|
||||||
|
<div class="section footer">
|
||||||
|
<iframe src="https://ghbtns.com/github-btn.html?user=fmtlib&repo=fmt&type=watch&count=true"
|
||||||
|
class="github-btn" width="100" height="20"></iframe>
|
||||||
|
</div></section>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="footer" role="contentinfo">
|
||||||
|
© Copyright 2012-present, Victor Zverovich.
|
||||||
|
Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<script src="_static/bootstrap.min.js"></script>
|
||||||
|
|
||||||
|
</body>
|
||||||
|
</html>
|
BIN
externals/fmt/doc/html/objects.inv
vendored
Normal file
BIN
externals/fmt/doc/html/objects.inv
vendored
Normal file
Binary file not shown.
171
externals/fmt/doc/html/search.html
vendored
Normal file
171
externals/fmt/doc/html/search.html
vendored
Normal file
@ -0,0 +1,171 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
|
||||||
|
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<meta http-equiv="X-UA-Compatible" content="IE=edge">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
|
||||||
|
|
||||||
|
<title>Search — fmt 9.1.0 documentation</title>
|
||||||
|
|
||||||
|
<link rel="stylesheet" href="_static/basic.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/pygments.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/breathe.css" type="text/css" />
|
||||||
|
|
||||||
|
<script type="text/javascript">
|
||||||
|
var DOCUMENTATION_OPTIONS = {
|
||||||
|
URL_ROOT: './',
|
||||||
|
VERSION: '9.1.0',
|
||||||
|
COLLAPSE_INDEX: false,
|
||||||
|
FILE_SUFFIX: '.html',
|
||||||
|
LINK_SUFFIX: '.html',
|
||||||
|
SOURCELINK_SUFFIX: '.txt',
|
||||||
|
HAS_SOURCE: true,
|
||||||
|
SOURCELINK_SUFFIX: '.txt'
|
||||||
|
};
|
||||||
|
</script>
|
||||||
|
<script src="_static/jquery.js"></script>
|
||||||
|
<script src="_static/underscore.js"></script>
|
||||||
|
<script src="_static/doctools.js"></script>
|
||||||
|
<script src="_static/language_data.js"></script>
|
||||||
|
<script src="_static/searchtools.js"></script>
|
||||||
|
<link rel="index" title="Index" href="genindex.html" />
|
||||||
|
<link rel="search" title="Search" href="#" />
|
||||||
|
<script type="text/javascript">
|
||||||
|
jQuery(function() { Search.loadIndex("searchindex.js"); });
|
||||||
|
</script>
|
||||||
|
|
||||||
|
<script type="text/javascript" id="searchindexloader"></script>
|
||||||
|
|
||||||
|
<meta name="description" content="Small, safe and fast formatting library">
|
||||||
|
<meta name="keywords" content="C++, formatting, printf, string, library">
|
||||||
|
<meta name="author" content="Victor Zverovich">
|
||||||
|
<link rel="stylesheet" href="_static/fmt.css">
|
||||||
|
|
||||||
|
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
|
||||||
|
<script>
|
||||||
|
window.dataLayer = window.dataLayer || [];
|
||||||
|
function gtag(){dataLayer.push(arguments);}
|
||||||
|
gtag('js', new Date());
|
||||||
|
|
||||||
|
gtag('config', 'UA-20116650-4');
|
||||||
|
</script>
|
||||||
|
|
||||||
|
|
||||||
|
</head>
|
||||||
|
<body role="document">
|
||||||
|
<nav class="navbar navbar-inverse">
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
<div class="navbar-content">
|
||||||
|
|
||||||
|
<div class="navbar-header">
|
||||||
|
<button type="button" class="navbar-toggle collapsed"
|
||||||
|
data-toggle="collapse" data-target=".navbar-collapse">
|
||||||
|
<span class="sr-only">Toggle navigation</span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
</button>
|
||||||
|
<a class="navbar-brand" href="index.html">{fmt}</a>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
<div class="collapse navbar-collapse">
|
||||||
|
<ul class="nav navbar-nav">
|
||||||
|
<li class="dropdown">
|
||||||
|
<a href="#" class="dropdown-toggle" data-toggle="dropdown"
|
||||||
|
role="button" aria-expanded="false">9.1.0
|
||||||
|
<span class="caret"></span></a>
|
||||||
|
<ul class="dropdown-menu" role="menu">
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="contents.html">Contents</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="usage.html">Usage</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="api.html">API</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="syntax.html">Syntax</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</nav>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
|
||||||
|
|
||||||
|
<div class="content">
|
||||||
|
|
||||||
|
<h1 id="search-documentation">Search</h1>
|
||||||
|
<div id="fallback" class="admonition warning">
|
||||||
|
<script type="text/javascript">$('#fallback').hide();</script>
|
||||||
|
<p>
|
||||||
|
Please activate JavaScript to enable the search
|
||||||
|
functionality.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
<p>
|
||||||
|
From here you can search these documents. Enter your search
|
||||||
|
words into the box below and click "search". Note that the search
|
||||||
|
function will automatically search for all of the words. Pages
|
||||||
|
containing fewer words won't appear in the result list.
|
||||||
|
</p>
|
||||||
|
|
||||||
|
<form class="form-inline" role="search" action="#"
|
||||||
|
method="get">
|
||||||
|
<div class="form-group">
|
||||||
|
<input type="text" name="q" class="form-control"
|
||||||
|
>
|
||||||
|
</div>
|
||||||
|
<input type="hidden" name="check_keywords" value="yes" />
|
||||||
|
<input type="hidden" name="area" value="default" />
|
||||||
|
|
||||||
|
<input type="submit" class="btn btn-default" value="search">
|
||||||
|
|
||||||
|
</form>
|
||||||
|
|
||||||
|
<div id="search-results">
|
||||||
|
|
||||||
|
</div>
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="footer" role="contentinfo">
|
||||||
|
© Copyright 2012-present, Victor Zverovich.
|
||||||
|
Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<script src="_static/bootstrap.min.js"></script>
|
||||||
|
|
||||||
|
</body>
|
||||||
|
</html>
|
1
externals/fmt/doc/html/searchindex.js
vendored
Normal file
1
externals/fmt/doc/html/searchindex.js
vendored
Normal file
File diff suppressed because one or more lines are too long
657
externals/fmt/doc/html/syntax.html
vendored
Normal file
657
externals/fmt/doc/html/syntax.html
vendored
Normal file
@ -0,0 +1,657 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
|
||||||
|
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<meta http-equiv="X-UA-Compatible" content="IE=edge">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
|
||||||
|
<meta name="generator" content="Docutils 0.17.1: http://docutils.sourceforge.net/" />
|
||||||
|
|
||||||
|
<title>Format String Syntax — fmt 9.1.0 documentation</title>
|
||||||
|
|
||||||
|
<link rel="stylesheet" href="_static/basic.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/pygments.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/breathe.css" type="text/css" />
|
||||||
|
|
||||||
|
<script type="text/javascript">
|
||||||
|
var DOCUMENTATION_OPTIONS = {
|
||||||
|
URL_ROOT: './',
|
||||||
|
VERSION: '9.1.0',
|
||||||
|
COLLAPSE_INDEX: false,
|
||||||
|
FILE_SUFFIX: '.html',
|
||||||
|
LINK_SUFFIX: '.html',
|
||||||
|
SOURCELINK_SUFFIX: '.txt',
|
||||||
|
HAS_SOURCE: true,
|
||||||
|
SOURCELINK_SUFFIX: '.txt'
|
||||||
|
};
|
||||||
|
</script>
|
||||||
|
<script src="_static/jquery.js"></script>
|
||||||
|
<script src="_static/underscore.js"></script>
|
||||||
|
<script src="_static/doctools.js"></script>
|
||||||
|
<script src="_static/language_data.js"></script>
|
||||||
|
<link rel="index" title="Index" href="genindex.html" />
|
||||||
|
<link rel="search" title="Search" href="search.html" />
|
||||||
|
<meta name="description" content="Small, safe and fast formatting library">
|
||||||
|
<meta name="keywords" content="C++, formatting, printf, string, library">
|
||||||
|
<meta name="author" content="Victor Zverovich">
|
||||||
|
<link rel="stylesheet" href="_static/fmt.css">
|
||||||
|
|
||||||
|
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
|
||||||
|
<script>
|
||||||
|
window.dataLayer = window.dataLayer || [];
|
||||||
|
function gtag(){dataLayer.push(arguments);}
|
||||||
|
gtag('js', new Date());
|
||||||
|
|
||||||
|
gtag('config', 'UA-20116650-4');
|
||||||
|
</script>
|
||||||
|
|
||||||
|
</head>
|
||||||
|
<body role="document">
|
||||||
|
<nav class="navbar navbar-inverse">
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
<div class="navbar-content">
|
||||||
|
|
||||||
|
<div class="navbar-header">
|
||||||
|
<button type="button" class="navbar-toggle collapsed"
|
||||||
|
data-toggle="collapse" data-target=".navbar-collapse">
|
||||||
|
<span class="sr-only">Toggle navigation</span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
</button>
|
||||||
|
<a class="navbar-brand" href="index.html">{fmt}</a>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
<div class="collapse navbar-collapse">
|
||||||
|
<ul class="nav navbar-nav">
|
||||||
|
<li class="dropdown">
|
||||||
|
<a href="#" class="dropdown-toggle" data-toggle="dropdown"
|
||||||
|
role="button" aria-expanded="false">9.1.0
|
||||||
|
<span class="caret"></span></a>
|
||||||
|
<ul class="dropdown-menu" role="menu">
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="contents.html">Contents</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="usage.html">Usage</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="api.html">API</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li class="active"><a href="syntax.html">Syntax
|
||||||
|
<span class="sr-only">(current)</span></a></li>
|
||||||
|
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
|
||||||
|
|
||||||
|
<form class="navbar-form navbar-right" role="search" action="search.html"
|
||||||
|
method="get">
|
||||||
|
<div class="form-group">
|
||||||
|
<input type="text" name="q" class="form-control"
|
||||||
|
placeholder="Search" >
|
||||||
|
</div>
|
||||||
|
<input type="hidden" name="check_keywords" value="yes" />
|
||||||
|
<input type="hidden" name="area" value="default" />
|
||||||
|
|
||||||
|
</form>
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</nav>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
|
||||||
|
|
||||||
|
<div class="content">
|
||||||
|
|
||||||
|
<section id="format-string-syntax">
|
||||||
|
<span id="syntax"></span><h1>Format String Syntax<a class="headerlink" href="#format-string-syntax" title="Permalink to this headline">¶</a></h1>
|
||||||
|
<p>Formatting functions such as <a class="reference internal" href="api.html#format"><span class="std std-ref">fmt::format()</span></a> and
|
||||||
|
<a class="reference internal" href="api.html#print"><span class="std std-ref">fmt::print()</span></a> use the same format string syntax described in this
|
||||||
|
section.</p>
|
||||||
|
<p>Format strings contain “replacement fields” surrounded by curly braces <code class="docutils literal notranslate"><span class="pre">{}</span></code>.
|
||||||
|
Anything that is not contained in braces is considered literal text, which is
|
||||||
|
copied unchanged to the output. If you need to include a brace character in the
|
||||||
|
literal text, it can be escaped by doubling: <code class="docutils literal notranslate"><span class="pre">{{</span></code> and <code class="docutils literal notranslate"><span class="pre">}}</span></code>.</p>
|
||||||
|
<p>The grammar for a replacement field is as follows:</p>
|
||||||
|
<pre>
|
||||||
|
<strong id="grammar-token-sf-replacement_field"><span id="grammar-token-replacement-field"></span>replacement_field</strong> ::= "{" [<a class="reference internal" href="#grammar-token-sf-arg_id"><code class="xref docutils literal notranslate"><span class="pre">arg_id</span></code></a>] [":" (<a class="reference internal" href="#grammar-token-sf-format_spec"><code class="xref docutils literal notranslate"><span class="pre">format_spec</span></code></a> | <a class="reference internal" href="#grammar-token-sf-chrono_format_spec"><code class="xref docutils literal notranslate"><span class="pre">chrono_format_spec</span></code></a>)] "}"
|
||||||
|
<strong id="grammar-token-sf-arg_id"><span id="grammar-token-arg-id"></span>arg_id </strong> ::= <a class="reference internal" href="#grammar-token-sf-integer"><code class="xref docutils literal notranslate"><span class="pre">integer</span></code></a> | <a class="reference internal" href="#grammar-token-sf-identifier"><code class="xref docutils literal notranslate"><span class="pre">identifier</span></code></a>
|
||||||
|
<strong id="grammar-token-sf-integer"><span id="grammar-token-integer"></span>integer </strong> ::= <a class="reference internal" href="#grammar-token-sf-digit"><code class="xref docutils literal notranslate"><span class="pre">digit</span></code></a>+
|
||||||
|
<strong id="grammar-token-sf-digit"><span id="grammar-token-digit"></span>digit </strong> ::= "0"..."9"
|
||||||
|
<strong id="grammar-token-sf-identifier"><span id="grammar-token-identifier"></span>identifier </strong> ::= <a class="reference internal" href="#grammar-token-sf-id_start"><code class="xref docutils literal notranslate"><span class="pre">id_start</span></code></a> <a class="reference internal" href="#grammar-token-sf-id_continue"><code class="xref docutils literal notranslate"><span class="pre">id_continue</span></code></a>*
|
||||||
|
<strong id="grammar-token-sf-id_start"><span id="grammar-token-id-start"></span>id_start </strong> ::= "a"..."z" | "A"..."Z" | "_"
|
||||||
|
<strong id="grammar-token-sf-id_continue"><span id="grammar-token-id-continue"></span>id_continue </strong> ::= <a class="reference internal" href="#grammar-token-sf-id_start"><code class="xref docutils literal notranslate"><span class="pre">id_start</span></code></a> | <a class="reference internal" href="#grammar-token-sf-digit"><code class="xref docutils literal notranslate"><span class="pre">digit</span></code></a>
|
||||||
|
</pre>
|
||||||
|
<p>In less formal terms, the replacement field can start with an <em>arg_id</em>
|
||||||
|
that specifies the argument whose value is to be formatted and inserted into
|
||||||
|
the output instead of the replacement field.
|
||||||
|
The <em>arg_id</em> is optionally followed by a <em>format_spec</em>, which is preceded by a
|
||||||
|
colon <code class="docutils literal notranslate"><span class="pre">':'</span></code>. These specify a non-default format for the replacement value.</p>
|
||||||
|
<p>See also the <a class="reference internal" href="#formatspec"><span class="std std-ref">Format Specification Mini-Language</span></a> section.</p>
|
||||||
|
<p>If the numerical arg_ids in a format string are 0, 1, 2, … in sequence,
|
||||||
|
they can all be omitted (not just some) and the numbers 0, 1, 2, … will be
|
||||||
|
automatically inserted in that order.</p>
|
||||||
|
<p>Named arguments can be referred to by their names or indices.</p>
|
||||||
|
<p>Some simple format string examples:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="s">"First, thou shalt count to {0}"</span><span class="w"> </span><span class="c1">// References the first argument</span>
|
||||||
|
<span class="s">"Bring me a {}"</span><span class="w"> </span><span class="c1">// Implicitly references the first argument</span>
|
||||||
|
<span class="s">"From {} to {}"</span><span class="w"> </span><span class="c1">// Same as "From {0} to {1}"</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>The <em>format_spec</em> field contains a specification of how the value should be
|
||||||
|
presented, including such details as field width, alignment, padding, decimal
|
||||||
|
precision and so on. Each value type can define its own “formatting
|
||||||
|
mini-language” or interpretation of the <em>format_spec</em>.</p>
|
||||||
|
<p>Most built-in types support a common formatting mini-language, which is
|
||||||
|
described in the next section.</p>
|
||||||
|
<p>A <em>format_spec</em> field can also include nested replacement fields in certain
|
||||||
|
positions within it. These nested replacement fields can contain only an
|
||||||
|
argument id; format specifications are not allowed. This allows the formatting
|
||||||
|
of a value to be dynamically specified.</p>
|
||||||
|
<p>See the <a class="reference internal" href="#formatexamples"><span class="std std-ref">Format Examples</span></a> section for some examples.</p>
|
||||||
|
<section id="format-specification-mini-language">
|
||||||
|
<span id="formatspec"></span><h2>Format Specification Mini-Language<a class="headerlink" href="#format-specification-mini-language" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>“Format specifications” are used within replacement fields contained within a
|
||||||
|
format string to define how individual values are presented (see
|
||||||
|
<a class="reference internal" href="#syntax"><span class="std std-ref">Format String Syntax</span></a>). Each formattable type may define how the format
|
||||||
|
specification is to be interpreted.</p>
|
||||||
|
<p>Most built-in types implement the following options for format specifications,
|
||||||
|
although some of the formatting options are only supported by the numeric types.</p>
|
||||||
|
<p>The general form of a <em>standard format specifier</em> is:</p>
|
||||||
|
<pre>
|
||||||
|
<strong id="grammar-token-sf-format_spec"><span id="grammar-token-format-spec"></span>format_spec</strong> ::= [[<a class="reference internal" href="#grammar-token-sf-fill"><code class="xref docutils literal notranslate"><span class="pre">fill</span></code></a>]<a class="reference internal" href="#grammar-token-sf-align"><code class="xref docutils literal notranslate"><span class="pre">align</span></code></a>][<a class="reference internal" href="#grammar-token-sf-sign"><code class="xref docutils literal notranslate"><span class="pre">sign</span></code></a>]["#"]["0"][<a class="reference internal" href="#grammar-token-sf-width"><code class="xref docutils literal notranslate"><span class="pre">width</span></code></a>]["." <a class="reference internal" href="#grammar-token-sf-precision"><code class="xref docutils literal notranslate"><span class="pre">precision</span></code></a>]["L"][<a class="reference internal" href="#grammar-token-sf-type"><code class="xref docutils literal notranslate"><span class="pre">type</span></code></a>]
|
||||||
|
<strong id="grammar-token-sf-fill"><span id="grammar-token-fill"></span>fill </strong> ::= <a character other than '{' or '}'>
|
||||||
|
<strong id="grammar-token-sf-align"><span id="grammar-token-align"></span>align </strong> ::= "<" | ">" | "^"
|
||||||
|
<strong id="grammar-token-sf-sign"><span id="grammar-token-sign"></span>sign </strong> ::= "+" | "-" | " "
|
||||||
|
<strong id="grammar-token-sf-width"><span id="grammar-token-width"></span>width </strong> ::= <a class="reference internal" href="#grammar-token-sf-integer"><code class="xref docutils literal notranslate"><span class="pre">integer</span></code></a> | "{" [<a class="reference internal" href="#grammar-token-sf-arg_id"><code class="xref docutils literal notranslate"><span class="pre">arg_id</span></code></a>] "}"
|
||||||
|
<strong id="grammar-token-sf-precision"><span id="grammar-token-precision"></span>precision </strong> ::= <a class="reference internal" href="#grammar-token-sf-integer"><code class="xref docutils literal notranslate"><span class="pre">integer</span></code></a> | "{" [<a class="reference internal" href="#grammar-token-sf-arg_id"><code class="xref docutils literal notranslate"><span class="pre">arg_id</span></code></a>] "}"
|
||||||
|
<strong id="grammar-token-sf-type"><span id="grammar-token-type"></span>type </strong> ::= "a" | "A" | "b" | "B" | "c" | "d" | "e" | "E" | "f" | "F" | "g" | "G" |
|
||||||
|
"o" | "p" | "s" | "x" | "X"
|
||||||
|
</pre>
|
||||||
|
<p>The <em>fill</em> character can be any Unicode code point other than <code class="docutils literal notranslate"><span class="pre">'{'</span></code> or
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">'}'</span></code>. The presence of a fill character is signaled by the character following
|
||||||
|
it, which must be one of the alignment options. If the second character of
|
||||||
|
<em>format_spec</em> is not a valid alignment option, then it is assumed that both the
|
||||||
|
fill character and the alignment option are absent.</p>
|
||||||
|
<p>The meaning of the various alignment options is as follows:</p>
|
||||||
|
<table class="docutils align-default">
|
||||||
|
<colgroup>
|
||||||
|
<col style="width: 13%" />
|
||||||
|
<col style="width: 87%" />
|
||||||
|
</colgroup>
|
||||||
|
<thead>
|
||||||
|
<tr class="row-odd"><th class="head"><p>Option</p></th>
|
||||||
|
<th class="head"><p>Meaning</p></th>
|
||||||
|
</tr>
|
||||||
|
</thead>
|
||||||
|
<tbody>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'<'</span></code></p></td>
|
||||||
|
<td><p>Forces the field to be left-aligned within the available
|
||||||
|
space (this is the default for most objects).</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'>'</span></code></p></td>
|
||||||
|
<td><p>Forces the field to be right-aligned within the
|
||||||
|
available space (this is the default for numbers).</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'^'</span></code></p></td>
|
||||||
|
<td><p>Forces the field to be centered within the available
|
||||||
|
space.</p></td>
|
||||||
|
</tr>
|
||||||
|
</tbody>
|
||||||
|
</table>
|
||||||
|
<p>Note that unless a minimum field width is defined, the field width will always
|
||||||
|
be the same size as the data to fill it, so that the alignment option has no
|
||||||
|
meaning in this case.</p>
|
||||||
|
<p>The <em>sign</em> option is only valid for number types, and can be one of the
|
||||||
|
following:</p>
|
||||||
|
<table class="docutils align-default">
|
||||||
|
<colgroup>
|
||||||
|
<col style="width: 13%" />
|
||||||
|
<col style="width: 87%" />
|
||||||
|
</colgroup>
|
||||||
|
<thead>
|
||||||
|
<tr class="row-odd"><th class="head"><p>Option</p></th>
|
||||||
|
<th class="head"><p>Meaning</p></th>
|
||||||
|
</tr>
|
||||||
|
</thead>
|
||||||
|
<tbody>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'+'</span></code></p></td>
|
||||||
|
<td><p>indicates that a sign should be used for both
|
||||||
|
nonnegative as well as negative numbers.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'-'</span></code></p></td>
|
||||||
|
<td><p>indicates that a sign should be used only for negative
|
||||||
|
numbers (this is the default behavior).</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p>space</p></td>
|
||||||
|
<td><p>indicates that a leading space should be used on
|
||||||
|
nonnegative numbers, and a minus sign on negative numbers.</p></td>
|
||||||
|
</tr>
|
||||||
|
</tbody>
|
||||||
|
</table>
|
||||||
|
<p>The <code class="docutils literal notranslate"><span class="pre">'#'</span></code> option causes the “alternate form” to be used for the
|
||||||
|
conversion. The alternate form is defined differently for different
|
||||||
|
types. This option is only valid for integer and floating-point types.
|
||||||
|
For integers, when binary, octal, or hexadecimal output is used, this
|
||||||
|
option adds the prefix respective <code class="docutils literal notranslate"><span class="pre">"0b"</span></code> (<code class="docutils literal notranslate"><span class="pre">"0B"</span></code>), <code class="docutils literal notranslate"><span class="pre">"0"</span></code>, or
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">"0x"</span></code> (<code class="docutils literal notranslate"><span class="pre">"0X"</span></code>) to the output value. Whether the prefix is
|
||||||
|
lower-case or upper-case is determined by the case of the type
|
||||||
|
specifier, for example, the prefix <code class="docutils literal notranslate"><span class="pre">"0x"</span></code> is used for the type <code class="docutils literal notranslate"><span class="pre">'x'</span></code>
|
||||||
|
and <code class="docutils literal notranslate"><span class="pre">"0X"</span></code> is used for <code class="docutils literal notranslate"><span class="pre">'X'</span></code>. For floating-point numbers the
|
||||||
|
alternate form causes the result of the conversion to always contain a
|
||||||
|
decimal-point character, even if no digits follow it. Normally, a
|
||||||
|
decimal-point character appears in the result of these conversions
|
||||||
|
only if a digit follows it. In addition, for <code class="docutils literal notranslate"><span class="pre">'g'</span></code> and <code class="docutils literal notranslate"><span class="pre">'G'</span></code>
|
||||||
|
conversions, trailing zeros are not removed from the result.</p>
|
||||||
|
<p><em>width</em> is a decimal integer defining the minimum field width. If not
|
||||||
|
specified, then the field width will be determined by the content.</p>
|
||||||
|
<p>Preceding the <em>width</em> field by a zero (<code class="docutils literal notranslate"><span class="pre">'0'</span></code>) character enables sign-aware
|
||||||
|
zero-padding for numeric types. It forces the padding to be placed after the
|
||||||
|
sign or base (if any) but before the digits. This is used for printing fields in
|
||||||
|
the form ‘+000000120’. This option is only valid for numeric types and it has no
|
||||||
|
effect on formatting of infinity and NaN.</p>
|
||||||
|
<p>The <em>precision</em> is a decimal number indicating how many digits should be
|
||||||
|
displayed after the decimal point for a floating-point value formatted with
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">'f'</span></code> and <code class="docutils literal notranslate"><span class="pre">'F'</span></code>, or before and after the decimal point for a floating-point
|
||||||
|
value formatted with <code class="docutils literal notranslate"><span class="pre">'g'</span></code> or <code class="docutils literal notranslate"><span class="pre">'G'</span></code>. For non-number types the field
|
||||||
|
indicates the maximum field size - in other words, how many characters will be
|
||||||
|
used from the field content. The <em>precision</em> is not allowed for integer,
|
||||||
|
character, Boolean, and pointer values. Note that a C string must be
|
||||||
|
null-terminated even if precision is specified.</p>
|
||||||
|
<p>The <code class="docutils literal notranslate"><span class="pre">'L'</span></code> option uses the current locale setting to insert the appropriate
|
||||||
|
number separator characters. This option is only valid for numeric types.</p>
|
||||||
|
<p>Finally, the <em>type</em> determines how the data should be presented.</p>
|
||||||
|
<p>The available string presentation types are:</p>
|
||||||
|
<table class="docutils align-default">
|
||||||
|
<colgroup>
|
||||||
|
<col style="width: 13%" />
|
||||||
|
<col style="width: 87%" />
|
||||||
|
</colgroup>
|
||||||
|
<thead>
|
||||||
|
<tr class="row-odd"><th class="head"><p>Type</p></th>
|
||||||
|
<th class="head"><p>Meaning</p></th>
|
||||||
|
</tr>
|
||||||
|
</thead>
|
||||||
|
<tbody>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'s'</span></code></p></td>
|
||||||
|
<td><p>String format. This is the default type for strings and
|
||||||
|
may be omitted.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p>none</p></td>
|
||||||
|
<td><p>The same as <code class="docutils literal notranslate"><span class="pre">'s'</span></code>.</p></td>
|
||||||
|
</tr>
|
||||||
|
</tbody>
|
||||||
|
</table>
|
||||||
|
<p>The available character presentation types are:</p>
|
||||||
|
<table class="docutils align-default">
|
||||||
|
<colgroup>
|
||||||
|
<col style="width: 13%" />
|
||||||
|
<col style="width: 87%" />
|
||||||
|
</colgroup>
|
||||||
|
<thead>
|
||||||
|
<tr class="row-odd"><th class="head"><p>Type</p></th>
|
||||||
|
<th class="head"><p>Meaning</p></th>
|
||||||
|
</tr>
|
||||||
|
</thead>
|
||||||
|
<tbody>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'c'</span></code></p></td>
|
||||||
|
<td><p>Character format. This is the default type for
|
||||||
|
characters and may be omitted.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p>none</p></td>
|
||||||
|
<td><p>The same as <code class="docutils literal notranslate"><span class="pre">'c'</span></code>.</p></td>
|
||||||
|
</tr>
|
||||||
|
</tbody>
|
||||||
|
</table>
|
||||||
|
<p>The available integer presentation types are:</p>
|
||||||
|
<table class="docutils align-default">
|
||||||
|
<colgroup>
|
||||||
|
<col style="width: 13%" />
|
||||||
|
<col style="width: 87%" />
|
||||||
|
</colgroup>
|
||||||
|
<thead>
|
||||||
|
<tr class="row-odd"><th class="head"><p>Type</p></th>
|
||||||
|
<th class="head"><p>Meaning</p></th>
|
||||||
|
</tr>
|
||||||
|
</thead>
|
||||||
|
<tbody>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'b'</span></code></p></td>
|
||||||
|
<td><p>Binary format. Outputs the number in base 2. Using the
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">'#'</span></code> option with this type adds the prefix <code class="docutils literal notranslate"><span class="pre">"0b"</span></code>
|
||||||
|
to the output value.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'B'</span></code></p></td>
|
||||||
|
<td><p>Binary format. Outputs the number in base 2. Using the
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">'#'</span></code> option with this type adds the prefix <code class="docutils literal notranslate"><span class="pre">"0B"</span></code>
|
||||||
|
to the output value.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'c'</span></code></p></td>
|
||||||
|
<td><p>Character format. Outputs the number as a character.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'d'</span></code></p></td>
|
||||||
|
<td><p>Decimal integer. Outputs the number in base 10.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'o'</span></code></p></td>
|
||||||
|
<td><p>Octal format. Outputs the number in base 8.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'x'</span></code></p></td>
|
||||||
|
<td><p>Hex format. Outputs the number in base 16, using
|
||||||
|
lower-case letters for the digits above 9. Using the
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">'#'</span></code> option with this type adds the prefix <code class="docutils literal notranslate"><span class="pre">"0x"</span></code>
|
||||||
|
to the output value.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'X'</span></code></p></td>
|
||||||
|
<td><p>Hex format. Outputs the number in base 16, using
|
||||||
|
upper-case letters for the digits above 9. Using the
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">'#'</span></code> option with this type adds the prefix <code class="docutils literal notranslate"><span class="pre">"0X"</span></code>
|
||||||
|
to the output value.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p>none</p></td>
|
||||||
|
<td><p>The same as <code class="docutils literal notranslate"><span class="pre">'d'</span></code>.</p></td>
|
||||||
|
</tr>
|
||||||
|
</tbody>
|
||||||
|
</table>
|
||||||
|
<p>Integer presentation types can also be used with character and Boolean values.
|
||||||
|
Boolean values are formatted using textual representation, either <code class="docutils literal notranslate"><span class="pre">true</span></code> or
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">false</span></code>, if the presentation type is not specified.</p>
|
||||||
|
<p>The available presentation types for floating-point values are:</p>
|
||||||
|
<table class="docutils align-default">
|
||||||
|
<colgroup>
|
||||||
|
<col style="width: 13%" />
|
||||||
|
<col style="width: 87%" />
|
||||||
|
</colgroup>
|
||||||
|
<thead>
|
||||||
|
<tr class="row-odd"><th class="head"><p>Type</p></th>
|
||||||
|
<th class="head"><p>Meaning</p></th>
|
||||||
|
</tr>
|
||||||
|
</thead>
|
||||||
|
<tbody>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'a'</span></code></p></td>
|
||||||
|
<td><p>Hexadecimal floating point format. Prints the number in
|
||||||
|
base 16 with prefix <code class="docutils literal notranslate"><span class="pre">"0x"</span></code> and lower-case letters for
|
||||||
|
digits above 9. Uses <code class="docutils literal notranslate"><span class="pre">'p'</span></code> to indicate the exponent.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'A'</span></code></p></td>
|
||||||
|
<td><p>Same as <code class="docutils literal notranslate"><span class="pre">'a'</span></code> except it uses upper-case letters for
|
||||||
|
the prefix, digits above 9 and to indicate the exponent.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'e'</span></code></p></td>
|
||||||
|
<td><p>Exponent notation. Prints the number in scientific
|
||||||
|
notation using the letter ‘e’ to indicate the exponent.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'E'</span></code></p></td>
|
||||||
|
<td><p>Exponent notation. Same as <code class="docutils literal notranslate"><span class="pre">'e'</span></code> except it uses an
|
||||||
|
upper-case <code class="docutils literal notranslate"><span class="pre">'E'</span></code> as the separator character.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'f'</span></code></p></td>
|
||||||
|
<td><p>Fixed point. Displays the number as a fixed-point
|
||||||
|
number.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'F'</span></code></p></td>
|
||||||
|
<td><p>Fixed point. Same as <code class="docutils literal notranslate"><span class="pre">'f'</span></code>, but converts <code class="docutils literal notranslate"><span class="pre">nan</span></code> to
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">NAN</span></code> and <code class="docutils literal notranslate"><span class="pre">inf</span></code> to <code class="docutils literal notranslate"><span class="pre">INF</span></code>.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'g'</span></code></p></td>
|
||||||
|
<td><p>General format. For a given precision <code class="docutils literal notranslate"><span class="pre">p</span> <span class="pre">>=</span> <span class="pre">1</span></code>,
|
||||||
|
this rounds the number to <code class="docutils literal notranslate"><span class="pre">p</span></code> significant digits and
|
||||||
|
then formats the result in either fixed-point format
|
||||||
|
or in scientific notation, depending on its magnitude.</p>
|
||||||
|
<p>A precision of <code class="docutils literal notranslate"><span class="pre">0</span></code> is treated as equivalent to a
|
||||||
|
precision of <code class="docutils literal notranslate"><span class="pre">1</span></code>.</p>
|
||||||
|
</td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'G'</span></code></p></td>
|
||||||
|
<td><p>General format. Same as <code class="docutils literal notranslate"><span class="pre">'g'</span></code> except switches to
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">'E'</span></code> if the number gets too large. The
|
||||||
|
representations of infinity and NaN are uppercased, too.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p>none</p></td>
|
||||||
|
<td><p>Similar to <code class="docutils literal notranslate"><span class="pre">'g'</span></code>, except that the default precision is
|
||||||
|
as high as needed to represent the particular value.</p></td>
|
||||||
|
</tr>
|
||||||
|
</tbody>
|
||||||
|
</table>
|
||||||
|
<p>The available presentation types for pointers are:</p>
|
||||||
|
<table class="docutils align-default">
|
||||||
|
<colgroup>
|
||||||
|
<col style="width: 13%" />
|
||||||
|
<col style="width: 87%" />
|
||||||
|
</colgroup>
|
||||||
|
<thead>
|
||||||
|
<tr class="row-odd"><th class="head"><p>Type</p></th>
|
||||||
|
<th class="head"><p>Meaning</p></th>
|
||||||
|
</tr>
|
||||||
|
</thead>
|
||||||
|
<tbody>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'p'</span></code></p></td>
|
||||||
|
<td><p>Pointer format. This is the default type for
|
||||||
|
pointers and may be omitted.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p>none</p></td>
|
||||||
|
<td><p>The same as <code class="docutils literal notranslate"><span class="pre">'p'</span></code>.</p></td>
|
||||||
|
</tr>
|
||||||
|
</tbody>
|
||||||
|
</table>
|
||||||
|
</section>
|
||||||
|
<section id="chrono-format-specifications">
|
||||||
|
<span id="chrono-specs"></span><h2>Chrono Format Specifications<a class="headerlink" href="#chrono-format-specifications" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>Format specifications for chrono types and <code class="docutils literal notranslate"><span class="pre">std::tm</span></code> have the following
|
||||||
|
syntax:</p>
|
||||||
|
<pre>
|
||||||
|
<strong id="grammar-token-sf-chrono_format_spec"><span id="grammar-token-chrono-format-spec"></span>chrono_format_spec</strong> ::= [[<a class="reference internal" href="#grammar-token-sf-fill"><code class="xref docutils literal notranslate"><span class="pre">fill</span></code></a>]<a class="reference internal" href="#grammar-token-sf-align"><code class="xref docutils literal notranslate"><span class="pre">align</span></code></a>][<a class="reference internal" href="#grammar-token-sf-width"><code class="xref docutils literal notranslate"><span class="pre">width</span></code></a>]["." <a class="reference internal" href="#grammar-token-sf-precision"><code class="xref docutils literal notranslate"><span class="pre">precision</span></code></a>][<a class="reference internal" href="#grammar-token-sf-chrono_specs"><code class="xref docutils literal notranslate"><span class="pre">chrono_specs</span></code></a>]
|
||||||
|
<strong id="grammar-token-sf-chrono_specs"><span id="grammar-token-chrono-specs"></span>chrono_specs </strong> ::= [<a class="reference internal" href="#grammar-token-sf-chrono_specs"><code class="xref docutils literal notranslate"><span class="pre">chrono_specs</span></code></a>] <a class="reference internal" href="#grammar-token-sf-conversion_spec"><code class="xref docutils literal notranslate"><span class="pre">conversion_spec</span></code></a> | <a class="reference internal" href="#grammar-token-sf-chrono_specs"><code class="xref docutils literal notranslate"><span class="pre">chrono_specs</span></code></a> <a class="reference internal" href="#grammar-token-sf-literal_char"><code class="xref docutils literal notranslate"><span class="pre">literal_char</span></code></a>
|
||||||
|
<strong id="grammar-token-sf-conversion_spec"><span id="grammar-token-conversion-spec"></span>conversion_spec </strong> ::= "%" [<a class="reference internal" href="#grammar-token-sf-modifier"><code class="xref docutils literal notranslate"><span class="pre">modifier</span></code></a>] <a class="reference internal" href="#grammar-token-sf-chrono_type"><code class="xref docutils literal notranslate"><span class="pre">chrono_type</span></code></a>
|
||||||
|
<strong id="grammar-token-sf-literal_char"><span id="grammar-token-literal-char"></span>literal_char </strong> ::= <a character other than '{', '}' or '%'>
|
||||||
|
<strong id="grammar-token-sf-modifier"><span id="grammar-token-modifier"></span>modifier </strong> ::= "E" | "O"
|
||||||
|
<strong id="grammar-token-sf-chrono_type"><span id="grammar-token-chrono-type"></span>chrono_type </strong> ::= "a" | "A" | "b" | "B" | "c" | "C" | "d" | "D" | "e" | "F" |
|
||||||
|
"g" | "G" | "h" | "H" | "I" | "j" | "m" | "M" | "n" | "p" |
|
||||||
|
"q" | "Q" | "r" | "R" | "S" | "t" | "T" | "u" | "U" | "V" |
|
||||||
|
"w" | "W" | "x" | "X" | "y" | "Y" | "z" | "Z" | "%"
|
||||||
|
</pre>
|
||||||
|
<p>Literal chars are copied unchanged to the output. Precision is valid only for
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">std::chrono::duration</span></code> types with a floating-point representation type.</p>
|
||||||
|
<p>The available presentation types (<em>chrono_type</em>) for chrono durations and time
|
||||||
|
points are:</p>
|
||||||
|
<table class="docutils align-default">
|
||||||
|
<colgroup>
|
||||||
|
<col style="width: 12%" />
|
||||||
|
<col style="width: 88%" />
|
||||||
|
</colgroup>
|
||||||
|
<thead>
|
||||||
|
<tr class="row-odd"><th class="head"><p>Type</p></th>
|
||||||
|
<th class="head"><p>Meaning</p></th>
|
||||||
|
</tr>
|
||||||
|
</thead>
|
||||||
|
<tbody>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'H'</span></code></p></td>
|
||||||
|
<td><p>The hour (24-hour clock) as a decimal number. If the result is a
|
||||||
|
single digit, it is prefixed with 0. The modified command <code class="docutils literal notranslate"><span class="pre">%OH</span></code>
|
||||||
|
produces the locale’s alternative representation.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-odd"><td><p><code class="docutils literal notranslate"><span class="pre">'M'</span></code></p></td>
|
||||||
|
<td><p>The minute as a decimal number. If the result is a single digit,
|
||||||
|
it is prefixed with 0. The modified command <code class="docutils literal notranslate"><span class="pre">%OM</span></code> produces the
|
||||||
|
locale’s alternative representation.</p></td>
|
||||||
|
</tr>
|
||||||
|
<tr class="row-even"><td><p><code class="docutils literal notranslate"><span class="pre">'S'</span></code></p></td>
|
||||||
|
<td><p>Seconds as a decimal number. If the number of seconds is less than
|
||||||
|
10, the result is prefixed with 0. If the precision of the input
|
||||||
|
cannot be exactly represented with seconds, then the format is a
|
||||||
|
decimal floating-point number with a fixed format and a precision
|
||||||
|
matching that of the precision of the input (or to a microseconds
|
||||||
|
precision if the conversion to floating-point decimal seconds
|
||||||
|
cannot be made within 18 fractional digits). The character for the
|
||||||
|
decimal point is localized according to the locale. The modified
|
||||||
|
command <code class="docutils literal notranslate"><span class="pre">%OS</span></code> produces the locale’s alternative representation.</p></td>
|
||||||
|
</tr>
|
||||||
|
</tbody>
|
||||||
|
</table>
|
||||||
|
<p>Specifiers that have a calendaric component such as <code class="docutils literal notranslate"><span class="pre">'d'</span></code> (the day of month)
|
||||||
|
are valid only for <code class="docutils literal notranslate"><span class="pre">std::tm</span></code> and not durations or time points.</p>
|
||||||
|
</section>
|
||||||
|
<section id="range-format-specifications">
|
||||||
|
<h2>Range Format Specifications<a class="headerlink" href="#range-format-specifications" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>Format specifications for range types have the following syntax:</p>
|
||||||
|
<pre>
|
||||||
|
<strong id="grammar-token-sf-range_format_spec"><span id="grammar-token-range-format-spec"></span>range_format_spec</strong> ::= [":" [<code class="xref docutils literal notranslate"><span class="pre">underlying_spec</span></code>]]
|
||||||
|
</pre>
|
||||||
|
<p>The <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">underlying_spec</span></code> is parsed based on the formatter of the range’s
|
||||||
|
reference type.</p>
|
||||||
|
<p>By default, a range of characters or strings is printed escaped and quoted. But
|
||||||
|
if any <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">underlying_spec</span></code> is provided (even if it is empty), then the characters
|
||||||
|
or strings are printed according to the provided specification.</p>
|
||||||
|
<p>Examples:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{}"</span><span class="p">,</span><span class="w"> </span><span class="n">std</span><span class="o">::</span><span class="n">vector</span><span class="p">{</span><span class="mi">10</span><span class="p">,</span><span class="w"> </span><span class="mi">20</span><span class="p">,</span><span class="w"> </span><span class="mi">30</span><span class="p">});</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: [10, 20, 30]</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{::#x}"</span><span class="p">,</span><span class="w"> </span><span class="n">std</span><span class="o">::</span><span class="n">vector</span><span class="p">{</span><span class="mi">10</span><span class="p">,</span><span class="w"> </span><span class="mi">20</span><span class="p">,</span><span class="w"> </span><span class="mi">30</span><span class="p">});</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: [0xa, 0x14, 0x13]</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{}"</span><span class="p">,</span><span class="w"> </span><span class="n">vector</span><span class="p">{</span><span class="sc">'h'</span><span class="p">,</span><span class="w"> </span><span class="sc">'e'</span><span class="p">,</span><span class="w"> </span><span class="sc">'l'</span><span class="p">,</span><span class="w"> </span><span class="sc">'l'</span><span class="p">,</span><span class="w"> </span><span class="sc">'o'</span><span class="p">});</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: ['h', 'e', 'l', 'l', 'o']</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{::}"</span><span class="p">,</span><span class="w"> </span><span class="n">vector</span><span class="p">{</span><span class="sc">'h'</span><span class="p">,</span><span class="w"> </span><span class="sc">'e'</span><span class="p">,</span><span class="w"> </span><span class="sc">'l'</span><span class="p">,</span><span class="w"> </span><span class="sc">'l'</span><span class="p">,</span><span class="w"> </span><span class="sc">'o'</span><span class="p">});</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: [h, e, l, l, o]</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{::d}"</span><span class="p">,</span><span class="w"> </span><span class="n">vector</span><span class="p">{</span><span class="sc">'h'</span><span class="p">,</span><span class="w"> </span><span class="sc">'e'</span><span class="p">,</span><span class="w"> </span><span class="sc">'l'</span><span class="p">,</span><span class="w"> </span><span class="sc">'l'</span><span class="p">,</span><span class="w"> </span><span class="sc">'o'</span><span class="p">});</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: [104, 101, 108, 108, 111]</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
<section id="format-examples">
|
||||||
|
<span id="formatexamples"></span><h2>Format Examples<a class="headerlink" href="#format-examples" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>This section contains examples of the format syntax and comparison with
|
||||||
|
the printf formatting.</p>
|
||||||
|
<p>In most of the cases the syntax is similar to the printf formatting, with the
|
||||||
|
addition of the <code class="docutils literal notranslate"><span class="pre">{}</span></code> and with <code class="docutils literal notranslate"><span class="pre">:</span></code> used instead of <code class="docutils literal notranslate"><span class="pre">%</span></code>.
|
||||||
|
For example, <code class="docutils literal notranslate"><span class="pre">"%03.2f"</span></code> can be translated to <code class="docutils literal notranslate"><span class="pre">"{:03.2f}"</span></code>.</p>
|
||||||
|
<p>The new format syntax also supports new and different options, shown in the
|
||||||
|
following examples.</p>
|
||||||
|
<p>Accessing arguments by position:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{0}, {1}, {2}"</span><span class="p">,</span><span class="w"> </span><span class="sc">'a'</span><span class="p">,</span><span class="w"> </span><span class="sc">'b'</span><span class="p">,</span><span class="w"> </span><span class="sc">'c'</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "a, b, c"</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{}, {}, {}"</span><span class="p">,</span><span class="w"> </span><span class="sc">'a'</span><span class="p">,</span><span class="w"> </span><span class="sc">'b'</span><span class="p">,</span><span class="w"> </span><span class="sc">'c'</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "a, b, c"</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{2}, {1}, {0}"</span><span class="p">,</span><span class="w"> </span><span class="sc">'a'</span><span class="p">,</span><span class="w"> </span><span class="sc">'b'</span><span class="p">,</span><span class="w"> </span><span class="sc">'c'</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "c, b, a"</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{0}{1}{0}"</span><span class="p">,</span><span class="w"> </span><span class="s">"abra"</span><span class="p">,</span><span class="w"> </span><span class="s">"cad"</span><span class="p">);</span><span class="w"> </span><span class="c1">// arguments' indices can be repeated</span>
|
||||||
|
<span class="c1">// Result: "abracadabra"</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Aligning the text and specifying a width:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:<30}"</span><span class="p">,</span><span class="w"> </span><span class="s">"left aligned"</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "left aligned "</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:>30}"</span><span class="p">,</span><span class="w"> </span><span class="s">"right aligned"</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: " right aligned"</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:^30}"</span><span class="p">,</span><span class="w"> </span><span class="s">"centered"</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: " centered "</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:*^30}"</span><span class="p">,</span><span class="w"> </span><span class="s">"centered"</span><span class="p">);</span><span class="w"> </span><span class="c1">// use '*' as a fill char</span>
|
||||||
|
<span class="c1">// Result: "***********centered***********"</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Dynamic width:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:<{}}"</span><span class="p">,</span><span class="w"> </span><span class="s">"left aligned"</span><span class="p">,</span><span class="w"> </span><span class="mi">30</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "left aligned "</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Dynamic precision:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:.{}f}"</span><span class="p">,</span><span class="w"> </span><span class="mf">3.14</span><span class="p">,</span><span class="w"> </span><span class="mi">1</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "3.1"</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Replacing <code class="docutils literal notranslate"><span class="pre">%+f</span></code>, <code class="docutils literal notranslate"><span class="pre">%-f</span></code>, and <code class="docutils literal notranslate"><span class="pre">%</span> <span class="pre">f</span></code> and specifying a sign:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:+f}; {:+f}"</span><span class="p">,</span><span class="w"> </span><span class="mf">3.14</span><span class="p">,</span><span class="w"> </span><span class="mf">-3.14</span><span class="p">);</span><span class="w"> </span><span class="c1">// show it always</span>
|
||||||
|
<span class="c1">// Result: "+3.140000; -3.140000"</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{: f}; {: f}"</span><span class="p">,</span><span class="w"> </span><span class="mf">3.14</span><span class="p">,</span><span class="w"> </span><span class="mf">-3.14</span><span class="p">);</span><span class="w"> </span><span class="c1">// show a space for positive numbers</span>
|
||||||
|
<span class="c1">// Result: " 3.140000; -3.140000"</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:-f}; {:-f}"</span><span class="p">,</span><span class="w"> </span><span class="mf">3.14</span><span class="p">,</span><span class="w"> </span><span class="mf">-3.14</span><span class="p">);</span><span class="w"> </span><span class="c1">// show only the minus -- same as '{:f}; {:f}'</span>
|
||||||
|
<span class="c1">// Result: "3.140000; -3.140000"</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Replacing <code class="docutils literal notranslate"><span class="pre">%x</span></code> and <code class="docutils literal notranslate"><span class="pre">%o</span></code> and converting the value to different bases:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"int: {0:d}; hex: {0:x}; oct: {0:o}; bin: {0:b}"</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "int: 42; hex: 2a; oct: 52; bin: 101010"</span>
|
||||||
|
<span class="c1">// with 0x or 0 or 0b as prefix:</span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"int: {0:d}; hex: {0:#x}; oct: {0:#o}; bin: {0:#b}"</span><span class="p">,</span><span class="w"> </span><span class="mi">42</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "int: 42; hex: 0x2a; oct: 052; bin: 0b101010"</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Padded hex byte with prefix and always prints both hex characters:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="s">"{:#04x}"</span><span class="p">,</span><span class="w"> </span><span class="mi">0</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Result: "0x00"</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Box drawing using Unicode fill:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="w"></span>
|
||||||
|
<span class="w"> </span><span class="s">"┌{0:─^{2}}┐</span><span class="se">\n</span><span class="s">"</span><span class="w"></span>
|
||||||
|
<span class="w"> </span><span class="s">"│{1: ^{2}}│</span><span class="se">\n</span><span class="s">"</span><span class="w"></span>
|
||||||
|
<span class="w"> </span><span class="s">"└{0:─^{2}}┘</span><span class="se">\n</span><span class="s">"</span><span class="p">,</span><span class="w"> </span><span class="s">""</span><span class="p">,</span><span class="w"> </span><span class="s">"Hello, world!"</span><span class="p">,</span><span class="w"> </span><span class="mi">20</span><span class="p">);</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>prints:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span>┌────────────────────┐
|
||||||
|
│ Hello, world! │
|
||||||
|
└────────────────────┘
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Using type-specific formatting:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="cp">#include</span><span class="w"> </span><span class="cpf"><fmt/chrono.h></span><span class="cp"></span>
|
||||||
|
|
||||||
|
<span class="k">auto</span><span class="w"> </span><span class="n">t</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">tm</span><span class="p">();</span><span class="w"></span>
|
||||||
|
<span class="n">t</span><span class="p">.</span><span class="n">tm_year</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">2010</span><span class="w"> </span><span class="o">-</span><span class="w"> </span><span class="mi">1900</span><span class="p">;</span><span class="w"></span>
|
||||||
|
<span class="n">t</span><span class="p">.</span><span class="n">tm_mon</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">7</span><span class="p">;</span><span class="w"></span>
|
||||||
|
<span class="n">t</span><span class="p">.</span><span class="n">tm_mday</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">4</span><span class="p">;</span><span class="w"></span>
|
||||||
|
<span class="n">t</span><span class="p">.</span><span class="n">tm_hour</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">12</span><span class="p">;</span><span class="w"></span>
|
||||||
|
<span class="n">t</span><span class="p">.</span><span class="n">tm_min</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">15</span><span class="p">;</span><span class="w"></span>
|
||||||
|
<span class="n">t</span><span class="p">.</span><span class="n">tm_sec</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="mi">58</span><span class="p">;</span><span class="w"></span>
|
||||||
|
<span class="n">fmt</span><span class="o">::</span><span class="n">print</span><span class="p">(</span><span class="s">"{:%Y-%m-%d %H:%M:%S}"</span><span class="p">,</span><span class="w"> </span><span class="n">t</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// Prints: 2010-08-04 12:15:58</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Using the comma as a thousands separator:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="cp">#include</span><span class="w"> </span><span class="cpf"><fmt/format.h></span><span class="cp"></span>
|
||||||
|
|
||||||
|
<span class="k">auto</span><span class="w"> </span><span class="n">s</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">format</span><span class="p">(</span><span class="n">std</span><span class="o">::</span><span class="n">locale</span><span class="p">(</span><span class="s">"en_US.UTF-8"</span><span class="p">),</span><span class="w"> </span><span class="s">"{:L}"</span><span class="p">,</span><span class="w"> </span><span class="mi">1234567890</span><span class="p">);</span><span class="w"></span>
|
||||||
|
<span class="c1">// s == "1,234,567,890"</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="footer" role="contentinfo">
|
||||||
|
© Copyright 2012-present, Victor Zverovich.
|
||||||
|
Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<script src="_static/bootstrap.min.js"></script>
|
||||||
|
|
||||||
|
</body>
|
||||||
|
</html>
|
335
externals/fmt/doc/html/usage.html
vendored
Normal file
335
externals/fmt/doc/html/usage.html
vendored
Normal file
@ -0,0 +1,335 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
|
||||||
|
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<meta http-equiv="X-UA-Compatible" content="IE=edge">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
|
||||||
|
<meta name="generator" content="Docutils 0.17.1: http://docutils.sourceforge.net/" />
|
||||||
|
|
||||||
|
<title>Usage — fmt 9.1.0 documentation</title>
|
||||||
|
|
||||||
|
<link rel="stylesheet" href="_static/basic.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/pygments.css" type="text/css" />
|
||||||
|
<link rel="stylesheet" href="_static/breathe.css" type="text/css" />
|
||||||
|
|
||||||
|
<script type="text/javascript">
|
||||||
|
var DOCUMENTATION_OPTIONS = {
|
||||||
|
URL_ROOT: './',
|
||||||
|
VERSION: '9.1.0',
|
||||||
|
COLLAPSE_INDEX: false,
|
||||||
|
FILE_SUFFIX: '.html',
|
||||||
|
LINK_SUFFIX: '.html',
|
||||||
|
SOURCELINK_SUFFIX: '.txt',
|
||||||
|
HAS_SOURCE: true,
|
||||||
|
SOURCELINK_SUFFIX: '.txt'
|
||||||
|
};
|
||||||
|
</script>
|
||||||
|
<script src="_static/jquery.js"></script>
|
||||||
|
<script src="_static/underscore.js"></script>
|
||||||
|
<script src="_static/doctools.js"></script>
|
||||||
|
<script src="_static/language_data.js"></script>
|
||||||
|
<link rel="index" title="Index" href="genindex.html" />
|
||||||
|
<link rel="search" title="Search" href="search.html" />
|
||||||
|
<meta name="description" content="Small, safe and fast formatting library">
|
||||||
|
<meta name="keywords" content="C++, formatting, printf, string, library">
|
||||||
|
<meta name="author" content="Victor Zverovich">
|
||||||
|
<link rel="stylesheet" href="_static/fmt.css">
|
||||||
|
|
||||||
|
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-20116650-4"></script>
|
||||||
|
<script>
|
||||||
|
window.dataLayer = window.dataLayer || [];
|
||||||
|
function gtag(){dataLayer.push(arguments);}
|
||||||
|
gtag('js', new Date());
|
||||||
|
|
||||||
|
gtag('config', 'UA-20116650-4');
|
||||||
|
</script>
|
||||||
|
|
||||||
|
</head>
|
||||||
|
<body role="document">
|
||||||
|
<nav class="navbar navbar-inverse">
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
<div class="navbar-content">
|
||||||
|
|
||||||
|
<div class="navbar-header">
|
||||||
|
<button type="button" class="navbar-toggle collapsed"
|
||||||
|
data-toggle="collapse" data-target=".navbar-collapse">
|
||||||
|
<span class="sr-only">Toggle navigation</span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
<span class="icon-bar"></span>
|
||||||
|
</button>
|
||||||
|
<a class="navbar-brand" href="index.html">{fmt}</a>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
<div class="collapse navbar-collapse">
|
||||||
|
<ul class="nav navbar-nav">
|
||||||
|
<li class="dropdown">
|
||||||
|
<a href="#" class="dropdown-toggle" data-toggle="dropdown"
|
||||||
|
role="button" aria-expanded="false">9.1.0
|
||||||
|
<span class="caret"></span></a>
|
||||||
|
<ul class="dropdown-menu" role="menu">
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.1.0">9.1.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/9.0.0">9.0.0</a></li>
|
||||||
|
|
||||||
|
<li><a href="https://fmt.dev/8.1.1">8.1.1</a></li>
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="contents.html">Contents</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li class="active"><a href="usage.html">Usage
|
||||||
|
<span class="sr-only">(current)</span></a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="api.html">API</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<li><a href="syntax.html">Syntax</a></li>
|
||||||
|
|
||||||
|
|
||||||
|
</ul>
|
||||||
|
|
||||||
|
|
||||||
|
<form class="navbar-form navbar-right" role="search" action="search.html"
|
||||||
|
method="get">
|
||||||
|
<div class="form-group">
|
||||||
|
<input type="text" name="q" class="form-control"
|
||||||
|
placeholder="Search" >
|
||||||
|
</div>
|
||||||
|
<input type="hidden" name="check_keywords" value="yes" />
|
||||||
|
<input type="hidden" name="area" value="default" />
|
||||||
|
|
||||||
|
</form>
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</nav>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="tb-container">
|
||||||
|
<div class="row">
|
||||||
|
|
||||||
|
|
||||||
|
<div class="content">
|
||||||
|
|
||||||
|
<section id="usage">
|
||||||
|
<h1>Usage<a class="headerlink" href="#usage" title="Permalink to this headline">¶</a></h1>
|
||||||
|
<p>To use the {fmt} library, add <code class="file docutils literal notranslate"><span class="pre">fmt/core.h</span></code>, <code class="file docutils literal notranslate"><span class="pre">fmt/format.h</span></code>,
|
||||||
|
<code class="file docutils literal notranslate"><span class="pre">fmt/format-inl.h</span></code>, <code class="file docutils literal notranslate"><span class="pre">src/format.cc</span></code> and optionally other headers
|
||||||
|
from a <a class="reference external" href="https://github.com/fmtlib/fmt/releases/latest">release archive</a> or
|
||||||
|
the <a class="reference external" href="https://github.com/fmtlib/fmt">Git repository</a> to your project.
|
||||||
|
Alternatively, you can <a class="reference internal" href="#building"><span class="std std-ref">build the library with CMake</span></a>.</p>
|
||||||
|
<section id="building-the-library">
|
||||||
|
<span id="building"></span><h2>Building the Library<a class="headerlink" href="#building-the-library" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>The included <a class="reference external" href="https://github.com/fmtlib/fmt/blob/master/CMakeLists.txt">CMake build script</a> can be used to build the fmt
|
||||||
|
library on a wide range of platforms. CMake is freely available for
|
||||||
|
download from <a class="reference external" href="https://www.cmake.org/download/">https://www.cmake.org/download/</a>.</p>
|
||||||
|
<p>CMake works by generating native makefiles or project files that can
|
||||||
|
be used in the compiler environment of your choice. The typical
|
||||||
|
workflow starts with:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span>mkdir build # Create a directory to hold the build output.
|
||||||
|
cd build
|
||||||
|
cmake .. # Generate native build scripts.
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>where <code class="file docutils literal notranslate"><em><span class="pre"><path/to/fmt></span></em></code> is a path to the <code class="docutils literal notranslate"><span class="pre">fmt</span></code> repository.</p>
|
||||||
|
<p>If you are on a *nix system, you should now see a Makefile in the
|
||||||
|
current directory. Now you can build the library by running <strong class="command">make</strong>.</p>
|
||||||
|
<p>Once the library has been built you can invoke <strong class="command">make test</strong> to run
|
||||||
|
the tests.</p>
|
||||||
|
<p>You can control generation of the make <code class="docutils literal notranslate"><span class="pre">test</span></code> target with the <code class="docutils literal notranslate"><span class="pre">FMT_TEST</span></code>
|
||||||
|
CMake option. This can be useful if you include fmt as a subdirectory in
|
||||||
|
your project but don’t want to add fmt’s tests to your <code class="docutils literal notranslate"><span class="pre">test</span></code> target.</p>
|
||||||
|
<p>If you use Windows and have Visual Studio installed, a <code class="file docutils literal notranslate"><span class="pre">FMT.sln</span></code>
|
||||||
|
file and several <code class="file docutils literal notranslate"><span class="pre">.vcproj</span></code> files will be created. You can then build them
|
||||||
|
using Visual Studio or msbuild.</p>
|
||||||
|
<p>On Mac OS X with Xcode installed, an <code class="file docutils literal notranslate"><span class="pre">.xcodeproj</span></code> file will be generated.</p>
|
||||||
|
<p>To build a <a class="reference external" href="https://en.wikipedia.org/wiki/Library_%28computing%29#Shared_libraries">shared library</a> set the <code class="docutils literal notranslate"><span class="pre">BUILD_SHARED_LIBS</span></code> CMake variable to
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">TRUE</span></code>:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">cmake</span><span class="w"> </span><span class="o">-</span><span class="n">DBUILD_SHARED_LIBS</span><span class="o">=</span><span class="n">TRUE</span><span class="w"> </span><span class="p">...</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>To build a <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">static</span> <span class="pre">library</span></code> with position independent code (required if the main
|
||||||
|
consumer of the fmt library is a shared library i.e. a Python extension) set the
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">CMAKE_POSITION_INDEPENDENT_CODE</span></code> CMake variable to <code class="docutils literal notranslate"><span class="pre">TRUE</span></code>:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">cmake</span><span class="w"> </span><span class="o">-</span><span class="n">DCMAKE_POSITION_INDEPENDENT_CODE</span><span class="o">=</span><span class="n">TRUE</span><span class="w"> </span><span class="p">...</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
<section id="installing-the-library">
|
||||||
|
<h2>Installing the Library<a class="headerlink" href="#installing-the-library" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>After building the library you can install it on a Unix-like system by running
|
||||||
|
<strong class="command">sudo make install</strong>.</p>
|
||||||
|
</section>
|
||||||
|
<section id="usage-with-cmake">
|
||||||
|
<h2>Usage with CMake<a class="headerlink" href="#usage-with-cmake" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>You can add the <code class="docutils literal notranslate"><span class="pre">fmt</span></code> library directory into your project and include it in
|
||||||
|
your <code class="docutils literal notranslate"><span class="pre">CMakeLists.txt</span></code> file:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">add_subdirectory</span><span class="p">(</span><span class="n">fmt</span><span class="p">)</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>or</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">add_subdirectory</span><span class="p">(</span><span class="n">fmt</span><span class="w"> </span><span class="n">EXCLUDE_FROM_ALL</span><span class="p">)</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>to exclude it from <code class="docutils literal notranslate"><span class="pre">make</span></code>, <code class="docutils literal notranslate"><span class="pre">make</span> <span class="pre">all</span></code>, or <code class="docutils literal notranslate"><span class="pre">cmake</span> <span class="pre">--build</span> <span class="pre">.</span></code>.</p>
|
||||||
|
<p>You can detect and use an installed version of {fmt} as follows:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">find_package</span><span class="p">(</span><span class="n">fmt</span><span class="p">)</span><span class="w"></span>
|
||||||
|
<span class="n">target_link_libraries</span><span class="p">(</span><span class="o"><</span><span class="n">your</span><span class="o">-</span><span class="n">target</span><span class="o">></span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">fmt</span><span class="p">)</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>Setting up your target to use a header-only version of <code class="docutils literal notranslate"><span class="pre">fmt</span></code> is equally easy:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">target_link_libraries</span><span class="p">(</span><span class="o"><</span><span class="n">your</span><span class="o">-</span><span class="n">target</span><span class="o">></span><span class="w"> </span><span class="n">PRIVATE</span><span class="w"> </span><span class="n">fmt</span><span class="o">::</span><span class="n">fmt</span><span class="o">-</span><span class="n">header</span><span class="o">-</span><span class="n">only</span><span class="p">)</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
<section id="usage-with-build2">
|
||||||
|
<h2>Usage with build2<a class="headerlink" href="#usage-with-build2" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>You can use <a class="reference external" href="https://build2.org">build2</a>, a dependency manager and a
|
||||||
|
build-system combined, to use <code class="docutils literal notranslate"><span class="pre">fmt</span></code>.</p>
|
||||||
|
<p>Currently this package is available in these package repositories:</p>
|
||||||
|
<ul class="simple">
|
||||||
|
<li><p><strong>https://cppget.org/fmt/</strong> for released and published versions.</p></li>
|
||||||
|
<li><p><a class="reference external" href="https://github.com/build2-packaging/fmt.git">The git repository with the sources of the build2 package of fmt</a>
|
||||||
|
for unreleased or custom revisions of <code class="docutils literal notranslate"><span class="pre">fmt</span></code>.</p></li>
|
||||||
|
</ul>
|
||||||
|
<p><strong>Usage:</strong></p>
|
||||||
|
<ul class="simple">
|
||||||
|
<li><p><code class="docutils literal notranslate"><span class="pre">build2</span></code> package name: <code class="docutils literal notranslate"><span class="pre">fmt</span></code></p></li>
|
||||||
|
<li><p>Library target name : <code class="docutils literal notranslate"><span class="pre">lib{fmt}</span></code></p></li>
|
||||||
|
</ul>
|
||||||
|
<p>For example, to make your <code class="docutils literal notranslate"><span class="pre">build2</span></code> project depend on <code class="docutils literal notranslate"><span class="pre">fmt</span></code>:</p>
|
||||||
|
<ul>
|
||||||
|
<li><p>Add one of the repositories to your configurations, or in your
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">repositories.manifest</span></code>, if not already there:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="o">:</span><span class="w"></span>
|
||||||
|
<span class="nl">role</span><span class="p">:</span><span class="w"> </span><span class="n">prerequisite</span><span class="w"></span>
|
||||||
|
<span class="nl">location</span><span class="p">:</span><span class="w"> </span><span class="n">https</span><span class="o">:</span><span class="c1">//pkg.cppget.org/1/stable</span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</li>
|
||||||
|
<li><p>Add this package as a dependency to your <code class="docutils literal notranslate"><span class="pre">./manifest</span></code> file
|
||||||
|
(example for <code class="docutils literal notranslate"><span class="pre">v7.0.x</span></code>):</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="nl">depends</span><span class="p">:</span><span class="w"> </span><span class="n">fmt</span><span class="w"> </span><span class="o">~</span><span class="mf">7.0.0</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</li>
|
||||||
|
<li><p>Import the target and use it as a prerequisite to your own target
|
||||||
|
using <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">fmt</span></code> in the appropriate <code class="docutils literal notranslate"><span class="pre">buildfile</span></code>:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="k">import</span><span class="w"> </span><span class="n">fmt</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="n">fmt</span><span class="o">%</span><span class="n">lib</span><span class="p">{</span><span class="n">fmt</span><span class="p">}</span><span class="w"></span>
|
||||||
|
<span class="n">lib</span><span class="p">{</span><span class="n">mylib</span><span class="p">}</span><span class="w"> </span><span class="o">:</span><span class="w"> </span><span class="n">cxx</span><span class="p">{</span><span class="o">**</span><span class="p">}</span><span class="w"> </span><span class="p">...</span><span class="w"> </span><span class="n">$fmt</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</li>
|
||||||
|
</ul>
|
||||||
|
<p>Then build your project as usual with <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">b</span></code> or <code class="xref cpp cpp-any docutils literal notranslate"><span class="pre">bdep</span> <span class="pre">update</span></code>.</p>
|
||||||
|
<p>For <code class="docutils literal notranslate"><span class="pre">build2</span></code> newcomers or to get more details and use cases, you can read the
|
||||||
|
<code class="docutils literal notranslate"><span class="pre">build2</span></code>
|
||||||
|
<a class="reference external" href="https://build2.org/build2-toolchain/doc/build2-toolchain-intro.xhtml">toolchain introduction</a>.</p>
|
||||||
|
</section>
|
||||||
|
<section id="building-the-documentation">
|
||||||
|
<h2>Building the Documentation<a class="headerlink" href="#building-the-documentation" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>To build the documentation you need the following software installed on your
|
||||||
|
system:</p>
|
||||||
|
<ul>
|
||||||
|
<li><p><a class="reference external" href="https://www.python.org/">Python</a> with pip and virtualenv</p></li>
|
||||||
|
<li><p><a class="reference external" href="http://www.stack.nl/~dimitri/doxygen/">Doxygen</a></p></li>
|
||||||
|
<li><p><a class="reference external" href="http://lesscss.org/">Less</a> with <code class="docutils literal notranslate"><span class="pre">less-plugin-clean-css</span></code>.
|
||||||
|
Ubuntu doesn’t package the <code class="docutils literal notranslate"><span class="pre">clean-css</span></code> plugin so you should use <code class="docutils literal notranslate"><span class="pre">npm</span></code>
|
||||||
|
instead of <code class="docutils literal notranslate"><span class="pre">apt</span></code> to install both <code class="docutils literal notranslate"><span class="pre">less</span></code> and the plugin:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">sudo</span><span class="w"> </span><span class="n">npm</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="o">-</span><span class="n">g</span><span class="w"> </span><span class="n">less</span><span class="w"> </span><span class="n">less</span><span class="o">-</span><span class="n">plugin</span><span class="o">-</span><span class="n">clean</span><span class="o">-</span><span class="n">css</span><span class="p">.</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</li>
|
||||||
|
</ul>
|
||||||
|
<p>First generate makefiles or project files using CMake as described in
|
||||||
|
the previous section. Then compile the <code class="docutils literal notranslate"><span class="pre">doc</span></code> target/project, for example:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">make</span><span class="w"> </span><span class="n">doc</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>This will generate the HTML documentation in <code class="docutils literal notranslate"><span class="pre">doc/html</span></code>.</p>
|
||||||
|
</section>
|
||||||
|
<section id="conda">
|
||||||
|
<h2>Conda<a class="headerlink" href="#conda" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>fmt can be installed on Linux, macOS and Windows with
|
||||||
|
<a class="reference external" href="https://docs.conda.io/en/latest/">Conda</a>, using its
|
||||||
|
<a class="reference external" href="https://conda-forge.org">conda-forge</a>
|
||||||
|
<a class="reference external" href="https://github.com/conda-forge/fmt-feedstock">package</a>, as follows:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">conda</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="o">-</span><span class="n">c</span><span class="w"> </span><span class="n">conda</span><span class="o">-</span><span class="n">forge</span><span class="w"> </span><span class="n">fmt</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
<section id="vcpkg">
|
||||||
|
<h2>Vcpkg<a class="headerlink" href="#vcpkg" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>You can download and install fmt using the <a class="reference external" href="https://github.com/Microsoft/vcpkg">vcpkg</a> dependency manager:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">git</span><span class="w"> </span><span class="n">clone</span><span class="w"> </span><span class="n">https</span><span class="o">:</span><span class="c1">//github.com/Microsoft/vcpkg.git</span>
|
||||||
|
<span class="n">cd</span><span class="w"> </span><span class="n">vcpkg</span><span class="w"></span>
|
||||||
|
<span class="p">.</span><span class="o">/</span><span class="n">bootstrap</span><span class="o">-</span><span class="n">vcpkg</span><span class="p">.</span><span class="n">sh</span><span class="w"></span>
|
||||||
|
<span class="p">.</span><span class="o">/</span><span class="n">vcpkg</span><span class="w"> </span><span class="n">integrate</span><span class="w"> </span><span class="n">install</span><span class="w"></span>
|
||||||
|
<span class="p">.</span><span class="o">/</span><span class="n">vcpkg</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="n">fmt</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>The fmt port in vcpkg is kept up to date by Microsoft team members and community
|
||||||
|
contributors. If the version is out of date, please <a class="reference external" href="https://github.com/Microsoft/vcpkg">create an issue or pull
|
||||||
|
request</a> on the vcpkg repository.</p>
|
||||||
|
</section>
|
||||||
|
<section id="lhelper">
|
||||||
|
<h2>LHelper<a class="headerlink" href="#lhelper" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>You can download and install fmt using
|
||||||
|
<a class="reference external" href="https://github.com/franko/lhelper">lhelper</a> dependency manager:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">lhelper</span><span class="w"> </span><span class="n">activate</span><span class="w"> </span><span class="o"><</span><span class="n">some</span><span class="o">-</span><span class="n">environment</span><span class="o">></span><span class="w"></span>
|
||||||
|
<span class="n">lhelper</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="n">fmt</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
<p>All the recipes for lhelper are kept in the
|
||||||
|
<a class="reference external" href="https://github.com/franko/lhelper-recipes">lhelper’s recipe</a> repository.</p>
|
||||||
|
</section>
|
||||||
|
<section id="android-ndk">
|
||||||
|
<h2>Android NDK<a class="headerlink" href="#android-ndk" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>fmt provides <a class="reference external" href="https://github.com/fmtlib/fmt/blob/master/support/Android.mk">Android.mk file</a> that can be used to build the library
|
||||||
|
with <a class="reference external" href="https://developer.android.com/tools/sdk/ndk/index.html">Android NDK</a>.
|
||||||
|
For an example of using fmt with Android NDK, see the
|
||||||
|
<a class="reference external" href="https://github.com/fmtlib/android-ndk-example">android-ndk-example</a>
|
||||||
|
repository.</p>
|
||||||
|
</section>
|
||||||
|
<section id="homebrew">
|
||||||
|
<h2>Homebrew<a class="headerlink" href="#homebrew" title="Permalink to this headline">¶</a></h2>
|
||||||
|
<p>fmt can be installed on OS X using <a class="reference external" href="https://brew.sh/">Homebrew</a>:</p>
|
||||||
|
<div class="highlight-c++ notranslate"><div class="highlight"><pre><span></span><span class="n">brew</span><span class="w"> </span><span class="n">install</span><span class="w"> </span><span class="n">fmt</span><span class="w"></span>
|
||||||
|
</pre></div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
<div class="footer" role="contentinfo">
|
||||||
|
© Copyright 2012-present, Victor Zverovich.
|
||||||
|
Created using <a href="http://sphinx-doc.org/">Sphinx</a> 3.3.0.
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<script src="_static/bootstrap.min.js"></script>
|
||||||
|
|
||||||
|
</body>
|
||||||
|
</html>
|
74
externals/fmt/doc/index.rst
vendored
74
externals/fmt/doc/index.rst
vendored
@ -22,25 +22,27 @@ Format API
|
|||||||
----------
|
----------
|
||||||
|
|
||||||
The format API is similar in spirit to the C ``printf`` family of function but
|
The format API is similar in spirit to the C ``printf`` family of function but
|
||||||
is safer, simpler and serveral times `faster
|
is safer, simpler and several times `faster
|
||||||
<http://zverovich.net/2013/09/07/integer-to-string-conversion-in-cplusplus.html>`_
|
<https://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html>`_
|
||||||
than common standard library implementations.
|
than common standard library implementations.
|
||||||
The `format string syntax <syntax.html>`_ is similar to the one used by
|
The `format string syntax <syntax.html>`_ is similar to the one used by
|
||||||
`str.format <http://docs.python.org/3/library/stdtypes.html#str.format>`_ in
|
`str.format <https://docs.python.org/3/library/stdtypes.html#str.format>`_ in
|
||||||
Python:
|
Python:
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
fmt::format("The answer is {}.", 42);
|
std::string s = fmt::format("The answer is {}.", 42);
|
||||||
|
|
||||||
The ``fmt::format`` function returns a string "The answer is 42.". You can use
|
The ``fmt::format`` function returns a string "The answer is 42.". You can use
|
||||||
``fmt::memory_buffer`` to avoid constructing ``std::string``:
|
``fmt::memory_buffer`` to avoid constructing ``std::string``:
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
fmt::memory_buffer out;
|
auto out = fmt::memory_buffer();
|
||||||
format_to(out, "For a moment, {} happened.", "nothing");
|
fmt::format_to(std::back_inserter(out),
|
||||||
out.data(); // returns a pointer to the formatted data
|
"For a moment, {} happened.", "nothing");
|
||||||
|
auto data = out.data(); // pointer to the formatted data
|
||||||
|
auto size = out.size(); // size of the formatted data
|
||||||
|
|
||||||
The ``fmt::print`` function performs formatting and writes the result to a stream:
|
The ``fmt::print`` function performs formatting and writes the result to a stream:
|
||||||
|
|
||||||
@ -48,21 +50,19 @@ The ``fmt::print`` function performs formatting and writes the result to a strea
|
|||||||
|
|
||||||
fmt::print(stderr, "System error code = {}\n", errno);
|
fmt::print(stderr, "System error code = {}\n", errno);
|
||||||
|
|
||||||
The file argument can be omitted in which case the function prints to
|
If you omit the file argument the function will print to ``stdout``:
|
||||||
``stdout``:
|
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
fmt::print("Don't {}\n", "panic");
|
fmt::print("Don't {}\n", "panic");
|
||||||
|
|
||||||
The Format API also supports positional arguments useful for localization:
|
The format API also supports positional arguments useful for localization:
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
fmt::print("I'd rather be {1} than {0}.", "right", "happy");
|
fmt::print("I'd rather be {1} than {0}.", "right", "happy");
|
||||||
|
|
||||||
Named arguments can be created with ``fmt::arg``. This makes it easier to track
|
You can pass named arguments with ``fmt::arg``:
|
||||||
what goes where when multiple arguments are being formatted:
|
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
@ -91,16 +91,17 @@ time. For example, the code
|
|||||||
|
|
||||||
fmt::format("The answer is {:d}", "forty-two");
|
fmt::format("The answer is {:d}", "forty-two");
|
||||||
|
|
||||||
throws a ``format_error`` exception with description "unknown format code 'd' for
|
throws the ``format_error`` exception because the argument ``"forty-two"`` is a
|
||||||
string", because the argument ``"forty-two"`` is a string while the format code
|
string while the format code ``d`` only applies to integers.
|
||||||
``d`` only applies to integers, while
|
|
||||||
|
The code
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
|
|
||||||
format(FMT_STRING("The answer is {:d}"), "forty-two");
|
format(FMT_STRING("The answer is {:d}"), "forty-two");
|
||||||
|
|
||||||
reports a compile-time error for the same reason on compilers that support
|
reports a compile-time error on compilers that support relaxed ``constexpr``.
|
||||||
relaxed ``constexpr``. See `here <api.html#c.fmt>`_ for details.
|
See `here <api.html#compile-time-format-string-checks>`_ for details.
|
||||||
|
|
||||||
The following code
|
The following code
|
||||||
|
|
||||||
@ -109,21 +110,15 @@ The following code
|
|||||||
fmt::format("Cyrillic letter {}", L'\x42e');
|
fmt::format("Cyrillic letter {}", L'\x42e');
|
||||||
|
|
||||||
produces a compile-time error because wide character ``L'\x42e'`` cannot be
|
produces a compile-time error because wide character ``L'\x42e'`` cannot be
|
||||||
formatted into a narrow string. You can use a wide format string instead:
|
formatted into a narrow string. For comparison, writing a wide character to
|
||||||
|
``std::ostream`` results in its numeric value being written to the stream
|
||||||
.. code:: c++
|
(i.e. 1070 instead of letter 'ю' which is represented by ``L'\x42e'`` if we
|
||||||
|
use Unicode) which is rarely desirable.
|
||||||
fmt::format(L"Cyrillic letter {}", L'\x42e');
|
|
||||||
|
|
||||||
For comparison, writing a wide character to ``std::ostream`` results in
|
|
||||||
its numeric value being written to the stream (i.e. 1070 instead of letter 'ю'
|
|
||||||
which is represented by ``L'\x42e'`` if we use Unicode) which is rarely what is
|
|
||||||
needed.
|
|
||||||
|
|
||||||
Compact Binary Code
|
Compact Binary Code
|
||||||
-------------------
|
-------------------
|
||||||
|
|
||||||
The library is designed to produce compact per-call compiled code. For example
|
The library produces compact per-call compiled code. For example
|
||||||
(`godbolt <https://godbolt.org/g/TZU4KF>`_),
|
(`godbolt <https://godbolt.org/g/TZU4KF>`_),
|
||||||
|
|
||||||
.. code:: c++
|
.. code:: c++
|
||||||
@ -144,8 +139,8 @@ compiles to just
|
|||||||
mov rcx, rsp
|
mov rcx, rsp
|
||||||
mov edi, offset .L.str
|
mov edi, offset .L.str
|
||||||
mov esi, 17
|
mov esi, 17
|
||||||
mov edx, 2
|
mov edx, 1
|
||||||
call fmt::v5::vprint(fmt::v5::basic_string_view<char>, fmt::v5::format_args)
|
call fmt::v7::vprint(fmt::v7::basic_string_view<char>, fmt::v7::format_args)
|
||||||
xor eax, eax
|
xor eax, eax
|
||||||
add rsp, 24
|
add rsp, 24
|
||||||
ret
|
ret
|
||||||
@ -167,20 +162,19 @@ The library is highly portable and relies only on a small set of C++11 features:
|
|||||||
* deleted functions
|
* deleted functions
|
||||||
* alias templates
|
* alias templates
|
||||||
|
|
||||||
These are available since GCC 4.8, Clang 3.0 and MSVC 19.0 (2015). For older
|
These are available in GCC 4.8, Clang 3.4, MSVC 19.0 (2015) and more recent
|
||||||
compilers use {fmt} `version 4.x
|
compiler version. For older compilers use {fmt} `version 4.x
|
||||||
<https://github.com/fmtlib/fmt/releases/tag/4.1.0>`_ which continues to be
|
<https://github.com/fmtlib/fmt/releases/tag/4.1.0>`_ which is maintained and
|
||||||
maintained and only requires C++98.
|
only requires C++98.
|
||||||
|
|
||||||
The output of all formatting functions is consistent across platforms. In
|
The output of all formatting functions is consistent across platforms.
|
||||||
particular, formatting a floating-point infinity always gives ``inf`` while the
|
For example,
|
||||||
output of ``printf`` is platform-dependent. For example,
|
|
||||||
|
|
||||||
.. code::
|
.. code::
|
||||||
|
|
||||||
fmt::print("{}", std::numeric_limits<double>::infinity());
|
fmt::print("{}", std::numeric_limits<double>::infinity());
|
||||||
|
|
||||||
always prints ``inf``.
|
always prints ``inf`` while the output of ``printf`` is platform-dependent.
|
||||||
|
|
||||||
.. _ease-of-use:
|
.. _ease-of-use:
|
||||||
|
|
||||||
@ -192,11 +186,13 @@ just three header files and no external dependencies.
|
|||||||
A permissive MIT `license <https://github.com/fmtlib/fmt#license>`_ allows
|
A permissive MIT `license <https://github.com/fmtlib/fmt#license>`_ allows
|
||||||
using the library both in open-source and commercial projects.
|
using the library both in open-source and commercial projects.
|
||||||
|
|
||||||
|
`Learn more... <contents.html>`_
|
||||||
|
|
||||||
.. raw:: html
|
.. raw:: html
|
||||||
|
|
||||||
<a class="btn btn-success" href="https://github.com/fmtlib/fmt">GitHub Repository</a>
|
<a class="btn btn-success" href="https://github.com/fmtlib/fmt">GitHub Repository</a>
|
||||||
|
|
||||||
<div class="section footer">
|
<div class="section footer">
|
||||||
<iframe src="http://ghbtns.com/github-btn.html?user=fmtlib&repo=fmt&type=watch&count=true"
|
<iframe src="https://ghbtns.com/github-btn.html?user=fmtlib&repo=fmt&type=watch&count=true"
|
||||||
class="github-btn" width="100" height="20"></iframe>
|
class="github-btn" width="100" height="20"></iframe>
|
||||||
</div>
|
</div>
|
||||||
|
136
externals/fmt/doc/syntax.rst
vendored
136
externals/fmt/doc/syntax.rst
vendored
@ -16,7 +16,7 @@ literal text, it can be escaped by doubling: ``{{`` and ``}}``.
|
|||||||
The grammar for a replacement field is as follows:
|
The grammar for a replacement field is as follows:
|
||||||
|
|
||||||
.. productionlist:: sf
|
.. productionlist:: sf
|
||||||
replacement_field: "{" [`arg_id`] [":" `format_spec`] "}"
|
replacement_field: "{" [`arg_id`] [":" (`format_spec` | `chrono_format_spec`)] "}"
|
||||||
arg_id: `integer` | `identifier`
|
arg_id: `integer` | `identifier`
|
||||||
integer: `digit`+
|
integer: `digit`+
|
||||||
digit: "0"..."9"
|
digit: "0"..."9"
|
||||||
@ -27,8 +27,8 @@ The grammar for a replacement field is as follows:
|
|||||||
In less formal terms, the replacement field can start with an *arg_id*
|
In less formal terms, the replacement field can start with an *arg_id*
|
||||||
that specifies the argument whose value is to be formatted and inserted into
|
that specifies the argument whose value is to be formatted and inserted into
|
||||||
the output instead of the replacement field.
|
the output instead of the replacement field.
|
||||||
The *arg_id* is optionally followed by a *format_spec*, which is preceded
|
The *arg_id* is optionally followed by a *format_spec*, which is preceded by a
|
||||||
by a colon ``':'``. These specify a non-default format for the replacement value.
|
colon ``':'``. These specify a non-default format for the replacement value.
|
||||||
|
|
||||||
See also the :ref:`formatspec` section.
|
See also the :ref:`formatspec` section.
|
||||||
|
|
||||||
@ -75,14 +75,14 @@ although some of the formatting options are only supported by the numeric types.
|
|||||||
The general form of a *standard format specifier* is:
|
The general form of a *standard format specifier* is:
|
||||||
|
|
||||||
.. productionlist:: sf
|
.. productionlist:: sf
|
||||||
format_spec: [[`fill`]`align`][`sign`]["#"]["0"][`width`]["." `precision`][`type`]
|
format_spec: [[`fill`]`align`][`sign`]["#"]["0"][`width`]["." `precision`]["L"][`type`]
|
||||||
fill: <a character other than '{' or '}'>
|
fill: <a character other than '{' or '}'>
|
||||||
align: "<" | ">" | "^"
|
align: "<" | ">" | "^"
|
||||||
sign: "+" | "-" | " "
|
sign: "+" | "-" | " "
|
||||||
width: `integer` | "{" `arg_id` "}"
|
width: `integer` | "{" [`arg_id`] "}"
|
||||||
precision: `integer` | "{" `arg_id` "}"
|
precision: `integer` | "{" [`arg_id`] "}"
|
||||||
type: `int_type` | "a" | "A" | "c" | "e" | "E" | "f" | "F" | "g" | "G" | "L" | "p" | "s"
|
type: "a" | "A" | "b" | "B" | "c" | "d" | "e" | "E" | "f" | "F" | "g" | "G" |
|
||||||
int_type: "b" | "B" | "d" | "o" | "x" | "X"
|
: "o" | "p" | "s" | "x" | "X"
|
||||||
|
|
||||||
The *fill* character can be any Unicode code point other than ``'{'`` or
|
The *fill* character can be any Unicode code point other than ``'{'`` or
|
||||||
``'}'``. The presence of a fill character is signaled by the character following
|
``'}'``. The presence of a fill character is signaled by the character following
|
||||||
@ -112,18 +112,18 @@ meaning in this case.
|
|||||||
The *sign* option is only valid for number types, and can be one of the
|
The *sign* option is only valid for number types, and can be one of the
|
||||||
following:
|
following:
|
||||||
|
|
||||||
+---------+----------------------------------------------------------+
|
+---------+------------------------------------------------------------+
|
||||||
| Option | Meaning |
|
| Option | Meaning |
|
||||||
+=========+==========================================================+
|
+=========+============================================================+
|
||||||
| ``'+'`` | indicates that a sign should be used for both |
|
| ``'+'`` | indicates that a sign should be used for both |
|
||||||
| | positive as well as negative numbers. |
|
| | nonnegative as well as negative numbers. |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+------------------------------------------------------------+
|
||||||
| ``'-'`` | indicates that a sign should be used only for negative |
|
| ``'-'`` | indicates that a sign should be used only for negative |
|
||||||
| | numbers (this is the default behavior). |
|
| | numbers (this is the default behavior). |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+------------------------------------------------------------+
|
||||||
| space | indicates that a leading space should be used on |
|
| space | indicates that a leading space should be used on |
|
||||||
| | positive numbers, and a minus sign on negative numbers. |
|
| | nonnegative numbers, and a minus sign on negative numbers. |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+------------------------------------------------------------+
|
||||||
|
|
||||||
The ``'#'`` option causes the "alternate form" to be used for the
|
The ``'#'`` option causes the "alternate form" to be used for the
|
||||||
conversion. The alternate form is defined differently for different
|
conversion. The alternate form is defined differently for different
|
||||||
@ -161,7 +161,11 @@ displayed after the decimal point for a floating-point value formatted with
|
|||||||
value formatted with ``'g'`` or ``'G'``. For non-number types the field
|
value formatted with ``'g'`` or ``'G'``. For non-number types the field
|
||||||
indicates the maximum field size - in other words, how many characters will be
|
indicates the maximum field size - in other words, how many characters will be
|
||||||
used from the field content. The *precision* is not allowed for integer,
|
used from the field content. The *precision* is not allowed for integer,
|
||||||
character, Boolean, and pointer values.
|
character, Boolean, and pointer values. Note that a C string must be
|
||||||
|
null-terminated even if precision is specified.
|
||||||
|
|
||||||
|
The ``'L'`` option uses the current locale setting to insert the appropriate
|
||||||
|
number separator characters. This option is only valid for numeric types.
|
||||||
|
|
||||||
Finally, the *type* determines how the data should be presented.
|
Finally, the *type* determines how the data should be presented.
|
||||||
|
|
||||||
@ -200,6 +204,8 @@ The available integer presentation types are:
|
|||||||
| | ``'#'`` option with this type adds the prefix ``"0B"`` |
|
| | ``'#'`` option with this type adds the prefix ``"0B"`` |
|
||||||
| | to the output value. |
|
| | to the output value. |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+----------------------------------------------------------+
|
||||||
|
| ``'c'`` | Character format. Outputs the number as a character. |
|
||||||
|
+---------+----------------------------------------------------------+
|
||||||
| ``'d'`` | Decimal integer. Outputs the number in base 10. |
|
| ``'d'`` | Decimal integer. Outputs the number in base 10. |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+----------------------------------------------------------+
|
||||||
| ``'o'`` | Octal format. Outputs the number in base 8. |
|
| ``'o'`` | Octal format. Outputs the number in base 8. |
|
||||||
@ -214,10 +220,6 @@ The available integer presentation types are:
|
|||||||
| | ``'#'`` option with this type adds the prefix ``"0X"`` |
|
| | ``'#'`` option with this type adds the prefix ``"0X"`` |
|
||||||
| | to the output value. |
|
| | to the output value. |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+----------------------------------------------------------+
|
||||||
| ``'L'`` | Locale-specific format. This is the same as ``'d'``, |
|
|
||||||
| | except that it uses the current locale setting to insert |
|
|
||||||
| | the appropriate number separator characters. |
|
|
||||||
+---------+----------------------------------------------------------+
|
|
||||||
| none | The same as ``'d'``. |
|
| none | The same as ``'d'``. |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
@ -261,14 +263,8 @@ The available presentation types for floating-point values are:
|
|||||||
| | ``'E'`` if the number gets too large. The |
|
| | ``'E'`` if the number gets too large. The |
|
||||||
| | representations of infinity and NaN are uppercased, too. |
|
| | representations of infinity and NaN are uppercased, too. |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+----------------------------------------------------------+
|
||||||
| ``'L'`` | Locale-specific format. This is the same as ``'g'``, |
|
| none | Similar to ``'g'``, except that the default precision is |
|
||||||
| | except that it uses the current locale setting to insert |
|
| | as high as needed to represent the particular value. |
|
||||||
| | the appropriate number separator characters. |
|
|
||||||
+---------+----------------------------------------------------------+
|
|
||||||
| none | Similar to ``'g'``, except that fixed-point notation, |
|
|
||||||
| | when used, has at least one digit past the decimal |
|
|
||||||
| | point. The default precision is as high as needed to |
|
|
||||||
| | represent the particular value. |
|
|
||||||
+---------+----------------------------------------------------------+
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
.. ifconfig:: False
|
.. ifconfig:: False
|
||||||
@ -303,6 +299,86 @@ The available presentation types for pointers are:
|
|||||||
| none | The same as ``'p'``. |
|
| none | The same as ``'p'``. |
|
||||||
+---------+----------------------------------------------------------+
|
+---------+----------------------------------------------------------+
|
||||||
|
|
||||||
|
.. _chrono-specs:
|
||||||
|
|
||||||
|
Chrono Format Specifications
|
||||||
|
============================
|
||||||
|
|
||||||
|
Format specifications for chrono types and ``std::tm`` have the following
|
||||||
|
syntax:
|
||||||
|
|
||||||
|
.. productionlist:: sf
|
||||||
|
chrono_format_spec: [[`fill`]`align`][`width`]["." `precision`][`chrono_specs`]
|
||||||
|
chrono_specs: [`chrono_specs`] `conversion_spec` | `chrono_specs` `literal_char`
|
||||||
|
conversion_spec: "%" [`modifier`] `chrono_type`
|
||||||
|
literal_char: <a character other than '{', '}' or '%'>
|
||||||
|
modifier: "E" | "O"
|
||||||
|
chrono_type: "a" | "A" | "b" | "B" | "c" | "C" | "d" | "D" | "e" | "F" |
|
||||||
|
: "g" | "G" | "h" | "H" | "I" | "j" | "m" | "M" | "n" | "p" |
|
||||||
|
: "q" | "Q" | "r" | "R" | "S" | "t" | "T" | "u" | "U" | "V" |
|
||||||
|
: "w" | "W" | "x" | "X" | "y" | "Y" | "z" | "Z" | "%"
|
||||||
|
|
||||||
|
Literal chars are copied unchanged to the output. Precision is valid only for
|
||||||
|
``std::chrono::duration`` types with a floating-point representation type.
|
||||||
|
|
||||||
|
The available presentation types (*chrono_type*) for chrono durations and time
|
||||||
|
points are:
|
||||||
|
|
||||||
|
+---------+--------------------------------------------------------------------+
|
||||||
|
| Type | Meaning |
|
||||||
|
+=========+====================================================================+
|
||||||
|
| ``'H'`` | The hour (24-hour clock) as a decimal number. If the result is a |
|
||||||
|
| | single digit, it is prefixed with 0. The modified command ``%OH`` |
|
||||||
|
| | produces the locale's alternative representation. |
|
||||||
|
+---------+--------------------------------------------------------------------+
|
||||||
|
| ``'M'`` | The minute as a decimal number. If the result is a single digit, |
|
||||||
|
| | it is prefixed with 0. The modified command ``%OM`` produces the |
|
||||||
|
| | locale's alternative representation. |
|
||||||
|
+---------+--------------------------------------------------------------------+
|
||||||
|
| ``'S'`` | Seconds as a decimal number. If the number of seconds is less than |
|
||||||
|
| | 10, the result is prefixed with 0. If the precision of the input |
|
||||||
|
| | cannot be exactly represented with seconds, then the format is a |
|
||||||
|
| | decimal floating-point number with a fixed format and a precision |
|
||||||
|
| | matching that of the precision of the input (or to a microseconds |
|
||||||
|
| | precision if the conversion to floating-point decimal seconds |
|
||||||
|
| | cannot be made within 18 fractional digits). The character for the |
|
||||||
|
| | decimal point is localized according to the locale. The modified |
|
||||||
|
| | command ``%OS`` produces the locale's alternative representation. |
|
||||||
|
+---------+--------------------------------------------------------------------+
|
||||||
|
|
||||||
|
Specifiers that have a calendaric component such as ``'d'`` (the day of month)
|
||||||
|
are valid only for ``std::tm`` and not durations or time points.
|
||||||
|
|
||||||
|
.. range-specs:
|
||||||
|
|
||||||
|
Range Format Specifications
|
||||||
|
===========================
|
||||||
|
|
||||||
|
Format specifications for range types have the following syntax:
|
||||||
|
|
||||||
|
.. productionlist:: sf
|
||||||
|
range_format_spec: [":" [`underlying_spec`]]
|
||||||
|
|
||||||
|
The `underlying_spec` is parsed based on the formatter of the range's
|
||||||
|
reference type.
|
||||||
|
|
||||||
|
By default, a range of characters or strings is printed escaped and quoted. But
|
||||||
|
if any `underlying_spec` is provided (even if it is empty), then the characters
|
||||||
|
or strings are printed according to the provided specification.
|
||||||
|
|
||||||
|
Examples::
|
||||||
|
|
||||||
|
fmt::format("{}", std::vector{10, 20, 30});
|
||||||
|
// Result: [10, 20, 30]
|
||||||
|
fmt::format("{::#x}", std::vector{10, 20, 30});
|
||||||
|
// Result: [0xa, 0x14, 0x13]
|
||||||
|
fmt::format("{}", vector{'h', 'e', 'l', 'l', 'o'});
|
||||||
|
// Result: ['h', 'e', 'l', 'l', 'o']
|
||||||
|
fmt::format("{::}", vector{'h', 'e', 'l', 'l', 'o'});
|
||||||
|
// Result: [h, e, l, l, o]
|
||||||
|
fmt::format("{::d}", vector{'h', 'e', 'l', 'l', 'o'});
|
||||||
|
// Result: [104, 101, 108, 108, 111]
|
||||||
|
|
||||||
.. _formatexamples:
|
.. _formatexamples:
|
||||||
|
|
||||||
Format Examples
|
Format Examples
|
||||||
@ -391,7 +467,7 @@ Using type-specific formatting::
|
|||||||
|
|
||||||
auto t = tm();
|
auto t = tm();
|
||||||
t.tm_year = 2010 - 1900;
|
t.tm_year = 2010 - 1900;
|
||||||
t.tm_mon = 6;
|
t.tm_mon = 7;
|
||||||
t.tm_mday = 4;
|
t.tm_mday = 4;
|
||||||
t.tm_hour = 12;
|
t.tm_hour = 12;
|
||||||
t.tm_min = 15;
|
t.tm_min = 15;
|
||||||
@ -401,7 +477,7 @@ Using type-specific formatting::
|
|||||||
|
|
||||||
Using the comma as a thousands separator::
|
Using the comma as a thousands separator::
|
||||||
|
|
||||||
#include <fmt/locale.h>
|
#include <fmt/format.h>
|
||||||
|
|
||||||
auto s = fmt::format(std::locale("en_US.UTF-8"), "{:L}", 1234567890);
|
auto s = fmt::format(std::locale("en_US.UTF-8"), "{:L}", 1234567890);
|
||||||
// s == "1,234,567,890"
|
// s == "1,234,567,890"
|
||||||
|
71
externals/fmt/doc/usage.rst
vendored
71
externals/fmt/doc/usage.rst
vendored
@ -15,7 +15,7 @@ Building the Library
|
|||||||
|
|
||||||
The included `CMake build script`__ can be used to build the fmt
|
The included `CMake build script`__ can be used to build the fmt
|
||||||
library on a wide range of platforms. CMake is freely available for
|
library on a wide range of platforms. CMake is freely available for
|
||||||
download from http://www.cmake.org/download/.
|
download from https://www.cmake.org/download/.
|
||||||
|
|
||||||
__ https://github.com/fmtlib/fmt/blob/master/CMakeLists.txt
|
__ https://github.com/fmtlib/fmt/blob/master/CMakeLists.txt
|
||||||
|
|
||||||
@ -50,7 +50,15 @@ To build a `shared library`__ set the ``BUILD_SHARED_LIBS`` CMake variable to
|
|||||||
|
|
||||||
cmake -DBUILD_SHARED_LIBS=TRUE ...
|
cmake -DBUILD_SHARED_LIBS=TRUE ...
|
||||||
|
|
||||||
__ http://en.wikipedia.org/wiki/Library_%28computing%29#Shared_libraries
|
__ https://en.wikipedia.org/wiki/Library_%28computing%29#Shared_libraries
|
||||||
|
|
||||||
|
|
||||||
|
To build a `static library` with position independent code (required if the main
|
||||||
|
consumer of the fmt library is a shared library i.e. a Python extension) set the
|
||||||
|
``CMAKE_POSITION_INDEPENDENT_CODE`` CMake variable to ``TRUE``::
|
||||||
|
|
||||||
|
cmake -DCMAKE_POSITION_INDEPENDENT_CODE=TRUE ...
|
||||||
|
|
||||||
|
|
||||||
Installing the Library
|
Installing the Library
|
||||||
======================
|
======================
|
||||||
@ -83,6 +91,49 @@ Setting up your target to use a header-only version of ``fmt`` is equally easy::
|
|||||||
|
|
||||||
target_link_libraries(<your-target> PRIVATE fmt::fmt-header-only)
|
target_link_libraries(<your-target> PRIVATE fmt::fmt-header-only)
|
||||||
|
|
||||||
|
Usage with build2
|
||||||
|
=================
|
||||||
|
|
||||||
|
You can use `build2 <https://build2.org>`_, a dependency manager and a
|
||||||
|
build-system combined, to use ``fmt``.
|
||||||
|
|
||||||
|
Currently this package is available in these package repositories:
|
||||||
|
|
||||||
|
- **https://cppget.org/fmt/** for released and published versions.
|
||||||
|
- `The git repository with the sources of the build2 package of fmt <https://github.com/build2-packaging/fmt.git>`_
|
||||||
|
for unreleased or custom revisions of ``fmt``.
|
||||||
|
|
||||||
|
**Usage:**
|
||||||
|
|
||||||
|
- ``build2`` package name: ``fmt``
|
||||||
|
- Library target name : ``lib{fmt}``
|
||||||
|
|
||||||
|
For example, to make your ``build2`` project depend on ``fmt``:
|
||||||
|
|
||||||
|
- Add one of the repositories to your configurations, or in your
|
||||||
|
``repositories.manifest``, if not already there::
|
||||||
|
|
||||||
|
:
|
||||||
|
role: prerequisite
|
||||||
|
location: https://pkg.cppget.org/1/stable
|
||||||
|
|
||||||
|
- Add this package as a dependency to your ``./manifest`` file
|
||||||
|
(example for ``v7.0.x``)::
|
||||||
|
|
||||||
|
depends: fmt ~7.0.0
|
||||||
|
|
||||||
|
- Import the target and use it as a prerequisite to your own target
|
||||||
|
using `fmt` in the appropriate ``buildfile``::
|
||||||
|
|
||||||
|
import fmt = fmt%lib{fmt}
|
||||||
|
lib{mylib} : cxx{**} ... $fmt
|
||||||
|
|
||||||
|
Then build your project as usual with `b` or `bdep update`.
|
||||||
|
|
||||||
|
For ``build2`` newcomers or to get more details and use cases, you can read the
|
||||||
|
``build2``
|
||||||
|
`toolchain introduction <https://build2.org/build2-toolchain/doc/build2-toolchain-intro.xhtml>`_.
|
||||||
|
|
||||||
Building the Documentation
|
Building the Documentation
|
||||||
==========================
|
==========================
|
||||||
|
|
||||||
@ -130,6 +181,18 @@ The fmt port in vcpkg is kept up to date by Microsoft team members and community
|
|||||||
contributors. If the version is out of date, please `create an issue or pull
|
contributors. If the version is out of date, please `create an issue or pull
|
||||||
request <https://github.com/Microsoft/vcpkg>`__ on the vcpkg repository.
|
request <https://github.com/Microsoft/vcpkg>`__ on the vcpkg repository.
|
||||||
|
|
||||||
|
LHelper
|
||||||
|
=======
|
||||||
|
|
||||||
|
You can download and install fmt using
|
||||||
|
`lhelper <https://github.com/franko/lhelper>`__ dependency manager::
|
||||||
|
|
||||||
|
lhelper activate <some-environment>
|
||||||
|
lhelper install fmt
|
||||||
|
|
||||||
|
All the recipes for lhelper are kept in the
|
||||||
|
`lhelper's recipe <https://github.com/franko/lhelper-recipes>`__ repository.
|
||||||
|
|
||||||
Android NDK
|
Android NDK
|
||||||
===========
|
===========
|
||||||
|
|
||||||
@ -139,11 +202,11 @@ For an example of using fmt with Android NDK, see the
|
|||||||
`android-ndk-example <https://github.com/fmtlib/android-ndk-example>`_
|
`android-ndk-example <https://github.com/fmtlib/android-ndk-example>`_
|
||||||
repository.
|
repository.
|
||||||
|
|
||||||
__ https://github.com/fmtlib/fmt/blob/master/Android.mk
|
__ https://github.com/fmtlib/fmt/blob/master/support/Android.mk
|
||||||
|
|
||||||
Homebrew
|
Homebrew
|
||||||
========
|
========
|
||||||
|
|
||||||
fmt can be installed on OS X using `Homebrew <http://brew.sh/>`_::
|
fmt can be installed on OS X using `Homebrew <https://brew.sh/>`_::
|
||||||
|
|
||||||
brew install fmt
|
brew install fmt
|
||||||
|
234
externals/fmt/include/fmt/args.h
vendored
Normal file
234
externals/fmt/include/fmt/args.h
vendored
Normal file
@ -0,0 +1,234 @@
|
|||||||
|
// Formatting library for C++ - dynamic format arguments
|
||||||
|
//
|
||||||
|
// Copyright (c) 2012 - present, Victor Zverovich
|
||||||
|
// All rights reserved.
|
||||||
|
//
|
||||||
|
// For the license information refer to format.h.
|
||||||
|
|
||||||
|
#ifndef FMT_ARGS_H_
|
||||||
|
#define FMT_ARGS_H_
|
||||||
|
|
||||||
|
#include <functional> // std::reference_wrapper
|
||||||
|
#include <memory> // std::unique_ptr
|
||||||
|
#include <vector>
|
||||||
|
|
||||||
|
#include "core.h"
|
||||||
|
|
||||||
|
FMT_BEGIN_NAMESPACE
|
||||||
|
|
||||||
|
namespace detail {
|
||||||
|
|
||||||
|
template <typename T> struct is_reference_wrapper : std::false_type {};
|
||||||
|
template <typename T>
|
||||||
|
struct is_reference_wrapper<std::reference_wrapper<T>> : std::true_type {};
|
||||||
|
|
||||||
|
template <typename T> const T& unwrap(const T& v) { return v; }
|
||||||
|
template <typename T> const T& unwrap(const std::reference_wrapper<T>& v) {
|
||||||
|
return static_cast<const T&>(v);
|
||||||
|
}
|
||||||
|
|
||||||
|
class dynamic_arg_list {
|
||||||
|
// Workaround for clang's -Wweak-vtables. Unlike for regular classes, for
|
||||||
|
// templates it doesn't complain about inability to deduce single translation
|
||||||
|
// unit for placing vtable. So storage_node_base is made a fake template.
|
||||||
|
template <typename = void> struct node {
|
||||||
|
virtual ~node() = default;
|
||||||
|
std::unique_ptr<node<>> next;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T> struct typed_node : node<> {
|
||||||
|
T value;
|
||||||
|
|
||||||
|
template <typename Arg>
|
||||||
|
FMT_CONSTEXPR typed_node(const Arg& arg) : value(arg) {}
|
||||||
|
|
||||||
|
template <typename Char>
|
||||||
|
FMT_CONSTEXPR typed_node(const basic_string_view<Char>& arg)
|
||||||
|
: value(arg.data(), arg.size()) {}
|
||||||
|
};
|
||||||
|
|
||||||
|
std::unique_ptr<node<>> head_;
|
||||||
|
|
||||||
|
public:
|
||||||
|
template <typename T, typename Arg> const T& push(const Arg& arg) {
|
||||||
|
auto new_node = std::unique_ptr<typed_node<T>>(new typed_node<T>(arg));
|
||||||
|
auto& value = new_node->value;
|
||||||
|
new_node->next = std::move(head_);
|
||||||
|
head_ = std::move(new_node);
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
A dynamic version of `fmt::format_arg_store`.
|
||||||
|
It's equipped with a storage to potentially temporary objects which lifetimes
|
||||||
|
could be shorter than the format arguments object.
|
||||||
|
|
||||||
|
It can be implicitly converted into `~fmt::basic_format_args` for passing
|
||||||
|
into type-erased formatting functions such as `~fmt::vformat`.
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
template <typename Context>
|
||||||
|
class dynamic_format_arg_store
|
||||||
|
#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409
|
||||||
|
// Workaround a GCC template argument substitution bug.
|
||||||
|
: public basic_format_args<Context>
|
||||||
|
#endif
|
||||||
|
{
|
||||||
|
private:
|
||||||
|
using char_type = typename Context::char_type;
|
||||||
|
|
||||||
|
template <typename T> struct need_copy {
|
||||||
|
static constexpr detail::type mapped_type =
|
||||||
|
detail::mapped_type_constant<T, Context>::value;
|
||||||
|
|
||||||
|
enum {
|
||||||
|
value = !(detail::is_reference_wrapper<T>::value ||
|
||||||
|
std::is_same<T, basic_string_view<char_type>>::value ||
|
||||||
|
std::is_same<T, detail::std_string_view<char_type>>::value ||
|
||||||
|
(mapped_type != detail::type::cstring_type &&
|
||||||
|
mapped_type != detail::type::string_type &&
|
||||||
|
mapped_type != detail::type::custom_type))
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
using stored_type = conditional_t<
|
||||||
|
std::is_convertible<T, std::basic_string<char_type>>::value &&
|
||||||
|
!detail::is_reference_wrapper<T>::value,
|
||||||
|
std::basic_string<char_type>, T>;
|
||||||
|
|
||||||
|
// Storage of basic_format_arg must be contiguous.
|
||||||
|
std::vector<basic_format_arg<Context>> data_;
|
||||||
|
std::vector<detail::named_arg_info<char_type>> named_info_;
|
||||||
|
|
||||||
|
// Storage of arguments not fitting into basic_format_arg must grow
|
||||||
|
// without relocation because items in data_ refer to it.
|
||||||
|
detail::dynamic_arg_list dynamic_args_;
|
||||||
|
|
||||||
|
friend class basic_format_args<Context>;
|
||||||
|
|
||||||
|
unsigned long long get_types() const {
|
||||||
|
return detail::is_unpacked_bit | data_.size() |
|
||||||
|
(named_info_.empty()
|
||||||
|
? 0ULL
|
||||||
|
: static_cast<unsigned long long>(detail::has_named_args_bit));
|
||||||
|
}
|
||||||
|
|
||||||
|
const basic_format_arg<Context>* data() const {
|
||||||
|
return named_info_.empty() ? data_.data() : data_.data() + 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T> void emplace_arg(const T& arg) {
|
||||||
|
data_.emplace_back(detail::make_arg<Context>(arg));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
void emplace_arg(const detail::named_arg<char_type, T>& arg) {
|
||||||
|
if (named_info_.empty()) {
|
||||||
|
constexpr const detail::named_arg_info<char_type>* zero_ptr{nullptr};
|
||||||
|
data_.insert(data_.begin(), {zero_ptr, 0});
|
||||||
|
}
|
||||||
|
data_.emplace_back(detail::make_arg<Context>(detail::unwrap(arg.value)));
|
||||||
|
auto pop_one = [](std::vector<basic_format_arg<Context>>* data) {
|
||||||
|
data->pop_back();
|
||||||
|
};
|
||||||
|
std::unique_ptr<std::vector<basic_format_arg<Context>>, decltype(pop_one)>
|
||||||
|
guard{&data_, pop_one};
|
||||||
|
named_info_.push_back({arg.name, static_cast<int>(data_.size() - 2u)});
|
||||||
|
data_[0].value_.named_args = {named_info_.data(), named_info_.size()};
|
||||||
|
guard.release();
|
||||||
|
}
|
||||||
|
|
||||||
|
public:
|
||||||
|
constexpr dynamic_format_arg_store() = default;
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
Adds an argument into the dynamic store for later passing to a formatting
|
||||||
|
function.
|
||||||
|
|
||||||
|
Note that custom types and string types (but not string views) are copied
|
||||||
|
into the store dynamically allocating memory if necessary.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
fmt::dynamic_format_arg_store<fmt::format_context> store;
|
||||||
|
store.push_back(42);
|
||||||
|
store.push_back("abc");
|
||||||
|
store.push_back(1.5f);
|
||||||
|
std::string result = fmt::vformat("{} and {} and {}", store);
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
template <typename T> void push_back(const T& arg) {
|
||||||
|
if (detail::const_check(need_copy<T>::value))
|
||||||
|
emplace_arg(dynamic_args_.push<stored_type<T>>(arg));
|
||||||
|
else
|
||||||
|
emplace_arg(detail::unwrap(arg));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
Adds a reference to the argument into the dynamic store for later passing to
|
||||||
|
a formatting function.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
fmt::dynamic_format_arg_store<fmt::format_context> store;
|
||||||
|
char band[] = "Rolling Stones";
|
||||||
|
store.push_back(std::cref(band));
|
||||||
|
band[9] = 'c'; // Changing str affects the output.
|
||||||
|
std::string result = fmt::vformat("{}", store);
|
||||||
|
// result == "Rolling Scones"
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
template <typename T> void push_back(std::reference_wrapper<T> arg) {
|
||||||
|
static_assert(
|
||||||
|
need_copy<T>::value,
|
||||||
|
"objects of built-in types and string views are always copied");
|
||||||
|
emplace_arg(arg.get());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
Adds named argument into the dynamic store for later passing to a formatting
|
||||||
|
function. ``std::reference_wrapper`` is supported to avoid copying of the
|
||||||
|
argument. The name is always copied into the store.
|
||||||
|
*/
|
||||||
|
template <typename T>
|
||||||
|
void push_back(const detail::named_arg<char_type, T>& arg) {
|
||||||
|
const char_type* arg_name =
|
||||||
|
dynamic_args_.push<std::basic_string<char_type>>(arg.name).c_str();
|
||||||
|
if (detail::const_check(need_copy<T>::value)) {
|
||||||
|
emplace_arg(
|
||||||
|
fmt::arg(arg_name, dynamic_args_.push<stored_type<T>>(arg.value)));
|
||||||
|
} else {
|
||||||
|
emplace_arg(fmt::arg(arg_name, arg.value));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/** Erase all elements from the store */
|
||||||
|
void clear() {
|
||||||
|
data_.clear();
|
||||||
|
named_info_.clear();
|
||||||
|
dynamic_args_ = detail::dynamic_arg_list();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
Reserves space to store at least *new_cap* arguments including
|
||||||
|
*new_cap_named* named arguments.
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
void reserve(size_t new_cap, size_t new_cap_named) {
|
||||||
|
FMT_ASSERT(new_cap >= new_cap_named,
|
||||||
|
"Set of arguments includes set of named arguments");
|
||||||
|
data_.reserve(new_cap);
|
||||||
|
named_info_.reserve(new_cap_named);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
|
#endif // FMT_ARGS_H_
|
1502
externals/fmt/include/fmt/chrono.h
vendored
1502
externals/fmt/include/fmt/chrono.h
vendored
File diff suppressed because it is too large
Load Diff
347
externals/fmt/include/fmt/color.h
vendored
347
externals/fmt/include/fmt/color.h
vendored
@ -11,6 +11,7 @@
|
|||||||
#include "format.h"
|
#include "format.h"
|
||||||
|
|
||||||
FMT_BEGIN_NAMESPACE
|
FMT_BEGIN_NAMESPACE
|
||||||
|
FMT_MODULE_EXPORT_BEGIN
|
||||||
|
|
||||||
enum class color : uint32_t {
|
enum class color : uint32_t {
|
||||||
alice_blue = 0xF0F8FF, // rgb(240,248,255)
|
alice_blue = 0xF0F8FF, // rgb(240,248,255)
|
||||||
@ -177,9 +178,13 @@ enum class terminal_color : uint8_t {
|
|||||||
|
|
||||||
enum class emphasis : uint8_t {
|
enum class emphasis : uint8_t {
|
||||||
bold = 1,
|
bold = 1,
|
||||||
italic = 1 << 1,
|
faint = 1 << 1,
|
||||||
underline = 1 << 2,
|
italic = 1 << 2,
|
||||||
strikethrough = 1 << 3
|
underline = 1 << 3,
|
||||||
|
blink = 1 << 4,
|
||||||
|
reverse = 1 << 5,
|
||||||
|
conceal = 1 << 6,
|
||||||
|
strikethrough = 1 << 7,
|
||||||
};
|
};
|
||||||
|
|
||||||
// rgb is a struct for red, green and blue colors.
|
// rgb is a struct for red, green and blue colors.
|
||||||
@ -198,21 +203,20 @@ struct rgb {
|
|||||||
uint8_t b;
|
uint8_t b;
|
||||||
};
|
};
|
||||||
|
|
||||||
namespace internal {
|
FMT_BEGIN_DETAIL_NAMESPACE
|
||||||
|
|
||||||
// color is a struct of either a rgb color or a terminal color.
|
// color is a struct of either a rgb color or a terminal color.
|
||||||
struct color_type {
|
struct color_type {
|
||||||
FMT_CONSTEXPR color_type() FMT_NOEXCEPT : is_rgb(), value{} {}
|
FMT_CONSTEXPR color_type() noexcept : is_rgb(), value{} {}
|
||||||
FMT_CONSTEXPR color_type(color rgb_color) FMT_NOEXCEPT : is_rgb(true),
|
FMT_CONSTEXPR color_type(color rgb_color) noexcept : is_rgb(true), value{} {
|
||||||
value{} {
|
|
||||||
value.rgb_color = static_cast<uint32_t>(rgb_color);
|
value.rgb_color = static_cast<uint32_t>(rgb_color);
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR color_type(rgb rgb_color) FMT_NOEXCEPT : is_rgb(true), value{} {
|
FMT_CONSTEXPR color_type(rgb rgb_color) noexcept : is_rgb(true), value{} {
|
||||||
value.rgb_color = (static_cast<uint32_t>(rgb_color.r) << 16) |
|
value.rgb_color = (static_cast<uint32_t>(rgb_color.r) << 16) |
|
||||||
(static_cast<uint32_t>(rgb_color.g) << 8) | rgb_color.b;
|
(static_cast<uint32_t>(rgb_color.g) << 8) | rgb_color.b;
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR color_type(terminal_color term_color) FMT_NOEXCEPT : is_rgb(),
|
FMT_CONSTEXPR color_type(terminal_color term_color) noexcept
|
||||||
value{} {
|
: is_rgb(), value{} {
|
||||||
value.term_color = static_cast<uint8_t>(term_color);
|
value.term_color = static_cast<uint8_t>(term_color);
|
||||||
}
|
}
|
||||||
bool is_rgb;
|
bool is_rgb;
|
||||||
@ -221,15 +225,14 @@ struct color_type {
|
|||||||
uint32_t rgb_color;
|
uint32_t rgb_color;
|
||||||
} value;
|
} value;
|
||||||
};
|
};
|
||||||
} // namespace internal
|
|
||||||
|
|
||||||
// Experimental text formatting support.
|
FMT_END_DETAIL_NAMESPACE
|
||||||
|
|
||||||
|
/** A text style consisting of foreground and background colors and emphasis. */
|
||||||
class text_style {
|
class text_style {
|
||||||
public:
|
public:
|
||||||
FMT_CONSTEXPR text_style(emphasis em = emphasis()) FMT_NOEXCEPT
|
FMT_CONSTEXPR text_style(emphasis em = emphasis()) noexcept
|
||||||
: set_foreground_color(),
|
: set_foreground_color(), set_background_color(), ems(em) {}
|
||||||
set_background_color(),
|
|
||||||
ems(em) {}
|
|
||||||
|
|
||||||
FMT_CONSTEXPR text_style& operator|=(const text_style& rhs) {
|
FMT_CONSTEXPR text_style& operator|=(const text_style& rhs) {
|
||||||
if (!set_foreground_color) {
|
if (!set_foreground_color) {
|
||||||
@ -260,63 +263,32 @@ class text_style {
|
|||||||
return lhs |= rhs;
|
return lhs |= rhs;
|
||||||
}
|
}
|
||||||
|
|
||||||
FMT_CONSTEXPR text_style& operator&=(const text_style& rhs) {
|
FMT_CONSTEXPR bool has_foreground() const noexcept {
|
||||||
if (!set_foreground_color) {
|
|
||||||
set_foreground_color = rhs.set_foreground_color;
|
|
||||||
foreground_color = rhs.foreground_color;
|
|
||||||
} else if (rhs.set_foreground_color) {
|
|
||||||
if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
|
|
||||||
FMT_THROW(format_error("can't AND a terminal color"));
|
|
||||||
foreground_color.value.rgb_color &= rhs.foreground_color.value.rgb_color;
|
|
||||||
}
|
|
||||||
|
|
||||||
if (!set_background_color) {
|
|
||||||
set_background_color = rhs.set_background_color;
|
|
||||||
background_color = rhs.background_color;
|
|
||||||
} else if (rhs.set_background_color) {
|
|
||||||
if (!background_color.is_rgb || !rhs.background_color.is_rgb)
|
|
||||||
FMT_THROW(format_error("can't AND a terminal color"));
|
|
||||||
background_color.value.rgb_color &= rhs.background_color.value.rgb_color;
|
|
||||||
}
|
|
||||||
|
|
||||||
ems = static_cast<emphasis>(static_cast<uint8_t>(ems) &
|
|
||||||
static_cast<uint8_t>(rhs.ems));
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
friend FMT_CONSTEXPR text_style operator&(text_style lhs,
|
|
||||||
const text_style& rhs) {
|
|
||||||
return lhs &= rhs;
|
|
||||||
}
|
|
||||||
|
|
||||||
FMT_CONSTEXPR bool has_foreground() const FMT_NOEXCEPT {
|
|
||||||
return set_foreground_color;
|
return set_foreground_color;
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR bool has_background() const FMT_NOEXCEPT {
|
FMT_CONSTEXPR bool has_background() const noexcept {
|
||||||
return set_background_color;
|
return set_background_color;
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR bool has_emphasis() const FMT_NOEXCEPT {
|
FMT_CONSTEXPR bool has_emphasis() const noexcept {
|
||||||
return static_cast<uint8_t>(ems) != 0;
|
return static_cast<uint8_t>(ems) != 0;
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR internal::color_type get_foreground() const FMT_NOEXCEPT {
|
FMT_CONSTEXPR detail::color_type get_foreground() const noexcept {
|
||||||
FMT_ASSERT(has_foreground(), "no foreground specified for this style");
|
FMT_ASSERT(has_foreground(), "no foreground specified for this style");
|
||||||
return foreground_color;
|
return foreground_color;
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR internal::color_type get_background() const FMT_NOEXCEPT {
|
FMT_CONSTEXPR detail::color_type get_background() const noexcept {
|
||||||
FMT_ASSERT(has_background(), "no background specified for this style");
|
FMT_ASSERT(has_background(), "no background specified for this style");
|
||||||
return background_color;
|
return background_color;
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR emphasis get_emphasis() const FMT_NOEXCEPT {
|
FMT_CONSTEXPR emphasis get_emphasis() const noexcept {
|
||||||
FMT_ASSERT(has_emphasis(), "no emphasis specified for this style");
|
FMT_ASSERT(has_emphasis(), "no emphasis specified for this style");
|
||||||
return ems;
|
return ems;
|
||||||
}
|
}
|
||||||
|
|
||||||
private:
|
private:
|
||||||
FMT_CONSTEXPR text_style(bool is_foreground,
|
FMT_CONSTEXPR text_style(bool is_foreground,
|
||||||
internal::color_type text_color) FMT_NOEXCEPT
|
detail::color_type text_color) noexcept
|
||||||
: set_foreground_color(),
|
: set_foreground_color(), set_background_color(), ems() {
|
||||||
set_background_color(),
|
|
||||||
ems() {
|
|
||||||
if (is_foreground) {
|
if (is_foreground) {
|
||||||
foreground_color = text_color;
|
foreground_color = text_color;
|
||||||
set_foreground_color = true;
|
set_foreground_color = true;
|
||||||
@ -326,45 +298,46 @@ class text_style {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
friend FMT_CONSTEXPR_DECL text_style fg(internal::color_type foreground)
|
friend FMT_CONSTEXPR text_style fg(detail::color_type foreground) noexcept;
|
||||||
FMT_NOEXCEPT;
|
|
||||||
friend FMT_CONSTEXPR_DECL text_style bg(internal::color_type background)
|
|
||||||
FMT_NOEXCEPT;
|
|
||||||
|
|
||||||
internal::color_type foreground_color;
|
friend FMT_CONSTEXPR text_style bg(detail::color_type background) noexcept;
|
||||||
internal::color_type background_color;
|
|
||||||
|
detail::color_type foreground_color;
|
||||||
|
detail::color_type background_color;
|
||||||
bool set_foreground_color;
|
bool set_foreground_color;
|
||||||
bool set_background_color;
|
bool set_background_color;
|
||||||
emphasis ems;
|
emphasis ems;
|
||||||
};
|
};
|
||||||
|
|
||||||
FMT_CONSTEXPR text_style fg(internal::color_type foreground) FMT_NOEXCEPT {
|
/** Creates a text style from the foreground (text) color. */
|
||||||
return text_style(/*is_foreground=*/true, foreground);
|
FMT_CONSTEXPR inline text_style fg(detail::color_type foreground) noexcept {
|
||||||
|
return text_style(true, foreground);
|
||||||
}
|
}
|
||||||
|
|
||||||
FMT_CONSTEXPR text_style bg(internal::color_type background) FMT_NOEXCEPT {
|
/** Creates a text style from the background color. */
|
||||||
return text_style(/*is_foreground=*/false, background);
|
FMT_CONSTEXPR inline text_style bg(detail::color_type background) noexcept {
|
||||||
|
return text_style(false, background);
|
||||||
}
|
}
|
||||||
|
|
||||||
FMT_CONSTEXPR text_style operator|(emphasis lhs, emphasis rhs) FMT_NOEXCEPT {
|
FMT_CONSTEXPR inline text_style operator|(emphasis lhs, emphasis rhs) noexcept {
|
||||||
return text_style(lhs) | rhs;
|
return text_style(lhs) | rhs;
|
||||||
}
|
}
|
||||||
|
|
||||||
namespace internal {
|
FMT_BEGIN_DETAIL_NAMESPACE
|
||||||
|
|
||||||
template <typename Char> struct ansi_color_escape {
|
template <typename Char> struct ansi_color_escape {
|
||||||
FMT_CONSTEXPR ansi_color_escape(internal::color_type text_color,
|
FMT_CONSTEXPR ansi_color_escape(detail::color_type text_color,
|
||||||
const char* esc) FMT_NOEXCEPT {
|
const char* esc) noexcept {
|
||||||
// If we have a terminal color, we need to output another escape code
|
// If we have a terminal color, we need to output another escape code
|
||||||
// sequence.
|
// sequence.
|
||||||
if (!text_color.is_rgb) {
|
if (!text_color.is_rgb) {
|
||||||
bool is_background = esc == internal::data::background_color;
|
bool is_background = esc == string_view("\x1b[48;2;");
|
||||||
uint32_t value = text_color.value.term_color;
|
uint32_t value = text_color.value.term_color;
|
||||||
// Background ASCII codes are the same as the foreground ones but with
|
// Background ASCII codes are the same as the foreground ones but with
|
||||||
// 10 more.
|
// 10 more.
|
||||||
if (is_background) value += 10u;
|
if (is_background) value += 10u;
|
||||||
|
|
||||||
std::size_t index = 0;
|
size_t index = 0;
|
||||||
buffer[index++] = static_cast<Char>('\x1b');
|
buffer[index++] = static_cast<Char>('\x1b');
|
||||||
buffer[index++] = static_cast<Char>('[');
|
buffer[index++] = static_cast<Char>('[');
|
||||||
|
|
||||||
@ -389,17 +362,19 @@ template <typename Char> struct ansi_color_escape {
|
|||||||
to_esc(color.b, buffer + 15, 'm');
|
to_esc(color.b, buffer + 15, 'm');
|
||||||
buffer[19] = static_cast<Char>(0);
|
buffer[19] = static_cast<Char>(0);
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR ansi_color_escape(emphasis em) FMT_NOEXCEPT {
|
FMT_CONSTEXPR ansi_color_escape(emphasis em) noexcept {
|
||||||
uint8_t em_codes[4] = {};
|
uint8_t em_codes[num_emphases] = {};
|
||||||
uint8_t em_bits = static_cast<uint8_t>(em);
|
if (has_emphasis(em, emphasis::bold)) em_codes[0] = 1;
|
||||||
if (em_bits & static_cast<uint8_t>(emphasis::bold)) em_codes[0] = 1;
|
if (has_emphasis(em, emphasis::faint)) em_codes[1] = 2;
|
||||||
if (em_bits & static_cast<uint8_t>(emphasis::italic)) em_codes[1] = 3;
|
if (has_emphasis(em, emphasis::italic)) em_codes[2] = 3;
|
||||||
if (em_bits & static_cast<uint8_t>(emphasis::underline)) em_codes[2] = 4;
|
if (has_emphasis(em, emphasis::underline)) em_codes[3] = 4;
|
||||||
if (em_bits & static_cast<uint8_t>(emphasis::strikethrough))
|
if (has_emphasis(em, emphasis::blink)) em_codes[4] = 5;
|
||||||
em_codes[3] = 9;
|
if (has_emphasis(em, emphasis::reverse)) em_codes[5] = 7;
|
||||||
|
if (has_emphasis(em, emphasis::conceal)) em_codes[6] = 8;
|
||||||
|
if (has_emphasis(em, emphasis::strikethrough)) em_codes[7] = 9;
|
||||||
|
|
||||||
std::size_t index = 0;
|
size_t index = 0;
|
||||||
for (int i = 0; i < 4; ++i) {
|
for (size_t i = 0; i < num_emphases; ++i) {
|
||||||
if (!em_codes[i]) continue;
|
if (!em_codes[i]) continue;
|
||||||
buffer[index++] = static_cast<Char>('\x1b');
|
buffer[index++] = static_cast<Char>('\x1b');
|
||||||
buffer[index++] = static_cast<Char>('[');
|
buffer[index++] = static_cast<Char>('[');
|
||||||
@ -408,129 +383,147 @@ template <typename Char> struct ansi_color_escape {
|
|||||||
}
|
}
|
||||||
buffer[index++] = static_cast<Char>(0);
|
buffer[index++] = static_cast<Char>(0);
|
||||||
}
|
}
|
||||||
FMT_CONSTEXPR operator const Char*() const FMT_NOEXCEPT { return buffer; }
|
FMT_CONSTEXPR operator const Char*() const noexcept { return buffer; }
|
||||||
|
|
||||||
FMT_CONSTEXPR const Char* begin() const FMT_NOEXCEPT { return buffer; }
|
FMT_CONSTEXPR const Char* begin() const noexcept { return buffer; }
|
||||||
FMT_CONSTEXPR const Char* end() const FMT_NOEXCEPT {
|
FMT_CONSTEXPR_CHAR_TRAITS const Char* end() const noexcept {
|
||||||
return buffer + std::char_traits<Char>::length(buffer);
|
return buffer + std::char_traits<Char>::length(buffer);
|
||||||
}
|
}
|
||||||
|
|
||||||
private:
|
private:
|
||||||
Char buffer[7u + 3u * 4u + 1u];
|
static constexpr size_t num_emphases = 8;
|
||||||
|
Char buffer[7u + 3u * num_emphases + 1u];
|
||||||
|
|
||||||
static FMT_CONSTEXPR void to_esc(uint8_t c, Char* out,
|
static FMT_CONSTEXPR void to_esc(uint8_t c, Char* out,
|
||||||
char delimiter) FMT_NOEXCEPT {
|
char delimiter) noexcept {
|
||||||
out[0] = static_cast<Char>('0' + c / 100);
|
out[0] = static_cast<Char>('0' + c / 100);
|
||||||
out[1] = static_cast<Char>('0' + c / 10 % 10);
|
out[1] = static_cast<Char>('0' + c / 10 % 10);
|
||||||
out[2] = static_cast<Char>('0' + c % 10);
|
out[2] = static_cast<Char>('0' + c % 10);
|
||||||
out[3] = static_cast<Char>(delimiter);
|
out[3] = static_cast<Char>(delimiter);
|
||||||
}
|
}
|
||||||
|
static FMT_CONSTEXPR bool has_emphasis(emphasis em, emphasis mask) noexcept {
|
||||||
|
return static_cast<uint8_t>(em) & static_cast<uint8_t>(mask);
|
||||||
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
template <typename Char>
|
template <typename Char>
|
||||||
FMT_CONSTEXPR ansi_color_escape<Char> make_foreground_color(
|
FMT_CONSTEXPR ansi_color_escape<Char> make_foreground_color(
|
||||||
internal::color_type foreground) FMT_NOEXCEPT {
|
detail::color_type foreground) noexcept {
|
||||||
return ansi_color_escape<Char>(foreground, internal::data::foreground_color);
|
return ansi_color_escape<Char>(foreground, "\x1b[38;2;");
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Char>
|
template <typename Char>
|
||||||
FMT_CONSTEXPR ansi_color_escape<Char> make_background_color(
|
FMT_CONSTEXPR ansi_color_escape<Char> make_background_color(
|
||||||
internal::color_type background) FMT_NOEXCEPT {
|
detail::color_type background) noexcept {
|
||||||
return ansi_color_escape<Char>(background, internal::data::background_color);
|
return ansi_color_escape<Char>(background, "\x1b[48;2;");
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Char>
|
template <typename Char>
|
||||||
FMT_CONSTEXPR ansi_color_escape<Char> make_emphasis(emphasis em) FMT_NOEXCEPT {
|
FMT_CONSTEXPR ansi_color_escape<Char> make_emphasis(emphasis em) noexcept {
|
||||||
return ansi_color_escape<Char>(em);
|
return ansi_color_escape<Char>(em);
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Char>
|
template <typename Char> inline void fputs(const Char* chars, FILE* stream) {
|
||||||
inline void fputs(const Char* chars, FILE* stream) FMT_NOEXCEPT {
|
int result = std::fputs(chars, stream);
|
||||||
std::fputs(chars, stream);
|
if (result < 0)
|
||||||
|
FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
|
||||||
}
|
}
|
||||||
|
|
||||||
template <>
|
template <> inline void fputs<wchar_t>(const wchar_t* chars, FILE* stream) {
|
||||||
inline void fputs<wchar_t>(const wchar_t* chars, FILE* stream) FMT_NOEXCEPT {
|
int result = std::fputws(chars, stream);
|
||||||
std::fputws(chars, stream);
|
if (result < 0)
|
||||||
|
FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Char> inline void reset_color(FILE* stream) FMT_NOEXCEPT {
|
template <typename Char> inline void reset_color(FILE* stream) {
|
||||||
fputs(internal::data::reset_color, stream);
|
fputs("\x1b[0m", stream);
|
||||||
}
|
}
|
||||||
|
|
||||||
template <> inline void reset_color<wchar_t>(FILE* stream) FMT_NOEXCEPT {
|
template <> inline void reset_color<wchar_t>(FILE* stream) {
|
||||||
fputs(internal::data::wreset_color, stream);
|
fputs(L"\x1b[0m", stream);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
template <typename Char> inline void reset_color(buffer<Char>& buffer) {
|
||||||
|
auto reset_color = string_view("\x1b[0m");
|
||||||
|
buffer.append(reset_color.begin(), reset_color.end());
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T> struct styled_arg {
|
||||||
|
const T& value;
|
||||||
|
text_style style;
|
||||||
|
};
|
||||||
|
|
||||||
template <typename Char>
|
template <typename Char>
|
||||||
inline void reset_color(basic_memory_buffer<Char>& buffer) FMT_NOEXCEPT {
|
void vformat_to(buffer<Char>& buf, const text_style& ts,
|
||||||
const char* begin = data::reset_color;
|
|
||||||
const char* end = begin + sizeof(data::reset_color) - 1;
|
|
||||||
buffer.append(begin, end);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename Char>
|
|
||||||
void vformat_to(basic_memory_buffer<Char>& buf, const text_style& ts,
|
|
||||||
basic_string_view<Char> format_str,
|
basic_string_view<Char> format_str,
|
||||||
basic_format_args<buffer_context<Char>> args) {
|
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
||||||
bool has_style = false;
|
bool has_style = false;
|
||||||
if (ts.has_emphasis()) {
|
if (ts.has_emphasis()) {
|
||||||
has_style = true;
|
has_style = true;
|
||||||
auto emphasis = internal::make_emphasis<Char>(ts.get_emphasis());
|
auto emphasis = detail::make_emphasis<Char>(ts.get_emphasis());
|
||||||
buf.append(emphasis.begin(), emphasis.end());
|
buf.append(emphasis.begin(), emphasis.end());
|
||||||
}
|
}
|
||||||
if (ts.has_foreground()) {
|
if (ts.has_foreground()) {
|
||||||
has_style = true;
|
has_style = true;
|
||||||
auto foreground =
|
auto foreground = detail::make_foreground_color<Char>(ts.get_foreground());
|
||||||
internal::make_foreground_color<Char>(ts.get_foreground());
|
|
||||||
buf.append(foreground.begin(), foreground.end());
|
buf.append(foreground.begin(), foreground.end());
|
||||||
}
|
}
|
||||||
if (ts.has_background()) {
|
if (ts.has_background()) {
|
||||||
has_style = true;
|
has_style = true;
|
||||||
auto background =
|
auto background = detail::make_background_color<Char>(ts.get_background());
|
||||||
internal::make_background_color<Char>(ts.get_background());
|
|
||||||
buf.append(background.begin(), background.end());
|
buf.append(background.begin(), background.end());
|
||||||
}
|
}
|
||||||
internal::vformat_to(buf, format_str, args);
|
detail::vformat_to(buf, format_str, args, {});
|
||||||
if (has_style) internal::reset_color<Char>(buf);
|
if (has_style) detail::reset_color<Char>(buf);
|
||||||
}
|
}
|
||||||
} // namespace internal
|
|
||||||
|
FMT_END_DETAIL_NAMESPACE
|
||||||
|
|
||||||
template <typename S, typename Char = char_t<S>>
|
template <typename S, typename Char = char_t<S>>
|
||||||
void vprint(std::FILE* f, const text_style& ts, const S& format,
|
void vprint(std::FILE* f, const text_style& ts, const S& format,
|
||||||
basic_format_args<buffer_context<Char>> args) {
|
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
||||||
basic_memory_buffer<Char> buf;
|
basic_memory_buffer<Char> buf;
|
||||||
internal::vformat_to(buf, ts, to_string_view(format), args);
|
detail::vformat_to(buf, ts, detail::to_string_view(format), args);
|
||||||
|
if (detail::is_utf8()) {
|
||||||
|
detail::print(f, basic_string_view<Char>(buf.begin(), buf.size()));
|
||||||
|
} else {
|
||||||
buf.push_back(Char(0));
|
buf.push_back(Char(0));
|
||||||
internal::fputs(buf.data(), f);
|
detail::fputs(buf.data(), f);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
\rst
|
||||||
Formats a string and prints it to the specified file stream using ANSI
|
Formats a string and prints it to the specified file stream using ANSI
|
||||||
escape sequences to specify text formatting.
|
escape sequences to specify text formatting.
|
||||||
Example:
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
|
fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
|
||||||
"Elapsed time: {0:.2f} seconds", 1.23);
|
"Elapsed time: {0:.2f} seconds", 1.23);
|
||||||
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename S, typename... Args,
|
template <typename S, typename... Args,
|
||||||
FMT_ENABLE_IF(internal::is_string<S>::value)>
|
FMT_ENABLE_IF(detail::is_string<S>::value)>
|
||||||
void print(std::FILE* f, const text_style& ts, const S& format_str,
|
void print(std::FILE* f, const text_style& ts, const S& format_str,
|
||||||
const Args&... args) {
|
const Args&... args) {
|
||||||
internal::check_format_string<Args...>(format_str);
|
vprint(f, ts, format_str,
|
||||||
using context = buffer_context<char_t<S>>;
|
fmt::make_format_args<buffer_context<char_t<S>>>(args...));
|
||||||
format_arg_store<context, Args...> as{args...};
|
|
||||||
vprint(f, ts, format_str, basic_format_args<context>(as));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
\rst
|
||||||
Formats a string and prints it to stdout using ANSI escape sequences to
|
Formats a string and prints it to stdout using ANSI escape sequences to
|
||||||
specify text formatting.
|
specify text formatting.
|
||||||
Example:
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
|
fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
|
||||||
"Elapsed time: {0:.2f} seconds", 1.23);
|
"Elapsed time: {0:.2f} seconds", 1.23);
|
||||||
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename S, typename... Args,
|
template <typename S, typename... Args,
|
||||||
FMT_ENABLE_IF(internal::is_string<S>::value)>
|
FMT_ENABLE_IF(detail::is_string<S>::value)>
|
||||||
void print(const text_style& ts, const S& format_str, const Args&... args) {
|
void print(const text_style& ts, const S& format_str, const Args&... args) {
|
||||||
return print(stdout, ts, format_str, args...);
|
return print(stdout, ts, format_str, args...);
|
||||||
}
|
}
|
||||||
@ -540,7 +533,7 @@ inline std::basic_string<Char> vformat(
|
|||||||
const text_style& ts, const S& format_str,
|
const text_style& ts, const S& format_str,
|
||||||
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
||||||
basic_memory_buffer<Char> buf;
|
basic_memory_buffer<Char> buf;
|
||||||
internal::vformat_to(buf, ts, to_string_view(format_str), args);
|
detail::vformat_to(buf, ts, detail::to_string_view(format_str), args);
|
||||||
return fmt::to_string(buf);
|
return fmt::to_string(buf);
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -559,10 +552,100 @@ inline std::basic_string<Char> vformat(
|
|||||||
template <typename S, typename... Args, typename Char = char_t<S>>
|
template <typename S, typename... Args, typename Char = char_t<S>>
|
||||||
inline std::basic_string<Char> format(const text_style& ts, const S& format_str,
|
inline std::basic_string<Char> format(const text_style& ts, const S& format_str,
|
||||||
const Args&... args) {
|
const Args&... args) {
|
||||||
return vformat(ts, to_string_view(format_str),
|
return fmt::vformat(ts, detail::to_string_view(format_str),
|
||||||
internal::make_args_checked<Args...>(format_str, args...));
|
fmt::make_format_args<buffer_context<Char>>(args...));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
Formats a string with the given text_style and writes the output to ``out``.
|
||||||
|
*/
|
||||||
|
template <typename OutputIt, typename Char,
|
||||||
|
FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value)>
|
||||||
|
OutputIt vformat_to(
|
||||||
|
OutputIt out, const text_style& ts, basic_string_view<Char> format_str,
|
||||||
|
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
||||||
|
auto&& buf = detail::get_buffer<Char>(out);
|
||||||
|
detail::vformat_to(buf, ts, format_str, args);
|
||||||
|
return detail::get_iterator(buf);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
Formats arguments with the given text_style, writes the result to the output
|
||||||
|
iterator ``out`` and returns the iterator past the end of the output range.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
std::vector<char> out;
|
||||||
|
fmt::format_to(std::back_inserter(out),
|
||||||
|
fmt::emphasis::bold | fg(fmt::color::red), "{}", 42);
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
template <typename OutputIt, typename S, typename... Args,
|
||||||
|
bool enable = detail::is_output_iterator<OutputIt, char_t<S>>::value&&
|
||||||
|
detail::is_string<S>::value>
|
||||||
|
inline auto format_to(OutputIt out, const text_style& ts, const S& format_str,
|
||||||
|
Args&&... args) ->
|
||||||
|
typename std::enable_if<enable, OutputIt>::type {
|
||||||
|
return vformat_to(out, ts, detail::to_string_view(format_str),
|
||||||
|
fmt::make_format_args<buffer_context<char_t<S>>>(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T, typename Char>
|
||||||
|
struct formatter<detail::styled_arg<T>, Char> : formatter<T, Char> {
|
||||||
|
template <typename FormatContext>
|
||||||
|
auto format(const detail::styled_arg<T>& arg, FormatContext& ctx) const
|
||||||
|
-> decltype(ctx.out()) {
|
||||||
|
const auto& ts = arg.style;
|
||||||
|
const auto& value = arg.value;
|
||||||
|
auto out = ctx.out();
|
||||||
|
|
||||||
|
bool has_style = false;
|
||||||
|
if (ts.has_emphasis()) {
|
||||||
|
has_style = true;
|
||||||
|
auto emphasis = detail::make_emphasis<Char>(ts.get_emphasis());
|
||||||
|
out = std::copy(emphasis.begin(), emphasis.end(), out);
|
||||||
|
}
|
||||||
|
if (ts.has_foreground()) {
|
||||||
|
has_style = true;
|
||||||
|
auto foreground =
|
||||||
|
detail::make_foreground_color<Char>(ts.get_foreground());
|
||||||
|
out = std::copy(foreground.begin(), foreground.end(), out);
|
||||||
|
}
|
||||||
|
if (ts.has_background()) {
|
||||||
|
has_style = true;
|
||||||
|
auto background =
|
||||||
|
detail::make_background_color<Char>(ts.get_background());
|
||||||
|
out = std::copy(background.begin(), background.end(), out);
|
||||||
|
}
|
||||||
|
out = formatter<T, Char>::format(value, ctx);
|
||||||
|
if (has_style) {
|
||||||
|
auto reset_color = string_view("\x1b[0m");
|
||||||
|
out = std::copy(reset_color.begin(), reset_color.end(), out);
|
||||||
|
}
|
||||||
|
return out;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
Returns an argument that will be formatted using ANSI escape sequences,
|
||||||
|
to be used in a formatting function.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
fmt::print("Elapsed time: {0:.2f} seconds",
|
||||||
|
fmt::styled(1.23, fmt::fg(fmt::color::green) |
|
||||||
|
fmt::bg(fmt::color::blue)));
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
template <typename T>
|
||||||
|
FMT_CONSTEXPR auto styled(const T& value, text_style ts)
|
||||||
|
-> detail::styled_arg<remove_cvref_t<T>> {
|
||||||
|
return detail::styled_arg<remove_cvref_t<T>>{value, ts};
|
||||||
|
}
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT_END
|
||||||
FMT_END_NAMESPACE
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
#endif // FMT_COLOR_H_
|
#endif // FMT_COLOR_H_
|
||||||
|
822
externals/fmt/include/fmt/compile.h
vendored
822
externals/fmt/include/fmt/compile.h
vendored
@ -8,344 +8,162 @@
|
|||||||
#ifndef FMT_COMPILE_H_
|
#ifndef FMT_COMPILE_H_
|
||||||
#define FMT_COMPILE_H_
|
#define FMT_COMPILE_H_
|
||||||
|
|
||||||
#include <vector>
|
|
||||||
|
|
||||||
#include "format.h"
|
#include "format.h"
|
||||||
|
|
||||||
FMT_BEGIN_NAMESPACE
|
FMT_BEGIN_NAMESPACE
|
||||||
namespace internal {
|
namespace detail {
|
||||||
|
|
||||||
// Part of a compiled format string. It can be either literal text or a
|
template <typename Char, typename InputIt>
|
||||||
// replacement field.
|
FMT_CONSTEXPR inline counting_iterator copy_str(InputIt begin, InputIt end,
|
||||||
template <typename Char> struct format_part {
|
counting_iterator it) {
|
||||||
enum class kind { arg_index, arg_name, text, replacement };
|
return it + (end - begin);
|
||||||
|
|
||||||
struct replacement {
|
|
||||||
arg_ref<Char> arg_id;
|
|
||||||
dynamic_format_specs<Char> specs;
|
|
||||||
};
|
|
||||||
|
|
||||||
kind part_kind;
|
|
||||||
union value {
|
|
||||||
int arg_index;
|
|
||||||
basic_string_view<Char> str;
|
|
||||||
replacement repl;
|
|
||||||
|
|
||||||
FMT_CONSTEXPR value(int index = 0) : arg_index(index) {}
|
|
||||||
FMT_CONSTEXPR value(basic_string_view<Char> s) : str(s) {}
|
|
||||||
FMT_CONSTEXPR value(replacement r) : repl(r) {}
|
|
||||||
} val;
|
|
||||||
// Position past the end of the argument id.
|
|
||||||
const Char* arg_id_end = nullptr;
|
|
||||||
|
|
||||||
FMT_CONSTEXPR format_part(kind k = kind::arg_index, value v = {})
|
|
||||||
: part_kind(k), val(v) {}
|
|
||||||
|
|
||||||
static FMT_CONSTEXPR format_part make_arg_index(int index) {
|
|
||||||
return format_part(kind::arg_index, index);
|
|
||||||
}
|
|
||||||
static FMT_CONSTEXPR format_part make_arg_name(basic_string_view<Char> name) {
|
|
||||||
return format_part(kind::arg_name, name);
|
|
||||||
}
|
|
||||||
static FMT_CONSTEXPR format_part make_text(basic_string_view<Char> text) {
|
|
||||||
return format_part(kind::text, text);
|
|
||||||
}
|
|
||||||
static FMT_CONSTEXPR format_part make_replacement(replacement repl) {
|
|
||||||
return format_part(kind::replacement, repl);
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename Char> struct part_counter {
|
|
||||||
unsigned num_parts = 0;
|
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
|
|
||||||
if (begin != end) ++num_parts;
|
|
||||||
}
|
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_arg_id() { ++num_parts; }
|
|
||||||
FMT_CONSTEXPR void on_arg_id(int) { ++num_parts; }
|
|
||||||
FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) { ++num_parts; }
|
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_replacement_field(const Char*) {}
|
|
||||||
|
|
||||||
FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
|
|
||||||
const Char* end) {
|
|
||||||
// Find the matching brace.
|
|
||||||
unsigned brace_counter = 0;
|
|
||||||
for (; begin != end; ++begin) {
|
|
||||||
if (*begin == '{') {
|
|
||||||
++brace_counter;
|
|
||||||
} else if (*begin == '}') {
|
|
||||||
if (brace_counter == 0u) break;
|
|
||||||
--brace_counter;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return begin;
|
|
||||||
}
|
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_error(const char*) {}
|
|
||||||
};
|
|
||||||
|
|
||||||
// Counts the number of parts in a format string.
|
|
||||||
template <typename Char>
|
|
||||||
FMT_CONSTEXPR unsigned count_parts(basic_string_view<Char> format_str) {
|
|
||||||
part_counter<Char> counter;
|
|
||||||
parse_format_string<true>(format_str, counter);
|
|
||||||
return counter.num_parts;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Char, typename PartHandler>
|
template <typename OutputIt> class truncating_iterator_base {
|
||||||
class format_string_compiler : public error_handler {
|
protected:
|
||||||
private:
|
OutputIt out_;
|
||||||
using part = format_part<Char>;
|
size_t limit_;
|
||||||
|
size_t count_ = 0;
|
||||||
|
|
||||||
PartHandler handler_;
|
truncating_iterator_base() : out_(), limit_(0) {}
|
||||||
part part_;
|
|
||||||
basic_string_view<Char> format_str_;
|
truncating_iterator_base(OutputIt out, size_t limit)
|
||||||
basic_format_parse_context<Char> parse_context_;
|
: out_(out), limit_(limit) {}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
FMT_CONSTEXPR format_string_compiler(basic_string_view<Char> format_str,
|
using iterator_category = std::output_iterator_tag;
|
||||||
PartHandler handler)
|
using value_type = typename std::iterator_traits<OutputIt>::value_type;
|
||||||
: handler_(handler),
|
using difference_type = std::ptrdiff_t;
|
||||||
format_str_(format_str),
|
using pointer = void;
|
||||||
parse_context_(format_str) {}
|
using reference = void;
|
||||||
|
FMT_UNCHECKED_ITERATOR(truncating_iterator_base);
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
|
OutputIt base() const { return out_; }
|
||||||
if (begin != end)
|
size_t count() const { return count_; }
|
||||||
handler_(part::make_text({begin, to_unsigned(end - begin)}));
|
};
|
||||||
|
|
||||||
|
// An output iterator that truncates the output and counts the number of objects
|
||||||
|
// written to it.
|
||||||
|
template <typename OutputIt,
|
||||||
|
typename Enable = typename std::is_void<
|
||||||
|
typename std::iterator_traits<OutputIt>::value_type>::type>
|
||||||
|
class truncating_iterator;
|
||||||
|
|
||||||
|
template <typename OutputIt>
|
||||||
|
class truncating_iterator<OutputIt, std::false_type>
|
||||||
|
: public truncating_iterator_base<OutputIt> {
|
||||||
|
mutable typename truncating_iterator_base<OutputIt>::value_type blackhole_;
|
||||||
|
|
||||||
|
public:
|
||||||
|
using value_type = typename truncating_iterator_base<OutputIt>::value_type;
|
||||||
|
|
||||||
|
truncating_iterator() = default;
|
||||||
|
|
||||||
|
truncating_iterator(OutputIt out, size_t limit)
|
||||||
|
: truncating_iterator_base<OutputIt>(out, limit) {}
|
||||||
|
|
||||||
|
truncating_iterator& operator++() {
|
||||||
|
if (this->count_++ < this->limit_) ++this->out_;
|
||||||
|
return *this;
|
||||||
}
|
}
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_arg_id() {
|
truncating_iterator operator++(int) {
|
||||||
part_ = part::make_arg_index(parse_context_.next_arg_id());
|
auto it = *this;
|
||||||
}
|
++*this;
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_arg_id(int id) {
|
|
||||||
parse_context_.check_arg_id(id);
|
|
||||||
part_ = part::make_arg_index(id);
|
|
||||||
}
|
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_arg_id(basic_string_view<Char> id) {
|
|
||||||
part_ = part::make_arg_name(id);
|
|
||||||
}
|
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_replacement_field(const Char* ptr) {
|
|
||||||
part_.arg_id_end = ptr;
|
|
||||||
handler_(part_);
|
|
||||||
}
|
|
||||||
|
|
||||||
FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
|
|
||||||
const Char* end) {
|
|
||||||
auto repl = typename part::replacement();
|
|
||||||
dynamic_specs_handler<basic_format_parse_context<Char>> handler(
|
|
||||||
repl.specs, parse_context_);
|
|
||||||
auto it = parse_format_specs(begin, end, handler);
|
|
||||||
if (*it != '}') on_error("missing '}' in format string");
|
|
||||||
repl.arg_id = part_.part_kind == part::kind::arg_index
|
|
||||||
? arg_ref<Char>(part_.val.arg_index)
|
|
||||||
: arg_ref<Char>(part_.val.str);
|
|
||||||
auto part = part::make_replacement(repl);
|
|
||||||
part.arg_id_end = begin;
|
|
||||||
handler_(part);
|
|
||||||
return it;
|
return it;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
value_type& operator*() const {
|
||||||
|
return this->count_ < this->limit_ ? *this->out_ : blackhole_;
|
||||||
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
// Compiles a format string and invokes handler(part) for each parsed part.
|
template <typename OutputIt>
|
||||||
template <bool IS_CONSTEXPR, typename Char, typename PartHandler>
|
class truncating_iterator<OutputIt, std::true_type>
|
||||||
FMT_CONSTEXPR void compile_format_string(basic_string_view<Char> format_str,
|
: public truncating_iterator_base<OutputIt> {
|
||||||
PartHandler handler) {
|
public:
|
||||||
parse_format_string<IS_CONSTEXPR>(
|
truncating_iterator() = default;
|
||||||
format_str,
|
|
||||||
format_string_compiler<Char, PartHandler>(format_str, handler));
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename Range, typename Context, typename Id>
|
truncating_iterator(OutputIt out, size_t limit)
|
||||||
void format_arg(
|
: truncating_iterator_base<OutputIt>(out, limit) {}
|
||||||
basic_format_parse_context<typename Range::value_type>& parse_ctx,
|
|
||||||
Context& ctx, Id arg_id) {
|
|
||||||
ctx.advance_to(
|
|
||||||
visit_format_arg(arg_formatter<Range>(ctx, &parse_ctx), ctx.arg(arg_id)));
|
|
||||||
}
|
|
||||||
|
|
||||||
// vformat_to is defined in a subnamespace to prevent ADL.
|
template <typename T> truncating_iterator& operator=(T val) {
|
||||||
namespace cf {
|
if (this->count_++ < this->limit_) *this->out_++ = val;
|
||||||
template <typename Context, typename Range, typename CompiledFormat>
|
return *this;
|
||||||
auto vformat_to(Range out, CompiledFormat& cf, basic_format_args<Context> args)
|
|
||||||
-> typename Context::iterator {
|
|
||||||
using char_type = typename Context::char_type;
|
|
||||||
basic_format_parse_context<char_type> parse_ctx(
|
|
||||||
to_string_view(cf.format_str_));
|
|
||||||
Context ctx(out.begin(), args);
|
|
||||||
|
|
||||||
const auto& parts = cf.parts();
|
|
||||||
for (auto part_it = std::begin(parts); part_it != std::end(parts);
|
|
||||||
++part_it) {
|
|
||||||
const auto& part = *part_it;
|
|
||||||
const auto& value = part.val;
|
|
||||||
|
|
||||||
using format_part_t = format_part<char_type>;
|
|
||||||
switch (part.part_kind) {
|
|
||||||
case format_part_t::kind::text: {
|
|
||||||
const auto text = value.str;
|
|
||||||
auto output = ctx.out();
|
|
||||||
auto&& it = reserve(output, text.size());
|
|
||||||
it = std::copy_n(text.begin(), text.size(), it);
|
|
||||||
ctx.advance_to(output);
|
|
||||||
break;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
case format_part_t::kind::arg_index:
|
truncating_iterator& operator++() { return *this; }
|
||||||
advance_to(parse_ctx, part.arg_id_end);
|
truncating_iterator& operator++(int) { return *this; }
|
||||||
internal::format_arg<Range>(parse_ctx, ctx, value.arg_index);
|
truncating_iterator& operator*() { return *this; }
|
||||||
break;
|
|
||||||
|
|
||||||
case format_part_t::kind::arg_name:
|
|
||||||
advance_to(parse_ctx, part.arg_id_end);
|
|
||||||
internal::format_arg<Range>(parse_ctx, ctx, value.str);
|
|
||||||
break;
|
|
||||||
|
|
||||||
case format_part_t::kind::replacement: {
|
|
||||||
const auto& arg_id_value = value.repl.arg_id.val;
|
|
||||||
const auto arg = value.repl.arg_id.kind == arg_id_kind::index
|
|
||||||
? ctx.arg(arg_id_value.index)
|
|
||||||
: ctx.arg(arg_id_value.name);
|
|
||||||
|
|
||||||
auto specs = value.repl.specs;
|
|
||||||
|
|
||||||
handle_dynamic_spec<width_checker>(specs.width, specs.width_ref, ctx);
|
|
||||||
handle_dynamic_spec<precision_checker>(specs.precision,
|
|
||||||
specs.precision_ref, ctx);
|
|
||||||
|
|
||||||
error_handler h;
|
|
||||||
numeric_specs_checker<error_handler> checker(h, arg.type());
|
|
||||||
if (specs.align == align::numeric) checker.require_numeric_argument();
|
|
||||||
if (specs.sign != sign::none) checker.check_sign();
|
|
||||||
if (specs.alt) checker.require_numeric_argument();
|
|
||||||
if (specs.precision >= 0) checker.check_precision();
|
|
||||||
|
|
||||||
advance_to(parse_ctx, part.arg_id_end);
|
|
||||||
ctx.advance_to(
|
|
||||||
visit_format_arg(arg_formatter<Range>(ctx, nullptr, &specs), arg));
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return ctx.out();
|
|
||||||
}
|
|
||||||
} // namespace cf
|
|
||||||
|
|
||||||
struct basic_compiled_format {};
|
|
||||||
|
|
||||||
template <typename S, typename = void>
|
|
||||||
struct compiled_format_base : basic_compiled_format {
|
|
||||||
using char_type = char_t<S>;
|
|
||||||
using parts_container = std::vector<internal::format_part<char_type>>;
|
|
||||||
|
|
||||||
parts_container compiled_parts;
|
|
||||||
|
|
||||||
explicit compiled_format_base(basic_string_view<char_type> format_str) {
|
|
||||||
compile_format_string<false>(format_str,
|
|
||||||
[this](const format_part<char_type>& part) {
|
|
||||||
compiled_parts.push_back(part);
|
|
||||||
});
|
|
||||||
}
|
|
||||||
|
|
||||||
const parts_container& parts() const { return compiled_parts; }
|
|
||||||
};
|
};
|
||||||
|
|
||||||
template <typename Char, unsigned N> struct format_part_array {
|
// A compile-time string which is compiled into fast formatting code.
|
||||||
format_part<Char> data[N] = {};
|
class compiled_string {};
|
||||||
FMT_CONSTEXPR format_part_array() = default;
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename Char, unsigned N>
|
|
||||||
FMT_CONSTEXPR format_part_array<Char, N> compile_to_parts(
|
|
||||||
basic_string_view<Char> format_str) {
|
|
||||||
format_part_array<Char, N> parts;
|
|
||||||
unsigned counter = 0;
|
|
||||||
// This is not a lambda for compatibility with older compilers.
|
|
||||||
struct {
|
|
||||||
format_part<Char>* parts;
|
|
||||||
unsigned* counter;
|
|
||||||
FMT_CONSTEXPR void operator()(const format_part<Char>& part) {
|
|
||||||
parts[(*counter)++] = part;
|
|
||||||
}
|
|
||||||
} collector{parts.data, &counter};
|
|
||||||
compile_format_string<true>(format_str, collector);
|
|
||||||
if (counter < N) {
|
|
||||||
parts.data[counter] =
|
|
||||||
format_part<Char>::make_text(basic_string_view<Char>());
|
|
||||||
}
|
|
||||||
return parts;
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename T> constexpr const T& constexpr_max(const T& a, const T& b) {
|
|
||||||
return (a < b) ? b : a;
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename S>
|
template <typename S>
|
||||||
struct compiled_format_base<S, enable_if_t<is_compile_string<S>::value>>
|
struct is_compiled_string : std::is_base_of<compiled_string, S> {};
|
||||||
: basic_compiled_format {
|
|
||||||
using char_type = char_t<S>;
|
|
||||||
|
|
||||||
FMT_CONSTEXPR explicit compiled_format_base(basic_string_view<char_type>) {}
|
/**
|
||||||
|
\rst
|
||||||
|
Converts a string literal *s* into a format string that will be parsed at
|
||||||
|
compile time and converted into efficient formatting code. Requires C++17
|
||||||
|
``constexpr if`` compiler support.
|
||||||
|
|
||||||
// Workaround for old compilers. Format string compilation will not be
|
**Example**::
|
||||||
// performed there anyway.
|
|
||||||
#if FMT_USE_CONSTEXPR
|
// Converts 42 into std::string using the most efficient method and no
|
||||||
static FMT_CONSTEXPR_DECL const unsigned num_format_parts =
|
// runtime format string processing.
|
||||||
constexpr_max(count_parts(to_string_view(S())), 1u);
|
std::string s = fmt::format(FMT_COMPILE("{}"), 42);
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
|
||||||
|
# define FMT_COMPILE(s) \
|
||||||
|
FMT_STRING_IMPL(s, fmt::detail::compiled_string, explicit)
|
||||||
#else
|
#else
|
||||||
static const unsigned num_format_parts = 1;
|
# define FMT_COMPILE(s) FMT_STRING(s)
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
using parts_container = format_part<char_type>[num_format_parts];
|
#if FMT_USE_NONTYPE_TEMPLATE_ARGS
|
||||||
|
template <typename Char, size_t N,
|
||||||
const parts_container& parts() const {
|
fmt::detail_exported::fixed_string<Char, N> Str>
|
||||||
static FMT_CONSTEXPR_DECL const auto compiled_parts =
|
struct udl_compiled_string : compiled_string {
|
||||||
compile_to_parts<char_type, num_format_parts>(
|
using char_type = Char;
|
||||||
internal::to_string_view(S()));
|
explicit constexpr operator basic_string_view<char_type>() const {
|
||||||
return compiled_parts.data;
|
return {Str.data, N - 1};
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
#endif
|
||||||
|
|
||||||
template <typename S, typename... Args>
|
template <typename T, typename... Tail>
|
||||||
class compiled_format : private compiled_format_base<S> {
|
const T& first(const T& value, const Tail&...) {
|
||||||
public:
|
return value;
|
||||||
using typename compiled_format_base<S>::char_type;
|
}
|
||||||
|
|
||||||
private:
|
#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
|
||||||
basic_string_view<char_type> format_str_;
|
|
||||||
|
|
||||||
template <typename Context, typename Range, typename CompiledFormat>
|
|
||||||
friend auto cf::vformat_to(Range out, CompiledFormat& cf,
|
|
||||||
basic_format_args<Context> args) ->
|
|
||||||
typename Context::iterator;
|
|
||||||
|
|
||||||
public:
|
|
||||||
compiled_format() = delete;
|
|
||||||
explicit constexpr compiled_format(basic_string_view<char_type> format_str)
|
|
||||||
: compiled_format_base<S>(format_str), format_str_(format_str) {}
|
|
||||||
};
|
|
||||||
|
|
||||||
#ifdef __cpp_if_constexpr
|
|
||||||
template <typename... Args> struct type_list {};
|
template <typename... Args> struct type_list {};
|
||||||
|
|
||||||
// Returns a reference to the argument at index N from [first, rest...].
|
// Returns a reference to the argument at index N from [first, rest...].
|
||||||
template <int N, typename T, typename... Args>
|
template <int N, typename T, typename... Args>
|
||||||
constexpr const auto& get(const T& first, const Args&... rest) {
|
constexpr const auto& get([[maybe_unused]] const T& first,
|
||||||
|
[[maybe_unused]] const Args&... rest) {
|
||||||
static_assert(N < 1 + sizeof...(Args), "index is out of bounds");
|
static_assert(N < 1 + sizeof...(Args), "index is out of bounds");
|
||||||
if constexpr (N == 0)
|
if constexpr (N == 0)
|
||||||
return first;
|
return first;
|
||||||
else
|
else
|
||||||
return get<N - 1>(rest...);
|
return detail::get<N - 1>(rest...);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Char, typename... Args>
|
||||||
|
constexpr int get_arg_index_by_name(basic_string_view<Char> name,
|
||||||
|
type_list<Args...>) {
|
||||||
|
return get_arg_index_by_name<Args...>(name);
|
||||||
}
|
}
|
||||||
|
|
||||||
template <int N, typename> struct get_type_impl;
|
template <int N, typename> struct get_type_impl;
|
||||||
|
|
||||||
template <int N, typename... Args> struct get_type_impl<N, type_list<Args...>> {
|
template <int N, typename... Args> struct get_type_impl<N, type_list<Args...>> {
|
||||||
using type = remove_cvref_t<decltype(get<N>(std::declval<Args>()...))>;
|
using type =
|
||||||
|
remove_cvref_t<decltype(detail::get<N>(std::declval<Args>()...))>;
|
||||||
};
|
};
|
||||||
|
|
||||||
template <int N, typename T>
|
template <int N, typename T>
|
||||||
@ -358,9 +176,8 @@ template <typename Char> struct text {
|
|||||||
using char_type = Char;
|
using char_type = Char;
|
||||||
|
|
||||||
template <typename OutputIt, typename... Args>
|
template <typename OutputIt, typename... Args>
|
||||||
OutputIt format(OutputIt out, const Args&...) const {
|
constexpr OutputIt format(OutputIt out, const Args&...) const {
|
||||||
// TODO: reserve
|
return write<Char>(out, data);
|
||||||
return copy_str<Char>(data.begin(), data.end(), out);
|
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
@ -373,55 +190,100 @@ constexpr text<Char> make_text(basic_string_view<Char> s, size_t pos,
|
|||||||
return {{&s[pos], size}};
|
return {{&s[pos], size}};
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Char, typename OutputIt, typename T,
|
template <typename Char> struct code_unit {
|
||||||
std::enable_if_t<std::is_integral_v<T>, int> = 0>
|
Char value;
|
||||||
OutputIt format_default(OutputIt out, T value) {
|
using char_type = Char;
|
||||||
// TODO: reserve
|
|
||||||
format_int fi(value);
|
template <typename OutputIt, typename... Args>
|
||||||
return std::copy(fi.data(), fi.data() + fi.size(), out);
|
constexpr OutputIt format(OutputIt out, const Args&...) const {
|
||||||
|
return write<Char>(out, value);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// This ensures that the argument type is convertible to `const T&`.
|
||||||
|
template <typename T, int N, typename... Args>
|
||||||
|
constexpr const T& get_arg_checked(const Args&... args) {
|
||||||
|
const auto& arg = detail::get<N>(args...);
|
||||||
|
if constexpr (detail::is_named_arg<remove_cvref_t<decltype(arg)>>()) {
|
||||||
|
return arg.value;
|
||||||
|
} else {
|
||||||
|
return arg;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Char, typename OutputIt>
|
template <typename Char>
|
||||||
OutputIt format_default(OutputIt out, double value) {
|
struct is_compiled_format<code_unit<Char>> : std::true_type {};
|
||||||
writer w(out);
|
|
||||||
w.write(value);
|
|
||||||
return w.out();
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename Char, typename OutputIt>
|
|
||||||
OutputIt format_default(OutputIt out, Char value) {
|
|
||||||
*out++ = value;
|
|
||||||
return out;
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename Char, typename OutputIt>
|
|
||||||
OutputIt format_default(OutputIt out, const Char* value) {
|
|
||||||
auto length = std::char_traits<Char>::length(value);
|
|
||||||
return copy_str<Char>(value, value + length, out);
|
|
||||||
}
|
|
||||||
|
|
||||||
// A replacement field that refers to argument N.
|
// A replacement field that refers to argument N.
|
||||||
template <typename Char, typename T, int N> struct field {
|
template <typename Char, typename T, int N> struct field {
|
||||||
using char_type = Char;
|
using char_type = Char;
|
||||||
|
|
||||||
template <typename OutputIt, typename... Args>
|
template <typename OutputIt, typename... Args>
|
||||||
OutputIt format(OutputIt out, const Args&... args) const {
|
constexpr OutputIt format(OutputIt out, const Args&... args) const {
|
||||||
// This ensures that the argument type is convertile to `const T&`.
|
return write<Char>(out, get_arg_checked<T, N>(args...));
|
||||||
const T& arg = get<N>(args...);
|
|
||||||
return format_default<Char>(out, arg);
|
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
template <typename Char, typename T, int N>
|
template <typename Char, typename T, int N>
|
||||||
struct is_compiled_format<field<Char, T, N>> : std::true_type {};
|
struct is_compiled_format<field<Char, T, N>> : std::true_type {};
|
||||||
|
|
||||||
|
// A replacement field that refers to argument with name.
|
||||||
|
template <typename Char> struct runtime_named_field {
|
||||||
|
using char_type = Char;
|
||||||
|
basic_string_view<Char> name;
|
||||||
|
|
||||||
|
template <typename OutputIt, typename T>
|
||||||
|
constexpr static bool try_format_argument(
|
||||||
|
OutputIt& out,
|
||||||
|
// [[maybe_unused]] due to unused-but-set-parameter warning in GCC 7,8,9
|
||||||
|
[[maybe_unused]] basic_string_view<Char> arg_name, const T& arg) {
|
||||||
|
if constexpr (is_named_arg<typename std::remove_cv<T>::type>::value) {
|
||||||
|
if (arg_name == arg.name) {
|
||||||
|
out = write<Char>(out, arg.value);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename OutputIt, typename... Args>
|
||||||
|
constexpr OutputIt format(OutputIt out, const Args&... args) const {
|
||||||
|
bool found = (try_format_argument(out, name, args) || ...);
|
||||||
|
if (!found) {
|
||||||
|
FMT_THROW(format_error("argument with specified name is not found"));
|
||||||
|
}
|
||||||
|
return out;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Char>
|
||||||
|
struct is_compiled_format<runtime_named_field<Char>> : std::true_type {};
|
||||||
|
|
||||||
|
// A replacement field that refers to argument N and has format specifiers.
|
||||||
|
template <typename Char, typename T, int N> struct spec_field {
|
||||||
|
using char_type = Char;
|
||||||
|
formatter<T, Char> fmt;
|
||||||
|
|
||||||
|
template <typename OutputIt, typename... Args>
|
||||||
|
constexpr FMT_INLINE OutputIt format(OutputIt out,
|
||||||
|
const Args&... args) const {
|
||||||
|
const auto& vargs =
|
||||||
|
fmt::make_format_args<basic_format_context<OutputIt, Char>>(args...);
|
||||||
|
basic_format_context<OutputIt, Char> ctx(out, vargs);
|
||||||
|
return fmt.format(get_arg_checked<T, N>(args...), ctx);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Char, typename T, int N>
|
||||||
|
struct is_compiled_format<spec_field<Char, T, N>> : std::true_type {};
|
||||||
|
|
||||||
template <typename L, typename R> struct concat {
|
template <typename L, typename R> struct concat {
|
||||||
L lhs;
|
L lhs;
|
||||||
R rhs;
|
R rhs;
|
||||||
using char_type = typename L::char_type;
|
using char_type = typename L::char_type;
|
||||||
|
|
||||||
template <typename OutputIt, typename... Args>
|
template <typename OutputIt, typename... Args>
|
||||||
OutputIt format(OutputIt out, const Args&... args) const {
|
constexpr OutputIt format(OutputIt out, const Args&... args) const {
|
||||||
out = lhs.format(out, args...);
|
out = lhs.format(out, args...);
|
||||||
return rhs.format(out, args...);
|
return rhs.format(out, args...);
|
||||||
}
|
}
|
||||||
@ -450,7 +312,8 @@ constexpr auto compile_format_string(S format_str);
|
|||||||
|
|
||||||
template <typename Args, size_t POS, int ID, typename T, typename S>
|
template <typename Args, size_t POS, int ID, typename T, typename S>
|
||||||
constexpr auto parse_tail(T head, S format_str) {
|
constexpr auto parse_tail(T head, S format_str) {
|
||||||
if constexpr (POS != to_string_view(format_str).size()) {
|
if constexpr (POS !=
|
||||||
|
basic_string_view<typename S::char_type>(format_str).size()) {
|
||||||
constexpr auto tail = compile_format_string<Args, POS, ID>(format_str);
|
constexpr auto tail = compile_format_string<Args, POS, ID>(format_str);
|
||||||
if constexpr (std::is_same<remove_cvref_t<decltype(tail)>,
|
if constexpr (std::is_same<remove_cvref_t<decltype(tail)>,
|
||||||
unknown_format>())
|
unknown_format>())
|
||||||
@ -462,134 +325,287 @@ constexpr auto parse_tail(T head, S format_str) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
template <typename T, typename Char> struct parse_specs_result {
|
||||||
|
formatter<T, Char> fmt;
|
||||||
|
size_t end;
|
||||||
|
int next_arg_id;
|
||||||
|
};
|
||||||
|
|
||||||
|
constexpr int manual_indexing_id = -1;
|
||||||
|
|
||||||
|
template <typename T, typename Char>
|
||||||
|
constexpr parse_specs_result<T, Char> parse_specs(basic_string_view<Char> str,
|
||||||
|
size_t pos, int next_arg_id) {
|
||||||
|
str.remove_prefix(pos);
|
||||||
|
auto ctx = compile_parse_context<Char>(str, max_value<int>(), nullptr, {},
|
||||||
|
next_arg_id);
|
||||||
|
auto f = formatter<T, Char>();
|
||||||
|
auto end = f.parse(ctx);
|
||||||
|
return {f, pos + fmt::detail::to_unsigned(end - str.data()),
|
||||||
|
next_arg_id == 0 ? manual_indexing_id : ctx.next_arg_id()};
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Char> struct arg_id_handler {
|
||||||
|
arg_ref<Char> arg_id;
|
||||||
|
|
||||||
|
constexpr int operator()() {
|
||||||
|
FMT_ASSERT(false, "handler cannot be used with automatic indexing");
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
constexpr int operator()(int id) {
|
||||||
|
arg_id = arg_ref<Char>(id);
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
constexpr int operator()(basic_string_view<Char> id) {
|
||||||
|
arg_id = arg_ref<Char>(id);
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
constexpr void on_error(const char* message) {
|
||||||
|
FMT_THROW(format_error(message));
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Char> struct parse_arg_id_result {
|
||||||
|
arg_ref<Char> arg_id;
|
||||||
|
const Char* arg_id_end;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <int ID, typename Char>
|
||||||
|
constexpr auto parse_arg_id(const Char* begin, const Char* end) {
|
||||||
|
auto handler = arg_id_handler<Char>{arg_ref<Char>{}};
|
||||||
|
auto arg_id_end = parse_arg_id(begin, end, handler);
|
||||||
|
return parse_arg_id_result<Char>{handler.arg_id, arg_id_end};
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T, typename Enable = void> struct field_type {
|
||||||
|
using type = remove_cvref_t<T>;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
struct field_type<T, enable_if_t<detail::is_named_arg<T>::value>> {
|
||||||
|
using type = remove_cvref_t<decltype(T::value)>;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T, typename Args, size_t END_POS, int ARG_INDEX, int NEXT_ID,
|
||||||
|
typename S>
|
||||||
|
constexpr auto parse_replacement_field_then_tail(S format_str) {
|
||||||
|
using char_type = typename S::char_type;
|
||||||
|
constexpr auto str = basic_string_view<char_type>(format_str);
|
||||||
|
constexpr char_type c = END_POS != str.size() ? str[END_POS] : char_type();
|
||||||
|
if constexpr (c == '}') {
|
||||||
|
return parse_tail<Args, END_POS + 1, NEXT_ID>(
|
||||||
|
field<char_type, typename field_type<T>::type, ARG_INDEX>(),
|
||||||
|
format_str);
|
||||||
|
} else if constexpr (c != ':') {
|
||||||
|
FMT_THROW(format_error("expected ':'"));
|
||||||
|
} else {
|
||||||
|
constexpr auto result = parse_specs<typename field_type<T>::type>(
|
||||||
|
str, END_POS + 1, NEXT_ID == manual_indexing_id ? 0 : NEXT_ID);
|
||||||
|
if constexpr (result.end >= str.size() || str[result.end] != '}') {
|
||||||
|
FMT_THROW(format_error("expected '}'"));
|
||||||
|
return 0;
|
||||||
|
} else {
|
||||||
|
return parse_tail<Args, result.end + 1, result.next_arg_id>(
|
||||||
|
spec_field<char_type, typename field_type<T>::type, ARG_INDEX>{
|
||||||
|
result.fmt},
|
||||||
|
format_str);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
// Compiles a non-empty format string and returns the compiled representation
|
// Compiles a non-empty format string and returns the compiled representation
|
||||||
// or unknown_format() on unrecognized input.
|
// or unknown_format() on unrecognized input.
|
||||||
template <typename Args, size_t POS, int ID, typename S>
|
template <typename Args, size_t POS, int ID, typename S>
|
||||||
constexpr auto compile_format_string(S format_str) {
|
constexpr auto compile_format_string(S format_str) {
|
||||||
using char_type = typename S::char_type;
|
using char_type = typename S::char_type;
|
||||||
constexpr basic_string_view<char_type> str = format_str;
|
constexpr auto str = basic_string_view<char_type>(format_str);
|
||||||
if constexpr (str[POS] == '{') {
|
if constexpr (str[POS] == '{') {
|
||||||
if (POS + 1 == str.size())
|
if constexpr (POS + 1 == str.size())
|
||||||
throw format_error("unmatched '{' in format string");
|
FMT_THROW(format_error("unmatched '{' in format string"));
|
||||||
if constexpr (str[POS + 1] == '{') {
|
if constexpr (str[POS + 1] == '{') {
|
||||||
return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
|
return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
|
||||||
} else if constexpr (str[POS + 1] == '}') {
|
} else if constexpr (str[POS + 1] == '}' || str[POS + 1] == ':') {
|
||||||
using type = get_type<ID, Args>;
|
static_assert(ID != manual_indexing_id,
|
||||||
if constexpr (std::is_same<type, int>::value) {
|
"cannot switch from manual to automatic argument indexing");
|
||||||
return parse_tail<Args, POS + 2, ID + 1>(field<char_type, type, ID>(),
|
constexpr auto next_id =
|
||||||
|
ID != manual_indexing_id ? ID + 1 : manual_indexing_id;
|
||||||
|
return parse_replacement_field_then_tail<get_type<ID, Args>, Args,
|
||||||
|
POS + 1, ID, next_id>(
|
||||||
format_str);
|
format_str);
|
||||||
} else {
|
} else {
|
||||||
return unknown_format();
|
constexpr auto arg_id_result =
|
||||||
}
|
parse_arg_id<ID>(str.data() + POS + 1, str.data() + str.size());
|
||||||
|
constexpr auto arg_id_end_pos = arg_id_result.arg_id_end - str.data();
|
||||||
|
constexpr char_type c =
|
||||||
|
arg_id_end_pos != str.size() ? str[arg_id_end_pos] : char_type();
|
||||||
|
static_assert(c == '}' || c == ':', "missing '}' in format string");
|
||||||
|
if constexpr (arg_id_result.arg_id.kind == arg_id_kind::index) {
|
||||||
|
static_assert(
|
||||||
|
ID == manual_indexing_id || ID == 0,
|
||||||
|
"cannot switch from automatic to manual argument indexing");
|
||||||
|
constexpr auto arg_index = arg_id_result.arg_id.val.index;
|
||||||
|
return parse_replacement_field_then_tail<get_type<arg_index, Args>,
|
||||||
|
Args, arg_id_end_pos,
|
||||||
|
arg_index, manual_indexing_id>(
|
||||||
|
format_str);
|
||||||
|
} else if constexpr (arg_id_result.arg_id.kind == arg_id_kind::name) {
|
||||||
|
constexpr auto arg_index =
|
||||||
|
get_arg_index_by_name(arg_id_result.arg_id.val.name, Args{});
|
||||||
|
if constexpr (arg_index != invalid_arg_index) {
|
||||||
|
constexpr auto next_id =
|
||||||
|
ID != manual_indexing_id ? ID + 1 : manual_indexing_id;
|
||||||
|
return parse_replacement_field_then_tail<
|
||||||
|
decltype(get_type<arg_index, Args>::value), Args, arg_id_end_pos,
|
||||||
|
arg_index, next_id>(format_str);
|
||||||
} else {
|
} else {
|
||||||
return unknown_format();
|
if constexpr (c == '}') {
|
||||||
|
return parse_tail<Args, arg_id_end_pos + 1, ID>(
|
||||||
|
runtime_named_field<char_type>{arg_id_result.arg_id.val.name},
|
||||||
|
format_str);
|
||||||
|
} else if constexpr (c == ':') {
|
||||||
|
return unknown_format(); // no type info for specs parsing
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
} else if constexpr (str[POS] == '}') {
|
} else if constexpr (str[POS] == '}') {
|
||||||
if (POS + 1 == str.size())
|
if constexpr (POS + 1 == str.size())
|
||||||
throw format_error("unmatched '}' in format string");
|
FMT_THROW(format_error("unmatched '}' in format string"));
|
||||||
return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
|
return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
|
||||||
} else {
|
} else {
|
||||||
constexpr auto end = parse_text(str, POS + 1);
|
constexpr auto end = parse_text(str, POS + 1);
|
||||||
|
if constexpr (end - POS > 1) {
|
||||||
return parse_tail<Args, end, ID>(make_text(str, POS, end - POS),
|
return parse_tail<Args, end, ID>(make_text(str, POS, end - POS),
|
||||||
format_str);
|
format_str);
|
||||||
|
} else {
|
||||||
|
return parse_tail<Args, end, ID>(code_unit<char_type>{str[POS]},
|
||||||
|
format_str);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
#endif // __cpp_if_constexpr
|
|
||||||
} // namespace internal
|
|
||||||
|
|
||||||
#if FMT_USE_CONSTEXPR
|
|
||||||
# ifdef __cpp_if_constexpr
|
|
||||||
template <typename... Args, typename S,
|
template <typename... Args, typename S,
|
||||||
FMT_ENABLE_IF(is_compile_string<S>::value)>
|
FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
|
||||||
constexpr auto compile(S format_str) {
|
constexpr auto compile(S format_str) {
|
||||||
constexpr basic_string_view<typename S::char_type> str = format_str;
|
constexpr auto str = basic_string_view<typename S::char_type>(format_str);
|
||||||
if constexpr (str.size() == 0) {
|
if constexpr (str.size() == 0) {
|
||||||
return internal::make_text(str, 0, 0);
|
return detail::make_text(str, 0, 0);
|
||||||
} else {
|
} else {
|
||||||
constexpr auto result =
|
constexpr auto result =
|
||||||
internal::compile_format_string<internal::type_list<Args...>, 0, 0>(
|
detail::compile_format_string<detail::type_list<Args...>, 0, 0>(
|
||||||
format_str);
|
format_str);
|
||||||
if constexpr (std::is_same<remove_cvref_t<decltype(result)>,
|
|
||||||
internal::unknown_format>()) {
|
|
||||||
return internal::compiled_format<S, Args...>(to_string_view(format_str));
|
|
||||||
} else {
|
|
||||||
return result;
|
return result;
|
||||||
}
|
}
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
#endif // defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT_BEGIN
|
||||||
|
|
||||||
|
#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
|
||||||
|
|
||||||
template <typename CompiledFormat, typename... Args,
|
template <typename CompiledFormat, typename... Args,
|
||||||
typename Char = typename CompiledFormat::char_type,
|
typename Char = typename CompiledFormat::char_type,
|
||||||
FMT_ENABLE_IF(internal::is_compiled_format<CompiledFormat>::value)>
|
FMT_ENABLE_IF(detail::is_compiled_format<CompiledFormat>::value)>
|
||||||
std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
|
FMT_INLINE std::basic_string<Char> format(const CompiledFormat& cf,
|
||||||
basic_memory_buffer<Char> buffer;
|
const Args&... args) {
|
||||||
cf.format(std::back_inserter(buffer), args...);
|
auto s = std::basic_string<Char>();
|
||||||
return to_string(buffer);
|
cf.format(std::back_inserter(s), args...);
|
||||||
|
return s;
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename OutputIt, typename CompiledFormat, typename... Args,
|
template <typename OutputIt, typename CompiledFormat, typename... Args,
|
||||||
FMT_ENABLE_IF(internal::is_compiled_format<CompiledFormat>::value)>
|
FMT_ENABLE_IF(detail::is_compiled_format<CompiledFormat>::value)>
|
||||||
OutputIt format_to(OutputIt out, const CompiledFormat& cf,
|
constexpr FMT_INLINE OutputIt format_to(OutputIt out, const CompiledFormat& cf,
|
||||||
const Args&... args) {
|
const Args&... args) {
|
||||||
return cf.format(out, args...);
|
return cf.format(out, args...);
|
||||||
}
|
}
|
||||||
# else
|
|
||||||
template <typename... Args, typename S,
|
|
||||||
FMT_ENABLE_IF(is_compile_string<S>::value)>
|
|
||||||
constexpr auto compile(S format_str) -> internal::compiled_format<S, Args...> {
|
|
||||||
return internal::compiled_format<S, Args...>(to_string_view(format_str));
|
|
||||||
}
|
|
||||||
# endif // __cpp_if_constexpr
|
|
||||||
#endif // FMT_USE_CONSTEXPR
|
|
||||||
|
|
||||||
// Compiles the format string which must be a string literal.
|
template <typename S, typename... Args,
|
||||||
template <typename... Args, typename Char, size_t N>
|
FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
|
||||||
auto compile(const Char (&format_str)[N])
|
FMT_INLINE std::basic_string<typename S::char_type> format(const S&,
|
||||||
-> internal::compiled_format<const Char*, Args...> {
|
Args&&... args) {
|
||||||
return internal::compiled_format<const Char*, Args...>(
|
if constexpr (std::is_same<typename S::char_type, char>::value) {
|
||||||
basic_string_view<Char>(format_str, N - 1));
|
constexpr auto str = basic_string_view<typename S::char_type>(S());
|
||||||
|
if constexpr (str.size() == 2 && str[0] == '{' && str[1] == '}') {
|
||||||
|
const auto& first = detail::first(args...);
|
||||||
|
if constexpr (detail::is_named_arg<
|
||||||
|
remove_cvref_t<decltype(first)>>::value) {
|
||||||
|
return fmt::to_string(first.value);
|
||||||
|
} else {
|
||||||
|
return fmt::to_string(first);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
constexpr auto compiled = detail::compile<Args...>(S());
|
||||||
|
if constexpr (std::is_same<remove_cvref_t<decltype(compiled)>,
|
||||||
|
detail::unknown_format>()) {
|
||||||
|
return fmt::format(
|
||||||
|
static_cast<basic_string_view<typename S::char_type>>(S()),
|
||||||
|
std::forward<Args>(args)...);
|
||||||
|
} else {
|
||||||
|
return fmt::format(compiled, std::forward<Args>(args)...);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename CompiledFormat, typename... Args,
|
template <typename OutputIt, typename S, typename... Args,
|
||||||
typename Char = typename CompiledFormat::char_type,
|
FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
|
||||||
FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
|
FMT_CONSTEXPR OutputIt format_to(OutputIt out, const S&, Args&&... args) {
|
||||||
CompiledFormat>::value)>
|
constexpr auto compiled = detail::compile<Args...>(S());
|
||||||
std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
|
if constexpr (std::is_same<remove_cvref_t<decltype(compiled)>,
|
||||||
basic_memory_buffer<Char> buffer;
|
detail::unknown_format>()) {
|
||||||
using range = buffer_range<Char>;
|
return fmt::format_to(
|
||||||
using context = buffer_context<Char>;
|
out, static_cast<basic_string_view<typename S::char_type>>(S()),
|
||||||
internal::cf::vformat_to<context>(range(buffer), cf,
|
std::forward<Args>(args)...);
|
||||||
make_format_args<context>(args...));
|
} else {
|
||||||
return to_string(buffer);
|
return fmt::format_to(out, compiled, std::forward<Args>(args)...);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
template <typename OutputIt, typename CompiledFormat, typename... Args,
|
template <typename OutputIt, typename S, typename... Args,
|
||||||
FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
|
FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
|
||||||
CompiledFormat>::value)>
|
|
||||||
OutputIt format_to(OutputIt out, const CompiledFormat& cf,
|
|
||||||
const Args&... args) {
|
|
||||||
using char_type = typename CompiledFormat::char_type;
|
|
||||||
using range = internal::output_range<OutputIt, char_type>;
|
|
||||||
using context = format_context_t<OutputIt, char_type>;
|
|
||||||
return internal::cf::vformat_to<context>(range(out), cf,
|
|
||||||
make_format_args<context>(args...));
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename OutputIt, typename CompiledFormat, typename... Args,
|
|
||||||
FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)>
|
|
||||||
format_to_n_result<OutputIt> format_to_n(OutputIt out, size_t n,
|
format_to_n_result<OutputIt> format_to_n(OutputIt out, size_t n,
|
||||||
const CompiledFormat& cf,
|
const S& format_str, Args&&... args) {
|
||||||
const Args&... args) {
|
auto it = fmt::format_to(detail::truncating_iterator<OutputIt>(out, n),
|
||||||
auto it =
|
format_str, std::forward<Args>(args)...);
|
||||||
format_to(internal::truncating_iterator<OutputIt>(out, n), cf, args...);
|
|
||||||
return {it.base(), it.count()};
|
return {it.base(), it.count()};
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename CompiledFormat, typename... Args>
|
template <typename S, typename... Args,
|
||||||
std::size_t formatted_size(const CompiledFormat& cf, const Args&... args) {
|
FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
|
||||||
return format_to(internal::counting_iterator(), cf, args...).count();
|
FMT_CONSTEXPR20 size_t formatted_size(const S& format_str,
|
||||||
|
const Args&... args) {
|
||||||
|
return fmt::format_to(detail::counting_iterator(), format_str, args...)
|
||||||
|
.count();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
template <typename S, typename... Args,
|
||||||
|
FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
|
||||||
|
void print(std::FILE* f, const S& format_str, const Args&... args) {
|
||||||
|
memory_buffer buffer;
|
||||||
|
fmt::format_to(std::back_inserter(buffer), format_str, args...);
|
||||||
|
detail::print(f, {buffer.data(), buffer.size()});
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename S, typename... Args,
|
||||||
|
FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
|
||||||
|
void print(const S& format_str, const Args&... args) {
|
||||||
|
print(stdout, format_str, args...);
|
||||||
|
}
|
||||||
|
|
||||||
|
#if FMT_USE_NONTYPE_TEMPLATE_ARGS
|
||||||
|
inline namespace literals {
|
||||||
|
template <detail_exported::fixed_string Str> constexpr auto operator""_cf() {
|
||||||
|
using char_t = remove_cvref_t<decltype(Str.data[0])>;
|
||||||
|
return detail::udl_compiled_string<char_t, sizeof(Str.data) / sizeof(char_t),
|
||||||
|
Str>();
|
||||||
|
}
|
||||||
|
} // namespace literals
|
||||||
|
#endif
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT_END
|
||||||
FMT_END_NAMESPACE
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
#endif // FMT_COMPILE_H_
|
#endif // FMT_COMPILE_H_
|
||||||
|
3702
externals/fmt/include/fmt/core.h
vendored
3702
externals/fmt/include/fmt/core.h
vendored
File diff suppressed because it is too large
Load Diff
2812
externals/fmt/include/fmt/format-inl.h
vendored
2812
externals/fmt/include/fmt/format-inl.h
vendored
File diff suppressed because it is too large
Load Diff
6119
externals/fmt/include/fmt/format.h
vendored
6119
externals/fmt/include/fmt/format.h
vendored
File diff suppressed because it is too large
Load Diff
78
externals/fmt/include/fmt/locale.h
vendored
78
externals/fmt/include/fmt/locale.h
vendored
@ -1,78 +0,0 @@
|
|||||||
// Formatting library for C++ - std::locale support
|
|
||||||
//
|
|
||||||
// Copyright (c) 2012 - present, Victor Zverovich
|
|
||||||
// All rights reserved.
|
|
||||||
//
|
|
||||||
// For the license information refer to format.h.
|
|
||||||
|
|
||||||
#ifndef FMT_LOCALE_H_
|
|
||||||
#define FMT_LOCALE_H_
|
|
||||||
|
|
||||||
#include <locale>
|
|
||||||
|
|
||||||
#include "format.h"
|
|
||||||
|
|
||||||
FMT_BEGIN_NAMESPACE
|
|
||||||
|
|
||||||
namespace internal {
|
|
||||||
template <typename Char>
|
|
||||||
typename buffer_context<Char>::iterator vformat_to(
|
|
||||||
const std::locale& loc, buffer<Char>& buf,
|
|
||||||
basic_string_view<Char> format_str,
|
|
||||||
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
|
||||||
using range = buffer_range<Char>;
|
|
||||||
return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str), args,
|
|
||||||
internal::locale_ref(loc));
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename Char>
|
|
||||||
std::basic_string<Char> vformat(
|
|
||||||
const std::locale& loc, basic_string_view<Char> format_str,
|
|
||||||
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
|
||||||
basic_memory_buffer<Char> buffer;
|
|
||||||
internal::vformat_to(loc, buffer, format_str, args);
|
|
||||||
return fmt::to_string(buffer);
|
|
||||||
}
|
|
||||||
} // namespace internal
|
|
||||||
|
|
||||||
template <typename S, typename Char = char_t<S>>
|
|
||||||
inline std::basic_string<Char> vformat(
|
|
||||||
const std::locale& loc, const S& format_str,
|
|
||||||
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
|
||||||
return internal::vformat(loc, to_string_view(format_str), args);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename S, typename... Args, typename Char = char_t<S>>
|
|
||||||
inline std::basic_string<Char> format(const std::locale& loc,
|
|
||||||
const S& format_str, Args&&... args) {
|
|
||||||
return internal::vformat(
|
|
||||||
loc, to_string_view(format_str),
|
|
||||||
internal::make_args_checked<Args...>(format_str, args...));
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename S, typename OutputIt, typename... Args,
|
|
||||||
typename Char = enable_if_t<
|
|
||||||
internal::is_output_iterator<OutputIt>::value, char_t<S>>>
|
|
||||||
inline OutputIt vformat_to(
|
|
||||||
OutputIt out, const std::locale& loc, const S& format_str,
|
|
||||||
format_args_t<type_identity_t<OutputIt>, Char> args) {
|
|
||||||
using range = internal::output_range<OutputIt, Char>;
|
|
||||||
return vformat_to<arg_formatter<range>>(
|
|
||||||
range(out), to_string_view(format_str), args, internal::locale_ref(loc));
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename OutputIt, typename S, typename... Args,
|
|
||||||
FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value&&
|
|
||||||
internal::is_string<S>::value)>
|
|
||||||
inline OutputIt format_to(OutputIt out, const std::locale& loc,
|
|
||||||
const S& format_str, Args&&... args) {
|
|
||||||
internal::check_format_string<Args...>(format_str);
|
|
||||||
using context = format_context_t<OutputIt, char_t<S>>;
|
|
||||||
format_arg_store<context, Args...> as{args...};
|
|
||||||
return vformat_to(out, loc, to_string_view(format_str),
|
|
||||||
basic_format_args<context>(as));
|
|
||||||
}
|
|
||||||
|
|
||||||
FMT_END_NAMESPACE
|
|
||||||
|
|
||||||
#endif // FMT_LOCALE_H_
|
|
306
externals/fmt/include/fmt/os.h
vendored
306
externals/fmt/include/fmt/os.h
vendored
@ -8,16 +8,10 @@
|
|||||||
#ifndef FMT_OS_H_
|
#ifndef FMT_OS_H_
|
||||||
#define FMT_OS_H_
|
#define FMT_OS_H_
|
||||||
|
|
||||||
#if defined(__MINGW32__) || defined(__CYGWIN__)
|
|
||||||
// Workaround MinGW bug https://sourceforge.net/p/mingw/bugs/2024/.
|
|
||||||
# undef __STRICT_ANSI__
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include <cerrno>
|
#include <cerrno>
|
||||||
#include <clocale> // for locale_t
|
|
||||||
#include <cstddef>
|
#include <cstddef>
|
||||||
#include <cstdio>
|
#include <cstdio>
|
||||||
#include <cstdlib> // for strtod_l
|
#include <system_error> // std::system_error
|
||||||
|
|
||||||
#if defined __APPLE__ || defined(__FreeBSD__)
|
#if defined __APPLE__ || defined(__FreeBSD__)
|
||||||
# include <xlocale.h> // for LC_NUMERIC_MASK on OS X
|
# include <xlocale.h> // for LC_NUMERIC_MASK on OS X
|
||||||
@ -25,16 +19,20 @@
|
|||||||
|
|
||||||
#include "format.h"
|
#include "format.h"
|
||||||
|
|
||||||
|
#ifndef FMT_USE_FCNTL
|
||||||
// UWP doesn't provide _pipe.
|
// UWP doesn't provide _pipe.
|
||||||
#if FMT_HAS_INCLUDE("winapifamily.h")
|
# if FMT_HAS_INCLUDE("winapifamily.h")
|
||||||
# include <winapifamily.h>
|
# include <winapifamily.h>
|
||||||
#endif
|
# endif
|
||||||
#if FMT_HAS_INCLUDE("fcntl.h") && \
|
# if (FMT_HAS_INCLUDE(<fcntl.h>) || defined(__APPLE__) || \
|
||||||
(!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
|
defined(__linux__)) && \
|
||||||
|
(!defined(WINAPI_FAMILY) || \
|
||||||
|
(WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
|
||||||
# include <fcntl.h> // for O_RDONLY
|
# include <fcntl.h> // for O_RDONLY
|
||||||
# define FMT_USE_FCNTL 1
|
# define FMT_USE_FCNTL 1
|
||||||
#else
|
# else
|
||||||
# define FMT_USE_FCNTL 0
|
# define FMT_USE_FCNTL 0
|
||||||
|
# endif
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#ifndef FMT_POSIX
|
#ifndef FMT_POSIX
|
||||||
@ -50,7 +48,7 @@
|
|||||||
#ifdef FMT_SYSTEM
|
#ifdef FMT_SYSTEM
|
||||||
# define FMT_POSIX_CALL(call) FMT_SYSTEM(call)
|
# define FMT_POSIX_CALL(call) FMT_SYSTEM(call)
|
||||||
#else
|
#else
|
||||||
# define FMT_SYSTEM(call) call
|
# define FMT_SYSTEM(call) ::call
|
||||||
# ifdef _WIN32
|
# ifdef _WIN32
|
||||||
// Fix warnings about deprecated symbols.
|
// Fix warnings about deprecated symbols.
|
||||||
# define FMT_POSIX_CALL(call) ::_##call
|
# define FMT_POSIX_CALL(call) ::_##call
|
||||||
@ -73,6 +71,7 @@
|
|||||||
#define FMT_RETRY(result, expression) FMT_RETRY_VAL(result, expression, -1)
|
#define FMT_RETRY(result, expression) FMT_RETRY_VAL(result, expression, -1)
|
||||||
|
|
||||||
FMT_BEGIN_NAMESPACE
|
FMT_BEGIN_NAMESPACE
|
||||||
|
FMT_MODULE_EXPORT_BEGIN
|
||||||
|
|
||||||
/**
|
/**
|
||||||
\rst
|
\rst
|
||||||
@ -121,19 +120,28 @@ template <typename Char> class basic_cstring_view {
|
|||||||
using cstring_view = basic_cstring_view<char>;
|
using cstring_view = basic_cstring_view<char>;
|
||||||
using wcstring_view = basic_cstring_view<wchar_t>;
|
using wcstring_view = basic_cstring_view<wchar_t>;
|
||||||
|
|
||||||
// An error code.
|
template <typename Char> struct formatter<std::error_code, Char> {
|
||||||
class error_code {
|
template <typename ParseContext>
|
||||||
private:
|
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
||||||
int value_;
|
return ctx.begin();
|
||||||
|
}
|
||||||
|
|
||||||
public:
|
template <typename FormatContext>
|
||||||
explicit error_code(int value = 0) FMT_NOEXCEPT : value_(value) {}
|
FMT_CONSTEXPR auto format(const std::error_code& ec, FormatContext& ctx) const
|
||||||
|
-> decltype(ctx.out()) {
|
||||||
int get() const FMT_NOEXCEPT { return value_; }
|
auto out = ctx.out();
|
||||||
|
out = detail::write_bytes(out, ec.category().name(),
|
||||||
|
basic_format_specs<Char>());
|
||||||
|
out = detail::write<Char>(out, Char(':'));
|
||||||
|
out = detail::write<Char>(out, ec.value());
|
||||||
|
return out;
|
||||||
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
#ifdef _WIN32
|
#ifdef _WIN32
|
||||||
namespace internal {
|
FMT_API const std::error_category& system_category() noexcept;
|
||||||
|
|
||||||
|
FMT_BEGIN_DETAIL_NAMESPACE
|
||||||
// A converter from UTF-16 to UTF-8.
|
// A converter from UTF-16 to UTF-8.
|
||||||
// It is only provided for Windows since other systems support UTF-8 natively.
|
// It is only provided for Windows since other systems support UTF-8 natively.
|
||||||
class utf16_to_utf8 {
|
class utf16_to_utf8 {
|
||||||
@ -142,7 +150,7 @@ class utf16_to_utf8 {
|
|||||||
|
|
||||||
public:
|
public:
|
||||||
utf16_to_utf8() {}
|
utf16_to_utf8() {}
|
||||||
FMT_API explicit utf16_to_utf8(wstring_view s);
|
FMT_API explicit utf16_to_utf8(basic_string_view<wchar_t> s);
|
||||||
operator string_view() const { return string_view(&buffer_[0], size()); }
|
operator string_view() const { return string_view(&buffer_[0], size()); }
|
||||||
size_t size() const { return buffer_.size() - 1; }
|
size_t size() const { return buffer_.size() - 1; }
|
||||||
const char* c_str() const { return &buffer_[0]; }
|
const char* c_str() const { return &buffer_[0]; }
|
||||||
@ -151,22 +159,19 @@ class utf16_to_utf8 {
|
|||||||
// Performs conversion returning a system error code instead of
|
// Performs conversion returning a system error code instead of
|
||||||
// throwing exception on conversion error. This method may still throw
|
// throwing exception on conversion error. This method may still throw
|
||||||
// in case of memory allocation error.
|
// in case of memory allocation error.
|
||||||
FMT_API int convert(wstring_view s);
|
FMT_API int convert(basic_string_view<wchar_t> s);
|
||||||
};
|
};
|
||||||
|
|
||||||
FMT_API void format_windows_error(buffer<char>& out, int error_code,
|
FMT_API void format_windows_error(buffer<char>& out, int error_code,
|
||||||
string_view message) FMT_NOEXCEPT;
|
const char* message) noexcept;
|
||||||
} // namespace internal
|
FMT_END_DETAIL_NAMESPACE
|
||||||
|
|
||||||
/** A Windows error. */
|
FMT_API std::system_error vwindows_error(int error_code, string_view format_str,
|
||||||
class windows_error : public system_error {
|
format_args args);
|
||||||
private:
|
|
||||||
FMT_API void init(int error_code, string_view format_str, format_args args);
|
|
||||||
|
|
||||||
public:
|
/**
|
||||||
/**
|
|
||||||
\rst
|
\rst
|
||||||
Constructs a :class:`fmt::windows_error` object with the description
|
Constructs a :class:`std::system_error` object with the description
|
||||||
of the form
|
of the form
|
||||||
|
|
||||||
.. parsed-literal::
|
.. parsed-literal::
|
||||||
@ -180,7 +185,7 @@ class windows_error : public system_error {
|
|||||||
|
|
||||||
**Example**::
|
**Example**::
|
||||||
|
|
||||||
// This throws a windows_error with the description
|
// This throws a system_error with the description
|
||||||
// cannot open file 'madeup': The system cannot find the file specified.
|
// cannot open file 'madeup': The system cannot find the file specified.
|
||||||
// or similar (system message may vary).
|
// or similar (system message may vary).
|
||||||
const char *filename = "madeup";
|
const char *filename = "madeup";
|
||||||
@ -191,19 +196,30 @@ class windows_error : public system_error {
|
|||||||
"cannot open file '{}'", filename);
|
"cannot open file '{}'", filename);
|
||||||
}
|
}
|
||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename... Args>
|
template <typename... Args>
|
||||||
windows_error(int error_code, string_view message, const Args&... args) {
|
std::system_error windows_error(int error_code, string_view message,
|
||||||
init(error_code, message, make_format_args(args...));
|
const Args&... args) {
|
||||||
}
|
return vwindows_error(error_code, message, fmt::make_format_args(args...));
|
||||||
};
|
}
|
||||||
|
|
||||||
// Reports a Windows error without throwing an exception.
|
// Reports a Windows error without throwing an exception.
|
||||||
// Can be used to report errors from destructors.
|
// Can be used to report errors from destructors.
|
||||||
FMT_API void report_windows_error(int error_code,
|
FMT_API void report_windows_error(int error_code, const char* message) noexcept;
|
||||||
string_view message) FMT_NOEXCEPT;
|
#else
|
||||||
|
inline const std::error_category& system_category() noexcept {
|
||||||
|
return std::system_category();
|
||||||
|
}
|
||||||
#endif // _WIN32
|
#endif // _WIN32
|
||||||
|
|
||||||
|
// std::system is not available on some platforms such as iOS (#2248).
|
||||||
|
#ifdef __OSX__
|
||||||
|
template <typename S, typename... Args, typename Char = char_t<S>>
|
||||||
|
void say(const S& format_str, Args&&... args) {
|
||||||
|
std::system(format("say \"{}\"", format(format_str, args...)).c_str());
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
|
||||||
// A buffered file.
|
// A buffered file.
|
||||||
class buffered_file {
|
class buffered_file {
|
||||||
private:
|
private:
|
||||||
@ -218,13 +234,13 @@ class buffered_file {
|
|||||||
void operator=(const buffered_file&) = delete;
|
void operator=(const buffered_file&) = delete;
|
||||||
|
|
||||||
// Constructs a buffered_file object which doesn't represent any file.
|
// Constructs a buffered_file object which doesn't represent any file.
|
||||||
buffered_file() FMT_NOEXCEPT : file_(nullptr) {}
|
buffered_file() noexcept : file_(nullptr) {}
|
||||||
|
|
||||||
// Destroys the object closing the file it represents if any.
|
// Destroys the object closing the file it represents if any.
|
||||||
FMT_API ~buffered_file() FMT_NOEXCEPT;
|
FMT_API ~buffered_file() noexcept;
|
||||||
|
|
||||||
public:
|
public:
|
||||||
buffered_file(buffered_file&& other) FMT_NOEXCEPT : file_(other.file_) {
|
buffered_file(buffered_file&& other) noexcept : file_(other.file_) {
|
||||||
other.file_ = nullptr;
|
other.file_ = nullptr;
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -242,11 +258,9 @@ class buffered_file {
|
|||||||
FMT_API void close();
|
FMT_API void close();
|
||||||
|
|
||||||
// Returns the pointer to a FILE object representing this file.
|
// Returns the pointer to a FILE object representing this file.
|
||||||
FILE* get() const FMT_NOEXCEPT { return file_; }
|
FILE* get() const noexcept { return file_; }
|
||||||
|
|
||||||
// We place parentheses around fileno to workaround a bug in some versions
|
FMT_API int descriptor() const;
|
||||||
// of MinGW that define fileno as a macro.
|
|
||||||
FMT_API int(fileno)() const;
|
|
||||||
|
|
||||||
void vprint(string_view format_str, format_args args) {
|
void vprint(string_view format_str, format_args args) {
|
||||||
fmt::vprint(file_, format_str, args);
|
fmt::vprint(file_, format_str, args);
|
||||||
@ -254,18 +268,18 @@ class buffered_file {
|
|||||||
|
|
||||||
template <typename... Args>
|
template <typename... Args>
|
||||||
inline void print(string_view format_str, const Args&... args) {
|
inline void print(string_view format_str, const Args&... args) {
|
||||||
vprint(format_str, make_format_args(args...));
|
vprint(format_str, fmt::make_format_args(args...));
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
#if FMT_USE_FCNTL
|
#if FMT_USE_FCNTL
|
||||||
// A file. Closed file is represented by a file object with descriptor -1.
|
// A file. Closed file is represented by a file object with descriptor -1.
|
||||||
// Methods that are not declared with FMT_NOEXCEPT may throw
|
// Methods that are not declared with noexcept may throw
|
||||||
// fmt::system_error in case of failure. Note that some errors such as
|
// fmt::system_error in case of failure. Note that some errors such as
|
||||||
// closing the file multiple times will cause a crash on Windows rather
|
// closing the file multiple times will cause a crash on Windows rather
|
||||||
// than an exception. You can get standard behavior by overriding the
|
// than an exception. You can get standard behavior by overriding the
|
||||||
// invalid parameter handler with _set_invalid_parameter_handler.
|
// invalid parameter handler with _set_invalid_parameter_handler.
|
||||||
class file {
|
class FMT_API file {
|
||||||
private:
|
private:
|
||||||
int fd_; // File descriptor.
|
int fd_; // File descriptor.
|
||||||
|
|
||||||
@ -277,22 +291,26 @@ class file {
|
|||||||
enum {
|
enum {
|
||||||
RDONLY = FMT_POSIX(O_RDONLY), // Open for reading only.
|
RDONLY = FMT_POSIX(O_RDONLY), // Open for reading only.
|
||||||
WRONLY = FMT_POSIX(O_WRONLY), // Open for writing only.
|
WRONLY = FMT_POSIX(O_WRONLY), // Open for writing only.
|
||||||
RDWR = FMT_POSIX(O_RDWR) // Open for reading and writing.
|
RDWR = FMT_POSIX(O_RDWR), // Open for reading and writing.
|
||||||
|
CREATE = FMT_POSIX(O_CREAT), // Create if the file doesn't exist.
|
||||||
|
APPEND = FMT_POSIX(O_APPEND), // Open in append mode.
|
||||||
|
TRUNC = FMT_POSIX(O_TRUNC) // Truncate the content of the file.
|
||||||
};
|
};
|
||||||
|
|
||||||
// Constructs a file object which doesn't represent any file.
|
// Constructs a file object which doesn't represent any file.
|
||||||
file() FMT_NOEXCEPT : fd_(-1) {}
|
file() noexcept : fd_(-1) {}
|
||||||
|
|
||||||
// Opens a file and constructs a file object representing this file.
|
// Opens a file and constructs a file object representing this file.
|
||||||
FMT_API file(cstring_view path, int oflag);
|
file(cstring_view path, int oflag);
|
||||||
|
|
||||||
public:
|
public:
|
||||||
file(const file&) = delete;
|
file(const file&) = delete;
|
||||||
void operator=(const file&) = delete;
|
void operator=(const file&) = delete;
|
||||||
|
|
||||||
file(file&& other) FMT_NOEXCEPT : fd_(other.fd_) { other.fd_ = -1; }
|
file(file&& other) noexcept : fd_(other.fd_) { other.fd_ = -1; }
|
||||||
|
|
||||||
file& operator=(file&& other) FMT_NOEXCEPT {
|
// Move assignment is not noexcept because close may throw.
|
||||||
|
file& operator=(file&& other) {
|
||||||
close();
|
close();
|
||||||
fd_ = other.fd_;
|
fd_ = other.fd_;
|
||||||
other.fd_ = -1;
|
other.fd_ = -1;
|
||||||
@ -300,93 +318,161 @@ class file {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Destroys the object closing the file it represents if any.
|
// Destroys the object closing the file it represents if any.
|
||||||
FMT_API ~file() FMT_NOEXCEPT;
|
~file() noexcept;
|
||||||
|
|
||||||
// Returns the file descriptor.
|
// Returns the file descriptor.
|
||||||
int descriptor() const FMT_NOEXCEPT { return fd_; }
|
int descriptor() const noexcept { return fd_; }
|
||||||
|
|
||||||
// Closes the file.
|
// Closes the file.
|
||||||
FMT_API void close();
|
void close();
|
||||||
|
|
||||||
// Returns the file size. The size has signed type for consistency with
|
// Returns the file size. The size has signed type for consistency with
|
||||||
// stat::st_size.
|
// stat::st_size.
|
||||||
FMT_API long long size() const;
|
long long size() const;
|
||||||
|
|
||||||
// Attempts to read count bytes from the file into the specified buffer.
|
// Attempts to read count bytes from the file into the specified buffer.
|
||||||
FMT_API std::size_t read(void* buffer, std::size_t count);
|
size_t read(void* buffer, size_t count);
|
||||||
|
|
||||||
// Attempts to write count bytes from the specified buffer to the file.
|
// Attempts to write count bytes from the specified buffer to the file.
|
||||||
FMT_API std::size_t write(const void* buffer, std::size_t count);
|
size_t write(const void* buffer, size_t count);
|
||||||
|
|
||||||
// Duplicates a file descriptor with the dup function and returns
|
// Duplicates a file descriptor with the dup function and returns
|
||||||
// the duplicate as a file object.
|
// the duplicate as a file object.
|
||||||
FMT_API static file dup(int fd);
|
static file dup(int fd);
|
||||||
|
|
||||||
// Makes fd be the copy of this file descriptor, closing fd first if
|
// Makes fd be the copy of this file descriptor, closing fd first if
|
||||||
// necessary.
|
// necessary.
|
||||||
FMT_API void dup2(int fd);
|
void dup2(int fd);
|
||||||
|
|
||||||
// Makes fd be the copy of this file descriptor, closing fd first if
|
// Makes fd be the copy of this file descriptor, closing fd first if
|
||||||
// necessary.
|
// necessary.
|
||||||
FMT_API void dup2(int fd, error_code& ec) FMT_NOEXCEPT;
|
void dup2(int fd, std::error_code& ec) noexcept;
|
||||||
|
|
||||||
// Creates a pipe setting up read_end and write_end file objects for reading
|
// Creates a pipe setting up read_end and write_end file objects for reading
|
||||||
// and writing respectively.
|
// and writing respectively.
|
||||||
FMT_API static void pipe(file& read_end, file& write_end);
|
static void pipe(file& read_end, file& write_end);
|
||||||
|
|
||||||
// Creates a buffered_file object associated with this file and detaches
|
// Creates a buffered_file object associated with this file and detaches
|
||||||
// this file object from the file.
|
// this file object from the file.
|
||||||
FMT_API buffered_file fdopen(const char* mode);
|
buffered_file fdopen(const char* mode);
|
||||||
};
|
};
|
||||||
|
|
||||||
// Returns the memory page size.
|
// Returns the memory page size.
|
||||||
long getpagesize();
|
long getpagesize();
|
||||||
#endif // FMT_USE_FCNTL
|
|
||||||
|
|
||||||
#ifdef FMT_LOCALE
|
FMT_BEGIN_DETAIL_NAMESPACE
|
||||||
// A "C" numeric locale.
|
|
||||||
class locale {
|
|
||||||
private:
|
|
||||||
# ifdef _WIN32
|
|
||||||
using locale_t = _locale_t;
|
|
||||||
|
|
||||||
static void freelocale(locale_t loc) { _free_locale(loc); }
|
struct buffer_size {
|
||||||
|
buffer_size() = default;
|
||||||
static double strtod_l(const char* nptr, char** endptr, _locale_t loc) {
|
size_t value = 0;
|
||||||
return _strtod_l(nptr, endptr, loc);
|
buffer_size operator=(size_t val) const {
|
||||||
}
|
auto bs = buffer_size();
|
||||||
# endif
|
bs.value = val;
|
||||||
|
return bs;
|
||||||
locale_t locale_;
|
|
||||||
|
|
||||||
public:
|
|
||||||
using type = locale_t;
|
|
||||||
locale(const locale&) = delete;
|
|
||||||
void operator=(const locale&) = delete;
|
|
||||||
|
|
||||||
locale() {
|
|
||||||
# ifndef _WIN32
|
|
||||||
locale_ = FMT_SYSTEM(newlocale(LC_NUMERIC_MASK, "C", nullptr));
|
|
||||||
# else
|
|
||||||
locale_ = _create_locale(LC_NUMERIC, "C");
|
|
||||||
# endif
|
|
||||||
if (!locale_) FMT_THROW(system_error(errno, "cannot create locale"));
|
|
||||||
}
|
|
||||||
~locale() { freelocale(locale_); }
|
|
||||||
|
|
||||||
type get() const { return locale_; }
|
|
||||||
|
|
||||||
// Converts string to floating-point number and advances str past the end
|
|
||||||
// of the parsed input.
|
|
||||||
double strtod(const char*& str) const {
|
|
||||||
char* end = nullptr;
|
|
||||||
double result = strtod_l(str, &end, locale_);
|
|
||||||
str = end;
|
|
||||||
return result;
|
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
using Locale FMT_DEPRECATED_ALIAS = locale;
|
|
||||||
#endif // FMT_LOCALE
|
struct ostream_params {
|
||||||
|
int oflag = file::WRONLY | file::CREATE | file::TRUNC;
|
||||||
|
size_t buffer_size = BUFSIZ > 32768 ? BUFSIZ : 32768;
|
||||||
|
|
||||||
|
ostream_params() {}
|
||||||
|
|
||||||
|
template <typename... T>
|
||||||
|
ostream_params(T... params, int new_oflag) : ostream_params(params...) {
|
||||||
|
oflag = new_oflag;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename... T>
|
||||||
|
ostream_params(T... params, detail::buffer_size bs)
|
||||||
|
: ostream_params(params...) {
|
||||||
|
this->buffer_size = bs.value;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Intel has a bug that results in failure to deduce a constructor
|
||||||
|
// for empty parameter packs.
|
||||||
|
# if defined(__INTEL_COMPILER) && __INTEL_COMPILER < 2000
|
||||||
|
ostream_params(int new_oflag) : oflag(new_oflag) {}
|
||||||
|
ostream_params(detail::buffer_size bs) : buffer_size(bs.value) {}
|
||||||
|
# endif
|
||||||
|
};
|
||||||
|
|
||||||
|
FMT_END_DETAIL_NAMESPACE
|
||||||
|
|
||||||
|
// Added {} below to work around default constructor error known to
|
||||||
|
// occur in Xcode versions 7.2.1 and 8.2.1.
|
||||||
|
constexpr detail::buffer_size buffer_size{};
|
||||||
|
|
||||||
|
/** A fast output stream which is not thread-safe. */
|
||||||
|
class FMT_API ostream final : private detail::buffer<char> {
|
||||||
|
private:
|
||||||
|
file file_;
|
||||||
|
|
||||||
|
void grow(size_t) override;
|
||||||
|
|
||||||
|
ostream(cstring_view path, const detail::ostream_params& params)
|
||||||
|
: file_(path, params.oflag) {
|
||||||
|
set(new char[params.buffer_size], params.buffer_size);
|
||||||
|
}
|
||||||
|
|
||||||
|
public:
|
||||||
|
ostream(ostream&& other)
|
||||||
|
: detail::buffer<char>(other.data(), other.size(), other.capacity()),
|
||||||
|
file_(std::move(other.file_)) {
|
||||||
|
other.clear();
|
||||||
|
other.set(nullptr, 0);
|
||||||
|
}
|
||||||
|
~ostream() {
|
||||||
|
flush();
|
||||||
|
delete[] data();
|
||||||
|
}
|
||||||
|
|
||||||
|
void flush() {
|
||||||
|
if (size() == 0) return;
|
||||||
|
file_.write(data(), size());
|
||||||
|
clear();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename... T>
|
||||||
|
friend ostream output_file(cstring_view path, T... params);
|
||||||
|
|
||||||
|
void close() {
|
||||||
|
flush();
|
||||||
|
file_.close();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
Formats ``args`` according to specifications in ``fmt`` and writes the
|
||||||
|
output to the file.
|
||||||
|
*/
|
||||||
|
template <typename... T> void print(format_string<T...> fmt, T&&... args) {
|
||||||
|
vformat_to(detail::buffer_appender<char>(*this), fmt,
|
||||||
|
fmt::make_format_args(args...));
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
Opens a file for writing. Supported parameters passed in *params*:
|
||||||
|
|
||||||
|
* ``<integer>``: Flags passed to `open
|
||||||
|
<https://pubs.opengroup.org/onlinepubs/007904875/functions/open.html>`_
|
||||||
|
(``file::WRONLY | file::CREATE | file::TRUNC`` by default)
|
||||||
|
* ``buffer_size=<integer>``: Output buffer size
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
auto out = fmt::output_file("guide.txt");
|
||||||
|
out.print("Don't {}", "Panic");
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
template <typename... T>
|
||||||
|
inline ostream output_file(cstring_view path, T... params) {
|
||||||
|
return {path, detail::ostream_params(params...)};
|
||||||
|
}
|
||||||
|
#endif // FMT_USE_FCNTL
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT_END
|
||||||
FMT_END_NAMESPACE
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
#endif // FMT_OS_H_
|
#endif // FMT_OS_H_
|
||||||
|
242
externals/fmt/include/fmt/ostream.h
vendored
242
externals/fmt/include/fmt/ostream.h
vendored
@ -8,74 +8,106 @@
|
|||||||
#ifndef FMT_OSTREAM_H_
|
#ifndef FMT_OSTREAM_H_
|
||||||
#define FMT_OSTREAM_H_
|
#define FMT_OSTREAM_H_
|
||||||
|
|
||||||
|
#include <fstream>
|
||||||
#include <ostream>
|
#include <ostream>
|
||||||
|
#if defined(_WIN32) && defined(__GLIBCXX__)
|
||||||
|
# include <ext/stdio_filebuf.h>
|
||||||
|
# include <ext/stdio_sync_filebuf.h>
|
||||||
|
#elif defined(_WIN32) && defined(_LIBCPP_VERSION)
|
||||||
|
# include <__std_stream>
|
||||||
|
#endif
|
||||||
|
|
||||||
#include "format.h"
|
#include "format.h"
|
||||||
|
|
||||||
FMT_BEGIN_NAMESPACE
|
FMT_BEGIN_NAMESPACE
|
||||||
namespace internal {
|
|
||||||
|
|
||||||
template <class Char> class formatbuf : public std::basic_streambuf<Char> {
|
template <typename OutputIt, typename Char> class basic_printf_context;
|
||||||
private:
|
|
||||||
using int_type = typename std::basic_streambuf<Char>::int_type;
|
|
||||||
using traits_type = typename std::basic_streambuf<Char>::traits_type;
|
|
||||||
|
|
||||||
buffer<Char>& buffer_;
|
namespace detail {
|
||||||
|
|
||||||
public:
|
// Checks if T has a user-defined operator<<.
|
||||||
formatbuf(buffer<Char>& buf) : buffer_(buf) {}
|
template <typename T, typename Char, typename Enable = void>
|
||||||
|
class is_streamable {
|
||||||
protected:
|
|
||||||
// The put-area is actually always empty. This makes the implementation
|
|
||||||
// simpler and has the advantage that the streambuf and the buffer are always
|
|
||||||
// in sync and sputc never writes into uninitialized memory. The obvious
|
|
||||||
// disadvantage is that each call to sputc always results in a (virtual) call
|
|
||||||
// to overflow. There is no disadvantage here for sputn since this always
|
|
||||||
// results in a call to xsputn.
|
|
||||||
|
|
||||||
int_type overflow(int_type ch = traits_type::eof()) FMT_OVERRIDE {
|
|
||||||
if (!traits_type::eq_int_type(ch, traits_type::eof()))
|
|
||||||
buffer_.push_back(static_cast<Char>(ch));
|
|
||||||
return ch;
|
|
||||||
}
|
|
||||||
|
|
||||||
std::streamsize xsputn(const Char* s, std::streamsize count) FMT_OVERRIDE {
|
|
||||||
buffer_.append(s, s + count);
|
|
||||||
return count;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename Char> struct test_stream : std::basic_ostream<Char> {
|
|
||||||
private:
|
|
||||||
// Hide all operator<< from std::basic_ostream<Char>.
|
|
||||||
void_t<> operator<<(null<>);
|
|
||||||
void_t<> operator<<(const Char*);
|
|
||||||
|
|
||||||
template <typename T, FMT_ENABLE_IF(std::is_convertible<T, int>::value &&
|
|
||||||
!std::is_enum<T>::value)>
|
|
||||||
void_t<> operator<<(T);
|
|
||||||
};
|
|
||||||
|
|
||||||
// Checks if T has a user-defined operator<< (e.g. not a member of
|
|
||||||
// std::ostream).
|
|
||||||
template <typename T, typename Char> class is_streamable {
|
|
||||||
private:
|
private:
|
||||||
template <typename U>
|
template <typename U>
|
||||||
static bool_constant<!std::is_same<decltype(std::declval<test_stream<Char>&>()
|
static auto test(int)
|
||||||
<< std::declval<U>()),
|
-> bool_constant<sizeof(std::declval<std::basic_ostream<Char>&>()
|
||||||
void_t<>>::value>
|
<< std::declval<U>()) != 0>;
|
||||||
test(int);
|
|
||||||
|
|
||||||
template <typename> static std::false_type test(...);
|
template <typename> static auto test(...) -> std::false_type;
|
||||||
|
|
||||||
using result = decltype(test<T>(0));
|
using result = decltype(test<T>(0));
|
||||||
|
|
||||||
public:
|
public:
|
||||||
|
is_streamable() = default;
|
||||||
|
|
||||||
static const bool value = result::value;
|
static const bool value = result::value;
|
||||||
};
|
};
|
||||||
|
|
||||||
|
// Formatting of built-in types and arrays is intentionally disabled because
|
||||||
|
// it's handled by standard (non-ostream) formatters.
|
||||||
|
template <typename T, typename Char>
|
||||||
|
struct is_streamable<
|
||||||
|
T, Char,
|
||||||
|
enable_if_t<
|
||||||
|
std::is_arithmetic<T>::value || std::is_array<T>::value ||
|
||||||
|
std::is_pointer<T>::value || std::is_same<T, char8_type>::value ||
|
||||||
|
std::is_convertible<T, fmt::basic_string_view<Char>>::value ||
|
||||||
|
std::is_same<T, std_string_view<Char>>::value ||
|
||||||
|
(std::is_convertible<T, int>::value && !std::is_enum<T>::value)>>
|
||||||
|
: std::false_type {};
|
||||||
|
|
||||||
|
// Generate a unique explicit instantion in every translation unit using a tag
|
||||||
|
// type in an anonymous namespace.
|
||||||
|
namespace {
|
||||||
|
struct file_access_tag {};
|
||||||
|
} // namespace
|
||||||
|
template <class Tag, class BufType, FILE* BufType::*FileMemberPtr>
|
||||||
|
class file_access {
|
||||||
|
friend auto get_file(BufType& obj) -> FILE* { return obj.*FileMemberPtr; }
|
||||||
|
};
|
||||||
|
|
||||||
|
#if FMT_MSC_VERSION
|
||||||
|
template class file_access<file_access_tag, std::filebuf,
|
||||||
|
&std::filebuf::_Myfile>;
|
||||||
|
auto get_file(std::filebuf&) -> FILE*;
|
||||||
|
#elif defined(_WIN32) && defined(_LIBCPP_VERSION)
|
||||||
|
template class file_access<file_access_tag, std::__stdoutbuf<char>,
|
||||||
|
&std::__stdoutbuf<char>::__file_>;
|
||||||
|
auto get_file(std::__stdoutbuf<char>&) -> FILE*;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
inline bool write_ostream_unicode(std::ostream& os, fmt::string_view data) {
|
||||||
|
#if FMT_MSC_VERSION
|
||||||
|
if (auto* buf = dynamic_cast<std::filebuf*>(os.rdbuf()))
|
||||||
|
if (FILE* f = get_file(*buf)) return write_console(f, data);
|
||||||
|
#elif defined(_WIN32) && defined(__GLIBCXX__)
|
||||||
|
auto* rdbuf = os.rdbuf();
|
||||||
|
FILE* c_file;
|
||||||
|
if (auto* fbuf = dynamic_cast<__gnu_cxx::stdio_sync_filebuf<char>*>(rdbuf))
|
||||||
|
c_file = fbuf->file();
|
||||||
|
else if (auto* fbuf = dynamic_cast<__gnu_cxx::stdio_filebuf<char>*>(rdbuf))
|
||||||
|
c_file = fbuf->file();
|
||||||
|
else
|
||||||
|
return false;
|
||||||
|
if (c_file) return write_console(c_file, data);
|
||||||
|
#elif defined(_WIN32) && defined(_LIBCPP_VERSION)
|
||||||
|
if (auto* buf = dynamic_cast<std::__stdoutbuf<char>*>(os.rdbuf()))
|
||||||
|
if (FILE* f = get_file(*buf)) return write_console(f, data);
|
||||||
|
#else
|
||||||
|
ignore_unused(os, data);
|
||||||
|
#endif
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
inline bool write_ostream_unicode(std::wostream&,
|
||||||
|
fmt::basic_string_view<wchar_t>) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
// Write the content of buf to os.
|
// Write the content of buf to os.
|
||||||
|
// It is a separate function rather than a part of vprint to simplify testing.
|
||||||
template <typename Char>
|
template <typename Char>
|
||||||
void write(std::basic_ostream<Char>& os, buffer<Char>& buf) {
|
void write_buffer(std::basic_ostream<Char>& os, buffer<Char>& buf) {
|
||||||
const Char* buf_data = buf.data();
|
const Char* buf_data = buf.data();
|
||||||
using unsigned_streamsize = std::make_unsigned<std::streamsize>::type;
|
using unsigned_streamsize = std::make_unsigned<std::streamsize>::type;
|
||||||
unsigned_streamsize size = buf.size();
|
unsigned_streamsize size = buf.size();
|
||||||
@ -91,36 +123,87 @@ void write(std::basic_ostream<Char>& os, buffer<Char>& buf) {
|
|||||||
template <typename Char, typename T>
|
template <typename Char, typename T>
|
||||||
void format_value(buffer<Char>& buf, const T& value,
|
void format_value(buffer<Char>& buf, const T& value,
|
||||||
locale_ref loc = locale_ref()) {
|
locale_ref loc = locale_ref()) {
|
||||||
formatbuf<Char> format_buf(buf);
|
auto&& format_buf = formatbuf<std::basic_streambuf<Char>>(buf);
|
||||||
std::basic_ostream<Char> output(&format_buf);
|
auto&& output = std::basic_ostream<Char>(&format_buf);
|
||||||
#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
|
#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
|
||||||
if (loc) output.imbue(loc.get<std::locale>());
|
if (loc) output.imbue(loc.get<std::locale>());
|
||||||
#endif
|
#endif
|
||||||
output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
|
|
||||||
output << value;
|
output << value;
|
||||||
buf.resize(buf.size());
|
output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
template <typename T> struct streamed_view { const T& value; };
|
||||||
|
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
// Formats an object of type T that has an overloaded ostream operator<<.
|
||||||
|
template <typename Char>
|
||||||
|
struct basic_ostream_formatter : formatter<basic_string_view<Char>, Char> {
|
||||||
|
void set_debug_format() = delete;
|
||||||
|
|
||||||
|
template <typename T, typename OutputIt>
|
||||||
|
auto format(const T& value, basic_format_context<OutputIt, Char>& ctx) const
|
||||||
|
-> OutputIt {
|
||||||
|
auto buffer = basic_memory_buffer<Char>();
|
||||||
|
format_value(buffer, value, ctx.locale());
|
||||||
|
return formatter<basic_string_view<Char>, Char>::format(
|
||||||
|
{buffer.data(), buffer.size()}, ctx);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
using ostream_formatter = basic_ostream_formatter<char>;
|
||||||
|
|
||||||
|
template <typename T, typename Char>
|
||||||
|
struct formatter<detail::streamed_view<T>, Char>
|
||||||
|
: basic_ostream_formatter<Char> {
|
||||||
|
template <typename OutputIt>
|
||||||
|
auto format(detail::streamed_view<T> view,
|
||||||
|
basic_format_context<OutputIt, Char>& ctx) const -> OutputIt {
|
||||||
|
return basic_ostream_formatter<Char>::format(view.value, ctx);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
Returns a view that formats `value` via an ostream ``operator<<``.
|
||||||
|
|
||||||
|
**Example**::
|
||||||
|
|
||||||
|
fmt::print("Current thread id: {}\n",
|
||||||
|
fmt::streamed(std::this_thread::get_id()));
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
template <typename T>
|
||||||
|
auto streamed(const T& value) -> detail::streamed_view<T> {
|
||||||
|
return {value};
|
||||||
|
}
|
||||||
|
|
||||||
|
namespace detail {
|
||||||
|
|
||||||
// Formats an object of type T that has an overloaded ostream operator<<.
|
// Formats an object of type T that has an overloaded ostream operator<<.
|
||||||
template <typename T, typename Char>
|
template <typename T, typename Char>
|
||||||
struct fallback_formatter<T, Char, enable_if_t<is_streamable<T, Char>::value>>
|
struct fallback_formatter<T, Char, enable_if_t<is_streamable<T, Char>::value>>
|
||||||
: formatter<basic_string_view<Char>, Char> {
|
: basic_ostream_formatter<Char> {
|
||||||
template <typename Context>
|
using basic_ostream_formatter<Char>::format;
|
||||||
auto format(const T& value, Context& ctx) -> decltype(ctx.out()) {
|
|
||||||
basic_memory_buffer<Char> buffer;
|
|
||||||
format_value(buffer, value, ctx.locale());
|
|
||||||
basic_string_view<Char> str(buffer.data(), buffer.size());
|
|
||||||
return formatter<basic_string_view<Char>, Char>::format(str, ctx);
|
|
||||||
}
|
|
||||||
};
|
};
|
||||||
} // namespace internal
|
|
||||||
|
|
||||||
template <typename Char>
|
inline void vprint_directly(std::ostream& os, string_view format_str,
|
||||||
void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str,
|
format_args args) {
|
||||||
|
auto buffer = memory_buffer();
|
||||||
|
detail::vformat_to(buffer, format_str, args);
|
||||||
|
detail::write_buffer(os, buffer);
|
||||||
|
}
|
||||||
|
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT template <typename Char>
|
||||||
|
void vprint(std::basic_ostream<Char>& os,
|
||||||
|
basic_string_view<type_identity_t<Char>> format_str,
|
||||||
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
basic_format_args<buffer_context<type_identity_t<Char>>> args) {
|
||||||
basic_memory_buffer<Char> buffer;
|
auto buffer = basic_memory_buffer<Char>();
|
||||||
internal::vformat_to(buffer, format_str, args);
|
detail::vformat_to(buffer, format_str, args);
|
||||||
internal::write(os, buffer);
|
if (detail::write_ostream_unicode(os, {buffer.data(), buffer.size()})) return;
|
||||||
|
detail::write_buffer(os, buffer);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@ -132,12 +215,23 @@ void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str,
|
|||||||
fmt::print(cerr, "Don't {}!", "panic");
|
fmt::print(cerr, "Don't {}!", "panic");
|
||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename S, typename... Args,
|
FMT_MODULE_EXPORT template <typename... T>
|
||||||
typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
|
void print(std::ostream& os, format_string<T...> fmt, T&&... args) {
|
||||||
void print(std::basic_ostream<Char>& os, const S& format_str, Args&&... args) {
|
const auto& vargs = fmt::make_format_args(args...);
|
||||||
vprint(os, to_string_view(format_str),
|
if (detail::is_utf8())
|
||||||
internal::make_args_checked<Args...>(format_str, args...));
|
vprint(os, fmt, vargs);
|
||||||
|
else
|
||||||
|
detail::vprint_directly(os, fmt, vargs);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT
|
||||||
|
template <typename... Args>
|
||||||
|
void print(std::wostream& os,
|
||||||
|
basic_format_string<wchar_t, type_identity_t<Args>...> fmt,
|
||||||
|
Args&&... args) {
|
||||||
|
vprint(os, fmt, fmt::make_format_args<buffer_context<wchar_t>>(args...));
|
||||||
|
}
|
||||||
|
|
||||||
FMT_END_NAMESPACE
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
#endif // FMT_OSTREAM_H_
|
#endif // FMT_OSTREAM_H_
|
||||||
|
2
externals/fmt/include/fmt/posix.h
vendored
2
externals/fmt/include/fmt/posix.h
vendored
@ -1,2 +0,0 @@
|
|||||||
#include "os.h"
|
|
||||||
#warning "fmt/posix.h is deprecated; use fmt/os.h instead"
|
|
521
externals/fmt/include/fmt/printf.h
vendored
521
externals/fmt/include/fmt/printf.h
vendored
@ -11,10 +11,52 @@
|
|||||||
#include <algorithm> // std::max
|
#include <algorithm> // std::max
|
||||||
#include <limits> // std::numeric_limits
|
#include <limits> // std::numeric_limits
|
||||||
|
|
||||||
#include "ostream.h"
|
#include "format.h"
|
||||||
|
|
||||||
FMT_BEGIN_NAMESPACE
|
FMT_BEGIN_NAMESPACE
|
||||||
namespace internal {
|
FMT_MODULE_EXPORT_BEGIN
|
||||||
|
|
||||||
|
template <typename T> struct printf_formatter { printf_formatter() = delete; };
|
||||||
|
|
||||||
|
template <typename Char>
|
||||||
|
class basic_printf_parse_context : public basic_format_parse_context<Char> {
|
||||||
|
using basic_format_parse_context<Char>::basic_format_parse_context;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename OutputIt, typename Char> class basic_printf_context {
|
||||||
|
private:
|
||||||
|
OutputIt out_;
|
||||||
|
basic_format_args<basic_printf_context> args_;
|
||||||
|
|
||||||
|
public:
|
||||||
|
using char_type = Char;
|
||||||
|
using format_arg = basic_format_arg<basic_printf_context>;
|
||||||
|
using parse_context_type = basic_printf_parse_context<Char>;
|
||||||
|
template <typename T> using formatter_type = printf_formatter<T>;
|
||||||
|
|
||||||
|
/**
|
||||||
|
\rst
|
||||||
|
Constructs a ``printf_context`` object. References to the arguments are
|
||||||
|
stored in the context object so make sure they have appropriate lifetimes.
|
||||||
|
\endrst
|
||||||
|
*/
|
||||||
|
basic_printf_context(OutputIt out,
|
||||||
|
basic_format_args<basic_printf_context> args)
|
||||||
|
: out_(out), args_(args) {}
|
||||||
|
|
||||||
|
OutputIt out() { return out_; }
|
||||||
|
void advance_to(OutputIt it) { out_ = it; }
|
||||||
|
|
||||||
|
detail::locale_ref locale() { return {}; }
|
||||||
|
|
||||||
|
format_arg arg(int id) const { return args_.get(id); }
|
||||||
|
|
||||||
|
FMT_CONSTEXPR void on_error(const char* message) {
|
||||||
|
detail::error_handler().on_error(message);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
FMT_BEGIN_DETAIL_NAMESPACE
|
||||||
|
|
||||||
// Checks if a value fits in int - used to avoid warnings about comparing
|
// Checks if a value fits in int - used to avoid warnings about comparing
|
||||||
// signed and unsigned integers.
|
// signed and unsigned integers.
|
||||||
@ -90,11 +132,11 @@ template <typename T, typename Context> class arg_converter {
|
|||||||
if (const_check(sizeof(target_type) <= sizeof(int))) {
|
if (const_check(sizeof(target_type) <= sizeof(int))) {
|
||||||
// Extra casts are used to silence warnings.
|
// Extra casts are used to silence warnings.
|
||||||
if (is_signed) {
|
if (is_signed) {
|
||||||
arg_ = internal::make_arg<Context>(
|
arg_ = detail::make_arg<Context>(
|
||||||
static_cast<int>(static_cast<target_type>(value)));
|
static_cast<int>(static_cast<target_type>(value)));
|
||||||
} else {
|
} else {
|
||||||
using unsigned_type = typename make_unsigned_or_bool<target_type>::type;
|
using unsigned_type = typename make_unsigned_or_bool<target_type>::type;
|
||||||
arg_ = internal::make_arg<Context>(
|
arg_ = detail::make_arg<Context>(
|
||||||
static_cast<unsigned>(static_cast<unsigned_type>(value)));
|
static_cast<unsigned>(static_cast<unsigned_type>(value)));
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
@ -102,9 +144,9 @@ template <typename T, typename Context> class arg_converter {
|
|||||||
// glibc's printf doesn't sign extend arguments of smaller types:
|
// glibc's printf doesn't sign extend arguments of smaller types:
|
||||||
// std::printf("%lld", -42); // prints "4294967254"
|
// std::printf("%lld", -42); // prints "4294967254"
|
||||||
// but we don't have to do the same because it's a UB.
|
// but we don't have to do the same because it's a UB.
|
||||||
arg_ = internal::make_arg<Context>(static_cast<long long>(value));
|
arg_ = detail::make_arg<Context>(static_cast<long long>(value));
|
||||||
} else {
|
} else {
|
||||||
arg_ = internal::make_arg<Context>(
|
arg_ = detail::make_arg<Context>(
|
||||||
static_cast<typename make_unsigned_or_bool<U>::type>(value));
|
static_cast<typename make_unsigned_or_bool<U>::type>(value));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -133,7 +175,7 @@ template <typename Context> class char_converter {
|
|||||||
|
|
||||||
template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
|
template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
|
||||||
void operator()(T value) {
|
void operator()(T value) {
|
||||||
arg_ = internal::make_arg<Context>(
|
arg_ = detail::make_arg<Context>(
|
||||||
static_cast<typename Context::char_type>(value));
|
static_cast<typename Context::char_type>(value));
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -141,6 +183,13 @@ template <typename Context> class char_converter {
|
|||||||
void operator()(T) {} // No conversion needed for non-integral types.
|
void operator()(T) {} // No conversion needed for non-integral types.
|
||||||
};
|
};
|
||||||
|
|
||||||
|
// An argument visitor that return a pointer to a C string if argument is a
|
||||||
|
// string or null otherwise.
|
||||||
|
template <typename Char> struct get_cstring {
|
||||||
|
template <typename T> const Char* operator()(T) { return nullptr; }
|
||||||
|
const Char* operator()(const Char* s) { return s; }
|
||||||
|
};
|
||||||
|
|
||||||
// Checks if an argument is a valid printf width specifier and sets
|
// Checks if an argument is a valid printf width specifier and sets
|
||||||
// left alignment if it is negative.
|
// left alignment if it is negative.
|
||||||
template <typename Char> class printf_width_handler {
|
template <typename Char> class printf_width_handler {
|
||||||
@ -155,7 +204,7 @@ template <typename Char> class printf_width_handler {
|
|||||||
template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
|
template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
|
||||||
unsigned operator()(T value) {
|
unsigned operator()(T value) {
|
||||||
auto width = static_cast<uint32_or_64_or_128_t<T>>(value);
|
auto width = static_cast<uint32_or_64_or_128_t<T>>(value);
|
||||||
if (internal::is_negative(value)) {
|
if (detail::is_negative(value)) {
|
||||||
specs_.align = align::left;
|
specs_.align = align::left;
|
||||||
width = 0 - width;
|
width = 0 - width;
|
||||||
}
|
}
|
||||||
@ -171,211 +220,87 @@ template <typename Char> class printf_width_handler {
|
|||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
template <typename Char, typename Context>
|
// The ``printf`` argument formatter.
|
||||||
void printf(buffer<Char>& buf, basic_string_view<Char> format,
|
template <typename OutputIt, typename Char>
|
||||||
basic_format_args<Context> args) {
|
class printf_arg_formatter : public arg_formatter<Char> {
|
||||||
Context(std::back_inserter(buf), format, args).format();
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename OutputIt, typename Char, typename Context>
|
|
||||||
internal::truncating_iterator<OutputIt> printf(
|
|
||||||
internal::truncating_iterator<OutputIt> it, basic_string_view<Char> format,
|
|
||||||
basic_format_args<Context> args) {
|
|
||||||
return Context(it, format, args).format();
|
|
||||||
}
|
|
||||||
} // namespace internal
|
|
||||||
|
|
||||||
using internal::printf; // For printing into memory_buffer.
|
|
||||||
|
|
||||||
template <typename Range> class printf_arg_formatter;
|
|
||||||
|
|
||||||
template <typename OutputIt, typename Char> class basic_printf_context;
|
|
||||||
|
|
||||||
/**
|
|
||||||
\rst
|
|
||||||
The ``printf`` argument formatter.
|
|
||||||
\endrst
|
|
||||||
*/
|
|
||||||
template <typename Range>
|
|
||||||
class printf_arg_formatter : public internal::arg_formatter_base<Range> {
|
|
||||||
public:
|
|
||||||
using iterator = typename Range::iterator;
|
|
||||||
|
|
||||||
private:
|
private:
|
||||||
using char_type = typename Range::value_type;
|
using base = arg_formatter<Char>;
|
||||||
using base = internal::arg_formatter_base<Range>;
|
using context_type = basic_printf_context<OutputIt, Char>;
|
||||||
using context_type = basic_printf_context<iterator, char_type>;
|
using format_specs = basic_format_specs<Char>;
|
||||||
|
|
||||||
context_type& context_;
|
context_type& context_;
|
||||||
|
|
||||||
void write_null_pointer(char) {
|
OutputIt write_null_pointer(bool is_string = false) {
|
||||||
this->specs()->type = 0;
|
auto s = this->specs;
|
||||||
this->write("(nil)");
|
s.type = presentation_type::none;
|
||||||
}
|
return write_bytes(this->out, is_string ? "(null)" : "(nil)", s);
|
||||||
|
|
||||||
void write_null_pointer(wchar_t) {
|
|
||||||
this->specs()->type = 0;
|
|
||||||
this->write(L"(nil)");
|
|
||||||
}
|
}
|
||||||
|
|
||||||
public:
|
public:
|
||||||
using format_specs = typename base::format_specs;
|
printf_arg_formatter(OutputIt iter, format_specs& s, context_type& ctx)
|
||||||
|
: base{iter, s, locale_ref()}, context_(ctx) {}
|
||||||
|
|
||||||
/**
|
OutputIt operator()(monostate value) { return base::operator()(value); }
|
||||||
\rst
|
|
||||||
Constructs an argument formatter object.
|
|
||||||
*buffer* is a reference to the output buffer and *specs* contains format
|
|
||||||
specifier information for standard argument types.
|
|
||||||
\endrst
|
|
||||||
*/
|
|
||||||
printf_arg_formatter(iterator iter, format_specs& specs, context_type& ctx)
|
|
||||||
: base(Range(iter), &specs, internal::locale_ref()), context_(ctx) {}
|
|
||||||
|
|
||||||
template <typename T, FMT_ENABLE_IF(fmt::internal::is_integral<T>::value)>
|
template <typename T, FMT_ENABLE_IF(detail::is_integral<T>::value)>
|
||||||
iterator operator()(T value) {
|
OutputIt operator()(T value) {
|
||||||
// MSVC2013 fails to compile separate overloads for bool and char_type so
|
// MSVC2013 fails to compile separate overloads for bool and Char so use
|
||||||
// use std::is_same instead.
|
// std::is_same instead.
|
||||||
if (std::is_same<T, bool>::value) {
|
if (std::is_same<T, Char>::value) {
|
||||||
format_specs& fmt_specs = *this->specs();
|
format_specs fmt_specs = this->specs;
|
||||||
if (fmt_specs.type != 's') return base::operator()(value ? 1 : 0);
|
if (fmt_specs.type != presentation_type::none &&
|
||||||
fmt_specs.type = 0;
|
fmt_specs.type != presentation_type::chr) {
|
||||||
this->write(value != 0);
|
|
||||||
} else if (std::is_same<T, char_type>::value) {
|
|
||||||
format_specs& fmt_specs = *this->specs();
|
|
||||||
if (fmt_specs.type && fmt_specs.type != 'c')
|
|
||||||
return (*this)(static_cast<int>(value));
|
return (*this)(static_cast<int>(value));
|
||||||
|
}
|
||||||
fmt_specs.sign = sign::none;
|
fmt_specs.sign = sign::none;
|
||||||
fmt_specs.alt = false;
|
fmt_specs.alt = false;
|
||||||
|
fmt_specs.fill[0] = ' '; // Ignore '0' flag for char types.
|
||||||
|
// align::numeric needs to be overwritten here since the '0' flag is
|
||||||
|
// ignored for non-numeric types
|
||||||
|
if (fmt_specs.align == align::none || fmt_specs.align == align::numeric)
|
||||||
fmt_specs.align = align::right;
|
fmt_specs.align = align::right;
|
||||||
return base::operator()(value);
|
return write<Char>(this->out, static_cast<Char>(value), fmt_specs);
|
||||||
} else {
|
|
||||||
return base::operator()(value);
|
|
||||||
}
|
}
|
||||||
return this->out();
|
return base::operator()(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
|
template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
|
||||||
iterator operator()(T value) {
|
OutputIt operator()(T value) {
|
||||||
return base::operator()(value);
|
return base::operator()(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/** Formats a null-terminated C string. */
|
/** Formats a null-terminated C string. */
|
||||||
iterator operator()(const char* value) {
|
OutputIt operator()(const char* value) {
|
||||||
if (value)
|
if (value) return base::operator()(value);
|
||||||
base::operator()(value);
|
return write_null_pointer(this->specs.type != presentation_type::pointer);
|
||||||
else if (this->specs()->type == 'p')
|
|
||||||
write_null_pointer(char_type());
|
|
||||||
else
|
|
||||||
this->write("(null)");
|
|
||||||
return this->out();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/** Formats a null-terminated wide C string. */
|
/** Formats a null-terminated wide C string. */
|
||||||
iterator operator()(const wchar_t* value) {
|
OutputIt operator()(const wchar_t* value) {
|
||||||
if (value)
|
if (value) return base::operator()(value);
|
||||||
base::operator()(value);
|
return write_null_pointer(this->specs.type != presentation_type::pointer);
|
||||||
else if (this->specs()->type == 'p')
|
|
||||||
write_null_pointer(char_type());
|
|
||||||
else
|
|
||||||
this->write(L"(null)");
|
|
||||||
return this->out();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
iterator operator()(basic_string_view<char_type> value) {
|
OutputIt operator()(basic_string_view<Char> value) {
|
||||||
return base::operator()(value);
|
return base::operator()(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
iterator operator()(monostate value) { return base::operator()(value); }
|
|
||||||
|
|
||||||
/** Formats a pointer. */
|
/** Formats a pointer. */
|
||||||
iterator operator()(const void* value) {
|
OutputIt operator()(const void* value) {
|
||||||
if (value) return base::operator()(value);
|
return value ? base::operator()(value) : write_null_pointer();
|
||||||
this->specs()->type = 0;
|
|
||||||
write_null_pointer(char_type());
|
|
||||||
return this->out();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/** Formats an argument of a custom (user-defined) type. */
|
/** Formats an argument of a custom (user-defined) type. */
|
||||||
iterator operator()(typename basic_format_arg<context_type>::handle handle) {
|
OutputIt operator()(typename basic_format_arg<context_type>::handle handle) {
|
||||||
handle.format(context_.parse_context(), context_);
|
auto parse_ctx =
|
||||||
return this->out();
|
basic_printf_parse_context<Char>(basic_string_view<Char>());
|
||||||
|
handle.format(parse_ctx, context_);
|
||||||
|
return this->out;
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
template <typename T> struct printf_formatter {
|
template <typename Char>
|
||||||
printf_formatter() = delete;
|
void parse_flags(basic_format_specs<Char>& specs, const Char*& it,
|
||||||
|
|
||||||
template <typename ParseContext>
|
|
||||||
auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
|
||||||
return ctx.begin();
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename FormatContext>
|
|
||||||
auto format(const T& value, FormatContext& ctx) -> decltype(ctx.out()) {
|
|
||||||
internal::format_value(internal::get_container(ctx.out()), value);
|
|
||||||
return ctx.out();
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
/** This template formats data and writes the output to a writer. */
|
|
||||||
template <typename OutputIt, typename Char> class basic_printf_context {
|
|
||||||
public:
|
|
||||||
/** The character type for the output. */
|
|
||||||
using char_type = Char;
|
|
||||||
using iterator = OutputIt;
|
|
||||||
using format_arg = basic_format_arg<basic_printf_context>;
|
|
||||||
template <typename T> using formatter_type = printf_formatter<T>;
|
|
||||||
|
|
||||||
private:
|
|
||||||
using format_specs = basic_format_specs<char_type>;
|
|
||||||
|
|
||||||
OutputIt out_;
|
|
||||||
basic_format_args<basic_printf_context> args_;
|
|
||||||
basic_format_parse_context<Char> parse_ctx_;
|
|
||||||
|
|
||||||
static void parse_flags(format_specs& specs, const Char*& it,
|
|
||||||
const Char* end);
|
|
||||||
|
|
||||||
// Returns the argument with specified index or, if arg_index is -1, the next
|
|
||||||
// argument.
|
|
||||||
format_arg get_arg(int arg_index = -1);
|
|
||||||
|
|
||||||
// Parses argument index, flags and width and returns the argument index.
|
|
||||||
int parse_header(const Char*& it, const Char* end, format_specs& specs);
|
|
||||||
|
|
||||||
public:
|
|
||||||
/**
|
|
||||||
\rst
|
|
||||||
Constructs a ``printf_context`` object. References to the arguments and
|
|
||||||
the writer are stored in the context object so make sure they have
|
|
||||||
appropriate lifetimes.
|
|
||||||
\endrst
|
|
||||||
*/
|
|
||||||
basic_printf_context(OutputIt out, basic_string_view<char_type> format_str,
|
|
||||||
basic_format_args<basic_printf_context> args)
|
|
||||||
: out_(out), args_(args), parse_ctx_(format_str) {}
|
|
||||||
|
|
||||||
OutputIt out() { return out_; }
|
|
||||||
void advance_to(OutputIt it) { out_ = it; }
|
|
||||||
|
|
||||||
internal::locale_ref locale() { return {}; }
|
|
||||||
|
|
||||||
format_arg arg(int id) const { return args_.get(id); }
|
|
||||||
|
|
||||||
basic_format_parse_context<Char>& parse_context() { return parse_ctx_; }
|
|
||||||
|
|
||||||
FMT_CONSTEXPR void on_error(const char* message) {
|
|
||||||
parse_ctx_.on_error(message);
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Formats stored arguments and writes the output to the range. */
|
|
||||||
template <typename ArgFormatter = printf_arg_formatter<buffer_range<Char>>>
|
|
||||||
OutputIt format();
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename OutputIt, typename Char>
|
|
||||||
void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
|
|
||||||
const Char*& it,
|
|
||||||
const Char* end) {
|
const Char* end) {
|
||||||
for (; it != end; ++it) {
|
for (; it != end; ++it) {
|
||||||
switch (*it) {
|
switch (*it) {
|
||||||
@ -389,7 +314,9 @@ void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
|
|||||||
specs.fill[0] = '0';
|
specs.fill[0] = '0';
|
||||||
break;
|
break;
|
||||||
case ' ':
|
case ' ':
|
||||||
|
if (specs.sign != sign::plus) {
|
||||||
specs.sign = sign::space;
|
specs.sign = sign::space;
|
||||||
|
}
|
||||||
break;
|
break;
|
||||||
case '#':
|
case '#':
|
||||||
specs.alt = true;
|
specs.alt = true;
|
||||||
@ -400,35 +327,24 @@ void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename OutputIt, typename Char>
|
template <typename Char, typename GetArg>
|
||||||
typename basic_printf_context<OutputIt, Char>::format_arg
|
int parse_header(const Char*& it, const Char* end,
|
||||||
basic_printf_context<OutputIt, Char>::get_arg(int arg_index) {
|
basic_format_specs<Char>& specs, GetArg get_arg) {
|
||||||
if (arg_index < 0)
|
|
||||||
arg_index = parse_ctx_.next_arg_id();
|
|
||||||
else
|
|
||||||
parse_ctx_.check_arg_id(--arg_index);
|
|
||||||
return internal::get_arg(*this, arg_index);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename OutputIt, typename Char>
|
|
||||||
int basic_printf_context<OutputIt, Char>::parse_header(const Char*& it,
|
|
||||||
const Char* end,
|
|
||||||
format_specs& specs) {
|
|
||||||
int arg_index = -1;
|
int arg_index = -1;
|
||||||
char_type c = *it;
|
Char c = *it;
|
||||||
if (c >= '0' && c <= '9') {
|
if (c >= '0' && c <= '9') {
|
||||||
// Parse an argument index (if followed by '$') or a width possibly
|
// Parse an argument index (if followed by '$') or a width possibly
|
||||||
// preceded with '0' flag(s).
|
// preceded with '0' flag(s).
|
||||||
internal::error_handler eh;
|
int value = parse_nonnegative_int(it, end, -1);
|
||||||
int value = parse_nonnegative_int(it, end, eh);
|
|
||||||
if (it != end && *it == '$') { // value is an argument index
|
if (it != end && *it == '$') { // value is an argument index
|
||||||
++it;
|
++it;
|
||||||
arg_index = value;
|
arg_index = value != -1 ? value : max_value<int>();
|
||||||
} else {
|
} else {
|
||||||
if (c == '0') specs.fill[0] = '0';
|
if (c == '0') specs.fill[0] = '0';
|
||||||
if (value != 0) {
|
if (value != 0) {
|
||||||
// Nonzero value means that we parsed width and don't need to
|
// Nonzero value means that we parsed width and don't need to
|
||||||
// parse it or flags again, so return now.
|
// parse it or flags again, so return now.
|
||||||
|
if (value == -1) FMT_THROW(format_error("number is too big"));
|
||||||
specs.width = value;
|
specs.width = value;
|
||||||
return arg_index;
|
return arg_index;
|
||||||
}
|
}
|
||||||
@ -438,71 +354,104 @@ int basic_printf_context<OutputIt, Char>::parse_header(const Char*& it,
|
|||||||
// Parse width.
|
// Parse width.
|
||||||
if (it != end) {
|
if (it != end) {
|
||||||
if (*it >= '0' && *it <= '9') {
|
if (*it >= '0' && *it <= '9') {
|
||||||
internal::error_handler eh;
|
specs.width = parse_nonnegative_int(it, end, -1);
|
||||||
specs.width = parse_nonnegative_int(it, end, eh);
|
if (specs.width == -1) FMT_THROW(format_error("number is too big"));
|
||||||
} else if (*it == '*') {
|
} else if (*it == '*') {
|
||||||
++it;
|
++it;
|
||||||
specs.width = static_cast<int>(visit_format_arg(
|
specs.width = static_cast<int>(visit_format_arg(
|
||||||
internal::printf_width_handler<char_type>(specs), get_arg()));
|
detail::printf_width_handler<Char>(specs), get_arg(-1)));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return arg_index;
|
return arg_index;
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename OutputIt, typename Char>
|
template <typename Char, typename Context>
|
||||||
template <typename ArgFormatter>
|
void vprintf(buffer<Char>& buf, basic_string_view<Char> format,
|
||||||
OutputIt basic_printf_context<OutputIt, Char>::format() {
|
basic_format_args<Context> args) {
|
||||||
auto out = this->out();
|
using OutputIt = buffer_appender<Char>;
|
||||||
const Char* start = parse_ctx_.begin();
|
auto out = OutputIt(buf);
|
||||||
const Char* end = parse_ctx_.end();
|
auto context = basic_printf_context<OutputIt, Char>(out, args);
|
||||||
|
auto parse_ctx = basic_printf_parse_context<Char>(format);
|
||||||
|
|
||||||
|
// Returns the argument with specified index or, if arg_index is -1, the next
|
||||||
|
// argument.
|
||||||
|
auto get_arg = [&](int arg_index) {
|
||||||
|
if (arg_index < 0)
|
||||||
|
arg_index = parse_ctx.next_arg_id();
|
||||||
|
else
|
||||||
|
parse_ctx.check_arg_id(--arg_index);
|
||||||
|
return detail::get_arg(context, arg_index);
|
||||||
|
};
|
||||||
|
|
||||||
|
const Char* start = parse_ctx.begin();
|
||||||
|
const Char* end = parse_ctx.end();
|
||||||
auto it = start;
|
auto it = start;
|
||||||
while (it != end) {
|
while (it != end) {
|
||||||
char_type c = *it++;
|
if (!detail::find<false, Char>(it, end, '%', it)) {
|
||||||
if (c != '%') continue;
|
it = end; // detail::find leaves it == nullptr if it doesn't find '%'
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
Char c = *it++;
|
||||||
if (it != end && *it == c) {
|
if (it != end && *it == c) {
|
||||||
out = std::copy(start, it, out);
|
out = detail::write(
|
||||||
|
out, basic_string_view<Char>(start, detail::to_unsigned(it - start)));
|
||||||
start = ++it;
|
start = ++it;
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
out = std::copy(start, it - 1, out);
|
out = detail::write(out, basic_string_view<Char>(
|
||||||
|
start, detail::to_unsigned(it - 1 - start)));
|
||||||
|
|
||||||
format_specs specs;
|
basic_format_specs<Char> specs;
|
||||||
specs.align = align::right;
|
specs.align = align::right;
|
||||||
|
|
||||||
// Parse argument index, flags and width.
|
// Parse argument index, flags and width.
|
||||||
int arg_index = parse_header(it, end, specs);
|
int arg_index = parse_header(it, end, specs, get_arg);
|
||||||
if (arg_index == 0) on_error("argument index out of range");
|
if (arg_index == 0) parse_ctx.on_error("argument not found");
|
||||||
|
|
||||||
// Parse precision.
|
// Parse precision.
|
||||||
if (it != end && *it == '.') {
|
if (it != end && *it == '.') {
|
||||||
++it;
|
++it;
|
||||||
c = it != end ? *it : 0;
|
c = it != end ? *it : 0;
|
||||||
if ('0' <= c && c <= '9') {
|
if ('0' <= c && c <= '9') {
|
||||||
internal::error_handler eh;
|
specs.precision = parse_nonnegative_int(it, end, 0);
|
||||||
specs.precision = parse_nonnegative_int(it, end, eh);
|
|
||||||
} else if (c == '*') {
|
} else if (c == '*') {
|
||||||
++it;
|
++it;
|
||||||
specs.precision = static_cast<int>(
|
specs.precision = static_cast<int>(
|
||||||
visit_format_arg(internal::printf_precision_handler(), get_arg()));
|
visit_format_arg(detail::printf_precision_handler(), get_arg(-1)));
|
||||||
} else {
|
} else {
|
||||||
specs.precision = 0;
|
specs.precision = 0;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
format_arg arg = get_arg(arg_index);
|
auto arg = get_arg(arg_index);
|
||||||
if (specs.alt && visit_format_arg(internal::is_zero_int(), arg))
|
// For d, i, o, u, x, and X conversion specifiers, if a precision is
|
||||||
|
// specified, the '0' flag is ignored
|
||||||
|
if (specs.precision >= 0 && arg.is_integral())
|
||||||
|
specs.fill[0] =
|
||||||
|
' '; // Ignore '0' flag for non-numeric types or if '-' present.
|
||||||
|
if (specs.precision >= 0 && arg.type() == detail::type::cstring_type) {
|
||||||
|
auto str = visit_format_arg(detail::get_cstring<Char>(), arg);
|
||||||
|
auto str_end = str + specs.precision;
|
||||||
|
auto nul = std::find(str, str_end, Char());
|
||||||
|
arg = detail::make_arg<basic_printf_context<OutputIt, Char>>(
|
||||||
|
basic_string_view<Char>(
|
||||||
|
str, detail::to_unsigned(nul != str_end ? nul - str
|
||||||
|
: specs.precision)));
|
||||||
|
}
|
||||||
|
if (specs.alt && visit_format_arg(detail::is_zero_int(), arg))
|
||||||
specs.alt = false;
|
specs.alt = false;
|
||||||
if (specs.fill[0] == '0') {
|
if (specs.fill[0] == '0') {
|
||||||
if (arg.is_arithmetic())
|
if (arg.is_arithmetic() && specs.align != align::left)
|
||||||
specs.align = align::numeric;
|
specs.align = align::numeric;
|
||||||
else
|
else
|
||||||
specs.fill[0] = ' '; // Ignore '0' flag for non-numeric types.
|
specs.fill[0] = ' '; // Ignore '0' flag for non-numeric types or if '-'
|
||||||
|
// flag is also present.
|
||||||
}
|
}
|
||||||
|
|
||||||
// Parse length and convert the argument to the required type.
|
// Parse length and convert the argument to the required type.
|
||||||
c = it != end ? *it++ : 0;
|
c = it != end ? *it++ : 0;
|
||||||
char_type t = it != end ? *it : 0;
|
Char t = it != end ? *it : 0;
|
||||||
using internal::convert_arg;
|
using detail::convert_arg;
|
||||||
switch (c) {
|
switch (c) {
|
||||||
case 'h':
|
case 'h':
|
||||||
if (t == 'h') {
|
if (t == 'h') {
|
||||||
@ -526,7 +475,7 @@ OutputIt basic_printf_context<OutputIt, Char>::format() {
|
|||||||
convert_arg<intmax_t>(arg, t);
|
convert_arg<intmax_t>(arg, t);
|
||||||
break;
|
break;
|
||||||
case 'z':
|
case 'z':
|
||||||
convert_arg<std::size_t>(arg, t);
|
convert_arg<size_t>(arg, t);
|
||||||
break;
|
break;
|
||||||
case 't':
|
case 't':
|
||||||
convert_arg<std::ptrdiff_t>(arg, t);
|
convert_arg<std::ptrdiff_t>(arg, t);
|
||||||
@ -542,33 +491,38 @@ OutputIt basic_printf_context<OutputIt, Char>::format() {
|
|||||||
|
|
||||||
// Parse type.
|
// Parse type.
|
||||||
if (it == end) FMT_THROW(format_error("invalid format string"));
|
if (it == end) FMT_THROW(format_error("invalid format string"));
|
||||||
specs.type = static_cast<char>(*it++);
|
char type = static_cast<char>(*it++);
|
||||||
if (arg.is_integral()) {
|
if (arg.is_integral()) {
|
||||||
// Normalize type.
|
// Normalize type.
|
||||||
switch (specs.type) {
|
switch (type) {
|
||||||
case 'i':
|
case 'i':
|
||||||
case 'u':
|
case 'u':
|
||||||
specs.type = 'd';
|
type = 'd';
|
||||||
break;
|
break;
|
||||||
case 'c':
|
case 'c':
|
||||||
visit_format_arg(internal::char_converter<basic_printf_context>(arg),
|
visit_format_arg(
|
||||||
|
detail::char_converter<basic_printf_context<OutputIt, Char>>(arg),
|
||||||
arg);
|
arg);
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
specs.type = parse_presentation_type(type);
|
||||||
|
if (specs.type == presentation_type::none)
|
||||||
|
parse_ctx.on_error("invalid type specifier");
|
||||||
|
|
||||||
start = it;
|
start = it;
|
||||||
|
|
||||||
// Format argument.
|
// Format argument.
|
||||||
visit_format_arg(ArgFormatter(out, specs, *this), arg);
|
out = visit_format_arg(
|
||||||
|
detail::printf_arg_formatter<OutputIt, Char>(out, specs, context), arg);
|
||||||
}
|
}
|
||||||
return std::copy(start, it, out);
|
detail::write(out, basic_string_view<Char>(start, to_unsigned(it - start)));
|
||||||
}
|
}
|
||||||
|
FMT_END_DETAIL_NAMESPACE
|
||||||
|
|
||||||
template <typename Char>
|
template <typename Char>
|
||||||
using basic_printf_context_t =
|
using basic_printf_context_t =
|
||||||
basic_printf_context<std::back_insert_iterator<internal::buffer<Char>>,
|
basic_printf_context<detail::buffer_appender<Char>, Char>;
|
||||||
Char>;
|
|
||||||
|
|
||||||
using printf_context = basic_printf_context_t<char>;
|
using printf_context = basic_printf_context_t<char>;
|
||||||
using wprintf_context = basic_printf_context_t<wchar_t>;
|
using wprintf_context = basic_printf_context_t<wchar_t>;
|
||||||
@ -582,9 +536,9 @@ using wprintf_args = basic_format_args<wprintf_context>;
|
|||||||
arguments and can be implicitly converted to `~fmt::printf_args`.
|
arguments and can be implicitly converted to `~fmt::printf_args`.
|
||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename... Args>
|
template <typename... T>
|
||||||
inline format_arg_store<printf_context, Args...> make_printf_args(
|
inline auto make_printf_args(const T&... args)
|
||||||
const Args&... args) {
|
-> format_arg_store<printf_context, T...> {
|
||||||
return {args...};
|
return {args...};
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -594,18 +548,19 @@ inline format_arg_store<printf_context, Args...> make_printf_args(
|
|||||||
arguments and can be implicitly converted to `~fmt::wprintf_args`.
|
arguments and can be implicitly converted to `~fmt::wprintf_args`.
|
||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename... Args>
|
template <typename... T>
|
||||||
inline format_arg_store<wprintf_context, Args...> make_wprintf_args(
|
inline auto make_wprintf_args(const T&... args)
|
||||||
const Args&... args) {
|
-> format_arg_store<wprintf_context, T...> {
|
||||||
return {args...};
|
return {args...};
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename S, typename Char = char_t<S>>
|
template <typename S, typename Char = char_t<S>>
|
||||||
inline std::basic_string<Char> vsprintf(
|
inline auto vsprintf(
|
||||||
const S& format,
|
const S& fmt,
|
||||||
basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
|
basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args)
|
||||||
|
-> std::basic_string<Char> {
|
||||||
basic_memory_buffer<Char> buffer;
|
basic_memory_buffer<Char> buffer;
|
||||||
printf(buffer, to_string_view(format), args);
|
vprintf(buffer, detail::to_string_view(fmt), args);
|
||||||
return to_string(buffer);
|
return to_string(buffer);
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -618,20 +573,22 @@ inline std::basic_string<Char> vsprintf(
|
|||||||
std::string message = fmt::sprintf("The answer is %d", 42);
|
std::string message = fmt::sprintf("The answer is %d", 42);
|
||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename S, typename... Args,
|
template <typename S, typename... T,
|
||||||
typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
|
typename Char = enable_if_t<detail::is_string<S>::value, char_t<S>>>
|
||||||
inline std::basic_string<Char> sprintf(const S& format, const Args&... args) {
|
inline auto sprintf(const S& fmt, const T&... args) -> std::basic_string<Char> {
|
||||||
using context = basic_printf_context_t<Char>;
|
using context = basic_printf_context_t<Char>;
|
||||||
return vsprintf(to_string_view(format), make_format_args<context>(args...));
|
return vsprintf(detail::to_string_view(fmt),
|
||||||
|
fmt::make_format_args<context>(args...));
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename S, typename Char = char_t<S>>
|
template <typename S, typename Char = char_t<S>>
|
||||||
inline int vfprintf(
|
inline auto vfprintf(
|
||||||
std::FILE* f, const S& format,
|
std::FILE* f, const S& fmt,
|
||||||
basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
|
basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args)
|
||||||
|
-> int {
|
||||||
basic_memory_buffer<Char> buffer;
|
basic_memory_buffer<Char> buffer;
|
||||||
printf(buffer, to_string_view(format), args);
|
vprintf(buffer, detail::to_string_view(fmt), args);
|
||||||
std::size_t size = buffer.size();
|
size_t size = buffer.size();
|
||||||
return std::fwrite(buffer.data(), sizeof(Char), size, f) < size
|
return std::fwrite(buffer.data(), sizeof(Char), size, f) < size
|
||||||
? -1
|
? -1
|
||||||
: static_cast<int>(size);
|
: static_cast<int>(size);
|
||||||
@ -646,19 +603,19 @@ inline int vfprintf(
|
|||||||
fmt::fprintf(stderr, "Don't %s!", "panic");
|
fmt::fprintf(stderr, "Don't %s!", "panic");
|
||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename S, typename... Args,
|
template <typename S, typename... T, typename Char = char_t<S>>
|
||||||
typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
|
inline auto fprintf(std::FILE* f, const S& fmt, const T&... args) -> int {
|
||||||
inline int fprintf(std::FILE* f, const S& format, const Args&... args) {
|
|
||||||
using context = basic_printf_context_t<Char>;
|
using context = basic_printf_context_t<Char>;
|
||||||
return vfprintf(f, to_string_view(format),
|
return vfprintf(f, detail::to_string_view(fmt),
|
||||||
make_format_args<context>(args...));
|
fmt::make_format_args<context>(args...));
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename S, typename Char = char_t<S>>
|
template <typename S, typename Char = char_t<S>>
|
||||||
inline int vprintf(
|
inline auto vprintf(
|
||||||
const S& format,
|
const S& fmt,
|
||||||
basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
|
basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args)
|
||||||
return vfprintf(stdout, to_string_view(format), args);
|
-> int {
|
||||||
|
return vfprintf(stdout, detail::to_string_view(fmt), args);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@ -670,52 +627,14 @@ inline int vprintf(
|
|||||||
fmt::printf("Elapsed time: %.2f seconds", 1.23);
|
fmt::printf("Elapsed time: %.2f seconds", 1.23);
|
||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename S, typename... Args,
|
template <typename S, typename... T, FMT_ENABLE_IF(detail::is_string<S>::value)>
|
||||||
FMT_ENABLE_IF(internal::is_string<S>::value)>
|
inline auto printf(const S& fmt, const T&... args) -> int {
|
||||||
inline int printf(const S& format_str, const Args&... args) {
|
return vprintf(
|
||||||
using context = basic_printf_context_t<char_t<S>>;
|
detail::to_string_view(fmt),
|
||||||
return vprintf(to_string_view(format_str),
|
fmt::make_format_args<basic_printf_context_t<char_t<S>>>(args...));
|
||||||
make_format_args<context>(args...));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename S, typename Char = char_t<S>>
|
FMT_MODULE_EXPORT_END
|
||||||
inline int vfprintf(
|
|
||||||
std::basic_ostream<Char>& os, const S& format,
|
|
||||||
basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
|
|
||||||
basic_memory_buffer<Char> buffer;
|
|
||||||
printf(buffer, to_string_view(format), args);
|
|
||||||
internal::write(os, buffer);
|
|
||||||
return static_cast<int>(buffer.size());
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Formats arguments and writes the output to the range. */
|
|
||||||
template <typename ArgFormatter, typename Char,
|
|
||||||
typename Context =
|
|
||||||
basic_printf_context<typename ArgFormatter::iterator, Char>>
|
|
||||||
typename ArgFormatter::iterator vprintf(
|
|
||||||
internal::buffer<Char>& out, basic_string_view<Char> format_str,
|
|
||||||
basic_format_args<type_identity_t<Context>> args) {
|
|
||||||
typename ArgFormatter::iterator iter(out);
|
|
||||||
Context(iter, format_str, args).template format<ArgFormatter>();
|
|
||||||
return iter;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
\rst
|
|
||||||
Prints formatted data to the stream *os*.
|
|
||||||
|
|
||||||
**Example**::
|
|
||||||
|
|
||||||
fmt::fprintf(cerr, "Don't %s!", "panic");
|
|
||||||
\endrst
|
|
||||||
*/
|
|
||||||
template <typename S, typename... Args, typename Char = char_t<S>>
|
|
||||||
inline int fprintf(std::basic_ostream<Char>& os, const S& format_str,
|
|
||||||
const Args&... args) {
|
|
||||||
using context = basic_printf_context_t<Char>;
|
|
||||||
return vfprintf(os, to_string_view(format_str),
|
|
||||||
make_format_args<context>(args...));
|
|
||||||
}
|
|
||||||
FMT_END_NAMESPACE
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
#endif // FMT_PRINTF_H_
|
#endif // FMT_PRINTF_H_
|
||||||
|
737
externals/fmt/include/fmt/ranges.h
vendored
737
externals/fmt/include/fmt/ranges.h
vendored
@ -13,48 +13,14 @@
|
|||||||
#define FMT_RANGES_H_
|
#define FMT_RANGES_H_
|
||||||
|
|
||||||
#include <initializer_list>
|
#include <initializer_list>
|
||||||
|
#include <tuple>
|
||||||
#include <type_traits>
|
#include <type_traits>
|
||||||
|
|
||||||
#include "format.h"
|
#include "format.h"
|
||||||
|
|
||||||
// output only up to N items from the range.
|
|
||||||
#ifndef FMT_RANGE_OUTPUT_LENGTH_LIMIT
|
|
||||||
# define FMT_RANGE_OUTPUT_LENGTH_LIMIT 256
|
|
||||||
#endif
|
|
||||||
|
|
||||||
FMT_BEGIN_NAMESPACE
|
FMT_BEGIN_NAMESPACE
|
||||||
|
|
||||||
template <typename Char> struct formatting_base {
|
namespace detail {
|
||||||
template <typename ParseContext>
|
|
||||||
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
|
||||||
return ctx.begin();
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename Char, typename Enable = void>
|
|
||||||
struct formatting_range : formatting_base<Char> {
|
|
||||||
static FMT_CONSTEXPR_DECL const std::size_t range_length_limit =
|
|
||||||
FMT_RANGE_OUTPUT_LENGTH_LIMIT; // output only up to N items from the
|
|
||||||
// range.
|
|
||||||
Char prefix;
|
|
||||||
Char delimiter;
|
|
||||||
Char postfix;
|
|
||||||
formatting_range() : prefix('{'), delimiter(','), postfix('}') {}
|
|
||||||
static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
|
|
||||||
static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename Char, typename Enable = void>
|
|
||||||
struct formatting_tuple : formatting_base<Char> {
|
|
||||||
Char prefix;
|
|
||||||
Char delimiter;
|
|
||||||
Char postfix;
|
|
||||||
formatting_tuple() : prefix('('), delimiter(','), postfix(')') {}
|
|
||||||
static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
|
|
||||||
static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
|
|
||||||
};
|
|
||||||
|
|
||||||
namespace internal {
|
|
||||||
|
|
||||||
template <typename RangeT, typename OutputIterator>
|
template <typename RangeT, typename OutputIterator>
|
||||||
OutputIterator copy(const RangeT& range, OutputIterator out) {
|
OutputIterator copy(const RangeT& range, OutputIterator out) {
|
||||||
@ -75,73 +41,194 @@ OutputIterator copy(char ch, OutputIterator out) {
|
|||||||
return out;
|
return out;
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Return true value if T has std::string interface, like std::string_view.
|
template <typename OutputIterator>
|
||||||
template <typename T> class is_like_std_string {
|
OutputIterator copy(wchar_t ch, OutputIterator out) {
|
||||||
|
*out++ = ch;
|
||||||
|
return out;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Returns true if T has a std::string-like interface, like std::string_view.
|
||||||
|
template <typename T> class is_std_string_like {
|
||||||
template <typename U>
|
template <typename U>
|
||||||
static auto check(U* p)
|
static auto check(U* p)
|
||||||
-> decltype((void)p->find('a'), p->length(), (void)p->data(), int());
|
-> decltype((void)p->find('a'), p->length(), (void)p->data(), int());
|
||||||
template <typename> static void check(...);
|
template <typename> static void check(...);
|
||||||
|
|
||||||
public:
|
public:
|
||||||
static FMT_CONSTEXPR_DECL const bool value =
|
static constexpr const bool value =
|
||||||
is_string<T>::value || !std::is_void<decltype(check<T>(nullptr))>::value;
|
is_string<T>::value ||
|
||||||
|
std::is_convertible<T, std_string_view<char>>::value ||
|
||||||
|
!std::is_void<decltype(check<T>(nullptr))>::value;
|
||||||
};
|
};
|
||||||
|
|
||||||
template <typename Char>
|
template <typename Char>
|
||||||
struct is_like_std_string<fmt::basic_string_view<Char>> : std::true_type {};
|
struct is_std_string_like<fmt::basic_string_view<Char>> : std::true_type {};
|
||||||
|
|
||||||
|
template <typename T> class is_map {
|
||||||
|
template <typename U> static auto check(U*) -> typename U::mapped_type;
|
||||||
|
template <typename> static void check(...);
|
||||||
|
|
||||||
|
public:
|
||||||
|
#ifdef FMT_FORMAT_MAP_AS_LIST
|
||||||
|
static constexpr const bool value = false;
|
||||||
|
#else
|
||||||
|
static constexpr const bool value =
|
||||||
|
!std::is_void<decltype(check<T>(nullptr))>::value;
|
||||||
|
#endif
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T> class is_set {
|
||||||
|
template <typename U> static auto check(U*) -> typename U::key_type;
|
||||||
|
template <typename> static void check(...);
|
||||||
|
|
||||||
|
public:
|
||||||
|
#ifdef FMT_FORMAT_SET_AS_LIST
|
||||||
|
static constexpr const bool value = false;
|
||||||
|
#else
|
||||||
|
static constexpr const bool value =
|
||||||
|
!std::is_void<decltype(check<T>(nullptr))>::value && !is_map<T>::value;
|
||||||
|
#endif
|
||||||
|
};
|
||||||
|
|
||||||
template <typename... Ts> struct conditional_helper {};
|
template <typename... Ts> struct conditional_helper {};
|
||||||
|
|
||||||
template <typename T, typename _ = void> struct is_range_ : std::false_type {};
|
template <typename T, typename _ = void> struct is_range_ : std::false_type {};
|
||||||
|
|
||||||
#if !FMT_MSC_VER || FMT_MSC_VER > 1800
|
#if !FMT_MSC_VERSION || FMT_MSC_VERSION > 1800
|
||||||
|
|
||||||
|
# define FMT_DECLTYPE_RETURN(val) \
|
||||||
|
->decltype(val) { return val; } \
|
||||||
|
static_assert( \
|
||||||
|
true, "") // This makes it so that a semicolon is required after the
|
||||||
|
// macro, which helps clang-format handle the formatting.
|
||||||
|
|
||||||
|
// C array overload
|
||||||
|
template <typename T, std::size_t N>
|
||||||
|
auto range_begin(const T (&arr)[N]) -> const T* {
|
||||||
|
return arr;
|
||||||
|
}
|
||||||
|
template <typename T, std::size_t N>
|
||||||
|
auto range_end(const T (&arr)[N]) -> const T* {
|
||||||
|
return arr + N;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T, typename Enable = void>
|
||||||
|
struct has_member_fn_begin_end_t : std::false_type {};
|
||||||
|
|
||||||
template <typename T>
|
template <typename T>
|
||||||
struct is_range_<
|
struct has_member_fn_begin_end_t<T, void_t<decltype(std::declval<T>().begin()),
|
||||||
T, conditional_t<false,
|
decltype(std::declval<T>().end())>>
|
||||||
conditional_helper<decltype(std::declval<T>().begin()),
|
: std::true_type {};
|
||||||
decltype(std::declval<T>().end())>,
|
|
||||||
void>> : std::true_type {};
|
// Member function overload
|
||||||
|
template <typename T>
|
||||||
|
auto range_begin(T&& rng) FMT_DECLTYPE_RETURN(static_cast<T&&>(rng).begin());
|
||||||
|
template <typename T>
|
||||||
|
auto range_end(T&& rng) FMT_DECLTYPE_RETURN(static_cast<T&&>(rng).end());
|
||||||
|
|
||||||
|
// ADL overload. Only participates in overload resolution if member functions
|
||||||
|
// are not found.
|
||||||
|
template <typename T>
|
||||||
|
auto range_begin(T&& rng)
|
||||||
|
-> enable_if_t<!has_member_fn_begin_end_t<T&&>::value,
|
||||||
|
decltype(begin(static_cast<T&&>(rng)))> {
|
||||||
|
return begin(static_cast<T&&>(rng));
|
||||||
|
}
|
||||||
|
template <typename T>
|
||||||
|
auto range_end(T&& rng) -> enable_if_t<!has_member_fn_begin_end_t<T&&>::value,
|
||||||
|
decltype(end(static_cast<T&&>(rng)))> {
|
||||||
|
return end(static_cast<T&&>(rng));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T, typename Enable = void>
|
||||||
|
struct has_const_begin_end : std::false_type {};
|
||||||
|
template <typename T, typename Enable = void>
|
||||||
|
struct has_mutable_begin_end : std::false_type {};
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
struct has_const_begin_end<
|
||||||
|
T,
|
||||||
|
void_t<
|
||||||
|
decltype(detail::range_begin(std::declval<const remove_cvref_t<T>&>())),
|
||||||
|
decltype(detail::range_end(std::declval<const remove_cvref_t<T>&>()))>>
|
||||||
|
: std::true_type {};
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
struct has_mutable_begin_end<
|
||||||
|
T, void_t<decltype(detail::range_begin(std::declval<T>())),
|
||||||
|
decltype(detail::range_end(std::declval<T>())),
|
||||||
|
enable_if_t<std::is_copy_constructible<T>::value>>>
|
||||||
|
: std::true_type {};
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
struct is_range_<T, void>
|
||||||
|
: std::integral_constant<bool, (has_const_begin_end<T>::value ||
|
||||||
|
has_mutable_begin_end<T>::value)> {};
|
||||||
|
# undef FMT_DECLTYPE_RETURN
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
/// tuple_size and tuple_element check.
|
// tuple_size and tuple_element check.
|
||||||
template <typename T> class is_tuple_like_ {
|
template <typename T> class is_tuple_like_ {
|
||||||
template <typename U>
|
template <typename U>
|
||||||
static auto check(U* p) -> decltype(std::tuple_size<U>::value, int());
|
static auto check(U* p) -> decltype(std::tuple_size<U>::value, int());
|
||||||
template <typename> static void check(...);
|
template <typename> static void check(...);
|
||||||
|
|
||||||
public:
|
public:
|
||||||
static FMT_CONSTEXPR_DECL const bool value =
|
static constexpr const bool value =
|
||||||
!std::is_void<decltype(check<T>(nullptr))>::value;
|
!std::is_void<decltype(check<T>(nullptr))>::value;
|
||||||
};
|
};
|
||||||
|
|
||||||
// Check for integer_sequence
|
// Check for integer_sequence
|
||||||
#if defined(__cpp_lib_integer_sequence) || FMT_MSC_VER >= 1900
|
#if defined(__cpp_lib_integer_sequence) || FMT_MSC_VERSION >= 1900
|
||||||
template <typename T, T... N>
|
template <typename T, T... N>
|
||||||
using integer_sequence = std::integer_sequence<T, N...>;
|
using integer_sequence = std::integer_sequence<T, N...>;
|
||||||
template <std::size_t... N> using index_sequence = std::index_sequence<N...>;
|
template <size_t... N> using index_sequence = std::index_sequence<N...>;
|
||||||
template <std::size_t N>
|
template <size_t N> using make_index_sequence = std::make_index_sequence<N>;
|
||||||
using make_index_sequence = std::make_index_sequence<N>;
|
|
||||||
#else
|
#else
|
||||||
template <typename T, T... N> struct integer_sequence {
|
template <typename T, T... N> struct integer_sequence {
|
||||||
using value_type = T;
|
using value_type = T;
|
||||||
|
|
||||||
static FMT_CONSTEXPR std::size_t size() { return sizeof...(N); }
|
static FMT_CONSTEXPR size_t size() { return sizeof...(N); }
|
||||||
};
|
};
|
||||||
|
|
||||||
template <std::size_t... N>
|
template <size_t... N> using index_sequence = integer_sequence<size_t, N...>;
|
||||||
using index_sequence = integer_sequence<std::size_t, N...>;
|
|
||||||
|
|
||||||
template <typename T, std::size_t N, T... Ns>
|
template <typename T, size_t N, T... Ns>
|
||||||
struct make_integer_sequence : make_integer_sequence<T, N - 1, N - 1, Ns...> {};
|
struct make_integer_sequence : make_integer_sequence<T, N - 1, N - 1, Ns...> {};
|
||||||
template <typename T, T... Ns>
|
template <typename T, T... Ns>
|
||||||
struct make_integer_sequence<T, 0, Ns...> : integer_sequence<T, Ns...> {};
|
struct make_integer_sequence<T, 0, Ns...> : integer_sequence<T, Ns...> {};
|
||||||
|
|
||||||
template <std::size_t N>
|
template <size_t N>
|
||||||
using make_index_sequence = make_integer_sequence<std::size_t, N>;
|
using make_index_sequence = make_integer_sequence<size_t, N>;
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
using tuple_index_sequence = make_index_sequence<std::tuple_size<T>::value>;
|
||||||
|
|
||||||
|
template <typename T, typename C, bool = is_tuple_like_<T>::value>
|
||||||
|
class is_tuple_formattable_ {
|
||||||
|
public:
|
||||||
|
static constexpr const bool value = false;
|
||||||
|
};
|
||||||
|
template <typename T, typename C> class is_tuple_formattable_<T, C, true> {
|
||||||
|
template <std::size_t... I>
|
||||||
|
static std::true_type check2(index_sequence<I...>,
|
||||||
|
integer_sequence<bool, (I == I)...>);
|
||||||
|
static std::false_type check2(...);
|
||||||
|
template <std::size_t... I>
|
||||||
|
static decltype(check2(
|
||||||
|
index_sequence<I...>{},
|
||||||
|
integer_sequence<
|
||||||
|
bool, (is_formattable<typename std::tuple_element<I, T>::type,
|
||||||
|
C>::value)...>{})) check(index_sequence<I...>);
|
||||||
|
|
||||||
|
public:
|
||||||
|
static constexpr const bool value =
|
||||||
|
decltype(check(tuple_index_sequence<T>{}))::value;
|
||||||
|
};
|
||||||
|
|
||||||
template <class Tuple, class F, size_t... Is>
|
template <class Tuple, class F, size_t... Is>
|
||||||
void for_each(index_sequence<Is...>, Tuple&& tup, F&& f) FMT_NOEXCEPT {
|
void for_each(index_sequence<Is...>, Tuple&& tup, F&& f) noexcept {
|
||||||
using std::get;
|
using std::get;
|
||||||
// using free function get<I>(T) now.
|
// using free function get<I>(T) now.
|
||||||
const int _[] = {0, ((void)f(get<Is>(tup)), 0)...};
|
const int _[] = {0, ((void)f(get<Is>(tup)), 0)...};
|
||||||
@ -159,183 +246,435 @@ template <class Tuple, class F> void for_each(Tuple&& tup, F&& f) {
|
|||||||
for_each(indexes, std::forward<Tuple>(tup), std::forward<F>(f));
|
for_each(indexes, std::forward<Tuple>(tup), std::forward<F>(f));
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Arg, FMT_ENABLE_IF(!is_like_std_string<
|
#if FMT_MSC_VERSION && FMT_MSC_VERSION < 1920
|
||||||
typename std::decay<Arg>::type>::value)>
|
// Older MSVC doesn't get the reference type correctly for arrays.
|
||||||
FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
|
template <typename R> struct range_reference_type_impl {
|
||||||
return add_space ? " {}" : "{}";
|
using type = decltype(*detail::range_begin(std::declval<R&>()));
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T, std::size_t N> struct range_reference_type_impl<T[N]> {
|
||||||
|
using type = T&;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
using range_reference_type = typename range_reference_type_impl<T>::type;
|
||||||
|
#else
|
||||||
|
template <typename Range>
|
||||||
|
using range_reference_type =
|
||||||
|
decltype(*detail::range_begin(std::declval<Range&>()));
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// We don't use the Range's value_type for anything, but we do need the Range's
|
||||||
|
// reference type, with cv-ref stripped.
|
||||||
|
template <typename Range>
|
||||||
|
using uncvref_type = remove_cvref_t<range_reference_type<Range>>;
|
||||||
|
|
||||||
|
template <typename Range>
|
||||||
|
using uncvref_first_type =
|
||||||
|
remove_cvref_t<decltype(std::declval<range_reference_type<Range>>().first)>;
|
||||||
|
|
||||||
|
template <typename Range>
|
||||||
|
using uncvref_second_type = remove_cvref_t<
|
||||||
|
decltype(std::declval<range_reference_type<Range>>().second)>;
|
||||||
|
|
||||||
|
template <typename OutputIt> OutputIt write_delimiter(OutputIt out) {
|
||||||
|
*out++ = ',';
|
||||||
|
*out++ = ' ';
|
||||||
|
return out;
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename Arg, FMT_ENABLE_IF(is_like_std_string<
|
template <typename Char, typename OutputIt>
|
||||||
typename std::decay<Arg>::type>::value)>
|
auto write_range_entry(OutputIt out, basic_string_view<Char> str) -> OutputIt {
|
||||||
FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
|
return write_escaped_string(out, str);
|
||||||
return add_space ? " \"{}\"" : "\"{}\"";
|
|
||||||
}
|
}
|
||||||
|
|
||||||
FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char*) {
|
template <typename Char, typename OutputIt, typename T,
|
||||||
return add_space ? " \"{}\"" : "\"{}\"";
|
FMT_ENABLE_IF(std::is_convertible<T, std_string_view<char>>::value)>
|
||||||
}
|
inline auto write_range_entry(OutputIt out, const T& str) -> OutputIt {
|
||||||
FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t*) {
|
auto sv = std_string_view<Char>(str);
|
||||||
return add_space ? L" \"{}\"" : L"\"{}\"";
|
return write_range_entry<Char>(out, basic_string_view<Char>(sv));
|
||||||
}
|
}
|
||||||
|
|
||||||
FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char) {
|
template <typename Char, typename OutputIt, typename Arg,
|
||||||
return add_space ? " '{}'" : "'{}'";
|
FMT_ENABLE_IF(std::is_same<Arg, Char>::value)>
|
||||||
}
|
OutputIt write_range_entry(OutputIt out, const Arg v) {
|
||||||
FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t) {
|
return write_escaped_char(out, v);
|
||||||
return add_space ? L" '{}'" : L"'{}'";
|
|
||||||
}
|
}
|
||||||
|
|
||||||
} // namespace internal
|
template <
|
||||||
|
typename Char, typename OutputIt, typename Arg,
|
||||||
|
FMT_ENABLE_IF(!is_std_string_like<typename std::decay<Arg>::type>::value &&
|
||||||
|
!std::is_same<Arg, Char>::value)>
|
||||||
|
OutputIt write_range_entry(OutputIt out, const Arg& v) {
|
||||||
|
return write<Char>(out, v);
|
||||||
|
}
|
||||||
|
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
template <typename T> struct is_tuple_like {
|
template <typename T> struct is_tuple_like {
|
||||||
static FMT_CONSTEXPR_DECL const bool value =
|
static constexpr const bool value =
|
||||||
internal::is_tuple_like_<T>::value && !internal::is_range_<T>::value;
|
detail::is_tuple_like_<T>::value && !detail::is_range_<T>::value;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T, typename C> struct is_tuple_formattable {
|
||||||
|
static constexpr const bool value =
|
||||||
|
detail::is_tuple_formattable_<T, C>::value;
|
||||||
};
|
};
|
||||||
|
|
||||||
template <typename TupleT, typename Char>
|
template <typename TupleT, typename Char>
|
||||||
struct formatter<TupleT, Char, enable_if_t<fmt::is_tuple_like<TupleT>::value>> {
|
struct formatter<TupleT, Char,
|
||||||
|
enable_if_t<fmt::is_tuple_like<TupleT>::value &&
|
||||||
|
fmt::is_tuple_formattable<TupleT, Char>::value>> {
|
||||||
private:
|
private:
|
||||||
// C++11 generic lambda for format()
|
basic_string_view<Char> separator_ = detail::string_literal<Char, ',', ' '>{};
|
||||||
|
basic_string_view<Char> opening_bracket_ =
|
||||||
|
detail::string_literal<Char, '('>{};
|
||||||
|
basic_string_view<Char> closing_bracket_ =
|
||||||
|
detail::string_literal<Char, ')'>{};
|
||||||
|
|
||||||
|
// C++11 generic lambda for format().
|
||||||
template <typename FormatContext> struct format_each {
|
template <typename FormatContext> struct format_each {
|
||||||
template <typename T> void operator()(const T& v) {
|
template <typename T> void operator()(const T& v) {
|
||||||
if (i > 0) {
|
if (i > 0) out = detail::copy_str<Char>(separator, out);
|
||||||
if (formatting.add_prepostfix_space) {
|
out = detail::write_range_entry<Char>(out, v);
|
||||||
*out++ = ' ';
|
|
||||||
}
|
|
||||||
out = internal::copy(formatting.delimiter, out);
|
|
||||||
}
|
|
||||||
out = format_to(out,
|
|
||||||
internal::format_str_quoted(
|
|
||||||
(formatting.add_delimiter_spaces && i > 0), v),
|
|
||||||
v);
|
|
||||||
++i;
|
++i;
|
||||||
}
|
}
|
||||||
|
int i;
|
||||||
formatting_tuple<Char>& formatting;
|
typename FormatContext::iterator& out;
|
||||||
std::size_t& i;
|
basic_string_view<Char> separator;
|
||||||
typename std::add_lvalue_reference<decltype(
|
|
||||||
std::declval<FormatContext>().out())>::type out;
|
|
||||||
};
|
};
|
||||||
|
|
||||||
public:
|
public:
|
||||||
formatting_tuple<Char> formatting;
|
FMT_CONSTEXPR formatter() {}
|
||||||
|
|
||||||
template <typename ParseContext>
|
FMT_CONSTEXPR void set_separator(basic_string_view<Char> sep) {
|
||||||
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
separator_ = sep;
|
||||||
return formatting.parse(ctx);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename FormatContext = format_context>
|
FMT_CONSTEXPR void set_brackets(basic_string_view<Char> open,
|
||||||
auto format(const TupleT& values, FormatContext& ctx) -> decltype(ctx.out()) {
|
basic_string_view<Char> close) {
|
||||||
auto out = ctx.out();
|
opening_bracket_ = open;
|
||||||
std::size_t i = 0;
|
closing_bracket_ = close;
|
||||||
internal::copy(formatting.prefix, out);
|
|
||||||
|
|
||||||
internal::for_each(values, format_each<FormatContext>{formatting, i, out});
|
|
||||||
if (formatting.add_prepostfix_space) {
|
|
||||||
*out++ = ' ';
|
|
||||||
}
|
|
||||||
internal::copy(formatting.postfix, out);
|
|
||||||
|
|
||||||
return ctx.out();
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename T, typename Char> struct is_range {
|
|
||||||
static FMT_CONSTEXPR_DECL const bool value =
|
|
||||||
internal::is_range_<T>::value &&
|
|
||||||
!internal::is_like_std_string<T>::value &&
|
|
||||||
!std::is_convertible<T, std::basic_string<Char>>::value &&
|
|
||||||
!std::is_constructible<internal::std_string_view<Char>, T>::value;
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename RangeT, typename Char>
|
|
||||||
struct formatter<RangeT, Char,
|
|
||||||
enable_if_t<fmt::is_range<RangeT, Char>::value>> {
|
|
||||||
formatting_range<Char> formatting;
|
|
||||||
|
|
||||||
template <typename ParseContext>
|
|
||||||
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
|
||||||
return formatting.parse(ctx);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename FormatContext>
|
|
||||||
typename FormatContext::iterator format(const RangeT& values,
|
|
||||||
FormatContext& ctx) {
|
|
||||||
auto out = internal::copy(formatting.prefix, ctx.out());
|
|
||||||
std::size_t i = 0;
|
|
||||||
for (auto it = values.begin(), end = values.end(); it != end; ++it) {
|
|
||||||
if (i > 0) {
|
|
||||||
if (formatting.add_prepostfix_space) *out++ = ' ';
|
|
||||||
out = internal::copy(formatting.delimiter, out);
|
|
||||||
}
|
|
||||||
out = format_to(out,
|
|
||||||
internal::format_str_quoted(
|
|
||||||
(formatting.add_delimiter_spaces && i > 0), *it),
|
|
||||||
*it);
|
|
||||||
if (++i > formatting.range_length_limit) {
|
|
||||||
out = format_to(out, " ... <other elements>");
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if (formatting.add_prepostfix_space) *out++ = ' ';
|
|
||||||
return internal::copy(formatting.postfix, out);
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename Char, typename... T> struct tuple_arg_join : internal::view {
|
|
||||||
const std::tuple<T...>& tuple;
|
|
||||||
basic_string_view<Char> sep;
|
|
||||||
|
|
||||||
tuple_arg_join(const std::tuple<T...>& t, basic_string_view<Char> s)
|
|
||||||
: tuple{t}, sep{s} {}
|
|
||||||
};
|
|
||||||
|
|
||||||
template <typename Char, typename... T>
|
|
||||||
struct formatter<tuple_arg_join<Char, T...>, Char> {
|
|
||||||
template <typename ParseContext>
|
template <typename ParseContext>
|
||||||
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
||||||
return ctx.begin();
|
return ctx.begin();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
template <typename FormatContext = format_context>
|
||||||
|
auto format(const TupleT& values, FormatContext& ctx) const
|
||||||
|
-> decltype(ctx.out()) {
|
||||||
|
auto out = ctx.out();
|
||||||
|
out = detail::copy_str<Char>(opening_bracket_, out);
|
||||||
|
detail::for_each(values, format_each<FormatContext>{0, out, separator_});
|
||||||
|
out = detail::copy_str<Char>(closing_bracket_, out);
|
||||||
|
return out;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T, typename Char> struct is_range {
|
||||||
|
static constexpr const bool value =
|
||||||
|
detail::is_range_<T>::value && !detail::is_std_string_like<T>::value &&
|
||||||
|
!std::is_convertible<T, std::basic_string<Char>>::value &&
|
||||||
|
!std::is_convertible<T, detail::std_string_view<Char>>::value;
|
||||||
|
};
|
||||||
|
|
||||||
|
namespace detail {
|
||||||
|
template <typename Context> struct range_mapper {
|
||||||
|
using mapper = arg_mapper<Context>;
|
||||||
|
|
||||||
|
template <typename T,
|
||||||
|
FMT_ENABLE_IF(has_formatter<remove_cvref_t<T>, Context>::value)>
|
||||||
|
static auto map(T&& value) -> T&& {
|
||||||
|
return static_cast<T&&>(value);
|
||||||
|
}
|
||||||
|
template <typename T,
|
||||||
|
FMT_ENABLE_IF(!has_formatter<remove_cvref_t<T>, Context>::value)>
|
||||||
|
static auto map(T&& value)
|
||||||
|
-> decltype(mapper().map(static_cast<T&&>(value))) {
|
||||||
|
return mapper().map(static_cast<T&&>(value));
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Char, typename Element>
|
||||||
|
using range_formatter_type = conditional_t<
|
||||||
|
is_formattable<Element, Char>::value,
|
||||||
|
formatter<remove_cvref_t<decltype(range_mapper<buffer_context<Char>>{}.map(
|
||||||
|
std::declval<Element>()))>,
|
||||||
|
Char>,
|
||||||
|
fallback_formatter<Element, Char>>;
|
||||||
|
|
||||||
|
template <typename R>
|
||||||
|
using maybe_const_range =
|
||||||
|
conditional_t<has_const_begin_end<R>::value, const R, R>;
|
||||||
|
|
||||||
|
// Workaround a bug in MSVC 2015 and earlier.
|
||||||
|
#if !FMT_MSC_VERSION || FMT_MSC_VERSION >= 1910
|
||||||
|
template <typename R, typename Char>
|
||||||
|
struct is_formattable_delayed
|
||||||
|
: disjunction<
|
||||||
|
is_formattable<uncvref_type<maybe_const_range<R>>, Char>,
|
||||||
|
has_fallback_formatter<uncvref_type<maybe_const_range<R>>, Char>> {};
|
||||||
|
#endif
|
||||||
|
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
template <typename T, typename Char, typename Enable = void>
|
||||||
|
struct range_formatter;
|
||||||
|
|
||||||
|
template <typename T, typename Char>
|
||||||
|
struct range_formatter<
|
||||||
|
T, Char,
|
||||||
|
enable_if_t<conjunction<
|
||||||
|
std::is_same<T, remove_cvref_t<T>>,
|
||||||
|
disjunction<is_formattable<T, Char>,
|
||||||
|
detail::has_fallback_formatter<T, Char>>>::value>> {
|
||||||
|
private:
|
||||||
|
detail::range_formatter_type<Char, T> underlying_;
|
||||||
|
bool custom_specs_ = false;
|
||||||
|
basic_string_view<Char> separator_ = detail::string_literal<Char, ',', ' '>{};
|
||||||
|
basic_string_view<Char> opening_bracket_ =
|
||||||
|
detail::string_literal<Char, '['>{};
|
||||||
|
basic_string_view<Char> closing_bracket_ =
|
||||||
|
detail::string_literal<Char, ']'>{};
|
||||||
|
|
||||||
|
template <class U>
|
||||||
|
FMT_CONSTEXPR static auto maybe_set_debug_format(U& u, int)
|
||||||
|
-> decltype(u.set_debug_format()) {
|
||||||
|
u.set_debug_format();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <class U>
|
||||||
|
FMT_CONSTEXPR static void maybe_set_debug_format(U&, ...) {}
|
||||||
|
|
||||||
|
FMT_CONSTEXPR void maybe_set_debug_format() {
|
||||||
|
maybe_set_debug_format(underlying_, 0);
|
||||||
|
}
|
||||||
|
|
||||||
|
public:
|
||||||
|
FMT_CONSTEXPR range_formatter() {}
|
||||||
|
|
||||||
|
FMT_CONSTEXPR auto underlying() -> detail::range_formatter_type<Char, T>& {
|
||||||
|
return underlying_;
|
||||||
|
}
|
||||||
|
|
||||||
|
FMT_CONSTEXPR void set_separator(basic_string_view<Char> sep) {
|
||||||
|
separator_ = sep;
|
||||||
|
}
|
||||||
|
|
||||||
|
FMT_CONSTEXPR void set_brackets(basic_string_view<Char> open,
|
||||||
|
basic_string_view<Char> close) {
|
||||||
|
opening_bracket_ = open;
|
||||||
|
closing_bracket_ = close;
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename ParseContext>
|
||||||
|
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
||||||
|
auto it = ctx.begin();
|
||||||
|
auto end = ctx.end();
|
||||||
|
if (it == end || *it == '}') {
|
||||||
|
maybe_set_debug_format();
|
||||||
|
return it;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (*it == 'n') {
|
||||||
|
set_brackets({}, {});
|
||||||
|
++it;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (*it == '}') {
|
||||||
|
maybe_set_debug_format();
|
||||||
|
return it;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (*it != ':')
|
||||||
|
FMT_THROW(format_error("no other top-level range formatters supported"));
|
||||||
|
|
||||||
|
custom_specs_ = true;
|
||||||
|
++it;
|
||||||
|
ctx.advance_to(it);
|
||||||
|
return underlying_.parse(ctx);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename R, class FormatContext>
|
||||||
|
auto format(R&& range, FormatContext& ctx) const -> decltype(ctx.out()) {
|
||||||
|
detail::range_mapper<buffer_context<Char>> mapper;
|
||||||
|
auto out = ctx.out();
|
||||||
|
out = detail::copy_str<Char>(opening_bracket_, out);
|
||||||
|
int i = 0;
|
||||||
|
auto it = detail::range_begin(range);
|
||||||
|
auto end = detail::range_end(range);
|
||||||
|
for (; it != end; ++it) {
|
||||||
|
if (i > 0) out = detail::copy_str<Char>(separator_, out);
|
||||||
|
;
|
||||||
|
ctx.advance_to(out);
|
||||||
|
out = underlying_.format(mapper.map(*it), ctx);
|
||||||
|
++i;
|
||||||
|
}
|
||||||
|
out = detail::copy_str<Char>(closing_bracket_, out);
|
||||||
|
return out;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
enum class range_format { disabled, map, set, sequence, string, debug_string };
|
||||||
|
|
||||||
|
namespace detail {
|
||||||
|
template <typename T> struct range_format_kind_ {
|
||||||
|
static constexpr auto value = std::is_same<range_reference_type<T>, T>::value
|
||||||
|
? range_format::disabled
|
||||||
|
: is_map<T>::value ? range_format::map
|
||||||
|
: is_set<T>::value ? range_format::set
|
||||||
|
: range_format::sequence;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <range_format K, typename R, typename Char, typename Enable = void>
|
||||||
|
struct range_default_formatter;
|
||||||
|
|
||||||
|
template <range_format K>
|
||||||
|
using range_format_constant = std::integral_constant<range_format, K>;
|
||||||
|
|
||||||
|
template <range_format K, typename R, typename Char>
|
||||||
|
struct range_default_formatter<
|
||||||
|
K, R, Char,
|
||||||
|
enable_if_t<(K == range_format::sequence || K == range_format::map ||
|
||||||
|
K == range_format::set)>> {
|
||||||
|
using range_type = detail::maybe_const_range<R>;
|
||||||
|
range_formatter<detail::uncvref_type<range_type>, Char> underlying_;
|
||||||
|
|
||||||
|
FMT_CONSTEXPR range_default_formatter() { init(range_format_constant<K>()); }
|
||||||
|
|
||||||
|
FMT_CONSTEXPR void init(range_format_constant<range_format::set>) {
|
||||||
|
underlying_.set_brackets(detail::string_literal<Char, '{'>{},
|
||||||
|
detail::string_literal<Char, '}'>{});
|
||||||
|
}
|
||||||
|
|
||||||
|
FMT_CONSTEXPR void init(range_format_constant<range_format::map>) {
|
||||||
|
underlying_.set_brackets(detail::string_literal<Char, '{'>{},
|
||||||
|
detail::string_literal<Char, '}'>{});
|
||||||
|
underlying_.underlying().set_brackets({}, {});
|
||||||
|
underlying_.underlying().set_separator(
|
||||||
|
detail::string_literal<Char, ':', ' '>{});
|
||||||
|
}
|
||||||
|
|
||||||
|
FMT_CONSTEXPR void init(range_format_constant<range_format::sequence>) {}
|
||||||
|
|
||||||
|
template <typename ParseContext>
|
||||||
|
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
||||||
|
return underlying_.parse(ctx);
|
||||||
|
}
|
||||||
|
|
||||||
template <typename FormatContext>
|
template <typename FormatContext>
|
||||||
typename FormatContext::iterator format(
|
auto format(range_type& range, FormatContext& ctx) const
|
||||||
const tuple_arg_join<Char, T...>& value, FormatContext& ctx) {
|
-> decltype(ctx.out()) {
|
||||||
return format(value, ctx, internal::make_index_sequence<sizeof...(T)>{});
|
return underlying_.format(range, ctx);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
template <typename T, typename Char, typename Enable = void>
|
||||||
|
struct range_format_kind
|
||||||
|
: conditional_t<
|
||||||
|
is_range<T, Char>::value, detail::range_format_kind_<T>,
|
||||||
|
std::integral_constant<range_format, range_format::disabled>> {};
|
||||||
|
|
||||||
|
template <typename R, typename Char>
|
||||||
|
struct formatter<
|
||||||
|
R, Char,
|
||||||
|
enable_if_t<conjunction<bool_constant<range_format_kind<R, Char>::value !=
|
||||||
|
range_format::disabled>
|
||||||
|
// Workaround a bug in MSVC 2015 and earlier.
|
||||||
|
#if !FMT_MSC_VERSION || FMT_MSC_VERSION >= 1910
|
||||||
|
,
|
||||||
|
detail::is_formattable_delayed<R, Char>
|
||||||
|
#endif
|
||||||
|
>::value>>
|
||||||
|
: detail::range_default_formatter<range_format_kind<R, Char>::value, R,
|
||||||
|
Char> {
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Char, typename... T> struct tuple_join_view : detail::view {
|
||||||
|
const std::tuple<T...>& tuple;
|
||||||
|
basic_string_view<Char> sep;
|
||||||
|
|
||||||
|
tuple_join_view(const std::tuple<T...>& t, basic_string_view<Char> s)
|
||||||
|
: tuple(t), sep{s} {}
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Char, typename... T>
|
||||||
|
using tuple_arg_join = tuple_join_view<Char, T...>;
|
||||||
|
|
||||||
|
// Define FMT_TUPLE_JOIN_SPECIFIERS to enable experimental format specifiers
|
||||||
|
// support in tuple_join. It is disabled by default because of issues with
|
||||||
|
// the dynamic width and precision.
|
||||||
|
#ifndef FMT_TUPLE_JOIN_SPECIFIERS
|
||||||
|
# define FMT_TUPLE_JOIN_SPECIFIERS 0
|
||||||
|
#endif
|
||||||
|
|
||||||
|
template <typename Char, typename... T>
|
||||||
|
struct formatter<tuple_join_view<Char, T...>, Char> {
|
||||||
|
template <typename ParseContext>
|
||||||
|
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
||||||
|
return do_parse(ctx, std::integral_constant<size_t, sizeof...(T)>());
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename FormatContext>
|
||||||
|
auto format(const tuple_join_view<Char, T...>& value,
|
||||||
|
FormatContext& ctx) const -> typename FormatContext::iterator {
|
||||||
|
return do_format(value, ctx,
|
||||||
|
std::integral_constant<size_t, sizeof...(T)>());
|
||||||
}
|
}
|
||||||
|
|
||||||
private:
|
private:
|
||||||
template <typename FormatContext, size_t... N>
|
std::tuple<formatter<typename std::decay<T>::type, Char>...> formatters_;
|
||||||
typename FormatContext::iterator format(
|
|
||||||
const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
|
template <typename ParseContext>
|
||||||
internal::index_sequence<N...>) {
|
FMT_CONSTEXPR auto do_parse(ParseContext& ctx,
|
||||||
return format_args(value, ctx, std::get<N>(value.tuple)...);
|
std::integral_constant<size_t, 0>)
|
||||||
|
-> decltype(ctx.begin()) {
|
||||||
|
return ctx.begin();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename ParseContext, size_t N>
|
||||||
|
FMT_CONSTEXPR auto do_parse(ParseContext& ctx,
|
||||||
|
std::integral_constant<size_t, N>)
|
||||||
|
-> decltype(ctx.begin()) {
|
||||||
|
auto end = ctx.begin();
|
||||||
|
#if FMT_TUPLE_JOIN_SPECIFIERS
|
||||||
|
end = std::get<sizeof...(T) - N>(formatters_).parse(ctx);
|
||||||
|
if (N > 1) {
|
||||||
|
auto end1 = do_parse(ctx, std::integral_constant<size_t, N - 1>());
|
||||||
|
if (end != end1)
|
||||||
|
FMT_THROW(format_error("incompatible format specs for tuple elements"));
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
return end;
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename FormatContext>
|
template <typename FormatContext>
|
||||||
typename FormatContext::iterator format_args(
|
auto do_format(const tuple_join_view<Char, T...>&, FormatContext& ctx,
|
||||||
const tuple_arg_join<Char, T...>&, FormatContext& ctx) {
|
std::integral_constant<size_t, 0>) const ->
|
||||||
// NOTE: for compilers that support C++17, this empty function instantiation
|
typename FormatContext::iterator {
|
||||||
// can be replaced with a constexpr branch in the variadic overload.
|
|
||||||
return ctx.out();
|
return ctx.out();
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename FormatContext, typename Arg, typename... Args>
|
template <typename FormatContext, size_t N>
|
||||||
typename FormatContext::iterator format_args(
|
auto do_format(const tuple_join_view<Char, T...>& value, FormatContext& ctx,
|
||||||
const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
|
std::integral_constant<size_t, N>) const ->
|
||||||
const Arg& arg, const Args&... args) {
|
typename FormatContext::iterator {
|
||||||
using base = formatter<typename std::decay<Arg>::type, Char>;
|
auto out = std::get<sizeof...(T) - N>(formatters_)
|
||||||
auto out = ctx.out();
|
.format(std::get<sizeof...(T) - N>(value.tuple), ctx);
|
||||||
out = base{}.format(arg, ctx);
|
if (N > 1) {
|
||||||
if (sizeof...(Args) > 0) {
|
|
||||||
out = std::copy(value.sep.begin(), value.sep.end(), out);
|
out = std::copy(value.sep.begin(), value.sep.end(), out);
|
||||||
ctx.advance_to(out);
|
ctx.advance_to(out);
|
||||||
return format_args(value, ctx, args...);
|
return do_format(value, ctx, std::integral_constant<size_t, N - 1>());
|
||||||
}
|
}
|
||||||
return out;
|
return out;
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT_BEGIN
|
||||||
|
|
||||||
/**
|
/**
|
||||||
\rst
|
\rst
|
||||||
Returns an object that formats `tuple` with elements separated by `sep`.
|
Returns an object that formats `tuple` with elements separated by `sep`.
|
||||||
@ -348,14 +687,15 @@ struct formatter<tuple_arg_join<Char, T...>, Char> {
|
|||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename... T>
|
template <typename... T>
|
||||||
FMT_CONSTEXPR tuple_arg_join<char, T...> join(const std::tuple<T...>& tuple,
|
FMT_CONSTEXPR auto join(const std::tuple<T...>& tuple, string_view sep)
|
||||||
string_view sep) {
|
-> tuple_join_view<char, T...> {
|
||||||
return {tuple, sep};
|
return {tuple, sep};
|
||||||
}
|
}
|
||||||
|
|
||||||
template <typename... T>
|
template <typename... T>
|
||||||
FMT_CONSTEXPR tuple_arg_join<wchar_t, T...> join(const std::tuple<T...>& tuple,
|
FMT_CONSTEXPR auto join(const std::tuple<T...>& tuple,
|
||||||
wstring_view sep) {
|
basic_string_view<wchar_t> sep)
|
||||||
|
-> tuple_join_view<wchar_t, T...> {
|
||||||
return {tuple, sep};
|
return {tuple, sep};
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -371,17 +711,12 @@ FMT_CONSTEXPR tuple_arg_join<wchar_t, T...> join(const std::tuple<T...>& tuple,
|
|||||||
\endrst
|
\endrst
|
||||||
*/
|
*/
|
||||||
template <typename T>
|
template <typename T>
|
||||||
arg_join<internal::iterator_t<const std::initializer_list<T>>, char> join(
|
auto join(std::initializer_list<T> list, string_view sep)
|
||||||
std::initializer_list<T> list, string_view sep) {
|
-> join_view<const T*, const T*> {
|
||||||
return join(std::begin(list), std::end(list), sep);
|
|
||||||
}
|
|
||||||
|
|
||||||
template <typename T>
|
|
||||||
arg_join<internal::iterator_t<const std::initializer_list<T>>, wchar_t> join(
|
|
||||||
std::initializer_list<T> list, wstring_view sep) {
|
|
||||||
return join(std::begin(list), std::end(list), sep);
|
return join(std::begin(list), std::end(list), sep);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT_END
|
||||||
FMT_END_NAMESPACE
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
#endif // FMT_RANGES_H_
|
#endif // FMT_RANGES_H_
|
||||||
|
171
externals/fmt/include/fmt/std.h
vendored
Normal file
171
externals/fmt/include/fmt/std.h
vendored
Normal file
@ -0,0 +1,171 @@
|
|||||||
|
// Formatting library for C++ - formatters for standard library types
|
||||||
|
//
|
||||||
|
// Copyright (c) 2012 - present, Victor Zverovich
|
||||||
|
// All rights reserved.
|
||||||
|
//
|
||||||
|
// For the license information refer to format.h.
|
||||||
|
|
||||||
|
#ifndef FMT_STD_H_
|
||||||
|
#define FMT_STD_H_
|
||||||
|
|
||||||
|
#include <thread>
|
||||||
|
#include <type_traits>
|
||||||
|
#include <utility>
|
||||||
|
|
||||||
|
#include "ostream.h"
|
||||||
|
|
||||||
|
#if FMT_HAS_INCLUDE(<version>)
|
||||||
|
# include <version>
|
||||||
|
#endif
|
||||||
|
// Checking FMT_CPLUSPLUS for warning suppression in MSVC.
|
||||||
|
#if FMT_CPLUSPLUS >= 201703L
|
||||||
|
# if FMT_HAS_INCLUDE(<filesystem>)
|
||||||
|
# include <filesystem>
|
||||||
|
# endif
|
||||||
|
# if FMT_HAS_INCLUDE(<variant>)
|
||||||
|
# include <variant>
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#ifdef __cpp_lib_filesystem
|
||||||
|
FMT_BEGIN_NAMESPACE
|
||||||
|
|
||||||
|
namespace detail {
|
||||||
|
|
||||||
|
template <typename Char>
|
||||||
|
void write_escaped_path(basic_memory_buffer<Char>& quoted,
|
||||||
|
const std::filesystem::path& p) {
|
||||||
|
write_escaped_string<Char>(std::back_inserter(quoted), p.string<Char>());
|
||||||
|
}
|
||||||
|
# ifdef _WIN32
|
||||||
|
template <>
|
||||||
|
inline void write_escaped_path<char>(basic_memory_buffer<char>& quoted,
|
||||||
|
const std::filesystem::path& p) {
|
||||||
|
auto s = p.u8string();
|
||||||
|
write_escaped_string<char>(
|
||||||
|
std::back_inserter(quoted),
|
||||||
|
string_view(reinterpret_cast<const char*>(s.c_str()), s.size()));
|
||||||
|
}
|
||||||
|
# endif
|
||||||
|
template <>
|
||||||
|
inline void write_escaped_path<std::filesystem::path::value_type>(
|
||||||
|
basic_memory_buffer<std::filesystem::path::value_type>& quoted,
|
||||||
|
const std::filesystem::path& p) {
|
||||||
|
write_escaped_string<std::filesystem::path::value_type>(
|
||||||
|
std::back_inserter(quoted), p.native());
|
||||||
|
}
|
||||||
|
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
template <typename Char>
|
||||||
|
struct formatter<std::filesystem::path, Char>
|
||||||
|
: formatter<basic_string_view<Char>> {
|
||||||
|
template <typename FormatContext>
|
||||||
|
auto format(const std::filesystem::path& p, FormatContext& ctx) const ->
|
||||||
|
typename FormatContext::iterator {
|
||||||
|
basic_memory_buffer<Char> quoted;
|
||||||
|
detail::write_escaped_path(quoted, p);
|
||||||
|
return formatter<basic_string_view<Char>>::format(
|
||||||
|
basic_string_view<Char>(quoted.data(), quoted.size()), ctx);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
FMT_END_NAMESPACE
|
||||||
|
#endif
|
||||||
|
|
||||||
|
FMT_BEGIN_NAMESPACE
|
||||||
|
template <typename Char>
|
||||||
|
struct formatter<std::thread::id, Char> : basic_ostream_formatter<Char> {};
|
||||||
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
|
#ifdef __cpp_lib_variant
|
||||||
|
FMT_BEGIN_NAMESPACE
|
||||||
|
template <typename Char> struct formatter<std::monostate, Char> {
|
||||||
|
template <typename ParseContext>
|
||||||
|
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
||||||
|
return ctx.begin();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename FormatContext>
|
||||||
|
auto format(const std::monostate&, FormatContext& ctx) const
|
||||||
|
-> decltype(ctx.out()) {
|
||||||
|
auto out = ctx.out();
|
||||||
|
out = detail::write<Char>(out, "monostate");
|
||||||
|
return out;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
namespace detail {
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
using variant_index_sequence =
|
||||||
|
std::make_index_sequence<std::variant_size<T>::value>;
|
||||||
|
|
||||||
|
// variant_size and variant_alternative check.
|
||||||
|
template <typename T, typename U = void>
|
||||||
|
struct is_variant_like_ : std::false_type {};
|
||||||
|
template <typename T>
|
||||||
|
struct is_variant_like_<T, std::void_t<decltype(std::variant_size<T>::value)>>
|
||||||
|
: std::true_type {};
|
||||||
|
|
||||||
|
// formattable element check
|
||||||
|
template <typename T, typename C> class is_variant_formattable_ {
|
||||||
|
template <std::size_t... I>
|
||||||
|
static std::conjunction<
|
||||||
|
is_formattable<std::variant_alternative_t<I, T>, C>...>
|
||||||
|
check(std::index_sequence<I...>);
|
||||||
|
|
||||||
|
public:
|
||||||
|
static constexpr const bool value =
|
||||||
|
decltype(check(variant_index_sequence<T>{}))::value;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Char, typename OutputIt, typename T>
|
||||||
|
auto write_variant_alternative(OutputIt out, const T& v) -> OutputIt {
|
||||||
|
if constexpr (is_string<T>::value)
|
||||||
|
return write_escaped_string<Char>(out, detail::to_string_view(v));
|
||||||
|
else if constexpr (std::is_same_v<T, Char>)
|
||||||
|
return write_escaped_char(out, v);
|
||||||
|
else
|
||||||
|
return write<Char>(out, v);
|
||||||
|
}
|
||||||
|
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
template <typename T> struct is_variant_like {
|
||||||
|
static constexpr const bool value = detail::is_variant_like_<T>::value;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename T, typename C> struct is_variant_formattable {
|
||||||
|
static constexpr const bool value =
|
||||||
|
detail::is_variant_formattable_<T, C>::value;
|
||||||
|
};
|
||||||
|
|
||||||
|
template <typename Variant, typename Char>
|
||||||
|
struct formatter<
|
||||||
|
Variant, Char,
|
||||||
|
std::enable_if_t<std::conjunction_v<
|
||||||
|
is_variant_like<Variant>, is_variant_formattable<Variant, Char>>>> {
|
||||||
|
template <typename ParseContext>
|
||||||
|
FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
|
||||||
|
return ctx.begin();
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename FormatContext>
|
||||||
|
auto format(const Variant& value, FormatContext& ctx) const
|
||||||
|
-> decltype(ctx.out()) {
|
||||||
|
auto out = ctx.out();
|
||||||
|
|
||||||
|
out = detail::write<Char>(out, "variant(");
|
||||||
|
std::visit(
|
||||||
|
[&](const auto& v) {
|
||||||
|
out = detail::write_variant_alternative<Char>(out, v);
|
||||||
|
},
|
||||||
|
value);
|
||||||
|
*out++ = ')';
|
||||||
|
return out;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
FMT_END_NAMESPACE
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#endif // FMT_STD_H_
|
229
externals/fmt/include/fmt/xchar.h
vendored
Normal file
229
externals/fmt/include/fmt/xchar.h
vendored
Normal file
@ -0,0 +1,229 @@
|
|||||||
|
// Formatting library for C++ - optional wchar_t and exotic character support
|
||||||
|
//
|
||||||
|
// Copyright (c) 2012 - present, Victor Zverovich
|
||||||
|
// All rights reserved.
|
||||||
|
//
|
||||||
|
// For the license information refer to format.h.
|
||||||
|
|
||||||
|
#ifndef FMT_XCHAR_H_
|
||||||
|
#define FMT_XCHAR_H_
|
||||||
|
|
||||||
|
#include <cwchar>
|
||||||
|
|
||||||
|
#include "format.h"
|
||||||
|
|
||||||
|
FMT_BEGIN_NAMESPACE
|
||||||
|
namespace detail {
|
||||||
|
template <typename T>
|
||||||
|
using is_exotic_char = bool_constant<!std::is_same<T, char>::value>;
|
||||||
|
}
|
||||||
|
|
||||||
|
FMT_MODULE_EXPORT_BEGIN
|
||||||
|
|
||||||
|
using wstring_view = basic_string_view<wchar_t>;
|
||||||
|
using wformat_parse_context = basic_format_parse_context<wchar_t>;
|
||||||
|
using wformat_context = buffer_context<wchar_t>;
|
||||||
|
using wformat_args = basic_format_args<wformat_context>;
|
||||||
|
using wmemory_buffer = basic_memory_buffer<wchar_t>;
|
||||||
|
|
||||||
|
#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409
|
||||||
|
// Workaround broken conversion on older gcc.
|
||||||
|
template <typename... Args> using wformat_string = wstring_view;
|
||||||
|
inline auto runtime(wstring_view s) -> wstring_view { return s; }
|
||||||
|
#else
|
||||||
|
template <typename... Args>
|
||||||
|
using wformat_string = basic_format_string<wchar_t, type_identity_t<Args>...>;
|
||||||
|
inline auto runtime(wstring_view s) -> basic_runtime<wchar_t> { return {{s}}; }
|
||||||
|
#endif
|
||||||
|
|
||||||
|
template <> struct is_char<wchar_t> : std::true_type {};
|
||||||
|
template <> struct is_char<detail::char8_type> : std::true_type {};
|
||||||
|
template <> struct is_char<char16_t> : std::true_type {};
|
||||||
|
template <> struct is_char<char32_t> : std::true_type {};
|
||||||
|
|
||||||
|
template <typename... Args>
|
||||||
|
constexpr format_arg_store<wformat_context, Args...> make_wformat_args(
|
||||||
|
const Args&... args) {
|
||||||
|
return {args...};
|
||||||
|
}
|
||||||
|
|
||||||
|
inline namespace literals {
|
||||||
|
#if FMT_USE_USER_DEFINED_LITERALS && !FMT_USE_NONTYPE_TEMPLATE_ARGS
|
||||||
|
constexpr detail::udl_arg<wchar_t> operator"" _a(const wchar_t* s, size_t) {
|
||||||
|
return {s};
|
||||||
|
}
|
||||||
|
#endif
|
||||||
|
} // namespace literals
|
||||||
|
|
||||||
|
template <typename It, typename Sentinel>
|
||||||
|
auto join(It begin, Sentinel end, wstring_view sep)
|
||||||
|
-> join_view<It, Sentinel, wchar_t> {
|
||||||
|
return {begin, end, sep};
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Range>
|
||||||
|
auto join(Range&& range, wstring_view sep)
|
||||||
|
-> join_view<detail::iterator_t<Range>, detail::sentinel_t<Range>,
|
||||||
|
wchar_t> {
|
||||||
|
return join(std::begin(range), std::end(range), sep);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
auto join(std::initializer_list<T> list, wstring_view sep)
|
||||||
|
-> join_view<const T*, const T*, wchar_t> {
|
||||||
|
return join(std::begin(list), std::end(list), sep);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Char, FMT_ENABLE_IF(!std::is_same<Char, char>::value)>
|
||||||
|
auto vformat(basic_string_view<Char> format_str,
|
||||||
|
basic_format_args<buffer_context<type_identity_t<Char>>> args)
|
||||||
|
-> std::basic_string<Char> {
|
||||||
|
basic_memory_buffer<Char> buffer;
|
||||||
|
detail::vformat_to(buffer, format_str, args);
|
||||||
|
return to_string(buffer);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename... T>
|
||||||
|
auto format(wformat_string<T...> fmt, T&&... args) -> std::wstring {
|
||||||
|
return vformat(fmt::wstring_view(fmt), fmt::make_wformat_args(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
// Pass char_t as a default template parameter instead of using
|
||||||
|
// std::basic_string<char_t<S>> to reduce the symbol size.
|
||||||
|
template <typename S, typename... Args, typename Char = char_t<S>,
|
||||||
|
FMT_ENABLE_IF(!std::is_same<Char, char>::value &&
|
||||||
|
!std::is_same<Char, wchar_t>::value)>
|
||||||
|
auto format(const S& format_str, Args&&... args) -> std::basic_string<Char> {
|
||||||
|
return vformat(detail::to_string_view(format_str),
|
||||||
|
fmt::make_format_args<buffer_context<Char>>(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Locale, typename S, typename Char = char_t<S>,
|
||||||
|
FMT_ENABLE_IF(detail::is_locale<Locale>::value&&
|
||||||
|
detail::is_exotic_char<Char>::value)>
|
||||||
|
inline auto vformat(
|
||||||
|
const Locale& loc, const S& format_str,
|
||||||
|
basic_format_args<buffer_context<type_identity_t<Char>>> args)
|
||||||
|
-> std::basic_string<Char> {
|
||||||
|
return detail::vformat(loc, detail::to_string_view(format_str), args);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Locale, typename S, typename... Args,
|
||||||
|
typename Char = char_t<S>,
|
||||||
|
FMT_ENABLE_IF(detail::is_locale<Locale>::value&&
|
||||||
|
detail::is_exotic_char<Char>::value)>
|
||||||
|
inline auto format(const Locale& loc, const S& format_str, Args&&... args)
|
||||||
|
-> std::basic_string<Char> {
|
||||||
|
return detail::vformat(loc, detail::to_string_view(format_str),
|
||||||
|
fmt::make_format_args<buffer_context<Char>>(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename OutputIt, typename S, typename Char = char_t<S>,
|
||||||
|
FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
|
||||||
|
detail::is_exotic_char<Char>::value)>
|
||||||
|
auto vformat_to(OutputIt out, const S& format_str,
|
||||||
|
basic_format_args<buffer_context<type_identity_t<Char>>> args)
|
||||||
|
-> OutputIt {
|
||||||
|
auto&& buf = detail::get_buffer<Char>(out);
|
||||||
|
detail::vformat_to(buf, detail::to_string_view(format_str), args);
|
||||||
|
return detail::get_iterator(buf);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename OutputIt, typename S, typename... Args,
|
||||||
|
typename Char = char_t<S>,
|
||||||
|
FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
|
||||||
|
detail::is_exotic_char<Char>::value)>
|
||||||
|
inline auto format_to(OutputIt out, const S& fmt, Args&&... args) -> OutputIt {
|
||||||
|
return vformat_to(out, detail::to_string_view(fmt),
|
||||||
|
fmt::make_format_args<buffer_context<Char>>(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename Locale, typename S, typename OutputIt, typename... Args,
|
||||||
|
typename Char = char_t<S>,
|
||||||
|
FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
|
||||||
|
detail::is_locale<Locale>::value&&
|
||||||
|
detail::is_exotic_char<Char>::value)>
|
||||||
|
inline auto vformat_to(
|
||||||
|
OutputIt out, const Locale& loc, const S& format_str,
|
||||||
|
basic_format_args<buffer_context<type_identity_t<Char>>> args) -> OutputIt {
|
||||||
|
auto&& buf = detail::get_buffer<Char>(out);
|
||||||
|
vformat_to(buf, detail::to_string_view(format_str), args,
|
||||||
|
detail::locale_ref(loc));
|
||||||
|
return detail::get_iterator(buf);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <
|
||||||
|
typename OutputIt, typename Locale, typename S, typename... Args,
|
||||||
|
typename Char = char_t<S>,
|
||||||
|
bool enable = detail::is_output_iterator<OutputIt, Char>::value&&
|
||||||
|
detail::is_locale<Locale>::value&& detail::is_exotic_char<Char>::value>
|
||||||
|
inline auto format_to(OutputIt out, const Locale& loc, const S& format_str,
|
||||||
|
Args&&... args) ->
|
||||||
|
typename std::enable_if<enable, OutputIt>::type {
|
||||||
|
return vformat_to(out, loc, to_string_view(format_str),
|
||||||
|
fmt::make_format_args<buffer_context<Char>>(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename OutputIt, typename Char, typename... Args,
|
||||||
|
FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
|
||||||
|
detail::is_exotic_char<Char>::value)>
|
||||||
|
inline auto vformat_to_n(
|
||||||
|
OutputIt out, size_t n, basic_string_view<Char> format_str,
|
||||||
|
basic_format_args<buffer_context<type_identity_t<Char>>> args)
|
||||||
|
-> format_to_n_result<OutputIt> {
|
||||||
|
detail::iterator_buffer<OutputIt, Char, detail::fixed_buffer_traits> buf(out,
|
||||||
|
n);
|
||||||
|
detail::vformat_to(buf, format_str, args);
|
||||||
|
return {buf.out(), buf.count()};
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename OutputIt, typename S, typename... Args,
|
||||||
|
typename Char = char_t<S>,
|
||||||
|
FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
|
||||||
|
detail::is_exotic_char<Char>::value)>
|
||||||
|
inline auto format_to_n(OutputIt out, size_t n, const S& fmt,
|
||||||
|
const Args&... args) -> format_to_n_result<OutputIt> {
|
||||||
|
return vformat_to_n(out, n, detail::to_string_view(fmt),
|
||||||
|
fmt::make_format_args<buffer_context<Char>>(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename S, typename... Args, typename Char = char_t<S>,
|
||||||
|
FMT_ENABLE_IF(detail::is_exotic_char<Char>::value)>
|
||||||
|
inline auto formatted_size(const S& fmt, Args&&... args) -> size_t {
|
||||||
|
detail::counting_buffer<Char> buf;
|
||||||
|
detail::vformat_to(buf, detail::to_string_view(fmt),
|
||||||
|
fmt::make_format_args<buffer_context<Char>>(args...));
|
||||||
|
return buf.count();
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void vprint(std::FILE* f, wstring_view fmt, wformat_args args) {
|
||||||
|
wmemory_buffer buffer;
|
||||||
|
detail::vformat_to(buffer, fmt, args);
|
||||||
|
buffer.push_back(L'\0');
|
||||||
|
if (std::fputws(buffer.data(), f) == -1)
|
||||||
|
FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
|
||||||
|
}
|
||||||
|
|
||||||
|
inline void vprint(wstring_view fmt, wformat_args args) {
|
||||||
|
vprint(stdout, fmt, args);
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename... T>
|
||||||
|
void print(std::FILE* f, wformat_string<T...> fmt, T&&... args) {
|
||||||
|
return vprint(f, wstring_view(fmt), fmt::make_wformat_args(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
template <typename... T> void print(wformat_string<T...> fmt, T&&... args) {
|
||||||
|
return vprint(wstring_view(fmt), fmt::make_wformat_args(args...));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
Converts *value* to ``std::wstring`` using the default format for type *T*.
|
||||||
|
*/
|
||||||
|
template <typename T> inline auto to_wstring(const T& value) -> std::wstring {
|
||||||
|
return format(FMT_STRING(L"{}"), value);
|
||||||
|
}
|
||||||
|
FMT_MODULE_EXPORT_END
|
||||||
|
FMT_END_NAMESPACE
|
||||||
|
|
||||||
|
#endif // FMT_XCHAR_H_
|
99
externals/fmt/src/fmt.cc
vendored
Normal file
99
externals/fmt/src/fmt.cc
vendored
Normal file
@ -0,0 +1,99 @@
|
|||||||
|
module;
|
||||||
|
#ifndef __cpp_modules
|
||||||
|
# error Module not supported.
|
||||||
|
#endif
|
||||||
|
|
||||||
|
// put all implementation-provided headers into the global module fragment
|
||||||
|
// to prevent attachment to this module
|
||||||
|
#if !defined(_CRT_SECURE_NO_WARNINGS) && defined(_MSC_VER)
|
||||||
|
# define _CRT_SECURE_NO_WARNINGS
|
||||||
|
#endif
|
||||||
|
#if !defined(WIN32_LEAN_AND_MEAN) && defined(_WIN32)
|
||||||
|
# define WIN32_LEAN_AND_MEAN
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <algorithm>
|
||||||
|
#include <cctype>
|
||||||
|
#include <cerrno>
|
||||||
|
#include <chrono>
|
||||||
|
#include <climits>
|
||||||
|
#include <clocale>
|
||||||
|
#include <cmath>
|
||||||
|
#include <cstdarg>
|
||||||
|
#include <cstddef>
|
||||||
|
#include <cstdint>
|
||||||
|
#include <cstdio>
|
||||||
|
#include <cstdlib>
|
||||||
|
#include <cstring>
|
||||||
|
#include <ctime>
|
||||||
|
#include <cwchar>
|
||||||
|
#include <exception>
|
||||||
|
#include <functional>
|
||||||
|
#include <iterator>
|
||||||
|
#include <limits>
|
||||||
|
#include <locale>
|
||||||
|
#include <memory>
|
||||||
|
#include <ostream>
|
||||||
|
#include <sstream>
|
||||||
|
#include <stdexcept>
|
||||||
|
#include <string>
|
||||||
|
#include <string_view>
|
||||||
|
#include <system_error>
|
||||||
|
#include <type_traits>
|
||||||
|
#include <utility>
|
||||||
|
#include <vector>
|
||||||
|
|
||||||
|
#if _MSC_VER
|
||||||
|
# include <intrin.h>
|
||||||
|
#endif
|
||||||
|
#if defined __APPLE__ || defined(__FreeBSD__)
|
||||||
|
# include <xlocale.h>
|
||||||
|
#endif
|
||||||
|
#if __has_include(<winapifamily.h>)
|
||||||
|
# include <winapifamily.h>
|
||||||
|
#endif
|
||||||
|
#if (__has_include(<fcntl.h>) || defined(__APPLE__) || \
|
||||||
|
defined(__linux__)) && \
|
||||||
|
(!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
|
||||||
|
# include <fcntl.h>
|
||||||
|
# include <sys/stat.h>
|
||||||
|
# include <sys/types.h>
|
||||||
|
# ifndef _WIN32
|
||||||
|
# include <unistd.h>
|
||||||
|
# else
|
||||||
|
# include <io.h>
|
||||||
|
# endif
|
||||||
|
#endif
|
||||||
|
#ifdef _WIN32
|
||||||
|
# include <windows.h>
|
||||||
|
#endif
|
||||||
|
|
||||||
|
export module fmt;
|
||||||
|
|
||||||
|
#define FMT_MODULE_EXPORT export
|
||||||
|
#define FMT_MODULE_EXPORT_BEGIN export {
|
||||||
|
#define FMT_MODULE_EXPORT_END }
|
||||||
|
#define FMT_BEGIN_DETAIL_NAMESPACE \
|
||||||
|
} \
|
||||||
|
namespace detail {
|
||||||
|
#define FMT_END_DETAIL_NAMESPACE \
|
||||||
|
} \
|
||||||
|
export {
|
||||||
|
// all library-provided declarations and definitions
|
||||||
|
// must be in the module purview to be exported
|
||||||
|
#include "fmt/args.h"
|
||||||
|
#include "fmt/chrono.h"
|
||||||
|
#include "fmt/color.h"
|
||||||
|
#include "fmt/compile.h"
|
||||||
|
#include "fmt/format.h"
|
||||||
|
#include "fmt/os.h"
|
||||||
|
#include "fmt/printf.h"
|
||||||
|
#include "fmt/xchar.h"
|
||||||
|
|
||||||
|
// gcc doesn't yet implement private module fragments
|
||||||
|
#if !FMT_GCC_VERSION
|
||||||
|
module : private;
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include "format.cc"
|
||||||
|
#include "os.cc"
|
173
externals/fmt/src/format.cc
vendored
173
externals/fmt/src/format.cc
vendored
@ -8,169 +8,40 @@
|
|||||||
#include "fmt/format-inl.h"
|
#include "fmt/format-inl.h"
|
||||||
|
|
||||||
FMT_BEGIN_NAMESPACE
|
FMT_BEGIN_NAMESPACE
|
||||||
namespace internal {
|
namespace detail {
|
||||||
|
|
||||||
template <typename T>
|
template FMT_API auto dragonbox::to_decimal(float x) noexcept
|
||||||
int format_float(char* buf, std::size_t size, const char* format, int precision,
|
-> dragonbox::decimal_fp<float>;
|
||||||
T value) {
|
template FMT_API auto dragonbox::to_decimal(double x) noexcept
|
||||||
#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
|
-> dragonbox::decimal_fp<double>;
|
||||||
if (precision > 100000)
|
|
||||||
throw std::runtime_error(
|
|
||||||
"fuzz mode - avoid large allocation inside snprintf");
|
|
||||||
#endif
|
|
||||||
// Suppress the warning about nonliteral format string.
|
|
||||||
int (*snprintf_ptr)(char*, size_t, const char*, ...) = FMT_SNPRINTF;
|
|
||||||
return precision < 0 ? snprintf_ptr(buf, size, format, value)
|
|
||||||
: snprintf_ptr(buf, size, format, precision, value);
|
|
||||||
}
|
|
||||||
struct sprintf_specs {
|
|
||||||
int precision;
|
|
||||||
char type;
|
|
||||||
bool alt : 1;
|
|
||||||
|
|
||||||
template <typename Char>
|
|
||||||
constexpr sprintf_specs(basic_format_specs<Char> specs)
|
|
||||||
: precision(specs.precision), type(specs.type), alt(specs.alt) {}
|
|
||||||
|
|
||||||
constexpr bool has_precision() const { return precision >= 0; }
|
|
||||||
};
|
|
||||||
|
|
||||||
// This is deprecated and is kept only to preserve ABI compatibility.
|
|
||||||
template <typename Double>
|
|
||||||
char* sprintf_format(Double value, internal::buffer<char>& buf,
|
|
||||||
sprintf_specs specs) {
|
|
||||||
// Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail.
|
|
||||||
FMT_ASSERT(buf.capacity() != 0, "empty buffer");
|
|
||||||
|
|
||||||
// Build format string.
|
|
||||||
enum { max_format_size = 10 }; // longest format: %#-*.*Lg
|
|
||||||
char format[max_format_size];
|
|
||||||
char* format_ptr = format;
|
|
||||||
*format_ptr++ = '%';
|
|
||||||
if (specs.alt || !specs.type) *format_ptr++ = '#';
|
|
||||||
if (specs.precision >= 0) {
|
|
||||||
*format_ptr++ = '.';
|
|
||||||
*format_ptr++ = '*';
|
|
||||||
}
|
|
||||||
if (std::is_same<Double, long double>::value) *format_ptr++ = 'L';
|
|
||||||
|
|
||||||
char type = specs.type;
|
|
||||||
|
|
||||||
if (type == '%')
|
|
||||||
type = 'f';
|
|
||||||
else if (type == 0 || type == 'n')
|
|
||||||
type = 'g';
|
|
||||||
#if FMT_MSC_VER
|
|
||||||
if (type == 'F') {
|
|
||||||
// MSVC's printf doesn't support 'F'.
|
|
||||||
type = 'f';
|
|
||||||
}
|
|
||||||
#endif
|
|
||||||
*format_ptr++ = type;
|
|
||||||
*format_ptr = '\0';
|
|
||||||
|
|
||||||
// Format using snprintf.
|
|
||||||
char* start = nullptr;
|
|
||||||
char* decimal_point_pos = nullptr;
|
|
||||||
for (;;) {
|
|
||||||
std::size_t buffer_size = buf.capacity();
|
|
||||||
start = &buf[0];
|
|
||||||
int result =
|
|
||||||
format_float(start, buffer_size, format, specs.precision, value);
|
|
||||||
if (result >= 0) {
|
|
||||||
unsigned n = internal::to_unsigned(result);
|
|
||||||
if (n < buf.capacity()) {
|
|
||||||
// Find the decimal point.
|
|
||||||
auto p = buf.data(), end = p + n;
|
|
||||||
if (*p == '+' || *p == '-') ++p;
|
|
||||||
if (specs.type != 'a' && specs.type != 'A') {
|
|
||||||
while (p < end && *p >= '0' && *p <= '9') ++p;
|
|
||||||
if (p < end && *p != 'e' && *p != 'E') {
|
|
||||||
decimal_point_pos = p;
|
|
||||||
if (!specs.type) {
|
|
||||||
// Keep only one trailing zero after the decimal point.
|
|
||||||
++p;
|
|
||||||
if (*p == '0') ++p;
|
|
||||||
while (p != end && *p >= '1' && *p <= '9') ++p;
|
|
||||||
char* where = p;
|
|
||||||
while (p != end && *p == '0') ++p;
|
|
||||||
if (p == end || *p < '0' || *p > '9') {
|
|
||||||
if (p != end) std::memmove(where, p, to_unsigned(end - p));
|
|
||||||
n -= static_cast<unsigned>(p - where);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
buf.resize(n);
|
|
||||||
break; // The buffer is large enough - continue with formatting.
|
|
||||||
}
|
|
||||||
buf.reserve(n + 1);
|
|
||||||
} else {
|
|
||||||
// If result is negative we ask to increase the capacity by at least 1,
|
|
||||||
// but as std::vector, the buffer grows exponentially.
|
|
||||||
buf.reserve(buf.capacity() + 1);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return decimal_point_pos;
|
|
||||||
}
|
|
||||||
} // namespace internal
|
|
||||||
|
|
||||||
template FMT_API char* internal::sprintf_format(double, internal::buffer<char>&,
|
|
||||||
sprintf_specs);
|
|
||||||
template FMT_API char* internal::sprintf_format(long double,
|
|
||||||
internal::buffer<char>&,
|
|
||||||
sprintf_specs);
|
|
||||||
|
|
||||||
template struct FMT_INSTANTIATION_DEF_API internal::basic_data<void>;
|
|
||||||
|
|
||||||
// Workaround a bug in MSVC2013 that prevents instantiation of format_float.
|
|
||||||
int (*instantiate_format_float)(double, int, internal::float_specs,
|
|
||||||
internal::buffer<char>&) =
|
|
||||||
internal::format_float;
|
|
||||||
|
|
||||||
#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
|
#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
|
||||||
template FMT_API internal::locale_ref::locale_ref(const std::locale& loc);
|
template FMT_API locale_ref::locale_ref(const std::locale& loc);
|
||||||
template FMT_API std::locale internal::locale_ref::get<std::locale>() const;
|
template FMT_API auto locale_ref::get<std::locale>() const -> std::locale;
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
// Explicit instantiations for char.
|
// Explicit instantiations for char.
|
||||||
|
|
||||||
template FMT_API std::string internal::grouping_impl<char>(locale_ref);
|
template FMT_API auto thousands_sep_impl(locale_ref)
|
||||||
template FMT_API char internal::thousands_sep_impl(locale_ref);
|
-> thousands_sep_result<char>;
|
||||||
template FMT_API char internal::decimal_point_impl(locale_ref);
|
template FMT_API auto decimal_point_impl(locale_ref) -> char;
|
||||||
|
|
||||||
template FMT_API void internal::buffer<char>::append(const char*, const char*);
|
template FMT_API void buffer<char>::append(const char*, const char*);
|
||||||
|
|
||||||
template FMT_API void internal::arg_map<format_context>::init(
|
// DEPRECATED!
|
||||||
const basic_format_args<format_context>& args);
|
// There is no correspondent extern template in format.h because of
|
||||||
|
// incompatibility between clang and gcc (#2377).
|
||||||
template FMT_API std::string internal::vformat<char>(
|
template FMT_API void vformat_to(buffer<char>&, string_view,
|
||||||
string_view, basic_format_args<format_context>);
|
basic_format_args<FMT_BUFFER_CONTEXT(char)>,
|
||||||
|
locale_ref);
|
||||||
template FMT_API format_context::iterator internal::vformat_to(
|
|
||||||
internal::buffer<char>&, string_view, basic_format_args<format_context>);
|
|
||||||
|
|
||||||
template FMT_API int internal::snprintf_float(double, int,
|
|
||||||
internal::float_specs,
|
|
||||||
internal::buffer<char>&);
|
|
||||||
template FMT_API int internal::snprintf_float(long double, int,
|
|
||||||
internal::float_specs,
|
|
||||||
internal::buffer<char>&);
|
|
||||||
template FMT_API int internal::format_float(double, int, internal::float_specs,
|
|
||||||
internal::buffer<char>&);
|
|
||||||
template FMT_API int internal::format_float(long double, int,
|
|
||||||
internal::float_specs,
|
|
||||||
internal::buffer<char>&);
|
|
||||||
|
|
||||||
// Explicit instantiations for wchar_t.
|
// Explicit instantiations for wchar_t.
|
||||||
|
|
||||||
template FMT_API std::string internal::grouping_impl<wchar_t>(locale_ref);
|
template FMT_API auto thousands_sep_impl(locale_ref)
|
||||||
template FMT_API wchar_t internal::thousands_sep_impl(locale_ref);
|
-> thousands_sep_result<wchar_t>;
|
||||||
template FMT_API wchar_t internal::decimal_point_impl(locale_ref);
|
template FMT_API auto decimal_point_impl(locale_ref) -> wchar_t;
|
||||||
|
|
||||||
template FMT_API void internal::buffer<wchar_t>::append(const wchar_t*,
|
template FMT_API void buffer<wchar_t>::append(const wchar_t*, const wchar_t*);
|
||||||
const wchar_t*);
|
|
||||||
|
|
||||||
template FMT_API std::wstring internal::vformat<wchar_t>(
|
} // namespace detail
|
||||||
wstring_view, basic_format_args<wformat_context>);
|
|
||||||
FMT_END_NAMESPACE
|
FMT_END_NAMESPACE
|
||||||
|
171
externals/fmt/src/os.cc
vendored
171
externals/fmt/src/os.cc
vendored
@ -25,21 +25,24 @@
|
|||||||
# define WIN32_LEAN_AND_MEAN
|
# define WIN32_LEAN_AND_MEAN
|
||||||
# endif
|
# endif
|
||||||
# include <io.h>
|
# include <io.h>
|
||||||
# include <windows.h>
|
|
||||||
|
|
||||||
# define O_CREAT _O_CREAT
|
|
||||||
# define O_TRUNC _O_TRUNC
|
|
||||||
|
|
||||||
# ifndef S_IRUSR
|
# ifndef S_IRUSR
|
||||||
# define S_IRUSR _S_IREAD
|
# define S_IRUSR _S_IREAD
|
||||||
# endif
|
# endif
|
||||||
|
|
||||||
# ifndef S_IWUSR
|
# ifndef S_IWUSR
|
||||||
# define S_IWUSR _S_IWRITE
|
# define S_IWUSR _S_IWRITE
|
||||||
# endif
|
# endif
|
||||||
|
# ifndef S_IRGRP
|
||||||
# ifdef __MINGW32__
|
# define S_IRGRP 0
|
||||||
# define _SH_DENYNO 0x40
|
# endif
|
||||||
|
# ifndef S_IWGRP
|
||||||
|
# define S_IWGRP 0
|
||||||
|
# endif
|
||||||
|
# ifndef S_IROTH
|
||||||
|
# define S_IROTH 0
|
||||||
|
# endif
|
||||||
|
# ifndef S_IWOTH
|
||||||
|
# define S_IWOTH 0
|
||||||
# endif
|
# endif
|
||||||
# endif // _WIN32
|
# endif // _WIN32
|
||||||
#endif // FMT_USE_FCNTL
|
#endif // FMT_USE_FCNTL
|
||||||
@ -48,23 +51,19 @@
|
|||||||
# include <windows.h>
|
# include <windows.h>
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#ifdef fileno
|
|
||||||
# undef fileno
|
|
||||||
#endif
|
|
||||||
|
|
||||||
namespace {
|
namespace {
|
||||||
#ifdef _WIN32
|
#ifdef _WIN32
|
||||||
// Return type of read and write functions.
|
// Return type of read and write functions.
|
||||||
using RWResult = int;
|
using rwresult = int;
|
||||||
|
|
||||||
// On Windows the count argument to read and write is unsigned, so convert
|
// On Windows the count argument to read and write is unsigned, so convert
|
||||||
// it from size_t preventing integer overflow.
|
// it from size_t preventing integer overflow.
|
||||||
inline unsigned convert_rwcount(std::size_t count) {
|
inline unsigned convert_rwcount(std::size_t count) {
|
||||||
return count <= UINT_MAX ? static_cast<unsigned>(count) : UINT_MAX;
|
return count <= UINT_MAX ? static_cast<unsigned>(count) : UINT_MAX;
|
||||||
}
|
}
|
||||||
#else
|
#elif FMT_USE_FCNTL
|
||||||
// Return type of read and write functions.
|
// Return type of read and write functions.
|
||||||
using RWResult = ssize_t;
|
using rwresult = ssize_t;
|
||||||
|
|
||||||
inline std::size_t convert_rwcount(std::size_t count) { return count; }
|
inline std::size_t convert_rwcount(std::size_t count) { return count; }
|
||||||
#endif
|
#endif
|
||||||
@ -73,14 +72,14 @@ inline std::size_t convert_rwcount(std::size_t count) { return count; }
|
|||||||
FMT_BEGIN_NAMESPACE
|
FMT_BEGIN_NAMESPACE
|
||||||
|
|
||||||
#ifdef _WIN32
|
#ifdef _WIN32
|
||||||
internal::utf16_to_utf8::utf16_to_utf8(wstring_view s) {
|
detail::utf16_to_utf8::utf16_to_utf8(basic_string_view<wchar_t> s) {
|
||||||
if (int error_code = convert(s)) {
|
if (int error_code = convert(s)) {
|
||||||
FMT_THROW(windows_error(error_code,
|
FMT_THROW(windows_error(error_code,
|
||||||
"cannot convert string from UTF-16 to UTF-8"));
|
"cannot convert string from UTF-16 to UTF-8"));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
int internal::utf16_to_utf8::convert(wstring_view s) {
|
int detail::utf16_to_utf8::convert(basic_string_view<wchar_t> s) {
|
||||||
if (s.size() > INT_MAX) return ERROR_INVALID_PARAMETER;
|
if (s.size() > INT_MAX) return ERROR_INVALID_PARAMETER;
|
||||||
int s_size = static_cast<int>(s.size());
|
int s_size = static_cast<int>(s.size());
|
||||||
if (s_size == 0) {
|
if (s_size == 0) {
|
||||||
@ -101,53 +100,90 @@ int internal::utf16_to_utf8::convert(wstring_view s) {
|
|||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
void windows_error::init(int err_code, string_view format_str,
|
namespace detail {
|
||||||
format_args args) {
|
|
||||||
error_code_ = err_code;
|
class system_message {
|
||||||
memory_buffer buffer;
|
system_message(const system_message&) = delete;
|
||||||
internal::format_windows_error(buffer, err_code, vformat(format_str, args));
|
void operator=(const system_message&) = delete;
|
||||||
std::runtime_error& base = *this;
|
|
||||||
base = std::runtime_error(to_string(buffer));
|
unsigned long result_;
|
||||||
|
wchar_t* message_;
|
||||||
|
|
||||||
|
static bool is_whitespace(wchar_t c) noexcept {
|
||||||
|
return c == L' ' || c == L'\n' || c == L'\r' || c == L'\t' || c == L'\0';
|
||||||
|
}
|
||||||
|
|
||||||
|
public:
|
||||||
|
explicit system_message(unsigned long error_code)
|
||||||
|
: result_(0), message_(nullptr) {
|
||||||
|
result_ = FormatMessageW(
|
||||||
|
FORMAT_MESSAGE_ALLOCATE_BUFFER | FORMAT_MESSAGE_FROM_SYSTEM |
|
||||||
|
FORMAT_MESSAGE_IGNORE_INSERTS,
|
||||||
|
nullptr, error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT),
|
||||||
|
reinterpret_cast<wchar_t*>(&message_), 0, nullptr);
|
||||||
|
if (result_ != 0) {
|
||||||
|
while (result_ != 0 && is_whitespace(message_[result_ - 1])) {
|
||||||
|
--result_;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
~system_message() { LocalFree(message_); }
|
||||||
|
explicit operator bool() const noexcept { return result_ != 0; }
|
||||||
|
operator basic_string_view<wchar_t>() const noexcept {
|
||||||
|
return basic_string_view<wchar_t>(message_, result_);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
class utf8_system_category final : public std::error_category {
|
||||||
|
public:
|
||||||
|
const char* name() const noexcept override { return "system"; }
|
||||||
|
std::string message(int error_code) const override {
|
||||||
|
system_message msg(error_code);
|
||||||
|
if (msg) {
|
||||||
|
utf16_to_utf8 utf8_message;
|
||||||
|
if (utf8_message.convert(msg) == ERROR_SUCCESS) {
|
||||||
|
return utf8_message.str();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return "unknown error";
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
} // namespace detail
|
||||||
|
|
||||||
|
FMT_API const std::error_category& system_category() noexcept {
|
||||||
|
static const detail::utf8_system_category category;
|
||||||
|
return category;
|
||||||
}
|
}
|
||||||
|
|
||||||
void internal::format_windows_error(internal::buffer<char>& out, int error_code,
|
std::system_error vwindows_error(int err_code, string_view format_str,
|
||||||
string_view message) FMT_NOEXCEPT {
|
format_args args) {
|
||||||
|
auto ec = std::error_code(err_code, system_category());
|
||||||
|
return std::system_error(ec, vformat(format_str, args));
|
||||||
|
}
|
||||||
|
|
||||||
|
void detail::format_windows_error(detail::buffer<char>& out, int error_code,
|
||||||
|
const char* message) noexcept {
|
||||||
FMT_TRY {
|
FMT_TRY {
|
||||||
wmemory_buffer buf;
|
system_message msg(error_code);
|
||||||
buf.resize(inline_buffer_size);
|
if (msg) {
|
||||||
for (;;) {
|
|
||||||
wchar_t* system_message = &buf[0];
|
|
||||||
int result = FormatMessageW(
|
|
||||||
FORMAT_MESSAGE_FROM_SYSTEM | FORMAT_MESSAGE_IGNORE_INSERTS, nullptr,
|
|
||||||
error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT), system_message,
|
|
||||||
static_cast<uint32_t>(buf.size()), nullptr);
|
|
||||||
if (result != 0) {
|
|
||||||
utf16_to_utf8 utf8_message;
|
utf16_to_utf8 utf8_message;
|
||||||
if (utf8_message.convert(system_message) == ERROR_SUCCESS) {
|
if (utf8_message.convert(msg) == ERROR_SUCCESS) {
|
||||||
internal::writer w(out);
|
fmt::format_to(buffer_appender<char>(out), "{}: {}", message, utf8_message);
|
||||||
w.write(message);
|
|
||||||
w.write(": ");
|
|
||||||
w.write(utf8_message);
|
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
break;
|
|
||||||
}
|
|
||||||
if (GetLastError() != ERROR_INSUFFICIENT_BUFFER)
|
|
||||||
break; // Can't get error message, report error code instead.
|
|
||||||
buf.resize(buf.size() * 2);
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
FMT_CATCH(...) {}
|
FMT_CATCH(...) {}
|
||||||
format_error_code(out, error_code, message);
|
format_error_code(out, error_code, message);
|
||||||
}
|
}
|
||||||
|
|
||||||
void report_windows_error(int error_code,
|
void report_windows_error(int error_code, const char* message) noexcept {
|
||||||
fmt::string_view message) FMT_NOEXCEPT {
|
report_error(detail::format_windows_error, error_code, message);
|
||||||
report_error(internal::format_windows_error, error_code, message);
|
|
||||||
}
|
}
|
||||||
#endif // _WIN32
|
#endif // _WIN32
|
||||||
|
|
||||||
buffered_file::~buffered_file() FMT_NOEXCEPT {
|
buffered_file::~buffered_file() noexcept {
|
||||||
if (file_ && FMT_SYSTEM(fclose(file_)) != 0)
|
if (file_ && FMT_SYSTEM(fclose(file_)) != 0)
|
||||||
report_system_error(errno, "cannot close file");
|
report_system_error(errno, "cannot close file");
|
||||||
}
|
}
|
||||||
@ -166,18 +202,19 @@ void buffered_file::close() {
|
|||||||
if (result != 0) FMT_THROW(system_error(errno, "cannot close file"));
|
if (result != 0) FMT_THROW(system_error(errno, "cannot close file"));
|
||||||
}
|
}
|
||||||
|
|
||||||
// A macro used to prevent expansion of fileno on broken versions of MinGW.
|
int buffered_file::descriptor() const {
|
||||||
#define FMT_ARGS
|
int fd = FMT_POSIX_CALL(fileno(file_));
|
||||||
|
|
||||||
int buffered_file::fileno() const {
|
|
||||||
int fd = FMT_POSIX_CALL(fileno FMT_ARGS(file_));
|
|
||||||
if (fd == -1) FMT_THROW(system_error(errno, "cannot get file descriptor"));
|
if (fd == -1) FMT_THROW(system_error(errno, "cannot get file descriptor"));
|
||||||
return fd;
|
return fd;
|
||||||
}
|
}
|
||||||
|
|
||||||
#if FMT_USE_FCNTL
|
#if FMT_USE_FCNTL
|
||||||
file::file(cstring_view path, int oflag) {
|
file::file(cstring_view path, int oflag) {
|
||||||
int mode = S_IRUSR | S_IWUSR;
|
# ifdef _WIN32
|
||||||
|
using mode_t = int;
|
||||||
|
# endif
|
||||||
|
constexpr mode_t mode =
|
||||||
|
S_IRUSR | S_IWUSR | S_IRGRP | S_IWGRP | S_IROTH | S_IWOTH;
|
||||||
# if defined(_WIN32) && !defined(__MINGW32__)
|
# if defined(_WIN32) && !defined(__MINGW32__)
|
||||||
fd_ = -1;
|
fd_ = -1;
|
||||||
FMT_POSIX_CALL(sopen_s(&fd_, path.c_str(), oflag, _SH_DENYNO, mode));
|
FMT_POSIX_CALL(sopen_s(&fd_, path.c_str(), oflag, _SH_DENYNO, mode));
|
||||||
@ -188,7 +225,7 @@ file::file(cstring_view path, int oflag) {
|
|||||||
FMT_THROW(system_error(errno, "cannot open file {}", path.c_str()));
|
FMT_THROW(system_error(errno, "cannot open file {}", path.c_str()));
|
||||||
}
|
}
|
||||||
|
|
||||||
file::~file() FMT_NOEXCEPT {
|
file::~file() noexcept {
|
||||||
// Don't retry close in case of EINTR!
|
// Don't retry close in case of EINTR!
|
||||||
// See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
|
// See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
|
||||||
if (fd_ != -1 && FMT_POSIX_CALL(close(fd_)) != 0)
|
if (fd_ != -1 && FMT_POSIX_CALL(close(fd_)) != 0)
|
||||||
@ -231,17 +268,17 @@ long long file::size() const {
|
|||||||
}
|
}
|
||||||
|
|
||||||
std::size_t file::read(void* buffer, std::size_t count) {
|
std::size_t file::read(void* buffer, std::size_t count) {
|
||||||
RWResult result = 0;
|
rwresult result = 0;
|
||||||
FMT_RETRY(result, FMT_POSIX_CALL(read(fd_, buffer, convert_rwcount(count))));
|
FMT_RETRY(result, FMT_POSIX_CALL(read(fd_, buffer, convert_rwcount(count))));
|
||||||
if (result < 0) FMT_THROW(system_error(errno, "cannot read from file"));
|
if (result < 0) FMT_THROW(system_error(errno, "cannot read from file"));
|
||||||
return internal::to_unsigned(result);
|
return detail::to_unsigned(result);
|
||||||
}
|
}
|
||||||
|
|
||||||
std::size_t file::write(const void* buffer, std::size_t count) {
|
std::size_t file::write(const void* buffer, std::size_t count) {
|
||||||
RWResult result = 0;
|
rwresult result = 0;
|
||||||
FMT_RETRY(result, FMT_POSIX_CALL(write(fd_, buffer, convert_rwcount(count))));
|
FMT_RETRY(result, FMT_POSIX_CALL(write(fd_, buffer, convert_rwcount(count))));
|
||||||
if (result < 0) FMT_THROW(system_error(errno, "cannot write to file"));
|
if (result < 0) FMT_THROW(system_error(errno, "cannot write to file"));
|
||||||
return internal::to_unsigned(result);
|
return detail::to_unsigned(result);
|
||||||
}
|
}
|
||||||
|
|
||||||
file file::dup(int fd) {
|
file file::dup(int fd) {
|
||||||
@ -262,10 +299,10 @@ void file::dup2(int fd) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
void file::dup2(int fd, error_code& ec) FMT_NOEXCEPT {
|
void file::dup2(int fd, std::error_code& ec) noexcept {
|
||||||
int result = 0;
|
int result = 0;
|
||||||
FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
|
FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
|
||||||
if (result == -1) ec = error_code(errno);
|
if (result == -1) ec = std::error_code(errno, std::generic_category());
|
||||||
}
|
}
|
||||||
|
|
||||||
void file::pipe(file& read_end, file& write_end) {
|
void file::pipe(file& read_end, file& write_end) {
|
||||||
@ -291,8 +328,12 @@ void file::pipe(file& read_end, file& write_end) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
buffered_file file::fdopen(const char* mode) {
|
buffered_file file::fdopen(const char* mode) {
|
||||||
// Don't retry as fdopen doesn't return EINTR.
|
// Don't retry as fdopen doesn't return EINTR.
|
||||||
|
# if defined(__MINGW32__) && defined(_POSIX_)
|
||||||
|
FILE* f = ::fdopen(fd_, mode);
|
||||||
|
# else
|
||||||
FILE* f = FMT_POSIX_CALL(fdopen(fd_, mode));
|
FILE* f = FMT_POSIX_CALL(fdopen(fd_, mode));
|
||||||
|
# endif
|
||||||
if (!f)
|
if (!f)
|
||||||
FMT_THROW(
|
FMT_THROW(
|
||||||
system_error(errno, "cannot associate stream with file descriptor"));
|
system_error(errno, "cannot associate stream with file descriptor"));
|
||||||
@ -312,5 +353,9 @@ long getpagesize() {
|
|||||||
return size;
|
return size;
|
||||||
# endif
|
# endif
|
||||||
}
|
}
|
||||||
|
|
||||||
|
FMT_API void ostream::grow(size_t) {
|
||||||
|
if (this->size() == this->capacity()) flush();
|
||||||
|
}
|
||||||
#endif // FMT_USE_FCNTL
|
#endif // FMT_USE_FCNTL
|
||||||
FMT_END_NAMESPACE
|
FMT_END_NAMESPACE
|
||||||
|
2
externals/fmt/support/README
vendored
2
externals/fmt/support/README
vendored
@ -2,5 +2,3 @@ This directory contains build support files such as
|
|||||||
|
|
||||||
* CMake modules
|
* CMake modules
|
||||||
* Build scripts
|
* Build scripts
|
||||||
* qmake (static build with dynamic libc only)
|
|
||||||
|
|
||||||
|
1
externals/fmt/support/Vagrantfile
vendored
1
externals/fmt/support/Vagrantfile
vendored
@ -4,6 +4,7 @@
|
|||||||
# A vagrant config for testing against gcc-4.8.
|
# A vagrant config for testing against gcc-4.8.
|
||||||
Vagrant.configure("2") do |config|
|
Vagrant.configure("2") do |config|
|
||||||
config.vm.box = "ubuntu/xenial64"
|
config.vm.box = "ubuntu/xenial64"
|
||||||
|
config.disksize.size = '15GB'
|
||||||
|
|
||||||
config.vm.provider "virtualbox" do |vb|
|
config.vm.provider "virtualbox" do |vb|
|
||||||
vb.memory = "4096"
|
vb.memory = "4096"
|
||||||
|
43
externals/fmt/support/appveyor-build.py
vendored
43
externals/fmt/support/appveyor-build.py
vendored
@ -1,43 +0,0 @@
|
|||||||
#!/usr/bin/env python
|
|
||||||
# Build the project on AppVeyor.
|
|
||||||
|
|
||||||
import os
|
|
||||||
from subprocess import check_call
|
|
||||||
|
|
||||||
build = os.environ['BUILD']
|
|
||||||
config = os.environ['CONFIGURATION']
|
|
||||||
platform = os.environ['PLATFORM']
|
|
||||||
path = os.environ['PATH']
|
|
||||||
image = os.environ['APPVEYOR_BUILD_WORKER_IMAGE']
|
|
||||||
jobid = os.environ['APPVEYOR_JOB_ID']
|
|
||||||
cmake_command = ['cmake', '-DFMT_PEDANTIC=ON', '-DCMAKE_BUILD_TYPE=' + config, '..']
|
|
||||||
if build == 'mingw':
|
|
||||||
cmake_command.append('-GMinGW Makefiles')
|
|
||||||
build_command = ['mingw32-make', '-j4']
|
|
||||||
test_command = ['mingw32-make', 'test']
|
|
||||||
# Remove the path to Git bin directory from $PATH because it breaks
|
|
||||||
# MinGW config.
|
|
||||||
path = path.replace(r'C:\Program Files (x86)\Git\bin', '')
|
|
||||||
os.environ['PATH'] = r'C:\MinGW\bin;' + path
|
|
||||||
else:
|
|
||||||
# Add MSBuild 14.0 to PATH as described in
|
|
||||||
# http://help.appveyor.com/discussions/problems/2229-v140-not-found-on-vs2105rc.
|
|
||||||
os.environ['PATH'] = r'C:\Program Files (x86)\MSBuild\15.0\Bin;' + path
|
|
||||||
if image == 'Visual Studio 2019':
|
|
||||||
generator = 'Visual Studio 16 2019'
|
|
||||||
if platform == 'x64':
|
|
||||||
cmake_command.extend(['-A', 'x64'])
|
|
||||||
else:
|
|
||||||
if image == 'Visual Studio 2015':
|
|
||||||
generator = 'Visual Studio 14 2015'
|
|
||||||
elif image == 'Visual Studio 2017':
|
|
||||||
generator = 'Visual Studio 15 2017'
|
|
||||||
if platform == 'x64':
|
|
||||||
generator += ' Win64'
|
|
||||||
cmake_command.append('-G' + generator)
|
|
||||||
build_command = ['cmake', '--build', '.', '--config', config, '--', '/m:4']
|
|
||||||
test_command = ['ctest', '-C', config]
|
|
||||||
|
|
||||||
check_call(cmake_command)
|
|
||||||
check_call(build_command)
|
|
||||||
check_call(test_command)
|
|
41
externals/fmt/support/appveyor.yml
vendored
41
externals/fmt/support/appveyor.yml
vendored
@ -1,41 +0,0 @@
|
|||||||
configuration:
|
|
||||||
- Debug
|
|
||||||
- Release
|
|
||||||
|
|
||||||
clone_depth: 1
|
|
||||||
|
|
||||||
image:
|
|
||||||
- Visual Studio 2015
|
|
||||||
- Visual Studio 2019
|
|
||||||
- Visual Studio 2017
|
|
||||||
|
|
||||||
platform:
|
|
||||||
- Win32
|
|
||||||
- x64
|
|
||||||
|
|
||||||
environment:
|
|
||||||
CTEST_OUTPUT_ON_FAILURE: 1
|
|
||||||
MSVC_DEFAULT_OPTIONS: ON
|
|
||||||
BUILD: msvc
|
|
||||||
|
|
||||||
matrix:
|
|
||||||
exclude:
|
|
||||||
- image: Visual Studio 2015
|
|
||||||
platform: Win32
|
|
||||||
- image: Visual Studio 2019
|
|
||||||
platform: Win32
|
|
||||||
|
|
||||||
before_build:
|
|
||||||
- mkdir build
|
|
||||||
- cd build
|
|
||||||
|
|
||||||
build_script:
|
|
||||||
- python ../support/appveyor-build.py
|
|
||||||
|
|
||||||
on_failure:
|
|
||||||
- appveyor PushArtifact Testing/Temporary/LastTest.log
|
|
||||||
- appveyor AddTest test
|
|
||||||
|
|
||||||
# Uncomment this to debug AppVeyor failures.
|
|
||||||
#on_finish:
|
|
||||||
# - ps: $blockRdp = $true; iex ((new-object net.webclient).DownloadString('https://raw.githubusercontent.com/appveyor/ci/master/scripts/enable-rdp.ps1'))
|
|
1
externals/fmt/support/bazel/.bazelrc
vendored
Normal file
1
externals/fmt/support/bazel/.bazelrc
vendored
Normal file
@ -0,0 +1 @@
|
|||||||
|
build --symlink_prefix=/ # Out of source build
|
1
externals/fmt/support/bazel/.bazelversion
vendored
Normal file
1
externals/fmt/support/bazel/.bazelversion
vendored
Normal file
@ -0,0 +1 @@
|
|||||||
|
5.1.1
|
28
externals/fmt/support/bazel/BUILD.bazel
vendored
Normal file
28
externals/fmt/support/bazel/BUILD.bazel
vendored
Normal file
@ -0,0 +1,28 @@
|
|||||||
|
cc_library(
|
||||||
|
name = "fmt",
|
||||||
|
srcs = [
|
||||||
|
#"src/fmt.cc", # No C++ module support
|
||||||
|
"src/format.cc",
|
||||||
|
"src/os.cc",
|
||||||
|
],
|
||||||
|
hdrs = [
|
||||||
|
"include/fmt/args.h",
|
||||||
|
"include/fmt/chrono.h",
|
||||||
|
"include/fmt/color.h",
|
||||||
|
"include/fmt/compile.h",
|
||||||
|
"include/fmt/core.h",
|
||||||
|
"include/fmt/format-inl.h",
|
||||||
|
"include/fmt/format.h",
|
||||||
|
"include/fmt/os.h",
|
||||||
|
"include/fmt/ostream.h",
|
||||||
|
"include/fmt/printf.h",
|
||||||
|
"include/fmt/ranges.h",
|
||||||
|
"include/fmt/std.h",
|
||||||
|
"include/fmt/xchar.h",
|
||||||
|
],
|
||||||
|
includes = [
|
||||||
|
"include",
|
||||||
|
],
|
||||||
|
strip_include_prefix = "include",
|
||||||
|
visibility = ["//visibility:public"],
|
||||||
|
)
|
73
externals/fmt/support/bazel/README.md
vendored
Normal file
73
externals/fmt/support/bazel/README.md
vendored
Normal file
@ -0,0 +1,73 @@
|
|||||||
|
# Bazel support
|
||||||
|
|
||||||
|
To get [Bazel](https://bazel.build/) working with {fmt} you can copy the files `BUILD.bazel`, `WORKSPACE.bazel`, `.bazelrc`, and `.bazelversion` from this folder (`support/bazel`) to the root folder of this project. This way {fmt} gets bazelized and can be used with Bazel (e.g. doing a `bazel build //...` on {fmt}).
|
||||||
|
|
||||||
|
## Using {fmt} as a dependency
|
||||||
|
|
||||||
|
The following minimal example shows how to use {fmt} as a dependency within a Bazel project.
|
||||||
|
|
||||||
|
The following file structure is assumed:
|
||||||
|
|
||||||
|
```
|
||||||
|
example
|
||||||
|
├── BUILD.bazel
|
||||||
|
├── main.cpp
|
||||||
|
└── WORKSPACE.bazel
|
||||||
|
```
|
||||||
|
|
||||||
|
*main.cpp*:
|
||||||
|
|
||||||
|
```c++
|
||||||
|
#include "fmt/core.h"
|
||||||
|
|
||||||
|
int main() {
|
||||||
|
fmt::print("The answer is {}\n", 42);
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
The expected output of this example is `The answer is 42`.
|
||||||
|
|
||||||
|
*WORKSPACE.bazel*:
|
||||||
|
|
||||||
|
```python
|
||||||
|
load("@bazel_tools//tools/build_defs/repo:git.bzl", "git_repository")
|
||||||
|
|
||||||
|
git_repository(
|
||||||
|
name = "fmt",
|
||||||
|
branch = "master",
|
||||||
|
remote = "https://github.com/fmtlib/fmt",
|
||||||
|
patch_cmds = [
|
||||||
|
"mv support/bazel/.bazelrc .bazelrc",
|
||||||
|
"mv support/bazel/.bazelversion .bazelversion",
|
||||||
|
"mv support/bazel/BUILD.bazel BUILD.bazel",
|
||||||
|
"mv support/bazel/WORKSPACE.bazel WORKSPACE.bazel",
|
||||||
|
],
|
||||||
|
# Windows-related patch commands are only needed in the case MSYS2 is not installed.
|
||||||
|
# More details about the installation process of MSYS2 on Windows systems can be found here:
|
||||||
|
# https://docs.bazel.build/versions/main/install-windows.html#installing-compilers-and-language-runtimes
|
||||||
|
# Even if MSYS2 is installed the Windows related patch commands can still be used.
|
||||||
|
patch_cmds_win = [
|
||||||
|
"Move-Item -Path support/bazel/.bazelrc -Destination .bazelrc",
|
||||||
|
"Move-Item -Path support/bazel/.bazelversion -Destination .bazelversion",
|
||||||
|
"Move-Item -Path support/bazel/BUILD.bazel -Destination BUILD.bazel",
|
||||||
|
"Move-Item -Path support/bazel/WORKSPACE.bazel -Destination WORKSPACE.bazel",
|
||||||
|
],
|
||||||
|
)
|
||||||
|
```
|
||||||
|
|
||||||
|
In the *WORKSPACE* file, the {fmt} GitHub repository is fetched. Using the attribute `patch_cmds` the files `BUILD.bazel`, `WORKSPACE.bazel`, `.bazelrc`, and `.bazelversion` are moved to the root of the {fmt} repository. This way the {fmt} repository is recognized as a bazelized workspace.
|
||||||
|
|
||||||
|
*BUILD.bazel*:
|
||||||
|
|
||||||
|
```python
|
||||||
|
cc_binary(
|
||||||
|
name = "Demo",
|
||||||
|
srcs = ["main.cpp"],
|
||||||
|
deps = ["@fmt"],
|
||||||
|
)
|
||||||
|
```
|
||||||
|
|
||||||
|
The *BUILD* file defines a binary named `Demo` that has a dependency to {fmt}.
|
||||||
|
|
||||||
|
To execute the binary you can run `bazel run //:Demo`.
|
||||||
|
|
1
externals/fmt/support/bazel/WORKSPACE.bazel
vendored
Normal file
1
externals/fmt/support/bazel/WORKSPACE.bazel
vendored
Normal file
@ -0,0 +1 @@
|
|||||||
|
workspace(name = "fmt")
|
58
externals/fmt/support/build-docs.py
vendored
Normal file
58
externals/fmt/support/build-docs.py
vendored
Normal file
@ -0,0 +1,58 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
# Build the documentation in CI.
|
||||||
|
|
||||||
|
from __future__ import print_function
|
||||||
|
import errno, os, shutil, subprocess, sys, urllib
|
||||||
|
from subprocess import call, check_call, Popen, PIPE, STDOUT
|
||||||
|
|
||||||
|
def rmtree_if_exists(dir):
|
||||||
|
try:
|
||||||
|
shutil.rmtree(dir)
|
||||||
|
except OSError as e:
|
||||||
|
if e.errno == errno.ENOENT:
|
||||||
|
pass
|
||||||
|
|
||||||
|
# Build the docs.
|
||||||
|
fmt_dir = os.path.dirname(os.path.dirname(os.path.realpath(__file__)))
|
||||||
|
sys.path.insert(0, os.path.join(fmt_dir, 'doc'))
|
||||||
|
import build
|
||||||
|
build.create_build_env()
|
||||||
|
html_dir = build.build_docs()
|
||||||
|
|
||||||
|
repo = 'fmtlib.github.io'
|
||||||
|
branch = os.environ['GITHUB_REF']
|
||||||
|
is_ci = 'CI' in os.environ
|
||||||
|
if is_ci and branch != 'refs/heads/master':
|
||||||
|
print('Branch: ' + branch)
|
||||||
|
exit(0) # Ignore non-master branches
|
||||||
|
if is_ci and 'KEY' not in os.environ:
|
||||||
|
# Don't update the repo if building in CI from an account that doesn't have
|
||||||
|
# push access.
|
||||||
|
print('Skipping update of ' + repo)
|
||||||
|
exit(0)
|
||||||
|
|
||||||
|
# Clone the fmtlib.github.io repo.
|
||||||
|
rmtree_if_exists(repo)
|
||||||
|
git_url = 'https://github.com/' if is_ci else 'git@github.com:'
|
||||||
|
check_call(['git', 'clone', git_url + 'fmtlib/{}.git'.format(repo)])
|
||||||
|
|
||||||
|
# Copy docs to the repo.
|
||||||
|
target_dir = os.path.join(repo, 'dev')
|
||||||
|
rmtree_if_exists(target_dir)
|
||||||
|
shutil.copytree(html_dir, target_dir, ignore=shutil.ignore_patterns('.*'))
|
||||||
|
if is_ci:
|
||||||
|
check_call(['git', 'config', '--global', 'user.name', 'fmtbot'])
|
||||||
|
check_call(['git', 'config', '--global', 'user.email', 'viz@fmt.dev'])
|
||||||
|
|
||||||
|
# Push docs to GitHub pages.
|
||||||
|
check_call(['git', 'add', '--all'], cwd=repo)
|
||||||
|
if call(['git', 'diff-index', '--quiet', 'HEAD'], cwd=repo):
|
||||||
|
check_call(['git', 'commit', '-m', 'Update documentation'], cwd=repo)
|
||||||
|
cmd = 'git push'
|
||||||
|
if is_ci:
|
||||||
|
cmd += ' https://$KEY@github.com/fmtlib/fmtlib.github.io.git master'
|
||||||
|
p = Popen(cmd, shell=True, stdout=PIPE, stderr=STDOUT, cwd=repo)
|
||||||
|
# Print the output without the key.
|
||||||
|
print(p.communicate()[0].decode('utf-8').replace(os.environ['KEY'], '$KEY'))
|
||||||
|
if p.returncode != 0:
|
||||||
|
raise subprocess.CalledProcessError(p.returncode, cmd)
|
71
externals/fmt/support/build.gradle
vendored
71
externals/fmt/support/build.gradle
vendored
@ -1,3 +1,4 @@
|
|||||||
|
import java.nio.file.Paths
|
||||||
|
|
||||||
// General gradle arguments for root project
|
// General gradle arguments for root project
|
||||||
buildscript {
|
buildscript {
|
||||||
@ -7,14 +8,12 @@ buildscript {
|
|||||||
}
|
}
|
||||||
dependencies {
|
dependencies {
|
||||||
//
|
//
|
||||||
// https://developer.android.com/studio/releases/gradle-plugin
|
// https://developer.android.com/studio/releases/gradle-plugin#updating-gradle
|
||||||
//
|
//
|
||||||
// Notice that 3.3.0 here is the version of [Android Gradle Plugin]
|
// Notice that 4.0.0 here is the version of [Android Gradle Plugin]
|
||||||
// Accroding to URL above you will need Gradle 5.0 or higher
|
// Accroding to URL above you will need Gradle 6.1 or higher
|
||||||
//
|
//
|
||||||
// If you are using Android Studio, and it is using Gradle's lower
|
classpath "com.android.tools.build:gradle:4.1.1"
|
||||||
// version, Use the plugin version 3.1.3 ~ 3.2.0 for Gradle 4.4 ~ 4.10
|
|
||||||
classpath 'com.android.tools.build:gradle:3.3.0'
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
repositories {
|
repositories {
|
||||||
@ -22,9 +21,12 @@ repositories {
|
|||||||
jcenter()
|
jcenter()
|
||||||
}
|
}
|
||||||
|
|
||||||
// Output: Shared library (.so) for Android
|
// Project's root where CMakeLists.txt exists: rootDir/support/.cxx -> rootDir
|
||||||
apply plugin: 'com.android.library'
|
def rootDir = Paths.get(project.buildDir.getParent()).getParent()
|
||||||
|
println("rootDir: ${rootDir}")
|
||||||
|
|
||||||
|
// Output: Shared library (.so) for Android
|
||||||
|
apply plugin: "com.android.library"
|
||||||
android {
|
android {
|
||||||
compileSdkVersion 25 // Android 7.0
|
compileSdkVersion 25 // Android 7.0
|
||||||
|
|
||||||
@ -41,13 +43,13 @@ android {
|
|||||||
include "arm64-v8a", "armeabi-v7a", "x86_64"
|
include "arm64-v8a", "armeabi-v7a", "x86_64"
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
ndkVersion "21.3.6528147" // ANDROID_NDK_HOME is deprecated. Be explicit
|
||||||
|
|
||||||
defaultConfig {
|
defaultConfig {
|
||||||
minSdkVersion 21 // Android 5.0+
|
minSdkVersion 21 // Android 5.0+
|
||||||
targetSdkVersion 25 // Follow Compile SDK
|
targetSdkVersion 25 // Follow Compile SDK
|
||||||
versionCode 21 // Follow release count
|
versionCode 34 // Follow release count
|
||||||
versionName "5.3.0" // Follow Official version
|
versionName "7.1.2" // Follow Official version
|
||||||
testInstrumentationRunner "android.support.test.runner.AndroidJUnitRunner"
|
|
||||||
|
|
||||||
externalNativeBuild {
|
externalNativeBuild {
|
||||||
cmake {
|
cmake {
|
||||||
@ -56,9 +58,9 @@ android {
|
|||||||
arguments "-DFMT_TEST=false" // Skip test
|
arguments "-DFMT_TEST=false" // Skip test
|
||||||
arguments "-DFMT_DOC=false" // Skip document
|
arguments "-DFMT_DOC=false" // Skip document
|
||||||
cppFlags "-std=c++17"
|
cppFlags "-std=c++17"
|
||||||
|
targets "fmt"
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
println("Gradle CMake Plugin: ")
|
|
||||||
println(externalNativeBuild.cmake.cppFlags)
|
println(externalNativeBuild.cmake.cppFlags)
|
||||||
println(externalNativeBuild.cmake.arguments)
|
println(externalNativeBuild.cmake.arguments)
|
||||||
}
|
}
|
||||||
@ -69,16 +71,27 @@ android {
|
|||||||
// neighbor of the top level cmake
|
// neighbor of the top level cmake
|
||||||
externalNativeBuild {
|
externalNativeBuild {
|
||||||
cmake {
|
cmake {
|
||||||
path "../CMakeLists.txt"
|
version "3.10.0+"
|
||||||
|
path "${rootDir}/CMakeLists.txt"
|
||||||
// buildStagingDirectory "./build" // Custom path for cmake output
|
// buildStagingDirectory "./build" // Custom path for cmake output
|
||||||
}
|
}
|
||||||
//println(cmake.path)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
sourceSets{
|
sourceSets{
|
||||||
// Android Manifest for Gradle
|
// Android Manifest for Gradle
|
||||||
main {
|
main {
|
||||||
manifest.srcFile 'AndroidManifest.xml'
|
manifest.srcFile "AndroidManifest.xml"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// https://developer.android.com/studio/build/native-dependencies#build_system_configuration
|
||||||
|
buildFeatures {
|
||||||
|
prefab true
|
||||||
|
prefabPublishing true
|
||||||
|
}
|
||||||
|
prefab {
|
||||||
|
fmt {
|
||||||
|
headers "${rootDir}/include"
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -88,20 +101,32 @@ assemble.doLast
|
|||||||
// Instead of `ninja install`, Gradle will deploy the files.
|
// Instead of `ninja install`, Gradle will deploy the files.
|
||||||
// We are doing this since FMT is dependent to the ANDROID_STL after build
|
// We are doing this since FMT is dependent to the ANDROID_STL after build
|
||||||
copy {
|
copy {
|
||||||
from 'build/intermediates/cmake'
|
from "build/intermediates/cmake"
|
||||||
into '../libs'
|
into "${rootDir}/libs"
|
||||||
}
|
}
|
||||||
// Copy debug binaries
|
// Copy debug binaries
|
||||||
copy {
|
copy {
|
||||||
from '../libs/debug/obj'
|
from "${rootDir}/libs/debug/obj"
|
||||||
into '../libs/debug'
|
into "${rootDir}/libs/debug"
|
||||||
}
|
}
|
||||||
// Copy Release binaries
|
// Copy Release binaries
|
||||||
copy {
|
copy {
|
||||||
from '../libs/release/obj'
|
from "${rootDir}/libs/release/obj"
|
||||||
into '../libs/release'
|
into "${rootDir}/libs/release"
|
||||||
}
|
}
|
||||||
// Remove empty directory
|
// Remove empty directory
|
||||||
delete '../libs/debug/obj'
|
delete "${rootDir}/libs/debug/obj"
|
||||||
delete '../libs/release/obj'
|
delete "${rootDir}/libs/release/obj"
|
||||||
|
|
||||||
|
// Copy AAR files. Notice that the aar is named after the folder of this script.
|
||||||
|
copy {
|
||||||
|
from "build/outputs/aar/support-release.aar"
|
||||||
|
into "${rootDir}/libs"
|
||||||
|
rename "support-release.aar", "fmt-release.aar"
|
||||||
|
}
|
||||||
|
copy {
|
||||||
|
from "build/outputs/aar/support-debug.aar"
|
||||||
|
into "${rootDir}/libs"
|
||||||
|
rename "support-debug.aar", "fmt-debug.aar"
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
26
externals/fmt/support/cmake/JoinPaths.cmake
vendored
Normal file
26
externals/fmt/support/cmake/JoinPaths.cmake
vendored
Normal file
@ -0,0 +1,26 @@
|
|||||||
|
# This module provides function for joining paths
|
||||||
|
# known from from most languages
|
||||||
|
#
|
||||||
|
# Original license:
|
||||||
|
# SPDX-License-Identifier: (MIT OR CC0-1.0)
|
||||||
|
# Explicit permission given to distribute this module under
|
||||||
|
# the terms of the project as described in /LICENSE.rst.
|
||||||
|
# Copyright 2020 Jan Tojnar
|
||||||
|
# https://github.com/jtojnar/cmake-snips
|
||||||
|
#
|
||||||
|
# Modelled after Python’s os.path.join
|
||||||
|
# https://docs.python.org/3.7/library/os.path.html#os.path.join
|
||||||
|
# Windows not supported
|
||||||
|
function(join_paths joined_path first_path_segment)
|
||||||
|
set(temp_path "${first_path_segment}")
|
||||||
|
foreach(current_segment IN LISTS ARGN)
|
||||||
|
if(NOT ("${current_segment}" STREQUAL ""))
|
||||||
|
if(IS_ABSOLUTE "${current_segment}")
|
||||||
|
set(temp_path "${current_segment}")
|
||||||
|
else()
|
||||||
|
set(temp_path "${temp_path}/${current_segment}")
|
||||||
|
endif()
|
||||||
|
endif()
|
||||||
|
endforeach()
|
||||||
|
set(${joined_path} "${temp_path}" PARENT_SCOPE)
|
||||||
|
endfunction()
|
48
externals/fmt/support/cmake/cxx14.cmake
vendored
48
externals/fmt/support/cmake/cxx14.cmake
vendored
@ -1,7 +1,11 @@
|
|||||||
# C++14 feature support detection
|
# C++14 feature support detection
|
||||||
|
|
||||||
include(CheckCXXSourceCompiles)
|
|
||||||
include(CheckCXXCompilerFlag)
|
include(CheckCXXCompilerFlag)
|
||||||
|
function (fmt_check_cxx_compiler_flag flag result)
|
||||||
|
if (NOT MSVC)
|
||||||
|
check_cxx_compiler_flag("${flag}" ${result})
|
||||||
|
endif ()
|
||||||
|
endfunction ()
|
||||||
|
|
||||||
if (NOT CMAKE_CXX_STANDARD)
|
if (NOT CMAKE_CXX_STANDARD)
|
||||||
set(CMAKE_CXX_STANDARD 11)
|
set(CMAKE_CXX_STANDARD 11)
|
||||||
@ -9,35 +13,38 @@ endif()
|
|||||||
message(STATUS "CXX_STANDARD: ${CMAKE_CXX_STANDARD}")
|
message(STATUS "CXX_STANDARD: ${CMAKE_CXX_STANDARD}")
|
||||||
|
|
||||||
if (CMAKE_CXX_STANDARD EQUAL 20)
|
if (CMAKE_CXX_STANDARD EQUAL 20)
|
||||||
check_cxx_compiler_flag(-std=c++20 has_std_20_flag)
|
fmt_check_cxx_compiler_flag(-std=c++20 has_std_20_flag)
|
||||||
check_cxx_compiler_flag(-std=c++2a has_std_2a_flag)
|
fmt_check_cxx_compiler_flag(-std=c++2a has_std_2a_flag)
|
||||||
|
|
||||||
if (has_std_20_flag)
|
if (has_std_20_flag)
|
||||||
set(CXX_STANDARD_FLAG -std=c++20)
|
set(CXX_STANDARD_FLAG -std=c++20)
|
||||||
elseif (has_std_2a_flag)
|
elseif (has_std_2a_flag)
|
||||||
set(CXX_STANDARD_FLAG -std=c++2a)
|
set(CXX_STANDARD_FLAG -std=c++2a)
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
elseif (CMAKE_CXX_STANDARD EQUAL 17)
|
elseif (CMAKE_CXX_STANDARD EQUAL 17)
|
||||||
check_cxx_compiler_flag(-std=c++17 has_std_17_flag)
|
fmt_check_cxx_compiler_flag(-std=c++17 has_std_17_flag)
|
||||||
check_cxx_compiler_flag(-std=c++1z has_std_1z_flag)
|
fmt_check_cxx_compiler_flag(-std=c++1z has_std_1z_flag)
|
||||||
|
|
||||||
if (has_std_17_flag)
|
if (has_std_17_flag)
|
||||||
set(CXX_STANDARD_FLAG -std=c++17)
|
set(CXX_STANDARD_FLAG -std=c++17)
|
||||||
elseif (has_std_1z_flag)
|
elseif (has_std_1z_flag)
|
||||||
set(CXX_STANDARD_FLAG -std=c++1z)
|
set(CXX_STANDARD_FLAG -std=c++1z)
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
elseif (CMAKE_CXX_STANDARD EQUAL 14)
|
elseif (CMAKE_CXX_STANDARD EQUAL 14)
|
||||||
check_cxx_compiler_flag(-std=c++14 has_std_14_flag)
|
fmt_check_cxx_compiler_flag(-std=c++14 has_std_14_flag)
|
||||||
check_cxx_compiler_flag(-std=c++1y has_std_1y_flag)
|
fmt_check_cxx_compiler_flag(-std=c++1y has_std_1y_flag)
|
||||||
|
|
||||||
if (has_std_14_flag)
|
if (has_std_14_flag)
|
||||||
set(CXX_STANDARD_FLAG -std=c++14)
|
set(CXX_STANDARD_FLAG -std=c++14)
|
||||||
elseif (has_std_1y_flag)
|
elseif (has_std_1y_flag)
|
||||||
set(CXX_STANDARD_FLAG -std=c++1y)
|
set(CXX_STANDARD_FLAG -std=c++1y)
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
elseif (CMAKE_CXX_STANDARD EQUAL 11)
|
elseif (CMAKE_CXX_STANDARD EQUAL 11)
|
||||||
check_cxx_compiler_flag(-std=c++11 has_std_11_flag)
|
fmt_check_cxx_compiler_flag(-std=c++11 has_std_11_flag)
|
||||||
check_cxx_compiler_flag(-std=c++0x has_std_0x_flag)
|
fmt_check_cxx_compiler_flag(-std=c++0x has_std_0x_flag)
|
||||||
|
|
||||||
if (has_std_11_flag)
|
if (has_std_11_flag)
|
||||||
set(CXX_STANDARD_FLAG -std=c++11)
|
set(CXX_STANDARD_FLAG -std=c++11)
|
||||||
@ -45,26 +52,3 @@ elseif (CMAKE_CXX_STANDARD EQUAL 11)
|
|||||||
set(CXX_STANDARD_FLAG -std=c++0x)
|
set(CXX_STANDARD_FLAG -std=c++0x)
|
||||||
endif ()
|
endif ()
|
||||||
endif ()
|
endif ()
|
||||||
|
|
||||||
set(CMAKE_REQUIRED_FLAGS ${CXX_STANDARD_FLAG})
|
|
||||||
|
|
||||||
# Check if user-defined literals are available
|
|
||||||
check_cxx_source_compiles("
|
|
||||||
void operator\"\" _udl(long double);
|
|
||||||
int main() {}"
|
|
||||||
SUPPORTS_USER_DEFINED_LITERALS)
|
|
||||||
if (NOT SUPPORTS_USER_DEFINED_LITERALS)
|
|
||||||
set (SUPPORTS_USER_DEFINED_LITERALS OFF)
|
|
||||||
endif ()
|
|
||||||
|
|
||||||
# Check if <variant> is available
|
|
||||||
set(CMAKE_REQUIRED_FLAGS -std=c++1z)
|
|
||||||
check_cxx_source_compiles("
|
|
||||||
#include <variant>
|
|
||||||
int main() {}"
|
|
||||||
FMT_HAS_VARIANT)
|
|
||||||
if (NOT FMT_HAS_VARIANT)
|
|
||||||
set (FMT_HAS_VARIANT OFF)
|
|
||||||
endif ()
|
|
||||||
|
|
||||||
set(CMAKE_REQUIRED_FLAGS )
|
|
||||||
|
@ -1,4 +1,7 @@
|
|||||||
@PACKAGE_INIT@
|
@PACKAGE_INIT@
|
||||||
|
|
||||||
include(${CMAKE_CURRENT_LIST_DIR}/@targets_export_name@.cmake)
|
if (NOT TARGET fmt::fmt)
|
||||||
|
include(${CMAKE_CURRENT_LIST_DIR}/@targets_export_name@.cmake)
|
||||||
|
endif ()
|
||||||
|
|
||||||
check_required_components(fmt)
|
check_required_components(fmt)
|
||||||
|
4
externals/fmt/support/cmake/fmt.pc.in
vendored
4
externals/fmt/support/cmake/fmt.pc.in
vendored
@ -1,7 +1,7 @@
|
|||||||
prefix=@CMAKE_INSTALL_PREFIX@
|
prefix=@CMAKE_INSTALL_PREFIX@
|
||||||
exec_prefix=@CMAKE_INSTALL_PREFIX@
|
exec_prefix=@CMAKE_INSTALL_PREFIX@
|
||||||
libdir=${exec_prefix}/@CMAKE_INSTALL_LIBDIR@
|
libdir=@libdir_for_pc_file@
|
||||||
includedir=${prefix}/@CMAKE_INSTALL_INCLUDEDIR@
|
includedir=@includedir_for_pc_file@
|
||||||
|
|
||||||
Name: fmt
|
Name: fmt
|
||||||
Description: A modern formatting library
|
Description: A modern formatting library
|
||||||
|
27
externals/fmt/support/fmt.pro
vendored
27
externals/fmt/support/fmt.pro
vendored
@ -1,27 +0,0 @@
|
|||||||
# Staticlib configuration for qmake builds
|
|
||||||
# For some reason qmake 3.1 fails to identify source dependencies and excludes format.cc and printf.cc
|
|
||||||
# from compilation so it _MUST_ be called as qmake -nodepend
|
|
||||||
# A workaround is implemented below: a custom compiler is defined which does not track dependencies
|
|
||||||
|
|
||||||
TEMPLATE = lib
|
|
||||||
|
|
||||||
TARGET = fmt
|
|
||||||
|
|
||||||
QMAKE_EXT_CPP = .cc
|
|
||||||
|
|
||||||
CONFIG = staticlib warn_on c++11
|
|
||||||
|
|
||||||
FMT_SOURCES = \
|
|
||||||
../src/format.cc \
|
|
||||||
../src/posix.cc
|
|
||||||
|
|
||||||
fmt.name = libfmt
|
|
||||||
fmt.input = FMT_SOURCES
|
|
||||||
fmt.output = ${QMAKE_FILE_BASE}$$QMAKE_EXT_OBJ
|
|
||||||
fmt.clean = ${QMAKE_FILE_BASE}$$QMAKE_EXT_OBJ
|
|
||||||
fmt.depends = ${QMAKE_FILE_IN}
|
|
||||||
# QMAKE_RUN_CXX will not be expanded
|
|
||||||
fmt.commands = $$QMAKE_CXX -c $$QMAKE_CXXFLAGS $$QMAKE_CXXFLAGS_WARN_ON $$QMAKE_CXXFLAGS_RELEASE_WITH_DEBUGINFO $$QMAKE_CXXFLAGS_CXX11 ${QMAKE_FILE_IN}
|
|
||||||
fmt.variable_out = OBJECTS
|
|
||||||
fmt.CONFIG = no_dependencies no_link
|
|
||||||
QMAKE_EXTRA_COMPILERS += fmt
|
|
51
externals/fmt/support/manage.py
vendored
51
externals/fmt/support/manage.py
vendored
@ -1,4 +1,4 @@
|
|||||||
#!/usr/bin/env python
|
#!/usr/bin/env python3
|
||||||
|
|
||||||
"""Manage site and releases.
|
"""Manage site and releases.
|
||||||
|
|
||||||
@ -144,14 +144,51 @@ def update_site(env):
|
|||||||
b.data = re.sub(pattern, r'doxygenfunction:: \1(int)', b.data)
|
b.data = re.sub(pattern, r'doxygenfunction:: \1(int)', b.data)
|
||||||
b.data = b.data.replace('std::FILE*', 'std::FILE *')
|
b.data = b.data.replace('std::FILE*', 'std::FILE *')
|
||||||
b.data = b.data.replace('unsigned int', 'unsigned')
|
b.data = b.data.replace('unsigned int', 'unsigned')
|
||||||
b.data = b.data.replace('operator""_', 'operator"" _')
|
#b.data = b.data.replace('operator""_', 'operator"" _')
|
||||||
|
b.data = b.data.replace(
|
||||||
|
'format_to_n(OutputIt, size_t, string_view, Args&&',
|
||||||
|
'format_to_n(OutputIt, size_t, const S&, const Args&')
|
||||||
|
b.data = b.data.replace(
|
||||||
|
'format_to_n(OutputIt, std::size_t, string_view, Args&&',
|
||||||
|
'format_to_n(OutputIt, std::size_t, const S&, const Args&')
|
||||||
|
if version == ('3.0.2'):
|
||||||
|
b.data = b.data.replace(
|
||||||
|
'fprintf(std::ostream&', 'fprintf(std::ostream &')
|
||||||
|
if version == ('5.3.0'):
|
||||||
|
b.data = b.data.replace(
|
||||||
|
'format_to(OutputIt, const S&, const Args&...)',
|
||||||
|
'format_to(OutputIt, const S &, const Args &...)')
|
||||||
|
if version.startswith('5.') or version.startswith('6.'):
|
||||||
b.data = b.data.replace(', size_t', ', std::size_t')
|
b.data = b.data.replace(', size_t', ', std::size_t')
|
||||||
|
if version.startswith('7.'):
|
||||||
|
b.data = b.data.replace(', std::size_t', ', size_t')
|
||||||
|
b.data = b.data.replace('join(It, It', 'join(It, Sentinel')
|
||||||
|
if version.startswith('7.1.'):
|
||||||
|
b.data = b.data.replace(', std::size_t', ', size_t')
|
||||||
|
b.data = b.data.replace('join(It, It', 'join(It, Sentinel')
|
||||||
|
b.data = b.data.replace(
|
||||||
|
'fmt::format_to(OutputIt, const S&, Args&&...)',
|
||||||
|
'fmt::format_to(OutputIt, const S&, Args&&...) -> ' +
|
||||||
|
'typename std::enable_if<enable, OutputIt>::type')
|
||||||
b.data = b.data.replace('aa long', 'a long')
|
b.data = b.data.replace('aa long', 'a long')
|
||||||
|
b.data = b.data.replace('serveral', 'several')
|
||||||
|
if version.startswith('6.2.'):
|
||||||
|
b.data = b.data.replace(
|
||||||
|
'vformat(const S&, basic_format_args<' +
|
||||||
|
'buffer_context<Char>>)',
|
||||||
|
'vformat(const S&, basic_format_args<' +
|
||||||
|
'buffer_context<type_identity_t<Char>>>)')
|
||||||
# Fix a broken link in index.rst.
|
# Fix a broken link in index.rst.
|
||||||
index = os.path.join(target_doc_dir, 'index.rst')
|
index = os.path.join(target_doc_dir, 'index.rst')
|
||||||
with rewrite(index) as b:
|
with rewrite(index) as b:
|
||||||
b.data = b.data.replace(
|
b.data = b.data.replace(
|
||||||
'doc/latest/index.html#format-string-syntax', 'syntax.html')
|
'doc/latest/index.html#format-string-syntax', 'syntax.html')
|
||||||
|
# Fix issues in syntax.rst.
|
||||||
|
index = os.path.join(target_doc_dir, 'syntax.rst')
|
||||||
|
with rewrite(index) as b:
|
||||||
|
b.data = b.data.replace(
|
||||||
|
'..productionlist:: sf\n', '.. productionlist:: sf\n ')
|
||||||
|
b.data = b.data.replace('Examples:\n', 'Examples::\n')
|
||||||
# Build the docs.
|
# Build the docs.
|
||||||
html_dir = os.path.join(env.build_dir, 'html')
|
html_dir = os.path.join(env.build_dir, 'html')
|
||||||
if os.path.exists(html_dir):
|
if os.path.exists(html_dir):
|
||||||
@ -209,7 +246,7 @@ def release(args):
|
|||||||
# Update the version in the changelog.
|
# Update the version in the changelog.
|
||||||
title_len = 0
|
title_len = 0
|
||||||
for line in fileinput.input(changelog_path, inplace=True):
|
for line in fileinput.input(changelog_path, inplace=True):
|
||||||
if line.decode('utf-8').startswith(version + ' - TBD'):
|
if line.startswith(version + ' - TBD'):
|
||||||
line = version + ' - ' + datetime.date.today().isoformat()
|
line = version + ' - ' + datetime.date.today().isoformat()
|
||||||
title_len = len(line)
|
title_len = len(line)
|
||||||
line += '\n'
|
line += '\n'
|
||||||
@ -239,9 +276,9 @@ def release(args):
|
|||||||
|
|
||||||
# Create a release on GitHub.
|
# Create a release on GitHub.
|
||||||
fmt_repo.push('origin', 'release')
|
fmt_repo.push('origin', 'release')
|
||||||
params = {'access_token': os.getenv('FMT_TOKEN')}
|
auth_headers = {'Authorization': 'token ' + os.getenv('FMT_TOKEN')}
|
||||||
r = requests.post('https://api.github.com/repos/fmtlib/fmt/releases',
|
r = requests.post('https://api.github.com/repos/fmtlib/fmt/releases',
|
||||||
params=params,
|
headers=auth_headers,
|
||||||
data=json.dumps({'tag_name': version,
|
data=json.dumps({'tag_name': version,
|
||||||
'target_commitish': 'release',
|
'target_commitish': 'release',
|
||||||
'body': changes, 'draft': True}))
|
'body': changes, 'draft': True}))
|
||||||
@ -252,8 +289,8 @@ def release(args):
|
|||||||
package = 'fmt-{}.zip'.format(version)
|
package = 'fmt-{}.zip'.format(version)
|
||||||
r = requests.post(
|
r = requests.post(
|
||||||
'{}/{}/assets?name={}'.format(uploads_url, id, package),
|
'{}/{}/assets?name={}'.format(uploads_url, id, package),
|
||||||
headers={'Content-Type': 'application/zip'},
|
headers={'Content-Type': 'application/zip'} | auth_headers,
|
||||||
params=params, data=open('build/fmt/' + package, 'rb'))
|
data=open('build/fmt/' + package, 'rb'))
|
||||||
if r.status_code != 201:
|
if r.status_code != 201:
|
||||||
raise Exception('Failed to upload an asset ' + str(r))
|
raise Exception('Failed to upload an asset ' + str(r))
|
||||||
|
|
||||||
|
201
externals/fmt/support/printable.py
vendored
Normal file
201
externals/fmt/support/printable.py
vendored
Normal file
@ -0,0 +1,201 @@
|
|||||||
|
#!/usr/bin/env python3
|
||||||
|
|
||||||
|
# This script is based on
|
||||||
|
# https://github.com/rust-lang/rust/blob/master/library/core/src/unicode/printable.py
|
||||||
|
# distributed under https://github.com/rust-lang/rust/blob/master/LICENSE-MIT.
|
||||||
|
|
||||||
|
# This script uses the following Unicode tables:
|
||||||
|
# - UnicodeData.txt
|
||||||
|
|
||||||
|
|
||||||
|
from collections import namedtuple
|
||||||
|
import csv
|
||||||
|
import os
|
||||||
|
import subprocess
|
||||||
|
|
||||||
|
NUM_CODEPOINTS=0x110000
|
||||||
|
|
||||||
|
def to_ranges(iter):
|
||||||
|
current = None
|
||||||
|
for i in iter:
|
||||||
|
if current is None or i != current[1] or i in (0x10000, 0x20000):
|
||||||
|
if current is not None:
|
||||||
|
yield tuple(current)
|
||||||
|
current = [i, i + 1]
|
||||||
|
else:
|
||||||
|
current[1] += 1
|
||||||
|
if current is not None:
|
||||||
|
yield tuple(current)
|
||||||
|
|
||||||
|
def get_escaped(codepoints):
|
||||||
|
for c in codepoints:
|
||||||
|
if (c.class_ or "Cn") in "Cc Cf Cs Co Cn Zl Zp Zs".split() and c.value != ord(' '):
|
||||||
|
yield c.value
|
||||||
|
|
||||||
|
def get_file(f):
|
||||||
|
try:
|
||||||
|
return open(os.path.basename(f))
|
||||||
|
except FileNotFoundError:
|
||||||
|
subprocess.run(["curl", "-O", f], check=True)
|
||||||
|
return open(os.path.basename(f))
|
||||||
|
|
||||||
|
Codepoint = namedtuple('Codepoint', 'value class_')
|
||||||
|
|
||||||
|
def get_codepoints(f):
|
||||||
|
r = csv.reader(f, delimiter=";")
|
||||||
|
prev_codepoint = 0
|
||||||
|
class_first = None
|
||||||
|
for row in r:
|
||||||
|
codepoint = int(row[0], 16)
|
||||||
|
name = row[1]
|
||||||
|
class_ = row[2]
|
||||||
|
|
||||||
|
if class_first is not None:
|
||||||
|
if not name.endswith("Last>"):
|
||||||
|
raise ValueError("Missing Last after First")
|
||||||
|
|
||||||
|
for c in range(prev_codepoint + 1, codepoint):
|
||||||
|
yield Codepoint(c, class_first)
|
||||||
|
|
||||||
|
class_first = None
|
||||||
|
if name.endswith("First>"):
|
||||||
|
class_first = class_
|
||||||
|
|
||||||
|
yield Codepoint(codepoint, class_)
|
||||||
|
prev_codepoint = codepoint
|
||||||
|
|
||||||
|
if class_first is not None:
|
||||||
|
raise ValueError("Missing Last after First")
|
||||||
|
|
||||||
|
for c in range(prev_codepoint + 1, NUM_CODEPOINTS):
|
||||||
|
yield Codepoint(c, None)
|
||||||
|
|
||||||
|
def compress_singletons(singletons):
|
||||||
|
uppers = [] # (upper, # items in lowers)
|
||||||
|
lowers = []
|
||||||
|
|
||||||
|
for i in singletons:
|
||||||
|
upper = i >> 8
|
||||||
|
lower = i & 0xff
|
||||||
|
if len(uppers) == 0 or uppers[-1][0] != upper:
|
||||||
|
uppers.append((upper, 1))
|
||||||
|
else:
|
||||||
|
upper, count = uppers[-1]
|
||||||
|
uppers[-1] = upper, count + 1
|
||||||
|
lowers.append(lower)
|
||||||
|
|
||||||
|
return uppers, lowers
|
||||||
|
|
||||||
|
def compress_normal(normal):
|
||||||
|
# lengths 0x00..0x7f are encoded as 00, 01, ..., 7e, 7f
|
||||||
|
# lengths 0x80..0x7fff are encoded as 80 80, 80 81, ..., ff fe, ff ff
|
||||||
|
compressed = [] # [truelen, (truelenaux), falselen, (falselenaux)]
|
||||||
|
|
||||||
|
prev_start = 0
|
||||||
|
for start, count in normal:
|
||||||
|
truelen = start - prev_start
|
||||||
|
falselen = count
|
||||||
|
prev_start = start + count
|
||||||
|
|
||||||
|
assert truelen < 0x8000 and falselen < 0x8000
|
||||||
|
entry = []
|
||||||
|
if truelen > 0x7f:
|
||||||
|
entry.append(0x80 | (truelen >> 8))
|
||||||
|
entry.append(truelen & 0xff)
|
||||||
|
else:
|
||||||
|
entry.append(truelen & 0x7f)
|
||||||
|
if falselen > 0x7f:
|
||||||
|
entry.append(0x80 | (falselen >> 8))
|
||||||
|
entry.append(falselen & 0xff)
|
||||||
|
else:
|
||||||
|
entry.append(falselen & 0x7f)
|
||||||
|
|
||||||
|
compressed.append(entry)
|
||||||
|
|
||||||
|
return compressed
|
||||||
|
|
||||||
|
def print_singletons(uppers, lowers, uppersname, lowersname):
|
||||||
|
print(" static constexpr singleton {}[] = {{".format(uppersname))
|
||||||
|
for u, c in uppers:
|
||||||
|
print(" {{{:#04x}, {}}},".format(u, c))
|
||||||
|
print(" };")
|
||||||
|
print(" static constexpr unsigned char {}[] = {{".format(lowersname))
|
||||||
|
for i in range(0, len(lowers), 8):
|
||||||
|
print(" {}".format(" ".join("{:#04x},".format(l) for l in lowers[i:i+8])))
|
||||||
|
print(" };")
|
||||||
|
|
||||||
|
def print_normal(normal, normalname):
|
||||||
|
print(" static constexpr unsigned char {}[] = {{".format(normalname))
|
||||||
|
for v in normal:
|
||||||
|
print(" {}".format(" ".join("{:#04x},".format(i) for i in v)))
|
||||||
|
print(" };")
|
||||||
|
|
||||||
|
def main():
|
||||||
|
file = get_file("https://www.unicode.org/Public/UNIDATA/UnicodeData.txt")
|
||||||
|
|
||||||
|
codepoints = get_codepoints(file)
|
||||||
|
|
||||||
|
CUTOFF=0x10000
|
||||||
|
singletons0 = []
|
||||||
|
singletons1 = []
|
||||||
|
normal0 = []
|
||||||
|
normal1 = []
|
||||||
|
extra = []
|
||||||
|
|
||||||
|
for a, b in to_ranges(get_escaped(codepoints)):
|
||||||
|
if a > 2 * CUTOFF:
|
||||||
|
extra.append((a, b - a))
|
||||||
|
elif a == b - 1:
|
||||||
|
if a & CUTOFF:
|
||||||
|
singletons1.append(a & ~CUTOFF)
|
||||||
|
else:
|
||||||
|
singletons0.append(a)
|
||||||
|
elif a == b - 2:
|
||||||
|
if a & CUTOFF:
|
||||||
|
singletons1.append(a & ~CUTOFF)
|
||||||
|
singletons1.append((a + 1) & ~CUTOFF)
|
||||||
|
else:
|
||||||
|
singletons0.append(a)
|
||||||
|
singletons0.append(a + 1)
|
||||||
|
else:
|
||||||
|
if a >= 2 * CUTOFF:
|
||||||
|
extra.append((a, b - a))
|
||||||
|
elif a & CUTOFF:
|
||||||
|
normal1.append((a & ~CUTOFF, b - a))
|
||||||
|
else:
|
||||||
|
normal0.append((a, b - a))
|
||||||
|
|
||||||
|
singletons0u, singletons0l = compress_singletons(singletons0)
|
||||||
|
singletons1u, singletons1l = compress_singletons(singletons1)
|
||||||
|
normal0 = compress_normal(normal0)
|
||||||
|
normal1 = compress_normal(normal1)
|
||||||
|
|
||||||
|
print("""\
|
||||||
|
FMT_FUNC auto is_printable(uint32_t cp) -> bool {\
|
||||||
|
""")
|
||||||
|
print_singletons(singletons0u, singletons0l, 'singletons0', 'singletons0_lower')
|
||||||
|
print_singletons(singletons1u, singletons1l, 'singletons1', 'singletons1_lower')
|
||||||
|
print_normal(normal0, 'normal0')
|
||||||
|
print_normal(normal1, 'normal1')
|
||||||
|
print("""\
|
||||||
|
auto lower = static_cast<uint16_t>(cp);
|
||||||
|
if (cp < 0x10000) {
|
||||||
|
return is_printable(lower, singletons0,
|
||||||
|
sizeof(singletons0) / sizeof(*singletons0),
|
||||||
|
singletons0_lower, normal0, sizeof(normal0));
|
||||||
|
}
|
||||||
|
if (cp < 0x20000) {
|
||||||
|
return is_printable(lower, singletons1,
|
||||||
|
sizeof(singletons1) / sizeof(*singletons1),
|
||||||
|
singletons1_lower, normal1, sizeof(normal1));
|
||||||
|
}\
|
||||||
|
""")
|
||||||
|
for a, b in extra:
|
||||||
|
print(" if (0x{:x} <= cp && cp < 0x{:x}) return false;".format(a, a + b))
|
||||||
|
print("""\
|
||||||
|
return cp < 0x{:x};
|
||||||
|
}}\
|
||||||
|
""".format(NUM_CODEPOINTS))
|
||||||
|
|
||||||
|
if __name__ == '__main__':
|
||||||
|
main()
|
2
externals/fmt/support/rst2md.py
vendored
2
externals/fmt/support/rst2md.py
vendored
@ -65,7 +65,7 @@ class Translator(nodes.NodeVisitor):
|
|||||||
self.write('\n\n')
|
self.write('\n\n')
|
||||||
|
|
||||||
def visit_paragraph(self, node):
|
def visit_paragraph(self, node):
|
||||||
pass
|
self.write('\n\n')
|
||||||
|
|
||||||
def depart_paragraph(self, node):
|
def depart_paragraph(self, node):
|
||||||
pass
|
pass
|
||||||
|
119
externals/fmt/support/travis-build.py
vendored
119
externals/fmt/support/travis-build.py
vendored
@ -1,119 +0,0 @@
|
|||||||
#!/usr/bin/env python
|
|
||||||
# Build the project on Travis CI.
|
|
||||||
|
|
||||||
from __future__ import print_function
|
|
||||||
import errno, os, shutil, subprocess, sys, urllib
|
|
||||||
from subprocess import call, check_call, Popen, PIPE, STDOUT
|
|
||||||
|
|
||||||
def rmtree_if_exists(dir):
|
|
||||||
try:
|
|
||||||
shutil.rmtree(dir)
|
|
||||||
except OSError as e:
|
|
||||||
if e.errno == errno.ENOENT:
|
|
||||||
pass
|
|
||||||
|
|
||||||
def makedirs_if_not_exist(dir):
|
|
||||||
try:
|
|
||||||
os.makedirs(dir)
|
|
||||||
except OSError as e:
|
|
||||||
if e.errno != errno.EEXIST:
|
|
||||||
raise
|
|
||||||
|
|
||||||
def install_dependencies():
|
|
||||||
branch = os.environ['TRAVIS_BRANCH']
|
|
||||||
if branch != 'master':
|
|
||||||
print('Branch: ' + branch)
|
|
||||||
exit(0) # Ignore non-master branches
|
|
||||||
check_call('curl -s https://deb.nodesource.com/gpgkey/nodesource.gpg.key ' +
|
|
||||||
'| sudo apt-key add -', shell=True)
|
|
||||||
check_call('echo "deb https://deb.nodesource.com/node_0.10 precise main" ' +
|
|
||||||
'| sudo tee /etc/apt/sources.list.d/nodesource.list', shell=True)
|
|
||||||
check_call(['sudo', 'apt-get', 'update'])
|
|
||||||
check_call(['sudo', 'apt-get', 'install', 'python-virtualenv', 'nodejs'])
|
|
||||||
check_call(['sudo', 'npm', 'install', '-g', 'less@2.6.1', 'less-plugin-clean-css'])
|
|
||||||
deb_file = 'doxygen_1.8.6-2_amd64.deb'
|
|
||||||
urllib.urlretrieve('http://mirrors.kernel.org/ubuntu/pool/main/d/doxygen/' +
|
|
||||||
deb_file, deb_file)
|
|
||||||
check_call(['sudo', 'dpkg', '-i', deb_file])
|
|
||||||
|
|
||||||
fmt_dir = os.path.dirname(os.path.dirname(os.path.realpath(__file__)))
|
|
||||||
|
|
||||||
build = os.environ['BUILD']
|
|
||||||
if build == 'Doc':
|
|
||||||
travis = 'TRAVIS' in os.environ
|
|
||||||
if travis:
|
|
||||||
install_dependencies()
|
|
||||||
sys.path.insert(0, os.path.join(fmt_dir, 'doc'))
|
|
||||||
import build
|
|
||||||
build.create_build_env()
|
|
||||||
html_dir = build.build_docs()
|
|
||||||
repo = 'fmtlib.github.io'
|
|
||||||
if travis and 'KEY' not in os.environ:
|
|
||||||
# Don't update the repo if building on Travis from an account that
|
|
||||||
# doesn't have push access.
|
|
||||||
print('Skipping update of ' + repo)
|
|
||||||
exit(0)
|
|
||||||
# Clone the fmtlib.github.io repo.
|
|
||||||
rmtree_if_exists(repo)
|
|
||||||
git_url = 'https://github.com/' if travis else 'git@github.com:'
|
|
||||||
check_call(['git', 'clone', git_url + 'fmtlib/{}.git'.format(repo)])
|
|
||||||
# Copy docs to the repo.
|
|
||||||
target_dir = os.path.join(repo, 'dev')
|
|
||||||
rmtree_if_exists(target_dir)
|
|
||||||
shutil.copytree(html_dir, target_dir, ignore=shutil.ignore_patterns('.*'))
|
|
||||||
if travis:
|
|
||||||
check_call(['git', 'config', '--global', 'user.name', 'amplbot'])
|
|
||||||
check_call(['git', 'config', '--global', 'user.email', 'viz@ampl.com'])
|
|
||||||
# Push docs to GitHub pages.
|
|
||||||
check_call(['git', 'add', '--all'], cwd=repo)
|
|
||||||
if call(['git', 'diff-index', '--quiet', 'HEAD'], cwd=repo):
|
|
||||||
check_call(['git', 'commit', '-m', 'Update documentation'], cwd=repo)
|
|
||||||
cmd = 'git push'
|
|
||||||
if travis:
|
|
||||||
cmd += ' https://$KEY@github.com/fmtlib/fmtlib.github.io.git master'
|
|
||||||
p = Popen(cmd, shell=True, stdout=PIPE, stderr=STDOUT, cwd=repo)
|
|
||||||
# Print the output without the key.
|
|
||||||
print(p.communicate()[0].replace(os.environ['KEY'], '$KEY'))
|
|
||||||
if p.returncode != 0:
|
|
||||||
raise subprocess.CalledProcessError(p.returncode, cmd)
|
|
||||||
exit(0)
|
|
||||||
|
|
||||||
standard = os.environ['STANDARD']
|
|
||||||
install_dir = os.path.join(fmt_dir, "_install")
|
|
||||||
build_dir = os.path.join(fmt_dir, "_build")
|
|
||||||
test_build_dir = os.path.join(fmt_dir, "_build_test")
|
|
||||||
|
|
||||||
# Configure the library.
|
|
||||||
makedirs_if_not_exist(build_dir)
|
|
||||||
cmake_flags = [
|
|
||||||
'-DCMAKE_INSTALL_PREFIX=' + install_dir, '-DCMAKE_BUILD_TYPE=' + build,
|
|
||||||
'-DCMAKE_CXX_STANDARD=' + standard
|
|
||||||
]
|
|
||||||
|
|
||||||
# Make sure the fuzzers still compile.
|
|
||||||
main_cmake_flags = list(cmake_flags)
|
|
||||||
if 'ENABLE_FUZZING' in os.environ:
|
|
||||||
main_cmake_flags += ['-DFMT_FUZZ=ON', '-DFMT_FUZZ_LINKMAIN=On']
|
|
||||||
|
|
||||||
check_call(['cmake', '-DFMT_DOC=OFF', '-DFMT_PEDANTIC=ON', '-DFMT_WERROR=ON', fmt_dir] +
|
|
||||||
main_cmake_flags, cwd=build_dir)
|
|
||||||
|
|
||||||
# Build the library.
|
|
||||||
check_call(['cmake', '--build','.'], cwd=build_dir)
|
|
||||||
|
|
||||||
# Test the library.
|
|
||||||
env = os.environ.copy()
|
|
||||||
env['CTEST_OUTPUT_ON_FAILURE'] = '1'
|
|
||||||
if call(['make', 'test'], env=env, cwd=build_dir):
|
|
||||||
with open(os.path.join(build_dir, 'Testing', 'Temporary', 'LastTest.log'), 'r') as f:
|
|
||||||
print(f.read())
|
|
||||||
sys.exit(-1)
|
|
||||||
|
|
||||||
# Install the library.
|
|
||||||
check_call(['make', 'install'], cwd=build_dir)
|
|
||||||
|
|
||||||
# Test installation.
|
|
||||||
makedirs_if_not_exist(test_build_dir)
|
|
||||||
check_call(['cmake', os.path.join(fmt_dir, "test", "find-package-test")] +
|
|
||||||
cmake_flags, cwd=test_build_dir)
|
|
||||||
check_call(['make', '-j4'], cwd=test_build_dir)
|
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
x
Reference in New Issue
Block a user